{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6fde72b8-a9fc-4b87-84e8-5d06b57ff5cc",
          "code": "13684-63-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13684-63-4",
          "code_system": "CAS",
          "references": [
            "02ae3a5e-0681-4e07-a690-8b029a6235e9",
            "4048c768-389b-4eb5-ac53-9790e04bdb2c"
          ]
        },
        {
          "uuid": "f964da49-cc99-4bf7-886c-b4165dc70b49",
          "code": "C100128",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100128",
          "code_system": "MESH",
          "references": [
            "02ae3a5e-0681-4e07-a690-8b029a6235e9"
          ]
        },
        {
          "uuid": "584079c6-410c-4702-99a2-6581a7cc24d4",
          "code": "98701",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3269",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "02ae3a5e-0681-4e07-a690-8b029a6235e9"
          ]
        },
        {
          "uuid": "07a29870-84ed-4ed5-a195-dfcfb25b6ef0",
          "code": "m8620",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8620?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "02ae3a5e-0681-4e07-a690-8b029a6235e9"
          ]
        },
        {
          "uuid": "a806a960-6f9a-4f4c-8cf1-3c2f27748df5",
          "code": "237-199-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.803",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "02ae3a5e-0681-4e07-a690-8b029a6235e9"
          ]
        },
        {
          "uuid": "04bc4376-f1d8-4b70-bbc4-ca6309d9f41c",
          "code": "24744",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24744",
          "code_system": "PUBCHEM",
          "references": [
            "02ae3a5e-0681-4e07-a690-8b029a6235e9"
          ]
        },
        {
          "uuid": "5e6e2320-719d-2852-41d1-3e190d442fff",
          "code": "1402",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1402",
          "code_system": "HSDB",
          "references": [
            "f0fa1523-c3c2-1ecc-0d12-10390c7b4bfb"
          ]
        },
        {
          "uuid": "54a83988-95a0-de25-37af-d50922e0cdf3",
          "code": "DTXSID1024255",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1024255",
          "code_system": "EPA CompTox",
          "references": [
            "f14b33a8-e981-ef9c-ccc8-9bb0d71fffc5"
          ]
        },
        {
          "uuid": "60b05392-a721-46ff-bfef-dd900dbe1c28",
          "code": "UJE31KXP78",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "faeafd53-8b7a-afba-5e12-a0a724a4e3bc",
          "code": "81734",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81734",
          "code_system": "CHEBI",
          "references": [
            "aeee3e54-2957-700a-e0d3-17d20d755236"
          ]
        },
        {
          "uuid": "9d9b81bd-ed6f-929e-2167-a842fa531702",
          "code": "phenmedipham",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/phenmedipham.html",
          "code_system": "ALANWOOD",
          "references": [
            "99fce7dd-9871-02d5-6dd0-8cf74b1cd44e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e5a449c0-c372-40fb-8baa-c15c0bbd0ad2",
          "name": "3-((METHOXYCARBONYL)AMINO)PHENYL N-(3-METHYLPHENYL)CARBAMATE",
          "stdName": "3-((METHOXYCARBONYL)AMINO)PHENYL N-(3-METHYLPHENYL)CARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1276eb6d-ac95-4057-8e43-06f0bb1c6414",
            "48830b66-6209-4399-9f32-4fb7c193c1c1"
          ],
          "display_name": false
        },
        {
          "uuid": "226f963d-9f63-4bca-86a9-f72d4753ed42",
          "name": "BETANAL",
          "stdName": "BETANAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f941a97e-d45e-43bb-a54f-0de08606df4d",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": false
        },
        {
          "uuid": "6cd169b1-ab04-4d98-a90a-c2f17e04f628",
          "name": "METHYL 3-(3-METHYLCARBANILOYLOXY)CARBANILATE",
          "stdName": "METHYL 3-(3-METHYLCARBANILOYLOXY)CARBANILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c55321e-8e59-4e1e-97c9-35dda8e3a665",
            "48830b66-6209-4399-9f32-4fb7c193c1c1"
          ],
          "display_name": false
        },
        {
          "uuid": "6e1d7ecd-741e-4df2-b0e6-659bff7cff16",
          "name": "METHYL-M-HYDROXYCARBANILATE-M-METHYLCARBANILATE",
          "stdName": "METHYL-M-HYDROXYCARBANILATE-M-METHYLCARBANILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f941a97e-d45e-43bb-a54f-0de08606df4d",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": false
        },
        {
          "uuid": "39d81652-2925-4b6a-b73b-1670cca98a1b",
          "name": "PHENMEDIPHAM",
          "stdName": "PHENMEDIPHAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9e1b437-1af9-4250-b3da-3b7be6da1dfd",
            "95495068-707c-40a7-91a2-e29c4b59a26d",
            "560d3535-f4f8-4b16-bf35-1b80337c756d",
            "fd91e194-3554-44b0-9d34-e3eaa89b6858",
            "3c524583-2c00-45f8-abc4-870da88c795a",
            "e11bfe48-3526-428b-ad7b-5eac7dfc6a3a",
            "de23277f-035a-4aa0-9a6a-9d93abc83186",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": true
        },
        {
          "uuid": "665a7b91-cd84-4cea-ae0a-269ee2b30020",
          "name": "PHENMEDIPHAM [HSDB]",
          "stdName": "PHENMEDIPHAM [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de23277f-035a-4aa0-9a6a-9d93abc83186",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": false
        },
        {
          "uuid": "8587f73a-e4a2-4de7-9b95-877c9ab14701",
          "name": "PHENMEDIPHAM [ISO]",
          "stdName": "PHENMEDIPHAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c524583-2c00-45f8-abc4-870da88c795a",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": false
        },
        {
          "uuid": "8c04e4f9-1268-41a2-a22c-c786d2603884",
          "name": "PHENMEDIPHAM [MI]",
          "stdName": "PHENMEDIPHAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95495068-707c-40a7-91a2-e29c4b59a26d",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": false
        },
        {
          "uuid": "a22ee630-1d02-4464-a8ff-85116587a4ee",
          "name": "SPIN-AID",
          "stdName": "SPIN-AID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f941a97e-d45e-43bb-a54f-0de08606df4d",
