{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "83507803-b3e5-4fb4-97ad-5a9e8820c045",
          "code": "27025-41-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27025-41-8",
          "code_system": "CAS",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320",
            "4c647564-c8c7-4378-8809-0eeac160f932"
          ]
        },
        {
          "uuid": "605ed55e-e500-4a78-b41a-46b704135aea",
          "code": "C62624",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62624",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "e2edc927-d8bd-4f12-b72a-6733ee106d51",
          "code": "GLUTATHIONE DISULFIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glutathione_disulfide",
          "code_system": "WIKIPEDIA",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "ff47b3b5-7cfd-4e5a-a3b2-039975dce618",
          "code": "6698",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6698",
          "code_system": "INN",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "3f574744-f263-4a9b-8dc4-f229446e476a",
          "code": "6835",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6835",
          "code_system": "IUPHAR",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "7bfb830e-f1cb-4b21-ab54-b32f6abb2559",
          "code": "25953",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/25953/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "317d75fb-71f6-4fef-b214-2e124792a302",
          "code": "m5781",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5781?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "9e80cb75-761e-4260-8247-5c3ef9ae29b1",
          "code": "SUB20964",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "e2808da3-8bb8-4e8b-94e6-103b090ff476",
          "code": "CHEMBL1372",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1372",
          "code_system": "ChEMBL",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "a802792e-d425-43f1-b793-6caa9a664e77",
          "code": "248-170-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.777",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "8c68ea8c-ceff-43d6-9e69-d33e6dd58fbf",
          "code": "65359",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65359",
          "code_system": "PUBCHEM",
          "references": [
            "c5ca6c90-6472-479c-a84b-a06528209320"
          ]
        },
        {
          "uuid": "be68d75b-c2e9-2b98-cc5a-b6a969848e82",
          "code": "DTXSID5048972",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5048972",
          "code_system": "EPA CompTox",
          "references": [
            "2072e31b-7022-bf82-efac-2aa8f9d5fcf6"
          ]
        },
        {
          "uuid": "5e8ccb09-b218-e8f9-fc51-0b8fa6dee5d3",
          "code": "C26170",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C26170",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ecc17c5e-a995-5bea-657c-8326b67cfb55"
          ]
        },
        {
          "uuid": "ba62b23a-5814-44f2-af9b-0d0c881fe1e9",
          "code": "ULW86O013H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5cb45a01-437b-5088-61ce-afb96868f010",
          "code": "5130",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/5130",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ecc17c5e-a995-5bea-657c-8326b67cfb55"
          ]
        },
        {
          "uuid": "902bc9a2-f9fa-8c73-ac68-7b068cf034d5",
          "code": "DB03310",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03310",
          "code_system": "DRUG BANK",
          "references": [
            "ecc17c5e-a995-5bea-657c-8326b67cfb55"
          ]
        },
        {
          "uuid": "25964af2-774b-f159-d19a-594d12e2f0a6",
          "code": "58297",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58297",
          "code_system": "CHEBI",
          "references": [
            "ecc17c5e-a995-5bea-657c-8326b67cfb55"
          ]
        },
        {
          "uuid": "b5a8b82a-e0a4-f9c2-de71-5875e2629a77",
          "code": "17858",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17858",
          "code_system": "CHEBI",
          "references": [
            "ecc17c5e-a995-5bea-657c-8326b67cfb55"
          ]
        },
        {
          "uuid": "8ea204a2-36f1-87ee-028f-1a02b3b0b94c",
          "code": "ULW86O013H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ULW86O013H",
          "code_system": "DAILYMED",
          "references": [
            "ec0c5e28-c5e3-f81a-592d-8286e200b0d6"
          ]
        },
        {
          "uuid": "e5090ccc-67ab-b140-e0eb-4d14187a36fe",
          "code": "100000087102",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6b0dddfc-5b47-439a-f7a0-83948de0aa9a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9171b834-eec1-469a-a54e-4054e0246fab",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c186651e-1f61-4269-8bf3-dbb151e9c657",
            "refuuid": "4974314c-cde6-43b0-866b-08937c728f62",
            "name": "OXIGLUTATIONE",
            "unii": "ULW86O013H",
            "linking_id": "ULW86O013H",
