{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f97838e6-2d65-4ae2-9d9b-e322e8ed29a9",
          "code": "1715016-75-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1715016-75-3",
          "code_system": "CAS",
          "references": [
            "2a6e05ad-e714-4790-a1ac-69765e8b77da",
            "d6685804-bcd0-4a40-8b29-73ef1cf7239b"
          ]
        },
        {
          "uuid": "85967ce7-a512-46c5-8ca1-9d594a2ed968",
          "code": "SUB183926",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2a6e05ad-e714-4790-a1ac-69765e8b77da"
          ]
        },
        {
          "uuid": "135ce379-496f-4f8d-94d0-da6c32ddd1af",
          "code": "5F-MDMB-PINACA",
          "comments": "This substance was identified and quantified during a recent post-mortem investigation in Japan, where it was also stated that there have been approximately 10 cases in Japan, since late September 2014, possibly associated with the inhalation of this substance. In the case of the death reported in this paper, the cause of death is listed as consistent with asphyxia, indirectly caused by synthetic scannabinoid poisoning, \"the low levels of 5-fluoro-ADB in all solid tissue specimens could be explained by the fact that only a small amount of 5-fluoro-ADB in the herbal smoke was inhaled in a very short period of time, as this potent synthetic cannabinoid likely exerted its powerful action on consciousness and provoked vomiting symptom very shortly after the victim inhaled the drug smoke.\" 5F-MDMB-PINACA was identified in 0.79 grams of white powder, seized by the National Tax and Customs Administration Airport Directorate Nr.1, in Budapest on the 2nd September 2014. The substance was analytically confirmed using GC-MS and FTIR.",
          "type": "PRIMARY",
          "url": "https://www.ukchemicalresearch.org/Thread-5F-MDMB-PINACA-5F-ADB",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "2a6e05ad-e714-4790-a1ac-69765e8b77da"
          ]
        },
        {
          "uuid": "32e4acbd-199a-4ddc-9d4c-5f875b69966e",
          "code": "101895417",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101895417",
          "code_system": "PUBCHEM",
          "references": [
            "2a6e05ad-e714-4790-a1ac-69765e8b77da"
          ]
        },
        {
          "uuid": "29b4b9a4-4624-4b78-8678-ca190f08bf7c",
          "code": "7034",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "875df486-b2bd-5c57-b36e-af60afcb0a1c"
          ]
        },
        {
          "uuid": "860df90c-d81e-40a9-aa5f-04c0ec7767c5",
          "code": "UN52BPP7RB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a45418ac-1f0d-4537-a065-2d7208c0ce69",
          "code": "5F-ADB",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/5F-ADB",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "5843141e-ddc2-c3e7-8c6b-238043f90435",
          "code": "Designer-drugs-5F-MDMB-PINACA",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indazole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "8c627c35-7bff-3207-0458-49bf225d351f"
          ]
        },
        {
          "uuid": "d84e5521-bb87-b062-ff81-1007da184cbc",
          "code": "DTXSID201009974",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201009974",
          "code_system": "EPA CompTox",
          "references": [
            "8c627c35-7bff-3207-0458-49bf225d351f"
          ]
        },
        {
          "uuid": "eb456b38-c99e-0f89-bd11-ece0c79b05c7",
          "code": "100000170087",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7cbf5793-d262-6a33-aae0-f0821bcf4ed6"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "e3548716-ccc7-468c-97ff-b7bfd3c2d3e7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d6685804-bcd0-4a40-8b29-73ef1cf7239b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0babec49-f795-46bc-b2a8-eee59ba23296",
          "citation": "https://www.caymanchem.com/product/16603",
          "url": "https://www.caymanchem.com/product/16603",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46b7ad82-bb91-415e-a775-38325d2f7fca",
          "citation": "Said IOUGHLISSEN-French ANSM; 2/17/2016 E-Mail List",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a68d567a-ce6b-44d2-b859-539c695a85ec",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a6e05ad-e714-4790-a1ac-69765e8b77da",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393305000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c0a5799-3939-4e8a-872f-09a929cc1b2e",
          "citation": "SRS import [UN52BPP7RB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UN52BPP7RB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393305000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7d18428-37df-6019-29f4-beed796d465b",
          "citation": "5F-ADB",
          "url": "http://www.who.int/medicines/access/controlled-substances/CriticalReview_5F-ADB.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "875df486-b2bd-5c57-b36e-af60afcb0a1c",
          "citation": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true
        },
        {
          "uuid": "8a15487f-9b67-ef52-4377-a84db5cacac9",