            "e698b9b1-e14e-4ead-a3c9-a6b698effe14"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d9e1b437-1af9-4250-b3da-3b7be6da1dfd",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "48830b66-6209-4399-9f32-4fb7c193c1c1",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c55321e-8e59-4e1e-97c9-35dda8e3a665",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1276eb6d-ac95-4057-8e43-06f0bb1c6414",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f941a97e-d45e-43bb-a54f-0de08606df4d",
          "citation": "http://pmep.cce.cornell.edu/profiles/herb-growthreg/naa-rimsulfuron/phenmedipham/herb-prof-phenmedip",
          "url": "http://pmep.cce.cornell.edu/profiles/herb-growthreg/naa-rimsulfuron/phenmedipham/herb-prof-phenmedip",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e698b9b1-e14e-4ead-a3c9-a6b698effe14",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95495068-707c-40a7-91a2-e29c4b59a26d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de23277f-035a-4aa0-9a6a-9d93abc83186",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c524583-2c00-45f8-abc4-870da88c795a",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02ae3a5e-0681-4e07-a690-8b029a6235e9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390885000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36197121-d3f5-44ff-80dd-9a9f5e32abd3",
          "citation": "SRS import [UJE31KXP78]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UJE31KXP78",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390885000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "185bedb6-0c1c-4cbe-8243-4ad3a4dca47d",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "560d3535-f4f8-4b16-bf35-1b80337c756d",
          "citation": "PHENMEDIPHAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e11bfe48-3526-428b-ad7b-5eac7dfc6a3a",
          "citation": "PHENMEDIPHAM [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd91e194-3554-44b0-9d34-e3eaa89b6858",
          "citation": "PHENMEDIPHAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0fa1523-c3c2-1ecc-0d12-10390c7b4bfb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+13684-63-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f14b33a8-e981-ef9c-ccc8-9bb0d71fffc5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13684-63-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "99fce7dd-9871-02d5-6dd0-8cf74b1cd44e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "aeee3e54-2957-700a-e0d3-17d20d755236",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4048c768-389b-4eb5-ac53-9790e04bdb2c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9facd176-0bc1-42e3-9c90-c9a3039879e7",
          "id": "9facd176-0bc1-42e3-9c90-c9a3039879e7",
          "molfile": "\n  Marvin  01132108182D          \n\n 22 23  0  0  0  0            999 V2000\n    2.0181   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7324   -5.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4471   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4471   -4.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1616   -5.6504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8761   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8761   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5906   -4.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3051   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3051   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0196   -5.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7342   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7342   -4.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4486   -5.6504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1632   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1632   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8777   -4.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5922   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5922   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3067   -5.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8777   -5.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5906   -5.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 22  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 22 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(c1)NC(=O)Oc2cccc(c2)NC(=O)OC",
          "formula": "C16H16N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "88704604-a5d6-4273-87f6-580e695b363c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "300.3099",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5c210f83-f99b-45b0-afce-93b8fbe552e8",
      "version": "7",
      "structure": {
        "id": "b36c7f42-0b49-4b1b-a21a-462f7fb9244b",
        "molfile": "\n  Marvin  01132109182D          \n\n 22 23  0  0  0  0            999 V2000\n    5.5906   -5.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3051   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0196   -5.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7342   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4486   -5.6504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1632   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8777   -5.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5922   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5922   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8777   -4.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1632   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3067   -5.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7342   -4.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3051   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5906   -4.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8761   -4.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8761   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1616   -5.6504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4471   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7324   -5.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0181   -5.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4471   -4.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  4 13  2  0  0  0  0\n  2 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n  1 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 19 22  2  0  0  0  0\nM  END",
        "smiles": "Cc1cccc(c1)NC(=O)Oc2cccc(c2)NC(=O)OC",
        "formula": "C16H16N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "300.3099",
        "optical_activity": "NONE",
        "references": [
          "185bedb6-0c1c-4cbe-8243-4ad3a4dca47d",
          "36197121-d3f5-44ff-80dd-9a9f5e32abd3"
        ],
        "stereo_centers": 0
      },
      "unii": "UJE31KXP78"
    }
  ]
}