            "ref_pname": "OXIGLUTATIONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4f84b5e6-db58-49d3-a0a2-34355212cd82",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "56978001-c138-43f9-bb9d-065ba7732d74",
            "refuuid": "6c4c9c18-bec5-444d-9419-3cad27c79720",
            "name": "OXIGLUTATIONE DISODIUM",
            "unii": "GY131TX61G",
            "linking_id": "GY131TX61G",
            "ref_pname": "OXIGLUTATIONE DISODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b918cd1c-da73-4ad1-88d0-48739fbc85cb",
          "name": "GLUTATHIONE DISULFIDE",
          "stdName": "GLUTATHIONE DISULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96b4e930-dcb3-4b5a-b8ff-9789b9f92132",
            "fd12c6d1-5025-4af9-b118-dea8fab95cdf",
            "8c7f3519-3fa8-4fd9-8b99-9296567d8901",
            "6c607f94-499c-47fd-a5c3-c59f137e0aae",
            "52a1daa3-8230-4a71-95bd-a82e49f6218d",
            "e2abdf75-4df9-45f4-9d16-f94a3c532cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "83cd8245-028f-46d8-829c-43370f7270b8",
          "name": "GLUTATHIONE DISULFIDE [MI]",
          "stdName": "GLUTATHIONE DISULFIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96b4e930-dcb3-4b5a-b8ff-9789b9f92132",
            "52a1daa3-8230-4a71-95bd-a82e49f6218d"
          ],
          "display_name": false
        },
        {
          "uuid": "979db469-2fef-4fc3-acba-e9590d95eaba",
          "name": "GLUTATHIONE DISULFIDE [ORANGE BOOK]",
          "stdName": "GLUTATHIONE DISULFIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c607f94-499c-47fd-a5c3-c59f137e0aae"
          ],
          "display_name": false
        },
        {
          "uuid": "0fc622d8-9a8d-4334-9ef1-b30fa16e9b91",
          "name": "GLUTATHIONE DISULPHIDE",
          "stdName": "GLUTATHIONE DISULPHIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de0b86e6-6640-49ab-a5e1-352972834b52"
          ],
          "display_name": false
        },
        {
          "uuid": "bdfe3df5-5ff1-4e83-a202-64a8d2cc1718",
          "name": "GLUTATHIONE, DISULFIDE",
          "stdName": "GLUTATHIONE, DISULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f481844f-5666-420b-991b-fd8a4b9b0617",
            "52a1daa3-8230-4a71-95bd-a82e49f6218d"
          ],
          "display_name": false
        },
        {
          "uuid": "1354e0a6-678e-4be8-9a28-1b6d6b696e14",
          "name": "OXIGLUTATIONE",
          "stdName": "OXIGLUTATIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a55ce4ae-55c1-40ad-9e00-4e4667d13249",
            "3c7fc375-3e46-4e53-93d5-7fb9451d0915",
            "2b33f51a-6a0a-4238-8f1f-a609fb472f48",
            "d7c14845-b944-4c3e-b9fe-7f76bbc78be5",
            "52a1daa3-8230-4a71-95bd-a82e49f6218d",
            "8becdb02-285a-4a9e-ac84-da9cc51d3555",
            "c9cbe4fe-5874-4bf9-a93c-718c722f074b",
            "b4f331d9-189b-4562-aa72-9f52f00ae895",
            "6552ac1b-6df9-4570-8f99-4be959fd5fdf",
            "2de082dc-edc8-4897-8cd0-84390aa46a1e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d8e8b238-4028-483f-b5bc-55c4d4c72130",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "941a669f-8b65-46c9-b258-f202d496f1b3",
          "name": "OXIGLUTATIONE [JAN]",
          "stdName": "OXIGLUTATIONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a55ce4ae-55c1-40ad-9e00-4e4667d13249",
            "52a1daa3-8230-4a71-95bd-a82e49f6218d"
          ],
          "display_name": false
        },
        {
          "uuid": "936159a9-ba77-46bd-a04c-97219fc8aaa2",
          "name": "OXIGLUTATIONE [ORANGE BOOK]",
          "stdName": "OXIGLUTATIONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7c14845-b944-4c3e-b9fe-7f76bbc78be5"
          ],
          "display_name": false
        },
        {
          "uuid": "4b454cf5-41c0-30ae-3806-fa8986f8a105",
          "name": "Oxiglutatione [WHO-DD]",
          "stdName": "OXIGLUTATIONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "854ece44-3840-c10f-dc4f-29b4adbf40aa"
          ],
          "display_name": false
        },
        {
          "uuid": "019cfb26-7dfe-4a1a-9407-3e4657e1a0aa",
          "name": "oxiglutatione [INN]",
          "stdName": "OXIGLUTATIONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2de082dc-edc8-4897-8cd0-84390aa46a1e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8c7f3519-3fa8-4fd9-8b99-9296567d8901",
          "citation": "NDC 10-OCT-2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a0398a49-bff2-49e7-9835-73be734a4964",
          "citation": "MERCK 14",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de0b86e6-6640-49ab-a5e1-352972834b52",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b33f51a-6a0a-4238-8f1f-a609fb472f48",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2de082dc-edc8-4897-8cd0-84390aa46a1e",
          "citation": "INN Proposed List 64",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL64.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a55ce4ae-55c1-40ad-9e00-4e4667d13249",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52a1daa3-8230-4a71-95bd-a82e49f6218d",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c607f94-499c-47fd-a5c3-c59f137e0aae",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7c14845-b944-4c3e-b9fe-7f76bbc78be5",
