{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8265fae0-1b6b-4c99-8593-52d5957abd8e",
          "code": "148-75-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=148-75-4",
          "code_system": "CAS",
          "references": [
            "15a5c843-011b-43dd-8097-6e6016b3f0e8",
            "3f5d1c85-e197-481b-9dc7-3e79b4331265"
          ]
        },
        {
          "uuid": "48f0d5d4-f344-4a47-87c5-fe854eedc844",
          "code": "C026496",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026496",
          "code_system": "MESH",
          "references": [
            "15a5c843-011b-43dd-8097-6e6016b3f0e8"
          ]
        },
        {
          "uuid": "07a4c4ff-8e8a-40e5-9931-53fb9662aeea",
          "code": "205-724-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.205",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "15a5c843-011b-43dd-8097-6e6016b3f0e8"
          ]
        },
        {
          "uuid": "f20580d7-ec32-46a1-994f-ba521cd83e11",
          "code": "m7742",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7742?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "15a5c843-011b-43dd-8097-6e6016b3f0e8"
          ]
        },
        {
          "uuid": "45d42f56-f405-4742-830e-2b982ca304c9",
          "code": "8674",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8674",
          "code_system": "PUBCHEM",
          "references": [
            "15a5c843-011b-43dd-8097-6e6016b3f0e8"
          ]
        },
        {
          "uuid": "e1f2d1ff-98a4-63ad-06ee-c5161fc5349f",
          "code": "DTXSID6045032",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6045032",
          "code_system": "EPA CompTox",
          "references": [
            "4be55451-6094-9cd1-492d-24d6b632534b"
          ]
        },
        {
          "uuid": "56e7ecc3-f671-4ea1-8dec-b530b8425fe8",
          "code": "UHI9372R49",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "c65382e4-926f-4b1f-a3bc-5cab06a6c2a0",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "58fa9641-728c-4d4e-952c-822a923f292d",
            "refuuid": "99c8aa6d-82f2-4db4-8b92-0fa9bacfab11",
            "name": "SODIUM 3-HYDROXY-2,7-NAPHTHALENEDISULFONATE",
            "unii": "KJ6P15NE8D",
            "linking_id": "KJ6P15NE8D",
            "ref_pname": "SODIUM 3-HYDROXY-2,7-NAPHTHALENEDISULFONATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9562fadf-8cea-4eda-908f-69ff241c97fd",
          "name": "2,7-NAPHTHALENEDISULFONIC ACID, 3-HYDROXY-",
          "stdName": "2,7-NAPHTHALENEDISULFONIC ACID, 3-HYDROXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b291d43a-20e7-4496-8e8f-97d6d07febd2",
            "ae9f22f7-5858-4fbc-81db-021480460e93"
          ],
          "display_name": false
        },
        {
          "uuid": "88f0fb54-d250-42e3-874e-30fca70849a2",
          "name": "2-NAPHTHOL-3,6-DISULFONIC ACID",
          "stdName": "2-NAPHTHOL-3,6-DISULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b291d43a-20e7-4496-8e8f-97d6d07febd2",
            "38ac14f3-65f0-4c60-afb6-1dc80d7f11c2",
            "cf1a5b13-e7bc-4a50-89ef-6025b41feb12",
            "1ddb0167-7186-420e-886b-f68405a8ae71"
          ],
          "display_name": true
        },
        {
          "uuid": "d7fd57dd-2816-4e3f-8deb-3bcd0eabd11d",
          "name": "2-NAPHTHOL-3,6-DISULFONIC ACID [MI]",
          "stdName": "2-NAPHTHOL-3,6-DISULFONIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b291d43a-20e7-4496-8e8f-97d6d07febd2",
            "cf1a5b13-e7bc-4a50-89ef-6025b41feb12"
          ],
          "display_name": false
        },
        {
          "uuid": "380bd5eb-6bc7-494d-a1dd-50f363e9eebb",
          "name": "3-HYDROXY-2,7-NAPHTHALENEDISULFONIC ACID",
          "stdName": "3-HYDROXY-2,7-NAPHTHALENEDISULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08a3fdb8-b1d3-4a67-acee-61154d881aed",
            "b291d43a-20e7-4496-8e8f-97d6d07febd2"
          ],
          "display_name": false
        },
        {
          "uuid": "668d8e69-5384-415d-a05c-f7f657010a49",
          "name": "3-HYDROXYNAPHTHALENE-2,7-DISULPHONIC ACID",
          "stdName": "3-HYDROXYNAPHTHALENE-2,7-DISULPHONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b291d43a-20e7-4496-8e8f-97d6d07febd2",
            "ae9f22f7-5858-4fbc-81db-021480460e93"
          ],
          "display_name": false
        },
        {
          "uuid": "050b4d20-5e8c-42e0-83a8-5cbea00104a8",
          "name": "R ACID",
          "stdName": "R ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08a3fdb8-b1d3-4a67-acee-61154d881aed",
