{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "015e7384-475b-4236-8abe-10a851dc2e2b", "code": "62518-65-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=62518-65-4", "code_system": "CAS", "references": [ "6256fb3f-0a83-4544-bb5c-d1a06dc58330", "1e0ce388-d144-4b54-99c9-66f37dc30202" ] }, { "uuid": "2d48be05-024f-4281-9812-1436be47425b", "code": "263-580-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.057.782", "code_system": "ECHA (EC/EINECS)", "references": [ "6256fb3f-0a83-4544-bb5c-d1a06dc58330" ] }, { "uuid": "73d416f8-fc7e-44a7-aa24-1134ed09d099", "code": "112494", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/112494", "code_system": "PUBCHEM", "references": [ "6256fb3f-0a83-4544-bb5c-d1a06dc58330" ] }, { "uuid": "a8c12d93-915f-823b-11ed-33ee89341607", "code": "DTXSID8052304", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8052304", "code_system": "EPA CompTox", "references": [ "c97bc96e-c862-7e2d-f515-c7724d300c91" ] }, { "uuid": "446ec34e-2c1e-4c24-a06e-420d109531dc", "code": "UGB2D7505H", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f6344649-f7cc-7252-c844-9b10e802c0a2", "code": "300000052956", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "126572bc-07fe-c945-ca98-ec0184634732" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0ffa5a0f-be97-4cdb-9c0c-5431e58f6cb9", "name": "3-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYLBENZENEPROPANAL", "stdName": "3-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYLBENZENEPROPANAL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a064e882-9464-41ba-b35d-893954e6d072" ], "display_name": false }, { "uuid": "830bb87a-1e3f-444e-954f-e4668439803e", "name": "3-(3-TERT-BUTYLPHENYL)-2-METHYLPROPANAL", "stdName": "3-(3-TERT-BUTYLPHENYL)-2-METHYLPROPANAL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a064e882-9464-41ba-b35d-893954e6d072" ], "display_name": true }, { "uuid": "68993a42-2c00-4cb6-be84-f52d96cdc2de", "name": "BENZENEPROPANAL, 3-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-", "stdName": "BENZENEPROPANAL, 3-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "74c4f986-0635-4834-a168-5c96c1afe004" ], "display_name": false } ], "references": [ { "uuid": "74c4f986-0635-4834-a168-5c96c1afe004", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a064e882-9464-41ba-b35d-893954e6d072", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6256fb3f-0a83-4544-bb5c-d1a06dc58330", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393387000, "tags": [ "NOMEN" ] }, { "uuid": "925b4d66-ee48-4c34-803e-9f97a63c2585", "citation": "SRS import [UGB2D7505H]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UGB2D7505H", "doc_type": "SRS", "public_domain": true, "document_date": 1493393387000, "tags": [ "NOMEN" ] }, { "uuid": "c97bc96e-c862-7e2d-f515-c7724d300c91", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=62518-65-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1e0ce388-d144-4b54-99c9-66f37dc30202", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "126572bc-07fe-c945-ca98-ec0184634732", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b081ebe6-3f82-4864-ba36-42781e9b1ec7", "id": "b081ebe6-3f82-4864-ba36-42781e9b1ec7", "molfile": "\n Marvin 01132109092D \n\n 15 15 0 0 0 0 999 V2000\n 10.4976 -4.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4976 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.7831 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0686 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0686 -4.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3541 -3.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6397 -4.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6397 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3541 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9252 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9252 -6.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2108 -6.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2108 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2121 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9266 -5.1951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 14 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 9 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 14 15 2 0 0 0 0\nM END", "smiles": "CC(Cc1cccc(c1)C(C)(C)C)C=O", "formula": "C14H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fd92fb4e-0405-4274-aa2d-3cdecb07ee8e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.3085", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "0693029f-83a3-4783-a9e8-6d2021174e10", "version": "6", "structure": { "id": "2feb8935-45bc-4ff1-ad9f-c016ec594dc8", "molfile": "\n Marvin 01132102342D \n\n 15 15 0 0 0 0 999 V2000\n 7.6397 -4.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3541 -3.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0686 -4.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0686 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7831 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4976 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2121 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9266 -5.1951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4976 -4.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3541 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6397 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9252 -5.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9252 -6.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2108 -6.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2108 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 6 9 1 0 0 0 0\n 10 4 2 0 0 0 0\n 11 10 1 0 0 0 0\n 1 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\nM END", "smiles": "CC(Cc1cccc(c1)C(C)(C)C)C=O", "formula": "C14H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.3085", "optical_activity": "( + / - )", "references": [ "925b4d66-ee48-4c34-803e-9f97a63c2585", "74c4f986-0635-4834-a168-5c96c1afe004" ], "stereo_centers": 1 }, "unii": "UGB2D7505H" } ] }