          "citation": "OB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f481844f-5666-420b-991b-fd8a4b9b0617",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6552ac1b-6df9-4570-8f99-4be959fd5fdf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96b4e930-dcb3-4b5a-b8ff-9789b9f92132",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5ca6c90-6472-479c-a84b-a06528209320",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390562000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "411c6271-c053-47f1-a9ad-8f0a0b6ab977",
          "citation": "SRS import [ULW86O013H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ULW86O013H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390562000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4f331d9-189b-4562-aa72-9f52f00ae895",
          "citation": "OXIGLUTATIONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8becdb02-285a-4a9e-ac84-da9cc51d3555",
          "citation": "OXIGLUTATIONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd12c6d1-5025-4af9-b118-dea8fab95cdf",
          "citation": "GLUTATHIONE DISULFIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c7fc375-3e46-4e53-93d5-7fb9451d0915",
          "citation": "OXIGLUTATIONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c9cbe4fe-5874-4bf9-a93c-718c722f074b",
          "citation": "OXIGLUTATIONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2abdf75-4df9-45f4-9d16-f94a3c532cd7",
          "citation": "GLUTATHIONE DISULFIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2072e31b-7022-bf82-efac-2aa8f9d5fcf6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27025-41-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ecc17c5e-a995-5bea-657c-8326b67cfb55",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4c647564-c8c7-4378-8809-0eeac160f932",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec0c5e28-c5e3-f81a-592d-8286e200b0d6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "854ece44-3840-c10f-dc4f-29b4adbf40aa",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6b0dddfc-5b47-439a-f7a0-83948de0aa9a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "496132f9-cbb2-4704-a948-eb40deffdb63",
          "id": "496132f9-cbb2-4704-a948-eb40deffdb63",
          "molfile": "\n  Marvin  01132103512D          \n\n 40 39  0  0  1  0            999 V2000\n    8.7265   -3.7499    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.7265   -2.9348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9362   -4.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1088   -3.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4914   -4.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5243   -5.0012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8863   -3.8034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9231   -4.1616    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.5527   -5.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4994   -5.8657    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4870   -6.6766    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3432   -7.3722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8616   -8.3559    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.9231   -8.8252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3304   -8.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3304   -7.5944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7006   -8.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8855   -8.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0829   -8.7758    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.0829   -9.5908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4654   -8.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4613   -7.4298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9056   -8.6152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -8.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -9.5908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -8.3724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7880   -8.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3931   -8.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1422   -8.6811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3931   -7.5944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0175   -3.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9846   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5153   -4.2233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9102   -3.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3175   -4.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5642   -3.9886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3504   -5.0506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3645   -4.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4015   -5.0712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9120   -3.8651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 38  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  1  0  0  0\n  8  9  1  0  0  0  0\n 31  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 24 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  2  0  0  0  0\n 32 31  2  0  0  0  0\n 33 31  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 35  1  0  0  0  0\n 37 35  2  0  0  0  0\n 39 38  1  0  0  0  0\n 40 38  2  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)N[C@@H](CSSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N)C(=O)NCC(=O)O)[C@@H](C(=O)O)N",
