{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "deaae505-240f-4dea-a963-2740e3142b30",
          "code": "2128-93-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2128-93-0",
          "code_system": "CAS",
          "references": [
            "b16c8532-b309-45ab-a0b3-5d96c572832f",
            "3b606f4f-87fb-40d6-869d-8670dac1ac80"
          ]
        },
        {
          "uuid": "1b2f5efc-bdf5-4d1b-8f0a-d971b0b6c085",
          "code": "218-345-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.678",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b16c8532-b309-45ab-a0b3-5d96c572832f"
          ]
        },
        {
          "uuid": "b9f777f0-cb05-467e-a16e-097e783e7008",
          "code": "75040",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75040",
          "code_system": "PUBCHEM",
          "references": [
            "b16c8532-b309-45ab-a0b3-5d96c572832f"
          ]
        },
        {
          "uuid": "ad0bbef9-516c-8f97-d26c-5e04422d96b7",
          "code": "DTXSID4062193",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4062193",
          "code_system": "EPA CompTox",
          "references": [
            "5cc518c1-86cc-6618-af1c-5d881e7d3ca9"
          ]
        },
        {
          "uuid": "acec6e86-2cd8-4d04-b8c8-1e756695a79d",
          "code": "UK25C63WBD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a71d42c0-ef15-3440-db18-54d5aa915376",
          "code": "55283",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=55283",
          "code_system": "NSC",
          "references": [
            "b5287e75-164b-a464-86e7-8d23b02c09b4"
          ]
        },
        {
          "uuid": "9230be61-07ba-d1b5-2b6e-9de914b8509b",
          "code": "97365",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=97365",
          "code_system": "NSC",
          "references": [
            "b5287e75-164b-a464-86e7-8d23b02c09b4"
          ]
        },
        {
          "uuid": "f3195c7f-290c-d4ed-3dbd-3ce3a0f93b61",
          "code": "300000053096",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "12837985-3f00-f5b5-179c-c62838868c80"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dd277456-d349-485b-9b2e-334d046e69fa",
          "name": "4-BENZOYLBIPHENYL",
          "stdName": "4-BENZOYLBIPHENYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "489bc921-b0db-4f26-9e04-a63995ffeacc"
          ],
          "display_name": true
        },
        {
          "uuid": "744b3cab-2e4b-4fd8-9bea-45a3f3274d92",
          "name": "4-PHENYLBENZOPHENONE",
          "stdName": "4-PHENYLBENZOPHENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b606f4f-87fb-40d6-869d-8670dac1ac80"
          ],
          "display_name": false
        },
        {
          "uuid": "8ba1318f-03ba-4a1e-9f66-927ac632b716",
          "name": "METHANONE, (1,1'-BIPHENYL)-4-YLPHENYL-",
          "stdName": "METHANONE, (1,1'-BIPHENYL)-4-YLPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b606f4f-87fb-40d6-869d-8670dac1ac80"
          ],
          "display_name": false
        },
        {
          "uuid": "fbc4ad4f-20eb-4d3d-8f87-c71819f450cb",
          "name": "NSC-55283",
          "stdName": "NSC-55283",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84103061-b2f0-465e-9464-7839d0593e52"
          ],
          "display_name": false
        },
        {
          "uuid": "4297d427-743a-4da7-90ab-e99ba78fc3b9",
          "name": "NSC-97365",
          "stdName": "NSC-97365",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84103061-b2f0-465e-9464-7839d0593e52"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "489bc921-b0db-4f26-9e04-a63995ffeacc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84103061-b2f0-465e-9464-7839d0593e52",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b16c8532-b309-45ab-a0b3-5d96c572832f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392161000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cc518c1-86cc-6618-af1c-5d881e7d3ca9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2128-93-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3b606f4f-87fb-40d6-869d-8670dac1ac80",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b5287e75-164b-a464-86e7-8d23b02c09b4",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "12837985-3f00-f5b5-179c-c62838868c80",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c811dc3c-9f9f-483f-b6cc-85b6863e17d9",
          "id": "c811dc3c-9f9f-483f-b6cc-85b6863e17d9",
          "molfile": "\n  Marvin  01132110202D          \n\n 20 22  0  0  0  0            999 V2000\n    4.9984   -2.8822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2859   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2859   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -0.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8555   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8555   -4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4304   -4.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7125   -3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7072   -5.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -4.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  9  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)-c2ccc(cc2)C(=O)c3ccccc3",
          "formula": "C19H14O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1749b165-949a-4923-8225-c8b1eda0ef52"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.3146",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1396b530-c597-4809-8364-e9c45ba85b45",
      "version": "8",
      "structure": {
        "id": "da1842b7-d73d-4fcb-baa6-9771af5adc6c",
        "molfile": "\n  Marvin  01132111192D          \n\n 20 22  0  0  0  0            999 V2000\n    4.9984   -2.8822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2859   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8555   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1429   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4304   -4.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7125   -3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7072   -5.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4250   -4.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8555   -4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2859   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -0.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5680   -1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 15  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 14  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)-c2ccc(cc2)C(=O)c3ccccc3",
        "formula": "C19H14O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.3146",
        "optical_activity": "NONE",
        "references": [
          "489bc921-b0db-4f26-9e04-a63995ffeacc",
          "3b606f4f-87fb-40d6-869d-8670dac1ac80"
        ],
        "stereo_centers": 0
      },
      "unii": "UK25C63WBD"
    }
  ]
}