{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "97f80b47-f64d-4e64-ba6c-1a887f0f1e80", "code": "272460-97-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=272460-97-6", "code_system": "CAS", "references": [ "b8c58f53-5a0e-4eaf-af15-b5e6eac1e3d3", "ffa4a2bf-ae86-4b66-b613-5c45af2fbe36" ] }, { "uuid": "00cd5616-2d6b-4fe6-8ac7-0c71134694b1", "code": "22019766", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22019766", "code_system": "PUBCHEM", "references": [ "b8c58f53-5a0e-4eaf-af15-b5e6eac1e3d3" ] }, { "uuid": "d7772d48-c547-1ac3-cec7-0dfba7f8fca1", "code": "DTXSID60889156", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60889156", "code_system": "EPA CompTox" }, { "uuid": "32c25185-34ac-46d4-b392-80482929dfe5", "code": "UQ7Z8WVZ2Q", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "59bc9b6e-4297-4130-b185-ffebfb624ae1", "name": "1-Propanone, 1-[4-[(4-benzoylphenyl)thio]phenyl]-2-methyl-2-[(4-methylphenyl)sulfonyl]-", "stdName": "1-PROPANONE, 1-(4-((4-BENZOYLPHENYL)THIO)PHENYL)-2-METHYL-2-((4-METHYLPHENYL)SULFONYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "82d77537-0895-4c01-b4a3-1e11d76fde59" ], "display_name": true }, { "uuid": "c36a9395-6b3a-46f3-97b0-8e6952c62c20", "name": "1-[4-[(4-Benzoylphenyl)thio]phenyl]-2-methyl-2-[(4-methylphenyl)sulfonyl]-1-propanone", "stdName": "1-(4-((4-BENZOYLPHENYL)THIO)PHENYL)-2-METHYL-2-((4-METHYLPHENYL)SULFONYL)-1-PROPANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ffa4a2bf-ae86-4b66-b613-5c45af2fbe36" ], "display_name": false } ], "references": [ { "uuid": "82d77537-0895-4c01-b4a3-1e11d76fde59", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b8c58f53-5a0e-4eaf-af15-b5e6eac1e3d3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392808000, "tags": [ "NOMEN" ] }, { "uuid": "ffa4a2bf-ae86-4b66-b613-5c45af2fbe36", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "64e7237e-435a-472d-aa2d-1cd6d489b2bd", "id": "64e7237e-435a-472d-aa2d-1cd6d489b2bd", "molfile": "\n Marvin 01132105152D \n\n 36 39 0 0 0 0 999 V2000\n 12.8905 -0.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0913 -0.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3823 -0.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6604 -0.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6604 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3823 -1.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0913 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8354 -1.4180 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8354 -0.5930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8354 -2.2430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0104 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0104 -0.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0104 -2.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1854 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1854 -0.5930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3604 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6386 -1.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9296 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9296 -2.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1046 -2.2430 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2668 -2.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5578 -2.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8359 -2.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8359 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5578 -1.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2668 -1.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2558 -0.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2558 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -0.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7219 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7219 -2.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4308 -1.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6386 -2.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3604 -2.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 2 0 0 0 0\n 11 8 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 11 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 36 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 19 35 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 21 26 2 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 27 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 1 0 0 0 0\n 34 29 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)S(=O)(=O)C(C)(C)C(=O)c2ccc(cc2)Sc3ccc(cc3)C(=O)c4ccccc4", "formula": "C30H26O4S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7e45cc0a-3274-4607-8f0d-6c761ef3b700" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "514.6583", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "1861a0e4-b334-4b12-8cd3-0d66f49e082a", "version": "6", "structure": { "id": "832e6269-4d9e-4ac9-a80e-b93aad0005ae", "molfile": "\n JSDraw210252314142D\n\n 36 39 0 0 0 0 0 V2000\n 18.3372 -14.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3372 -12.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6882 -11.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6882 -10.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3372 -9.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9862 -10.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9862 -11.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3372 -7.7998 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7772 -7.7998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8971 -7.7998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3372 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7772 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8971 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3372 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9862 -3.8999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6882 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0392 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3900 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3900 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7411 -1.5600 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0921 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0921 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4429 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7939 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7939 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4429 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1449 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4959 -3.8999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1449 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7939 -7.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7939 -8.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1449 -9.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4959 -8.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4959 -7.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0392 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6882 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 2 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 2 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 21 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 29 34 1 0 0 0 0\n 19 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 16 36 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)S(=O)(=O)C(C)(C)C(=O)c2ccc(cc2)Sc3ccc(cc3)C(=O)c4ccccc4", "formula": "C30H26O4S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "514.6583", "optical_activity": "NONE", "references": [ "82d77537-0895-4c01-b4a3-1e11d76fde59" ], "stereo_centers": 0 }, "unii": "UQ7Z8WVZ2Q" } ] }