          "citation": "U.S. Department of JusticeDrug Enforcement AdministrationDiversion Control DivisionDrug & Chemical Evaluation SectionLists of:Scheduling Actions Controlled SubstancesRegulated Chemicals",
          "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/orangebook.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "0e4a689c-c044-4015-b16d-9309a42ef2e7",
          "citation": "Electronic Code of Federal Regulations",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c627c35-7bff-3207-0458-49bf225d351f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7cbf5793-d262-6a33-aae0-f0821bcf4ed6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "eee313d1-9b82-4ffb-aae4-a4801535401a",
          "citation": "https://www.drugsdata.org/stats_substance_by_year.php",
          "url": "https://www.drugsdata.org/stats_substance_by_year.php",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0dcb27b5-a11f-4e04-84ab-b7e1629dfc49",
          "id": "0dcb27b5-a11f-4e04-84ab-b7e1629dfc49",
          "molfile": "\n  Marvin  01132100572D          \n\n 27 28  0  0  0  0            999 V2000\n   10.0448   -9.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2467   -9.7163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6628   -9.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0772   -8.4190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694   -9.3465    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6552  -10.1445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8574  -10.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4475   -9.6452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6432  -11.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1308  -11.8233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6431  -12.4897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8572  -13.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6552  -13.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694  -14.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6627  -14.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8768  -15.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6749  -15.5214    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8600  -12.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1466  -12.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4333  -12.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4333  -11.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1466  -10.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8600  -11.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4551   -8.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8694   -7.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0407   -7.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6309   -8.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 24  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  2  0  0  0  0\n 23  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 18 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)C(C(=O)OC)NC(=O)c1c2ccccc2n(CCCCCF)n1",
          "formula": "C20H28FN3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "acb460ed-9f47-4fa4-80c4-fe3a7fb1e014"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "377.4538",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c3bca662-d1d2-4bab-b79c-f8c3c9281280",
      "version": "19",
      "structure": {
        "id": "88ac2882-a657-47af-ac23-008ca2c31921",
        "molfile": "\n  Marvin  01132107052D          \n\n 27 28  0  0  0  0            999 V2000\n   14.5415   -4.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2548   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9681   -4.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9681   -5.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2548   -5.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5415   -5.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7512   -5.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2389   -4.7288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7513   -4.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9655   -3.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5556   -2.5507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7633   -3.0500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9775   -2.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5632   -1.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9775   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1488   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7391   -1.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7709   -2.0425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1853   -1.3244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3548   -2.6217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1529   -2.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9654   -6.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7633   -6.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9775   -7.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7708   -7.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9850   -8.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7830   -8.4268    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  4  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  7 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)C(C(=O)OC)NC(=O)c1c2ccccc2n(CCCCCF)n1",
