{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2bc64ca4-f50a-4bee-83fc-91cd166ef4f1",
          "code": "874967-67-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=874967-67-6",
          "code_system": "CAS",
          "references": [
            "8104896a-1eb3-4f1c-9b24-1ae0ed7191bb",
            "e113e9af-a509-46ae-be7e-14b3bf6bea8e"
          ]
        },
        {
          "uuid": "2511e446-198b-4ef1-93f2-18ec78e7c1e1",
          "code": "11688533",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11688533",
          "code_system": "PUBCHEM",
          "references": [
            "8104896a-1eb3-4f1c-9b24-1ae0ed7191bb"
          ]
        },
        {
          "uuid": "248381cd-5ef2-203f-b8a2-cf43c82ffa02",
          "code": "DTXSID2058207",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2058207",
          "code_system": "EPA CompTox",
          "references": [
            "5a130c02-8bdd-a3c3-dd5b-931f78e7afa0"
          ]
        },
        {
          "uuid": "2f021608-fa8f-4cd8-ae01-e378c94350be",
          "code": "UHZ33J8Z9F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a27d7ac7-6789-83b6-3fce-051efe02698e",
          "code": "Sedaxane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sedaxane",
          "code_system": "WIKIPEDIA",
          "references": [
            "b1a19187-e954-a22c-548f-d6985f4b7a4a"
          ]
        },
        {
          "uuid": "53d74169-598f-43de-1e05-8f3ad5578097",
          "code": "sedaxane",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/sedaxane.html",
          "code_system": "ALANWOOD",
          "references": [
            "b0c38589-dec5-ccee-7d6e-ac58b87c3819"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "85bb90b5-9523-4b22-ad5f-3f1786c87594",
          "name": "1H-PYRAZOLE-4-CARBOXAMIDE, N-(2-(1,1'-BICYCLOPROPYL)-2-YLPHENYL)-3-(DIFLUOROMETHYL)-1-METHYL-",
          "stdName": "1H-PYRAZOLE-4-CARBOXAMIDE, N-(2-(1,1'-BICYCLOPROPYL)-2-YLPHENYL)-3-(DIFLUOROMETHYL)-1-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c72a3bad-9684-4cad-a332-7a957a2f8895",
            "8f3f4370-a11c-44ce-a1f8-2e7e6ea60369"
          ],
          "display_name": false
        },
        {
          "uuid": "8e06dc74-4275-463f-8763-4a05d4d76676",
          "name": "N-(2-(1,1'-BI(CYCLOPROPYL)-2-YL)PHENYL)-1-METHYL-3-(DIFLUOROMETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "N-(2-(1,1'-BI(CYCLOPROPYL)-2-YL)PHENYL)-1-METHYL-3-(DIFLUOROMETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c72a3bad-9684-4cad-a332-7a957a2f8895",
            "8f3f4370-a11c-44ce-a1f8-2e7e6ea60369"
          ],
          "display_name": false
        },
        {
          "uuid": "5d070b4d-0d91-4ece-b5b0-617cc54afaa1",
          "name": "SEDAXANE",
          "stdName": "SEDAXANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c72a3bad-9684-4cad-a332-7a957a2f8895",
            "b4302219-9bff-431a-bd5e-ef5bda4359de",
            "8f3f4370-a11c-44ce-a1f8-2e7e6ea60369",
            "05ab7fe2-16d4-4e24-86c0-68ecb72c4738"
          ],
          "display_name": true
        },
        {
          "uuid": "ac6f5b82-2200-41a8-8ab8-b20ffdeac36b",
          "name": "SEDAXANE [ISO]",
          "stdName": "SEDAXANE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4302219-9bff-431a-bd5e-ef5bda4359de",
            "c72a3bad-9684-4cad-a332-7a957a2f8895"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b4302219-9bff-431a-bd5e-ef5bda4359de",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c72a3bad-9684-4cad-a332-7a957a2f8895",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f3f4370-a11c-44ce-a1f8-2e7e6ea60369",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8104896a-1eb3-4f1c-9b24-1ae0ed7191bb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "006b5dd5-a686-4a53-91b3-20a98ff635e9",
          "citation": "SRS import [UHZ33J8Z9F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UHZ33J8Z9F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05ab7fe2-16d4-4e24-86c0-68ecb72c4738",
          "citation": "SEDAXANE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a130c02-8bdd-a3c3-dd5b-931f78e7afa0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=874967-67-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1a19187-e954-a22c-548f-d6985f4b7a4a",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "b0c38589-dec5-ccee-7d6e-ac58b87c3819",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e113e9af-a509-46ae-be7e-14b3bf6bea8e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "af68c5e0-f7b3-4ac8-adf8-c23e39b9fcb6",
          "id": "af68c5e0-f7b3-4ac8-adf8-c23e39b9fcb6",
          "molfile": "\n  Marvin  01132109062D          \n\n 24 27  0  0  0  0            999 V2000\n    4.4494   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7849   -3.6361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -3.8076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6781   -4.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3926   -5.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1071   -4.6281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3926   -5.8656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1071   -6.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1071   -7.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8215   -7.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5360   -7.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5360   -6.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8215   -5.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8215   -5.0406    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.4091   -4.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2341   -4.3261    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.9485   -3.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3610   -3.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7736   -3.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9244   -4.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3724   -4.3505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7530   -5.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3660   -6.3226    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9683   -6.0256    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 21  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 20  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
          "smiles": "Cn1cc(c(C(F)F)n1)C(=O)Nc2ccccc2C3CC3C4CC4",
          "formula": "C18H19F2N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dcb71754-a3be-422e-b2f5-9b210ef698d3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "331.3604",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7335f780-00f7-4a74-b710-4e111f42fff3",
      "version": "5",
      "structure": {
        "id": "cac33b49-24da-4114-b4df-30223c243de3",
        "molfile": "\n  Marvin  01132110282D          \n\n 24 27  0  0  0  0            999 V2000\n    6.3926   -5.8656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1071   -6.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1071   -7.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8215   -7.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5360   -7.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5360   -6.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8215   -5.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8215   -5.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4091   -4.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2341   -4.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9485   -3.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3610   -3.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7736   -3.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3926   -5.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6781   -4.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -3.8076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7849   -3.6361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4494   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3724   -4.3505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9244   -4.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7530   -5.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3660   -6.3226    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9683   -6.0256    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1071   -4.6281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 14 24  2  0  0  0  0\nM  END",
        "smiles": "Cn1cc(c(C(F)F)n1)C(=O)Nc2ccccc2C3CC3C4CC4",
        "formula": "C18H19F2N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "331.3604",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "006b5dd5-a686-4a53-91b3-20a98ff635e9",
          "8f3f4370-a11c-44ce-a1f8-2e7e6ea60369"
        ],
        "stereo_centers": 2
      },
      "unii": "UHZ33J8Z9F"
    }
  ]
}