{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "41faabc1-4cc7-4183-a54a-e8187ac79ca1",
          "code": "307519-91-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=307519-91-1",
          "code_system": "CAS",
          "references": [
            "ce44d162-e80a-495f-949b-abc44dc7031d",
            "38a7abfa-8a49-4251-a2d4-aec1de4ce395"
          ]
        },
        {
          "uuid": "f1c80ad6-ee4a-443d-abf4-fecd1399586d",
          "code": "44250995",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44250995",
          "code_system": "PUBCHEM",
          "references": [
            "ce44d162-e80a-495f-949b-abc44dc7031d"
          ]
        },
        {
          "uuid": "9b78366c-c0be-147e-9849-debfc23f29fe",
          "code": "DTXSID80184776",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80184776",
          "code_system": "EPA CompTox",
          "references": [
            "2cebadb2-9e1e-f9d6-fdea-14a09860759c"
          ]
        },
        {
          "uuid": "fbe052a9-32cc-4ca2-8c52-43e0a0b1ac6f",
          "code": "UKY191363Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1480f73e-5688-4dc4-8198-c0363c9ccaa3",
          "name": ".BETA.-ALANINE, N-(2-(2-CARBOXYETHOXY)ETHYL)-N-(2-((1-OXOOCTYL)AMINO)ETHYL)-, DISODIUM SALT",
          "stdName": ".BETA.-ALANINE, N-(2-(2-CARBOXYETHOXY)ETHYL)-N-(2-((1-OXOOCTYL)AMINO)ETHYL)-, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc467327-4d0e-4171-b20c-a1485222ad54",
            "31792376-e139-4689-b959-136197cee6a4"
          ],
          "display_name": false
        },
        {
          "uuid": "a9ef1c0d-41f4-40e8-817c-5700f14e7bc4",
          "name": "CAPRYLOAMPHOCARBOXYPROPIONATE",
          "stdName": "CAPRYLOAMPHOCARBOXYPROPIONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1097f4b-cf29-4848-874f-7b6c0a028b45",
            "31792376-e139-4689-b959-136197cee6a4"
          ],
          "display_name": false
        },
        {
          "uuid": "34a64f70-8899-4d45-ae65-f801c11216b1",
          "name": "CAPRYLOAMPHODIPROPIONATE",
          "stdName": "CAPRYLOAMPHODIPROPIONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1097f4b-cf29-4848-874f-7b6c0a028b45",
            "31792376-e139-4689-b959-136197cee6a4"
          ],
          "display_name": false
        },
        {
          "uuid": "a41dabc6-cc64-4059-b1cb-27356b19afc7",
          "name": "DISODIUM CAPRYLOAMPHODIPROPIONATE",
          "stdName": "DISODIUM CAPRYLOAMPHODIPROPIONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1097f4b-cf29-4848-874f-7b6c0a028b45",
            "214f50eb-798a-4e80-934b-20248af970f2",
            "31792376-e139-4689-b959-136197cee6a4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "39343815-f96c-4425-a26f-16cd9a42ca33",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f1303095-7cf1-406d-99bb-90b28a45c533",
          "name": "MACKAM 2CYSF",
          "stdName": "MACKAM 2CYSF",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1097f4b-cf29-4848-874f-7b6c0a028b45",
            "31792376-e139-4689-b959-136197cee6a4"
          ],
          "display_name": false
        },
        {
          "uuid": "06c648cd-aa04-4f5d-a67f-95448e8aa4fd",
          "name": "MIRANOL J2M-SF CONC.",
          "stdName": "MIRANOL J2M-SF CONC.",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1097f4b-cf29-4848-874f-7b6c0a028b45",
            "31792376-e139-4689-b959-136197cee6a4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1097f4b-cf29-4848-874f-7b6c0a028b45",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "31792376-e139-4689-b959-136197cee6a4",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc467327-4d0e-4171-b20c-a1485222ad54",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce44d162-e80a-495f-949b-abc44dc7031d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391504000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b2141b8-8ccb-42e0-b43c-adebe82d4460",
          "citation": "SRS import [UKY191363Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UKY191363Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391504000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "214f50eb-798a-4e80-934b-20248af970f2",
          "citation": "DISODIUM CAPRYLOAMPHODIPROPIONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2cebadb2-9e1e-f9d6-fdea-14a09860759c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=307519-91-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "38a7abfa-8a49-4251-a2d4-aec1de4ce395",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "55c01498-fd13-499a-b8d5-94659558c8fe",
          "id": "55c01498-fd13-499a-b8d5-94659558c8fe",
          "molfile": "\n  Marvin  01132104282D          \n\n  1  0  0  0  0  0            999 V2000\n    6.5097   -3.2563    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "eae0642c-dfd7-4079-be6b-8ce7267c68a9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0312f7ad-5108-4eee-8d94-c935be865858",
          "id": "0312f7ad-5108-4eee-8d94-c935be865858",
          "molfile": "\n  Marvin  01132100282D          \n\n 26 25  0  0  0  0            999 V2000\n    2.1459   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5728   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2909   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0043   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7178   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4312   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1445   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1445   -6.9207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8581   -8.1592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5761   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2895   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0029   -7.7449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0029   -6.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7164   -6.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7164   -5.6821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4298   -5.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4298   -4.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -4.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -3.2096    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.8613   -4.4483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7164   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4298   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8613   -7.7449    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.1479   -8.9834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\nM  CHG  2  20  -1  25  -1\nM  END",
          "smiles": "CCCCCCCC(=O)NCCN(CCC(=O)[O-])CCOCCC(=O)[O-]",
          "formula": "C18H32N2O6",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad8da84d-c64a-4bd9-83b4-d750af3c96ec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "372.4572",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "865d72b7-96f3-418e-9090-4991da819969",
      "version": "5",
      "structure": {
        "id": "30115c5b-f0a9-478b-9cb5-796d2c4e34b6",
        "molfile": "\n  Marvin  01132102352D          \n\n 28 25  0  0  0  0            999 V2000\n    2.1459   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5728   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2909   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0043   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7178   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4312   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1445   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1445   -6.9207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8581   -8.1592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5761   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2895   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0029   -7.7449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0029   -6.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7164   -6.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7164   -5.6821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4298   -5.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4298   -4.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -4.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -3.2096    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.8613   -4.4483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7164   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4298   -7.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8613   -7.7449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1479   -8.9834    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.5097   -3.2563    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    6.5097   -3.2563    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 13 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n  1  2  1  0  0  0  0\nM  CHG  4  20  -1  26  -1  27   1  28   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  27  28\nM  SPA   1  1  27\nM  SDI   1  4    6.0897   -3.6763    6.0897   -2.8363\nM  SDI   1  4    6.9297   -2.8363    6.9297   -3.6763\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCCC(=O)NCCN(CCC(=O)[O-])CCOCCC(=O)[O-].[Na+].[Na+]",
        "formula": "C18H32N2O6.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.4367",
        "optical_activity": "NONE",
        "references": [
          "fc467327-4d0e-4171-b20c-a1485222ad54",
          "6b2141b8-8ccb-42e0-b43c-adebe82d4460"
        ],
        "stereo_centers": 0
      },
      "unii": "UKY191363Z"
    }
  ]
}