        "formula": "C20H28FN3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "377.4538",
        "optical_activity": "( + / - )",
        "references": [
          "6c0a5799-3939-4e8a-872f-09a929cc1b2e",
          "46b7ad82-bb91-415e-a775-38325d2f7fca"
        ],
        "stereo_centers": 1
      },
      "unii": "UN52BPP7RB",
      "relationships": [
        {
          "uuid": "347cace1-c9ba-4e0f-81fc-7857da1c70bb",
          "amount": {
            "uuid": "062eaeff-e363-4af3-9e3c-72ad5691868b"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "923bb377-b7e6-431b-b7e1-f0d2f943ee2b",
            "refuuid": "c3bca662-d1d2-4bab-b79c-f8c3c9281280",
            "name": "5-FLUORO-ADB",
            "unii": "UN52BPP7RB",
            "linking_id": "UN52BPP7RB",
            "ref_pname": "5-FLUORO-ADB",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "24324c57-f2a9-4f62-8a11-1c08d86eac3e",
          "amount": {
            "uuid": "e204d37d-0533-4d43-affd-93d85755ebf0"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "cd8db375-f2e0-4245-982a-42a479bf7c42",
            "refuuid": "157c3969-4cc7-4c05-a027-47c039372d9d",
            "name": "5-FLUORO-ADB, (R)-",
            "unii": "99T2ZS2C9R",
            "linking_id": "99T2ZS2C9R",
            "ref_pname": "5-FLUORO-ADB, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f45a756f-f964-4301-a0e6-58e29801b5de",
          "amount": {
            "uuid": "2d4db396-e7e8-421e-a84f-e5467a9ffb3f"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "875df486-b2bd-5c57-b36e-af60afcb0a1c"
          ],
          "related_substance": {
            "uuid": "cb56f44d-770e-405c-9c2a-0429e75c7144",
            "refuuid": "41377252-984f-a476-dbf6-67b32c878ea8",
            "name": "5F-ADB",
            "unii": "FD7BD1M9FY",
            "linking_id": "FD7BD1M9FY",
            "ref_pname": "5F-ADB",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "e1abd920-1693-4ff2-b32c-3e94a709e1c7",
          "name": "5-FLUORO-ADB",
          "stdName": "5-FLUORO-ADB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eee313d1-9b82-4ffb-aae4-a4801535401a"
          ],
          "display_name": true
        },
        {
          "uuid": "dd5349db-5f18-46ba-a459-fcc0f1a1d9d5",
          "name": "5-FLUORO-ADB, (±)-",
          "stdName": "5-FLUORO-ADB, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0babec49-f795-46bc-b2a8-eee59ba23296",
            "d6685804-bcd0-4a40-8b29-73ef1cf7239b"
          ],
          "display_name": false
        },
        {
          "uuid": "eddf0470-125f-4725-9e14-b56ee8662b93",
          "name": "5F-ADB, (±)-",
          "stdName": "5F-ADB, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6685804-bcd0-4a40-8b29-73ef1cf7239b",
            "e3548716-ccc7-468c-97ff-b7bfd3c2d3e7"
          ],
          "display_name": false
        },
        {
          "uuid": "1099c42e-0b33-43ea-ab16-dc2997f5917b",
          "name": "5F-MDMB-PINACA, (±)-",
          "stdName": "5F-MDMB-PINACA, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6685804-bcd0-4a40-8b29-73ef1cf7239b",
            "46b7ad82-bb91-415e-a775-38325d2f7fca"
          ],
          "display_name": false
        },
        {
          "uuid": "b3603aa3-7c4e-78ec-db6c-d3da34923090",
          "name": "DEA NO. 7034 (±)-",
          "stdName": "DEA NO. 7034 (+/-)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875df486-b2bd-5c57-b36e-af60afcb0a1c"
          ],
          "display_name": false
        },
        {
          "uuid": "3876c688-afb4-4d02-8d72-653f1cfab7a2",
          "name": "METHYL (RS)-2-(1-(5-FLUOROPENTYL)-1H-INDAZOLE-3-CARBOXAMIDO)-3,3-DIMETHYLBUTANOATE",
          "stdName": "METHYL (RS)-2-(1-(5-FLUOROPENTYL)-1H-INDAZOLE-3-CARBOXAMIDO)-3,3-DIMETHYLBUTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7d18428-37df-6019-29f4-beed796d465b"
          ],
          "display_name": false
        },
        {
          "uuid": "ee3f00ba-9e8d-38c4-7d7c-d538fb9faeb6",
          "name": "METHYL 2-(1-(5-FLUOROPENTYL)-1H-INDAZOLE-3-CARBOXAMIDO)-3,3-DIMETHYLBUTANOATE",
          "stdName": "METHYL 2-(1-(5-FLUOROPENTYL)-1H-INDAZOLE-3-CARBOXAMIDO)-3,3-DIMETHYLBUTANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875df486-b2bd-5c57-b36e-af60afcb0a1c"
          ],
          "display_name": false
        },
        {
          "uuid": "48ec1f91-81eb-49ac-9542-437058fc059b",
          "name": "VALINE, N-((1-(5-FLUOROPENTYL)-1H-INDAZOL-3-YL)CARBONYL)-3-METHYL-, METHYL ESTER",
          "stdName": "VALINE, N-((1-(5-FLUOROPENTYL)-1H-INDAZOL-3-YL)CARBONYL)-3-METHYL-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6685804-bcd0-4a40-8b29-73ef1cf7239b",
            "a68d567a-ce6b-44d2-b859-539c695a85ec"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "6d710915-7bd6-4a43-a731-7103598ab1e4"
      }
    }
  ]
}