{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ae9d45d5-d9a0-4ad2-b574-c460adf789ea", "code": "4366-18-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4366-18-1", "code_system": "CAS", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7", "b897fdab-2d51-4b68-8172-8deadc3d1b21" ] }, { "uuid": "b587763c-2080-4ece-b83c-973409888c97", "code": "C77992", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77992", "code_system": "NCI_THESAURUS", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "c33d82ad-c672-44ed-9c35-d5489ebddcaf", "code": "C060966", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67060966", "code_system": "MESH", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "970920dd-7055-4a0c-9110-4cc169b89140", "code": "1520", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1520", "code_system": "INN", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "b627b858-c2a2-47fd-ab8e-1ec87f419334", "code": "m666", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m666?q=authorize", "code_system": "MERCK INDEX", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "d1e8d807-0cfa-4caa-a58c-e689cd67ccad", "code": "SUB06816MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "1e3fe8aa-5650-4703-9bfc-97ddc00e090f", "code": "CHEMBL2106007", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106007", "code_system": "ChEMBL", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "eaccda6b-5ce6-4233-b29a-9db21aec12c0", "code": "224-455-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.233", "code_system": "ECHA (EC/EINECS)", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "30d2593f-170a-4e27-b6e1-d8853aad9512", "code": "54716150", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54716150", "code_system": "PUBCHEM", "references": [ "eb0c81a3-4884-4253-a693-39f708d70df7" ] }, { "uuid": "5e7759ed-6d8c-dfc7-cce1-224ad555e7d3", "code": "DTXSID20195902", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20195902", "code_system": "EPA CompTox", "references": [ "cdf4b866-8968-11d0-d335-c1aeed57a559" ] }, { "uuid": "74c0d787-f764-e678-7f4f-ff26513c692e", "code": "C263", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263", "code_system": "NCI_THESAURUS", "references": [ "377f984d-20e8-c582-cf1a-15879dd8d099" ] }, { "uuid": "99f99b2f-5ebf-4a4c-930a-e9fb465aa9d5", "code": "UO1VQB3SPZ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ab9f4b36-c1fc-d198-3a9a-a66fcad49ac9", "code": "3721", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/3721", "code_system": "DRUG CENTRAL", "references": [ "377f984d-20e8-c582-cf1a-15879dd8d099" ] }, { "uuid": "39f2f1dc-4cd4-50f1-84b3-f8a39e65270f", "code": "100000083716", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "b07c00aa-22b1-1cf2-22f5-b6eeb70ce301" ] } ], "relationships": [ { "uuid": "15fa0519-f591-46d2-9688-cf52ada3d49c", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "612b3dfc-ea12-4cec-81b4-015403680770", "refuuid": "c6df8bb4-6637-407f-ae8f-051475b6ae2e", "name": "COUMETAROL", "unii": "UO1VQB3SPZ", "linking_id": "UO1VQB3SPZ", "ref_pname": "COUMETAROL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "3ae055d1-0e47-4045-be87-16a5c27b2ae7", "name": "3,3'-(2-METHOXYETHYLIDENE)BIS(4-HYDROXYCOUMARIN)", "stdName": "3,3'-(2-METHOXYETHYLIDENE)BIS(4-HYDROXYCOUMARIN)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c54d2e7f-e1e8-4860-944f-c180636f5caa" ], "display_name": false }, { "uuid": "e30b6345-a81b-4223-b439-69b3cc3d13b1", "name": "COUMETAROL", "stdName": "COUMETAROL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "7dc39dc4-8b83-4fa9-8c24-6b4f4eadc466", "e66fbbb4-5aa1-4582-83a8-13856ea899f6", "00dad6c9-4c00-44e9-a3f5-fb6900d7bc52", "3ca7ef93-977f-435a-b0af-a149acaadacc", "de27d050-df42-4e51-9705-d43f3bdc78aa", "c54d2e7f-e1e8-4860-944f-c180636f5caa", "c8ce1ef7-4fd7-48fb-a2ce-e670c5ba027e" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "17b819d8-8721-40e8-9602-f058292a1e6a", "name_org": "INN" } ] }, { "uuid": "1c4d61cb-c7a3-47bf-af75-bb28bc8b0865", "name": "COUMETAROL [MI]", "stdName": "COUMETAROL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "de27d050-df42-4e51-9705-d43f3bdc78aa" ], "display_name": false }, { "uuid": "565e34fb-4bbc-4864-99d7-67dc59924ec0", "name": "CUMETHAROL", "stdName": "CUMETHAROL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c54d2e7f-e1e8-4860-944f-c180636f5caa" ], "display_name": false }, { "uuid": "512d6b49-c3a0-17b7-a61c-19058e3b798f", "name": "Coumetarol [WHO-DD]", "stdName": "COUMETAROL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7238b398-12e8-6c18-8d8d-89828d75f2f9" ], "display_name": false }, { "uuid": "390b7514-cbb5-438e-b993-9b130697be3e", "name": "coumetarol [INN]", "stdName": "COUMETAROL [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3ca7ef93-977f-435a-b0af-a149acaadacc" ], "display_name": false } ], "references": [ { "uuid": "c54d2e7f-e1e8-4860-944f-c180636f5caa", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3ca7ef93-977f-435a-b0af-a149acaadacc", "citation": "INN Proposed List 13", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7dc39dc4-8b83-4fa9-8c24-6b4f4eadc466", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "de27d050-df42-4e51-9705-d43f3bdc78aa", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eb0c81a3-4884-4253-a693-39f708d70df7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390710000, "tags": [ "NOMEN" ] }, { "uuid": "394a3974-d1ae-4fbf-862e-91d6b9809699", "citation": "SRS import [UO1VQB3SPZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UO1VQB3SPZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493390710000, "tags": [ "NOMEN" ] }, { "uuid": "00dad6c9-4c00-44e9-a3f5-fb6900d7bc52", "citation": "COUMETAROL [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c8ce1ef7-4fd7-48fb-a2ce-e670c5ba027e", "citation": "COUMETAROL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e66fbbb4-5aa1-4582-83a8-13856ea899f6", "citation": "COUMETAROL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "cdf4b866-8968-11d0-d335-c1aeed57a559", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4366-18-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "377f984d-20e8-c582-cf1a-15879dd8d099", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b897fdab-2d51-4b68-8172-8deadc3d1b21", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7238b398-12e8-6c18-8d8d-89828d75f2f9", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "b07c00aa-22b1-1cf2-22f5-b6eeb70ce301", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "aca60659-c19d-4df6-a523-a5f6ae7cacf5", "id": "aca60659-c19d-4df6-a523-a5f6ae7cacf5", "molfile": "\n Marvin 01132108572D \n\n 28 31 0 0 0 0 999 V2000\n 5.6850 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6891 -3.8206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1053 -3.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1117 -2.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3483 -2.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3494 -1.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8592 -0.5589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6311 -0.8608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9163 -1.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2002 -0.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4876 -1.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4864 -2.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2020 -2.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9151 -2.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6288 -2.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6245 -3.3450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8707 -2.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8587 -1.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4177 -0.5540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5728 -0.8410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2928 -1.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9990 -0.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7139 -1.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7218 -2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0109 -2.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2967 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5907 -2.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5860 -3.3159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 17 1 0 0 0 0\n 5 6 2 0 0 0 0\n 15 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 17 27 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 21 26 2 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 2 0 0 0 0\nM END", "smiles": "COCC(c1c(=O)c2ccccc2oc1O)c3c(=O)c4ccccc4oc3O", "formula": "C21H16O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "de1d246e-9dd4-4b1c-b496-e66095d3ff43" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "380.3483", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c6df8bb4-6637-407f-ae8f-051475b6ae2e", "version": "10", "structure": { "id": "72c34ebb-41e4-40dd-a7c5-ef0f5ae53080", "molfile": "\n Marvin 01132105572D \n\n 28 31 0 0 0 0 999 V2000\n 1.4876 -1.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4864 -2.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2020 -2.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2002 -0.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9163 -1.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9151 -2.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6288 -2.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3483 -2.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3494 -1.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6311 -0.8608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8592 -0.5589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6245 -3.3450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1117 -2.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8707 -2.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5907 -2.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5728 -0.8410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8587 -1.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4177 -0.5540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5860 -3.3159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2928 -1.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2967 -2.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0109 -2.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7218 -2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7139 -1.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9990 -0.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1053 -3.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6891 -3.8206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6850 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 5 4 2 0 0 0 0\n 4 1 1 0 0 0 0\n 14 15 2 0 0 0 0\n 5 10 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 14 17 1 0 0 0 0\n 15 21 1 0 0 0 0\n 20 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 8 9 1 0 0 0 0\n 17 18 2 0 0 0 0\n 9 10 1 0 0 0 0\n 15 19 1 0 0 0 0\n 5 6 1 0 0 0 0\n 9 11 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 7 12 1 0 0 0 0\n 22 23 2 0 0 0 0\n 2 3 1 0 0 0 0\n 23 24 1 0 0 0 0\n 8 13 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 20 1 0 0 0 0\n 13 26 1 0 0 0 0\n 3 6 2 0 0 0 0\n 26 27 1 0 0 0 0\n 13 14 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "COCC(c1c(c2ccccc2oc1=O)O)c3c(c4ccccc4oc3=O)O", "formula": "C21H16O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "380.3483", "optical_activity": "NONE", "references": [ "394a3974-d1ae-4fbf-862e-91d6b9809699", "c54d2e7f-e1e8-4860-944f-c180636f5caa", "3ca7ef93-977f-435a-b0af-a149acaadacc" ], "stereo_centers": 0 }, "unii": "UO1VQB3SPZ" } ] }