            "b291d43a-20e7-4496-8e8f-97d6d07febd2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "38ac14f3-65f0-4c60-afb6-1dc80d7f11c2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cf1a5b13-e7bc-4a50-89ef-6025b41feb12",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b291d43a-20e7-4496-8e8f-97d6d07febd2",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08a3fdb8-b1d3-4a67-acee-61154d881aed",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae9f22f7-5858-4fbc-81db-021480460e93",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15a5c843-011b-43dd-8097-6e6016b3f0e8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edf61589-fbfc-4324-8f1a-7793250fe191",
          "citation": "SRS import [UHI9372R49]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UHI9372R49",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "178fa63a-8cdc-4078-85d3-abb7d6a7423a",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ddb0167-7186-420e-886b-f68405a8ae71",
          "citation": "2-NAPHTHOL-3,6-DISULFONIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4be55451-6094-9cd1-492d-24d6b632534b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=148-75-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3f5d1c85-e197-481b-9dc7-3e79b4331265",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d748ca09-7af1-4dff-86b7-376e7d6fcce7",
          "id": "d748ca09-7af1-4dff-86b7-376e7d6fcce7",
          "molfile": "\n  Marvin  01132111092D          \n\n 19 20  0  0  0  0            999 V2000\n    9.2383   -3.9901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6278   -4.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9206   -4.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1998   -4.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4102   -4.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7449   -4.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7449   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4102   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1998   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9206   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6278   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3069   -5.8200    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8684   -6.5062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0511   -6.3398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7450   -5.1646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0794   -5.8435    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6357   -5.2019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5414   -6.5221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3586   -6.3557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7 16  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  2  0  0  0  0\nM  END",
          "smiles": "c1cc(cc2cc(c(cc12)O)S(=O)(=O)O)S(=O)(=O)O",
          "formula": "C10H8O7S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b84e9402-c2b9-4922-a771-95b320d5e3b3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "304.2989",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "99f9b10f-68f9-4fca-8abe-b9fb41939800",
      "version": "3",
      "structure": {
        "id": "a3aecd7b-4981-4026-9c91-cbf3c1933c6f",
        "molfile": "\n  Marvin  01132108302D          \n\n 19 20  0  0  0  0            999 V2000\n    7.1998   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1998   -4.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9206   -4.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6278   -4.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -3.9901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6278   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9206   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3069   -5.8200    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8684   -6.5062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0511   -6.3398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7450   -5.1646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4102   -4.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7449   -4.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7449   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4102   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0794   -5.8435    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6357   -5.2019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5414   -6.5221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3586   -6.3557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  2  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  2  0  0  0  0\nM  END",
        "smiles": "c1cc(cc2cc(c(cc12)O)S(=O)(=O)O)S(=O)(=O)O",
        "formula": "C10H8O7S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "304.2989",
        "optical_activity": "NONE",
        "references": [
          "178fa63a-8cdc-4078-85d3-abb7d6a7423a",
          "edf61589-fbfc-4324-8f1a-7793250fe191"
        ],
        "stereo_centers": 0
      },
      "unii": "UHI9372R49"
    }
  ]
}