          "formula": "C20H32N6O12S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c6ca8374-26a4-4601-99ee-4b09536f4d14"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "612.6341",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4974314c-cde6-43b0-866b-08937c728f62",
      "version": "18",
      "structure": {
        "id": "ed0f5476-53d5-4018-88a5-e0b9627b1362",
        "molfile": "\n  Marvin  01132112162D          \n\n 40 39  0  0  1  0            999 V2000\n    4.9231   -4.1616    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8616   -8.3559    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0175   -3.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -8.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8863   -3.8034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9231   -8.8252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3645   -4.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4654   -8.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4914   -4.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3304   -8.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5153   -4.2233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -8.3724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3175   -4.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3931   -8.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9846   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6849   -9.5908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4015   -5.0712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4613   -7.4298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7265   -3.7499    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0829   -8.7758    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5243   -5.0012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3304   -7.5944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5642   -3.9886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1422   -8.6811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5527   -5.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3432   -7.3722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9102   -3.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7880   -8.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9362   -4.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8855   -8.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4994   -5.8657    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4870   -6.6766    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1088   -3.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7006   -8.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9120   -3.8651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9056   -8.6152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7265   -2.9348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0829   -9.5908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3504   -5.0506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3931   -7.5944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2 26  1  1  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7 19  1  0  0  0  0\n  8 20  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13 27  1  0  0  0  0\n 14 28  1  0  0  0  0\n 15  3  2  0  0  0  0\n 16  4  2  0  0  0  0\n 17  7  2  0  0  0  0\n 18  8  2  0  0  0  0\n 19 29  1  0  0  0  0\n 20 30  1  0  0  0  0\n 21  9  2  0  0  0  0\n 22 10  2  0  0  0  0\n 23 13  2  0  0  0  0\n 24 14  2  0  0  0  0\n  1 25  1  1  0  0  0\n 26 32  1  0  0  0  0\n 27 11  1  0  0  0  0\n 28 12  1  0  0  0  0\n 29 33  1  0  0  0  0\n 30 34  1  0  0  0  0\n 31 25  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33  9  1  0  0  0  0\n 34 10  1  0  0  0  0\n 35  7  1  0  0  0  0\n 36  8  1  0  0  0  0\n 19 37  1  6  0  0  0\n 20 38  1  6  0  0  0\n 39 13  1  0  0  0  0\n 40 14  1  0  0  0  0\nM  END",
        "smiles": "C(CC(=O)N[C@@H](CSSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N)C(=O)NCC(=O)O)[C@@H](C(=O)O)N",
        "formula": "C20H32N6O12S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "612.6341",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8c7f3519-3fa8-4fd9-8b99-9296567d8901",
          "411c6271-c053-47f1-a9ad-8f0a0b6ab977",
          "2de082dc-edc8-4897-8cd0-84390aa46a1e"
        ],
        "stereo_centers": 4
      },
      "unii": "ULW86O013H"
    }
  ]
}