{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "93ac2c0c-07ca-40a2-9894-19fe2c1e64ee",
          "code": "114311-32-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=114311-32-9",
          "code_system": "CAS",
          "references": [
            "e207eb3b-2fa0-46bf-8f81-fa4e1f870a74",
            "02b73f2d-ddc4-4de4-bec6-e6163c89b2f7"
          ]
        },
        {
          "uuid": "898db788-1ec6-4d1b-833f-e63f026ec2f3",
          "code": "129171",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2565",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e207eb3b-2fa0-46bf-8f81-fa4e1f870a74"
          ]
        },
        {
          "uuid": "c811c728-975c-42e1-a0b6-51eababc4f0b",
          "code": "ANNEX I INDEX 613-208-00-7",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e207eb3b-2fa0-46bf-8f81-fa4e1f870a74"
          ]
        },
        {
          "uuid": "c21a2ec7-c8ad-4333-bc81-8dc4fd95da3c",
          "code": "m6215",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6215?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e207eb3b-2fa0-46bf-8f81-fa4e1f870a74"
          ]
        },
        {
          "uuid": "08119965-af38-4282-b414-144e2dd22ebd",
          "code": "86137",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86137",
          "code_system": "PUBCHEM",
          "references": [
            "e207eb3b-2fa0-46bf-8f81-fa4e1f870a74"
          ]
        },
        {
          "uuid": "63bdcbf2-f56d-3259-2bae-d40a577dff25",
          "code": "7013",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7013",
          "code_system": "HSDB",
          "references": [
            "c1700989-8c3d-ace3-4b27-388908d3af9b"
          ]
        },
        {
          "uuid": "b84226af-f812-1179-f771-b0126ac7081a",
          "code": "DTXSID3034664",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3034664",
          "code_system": "EPA CompTox",
          "references": [
            "c97925ae-f159-686c-c21a-3b9c6d19ebe1"
          ]
        },
        {
          "uuid": "3a29994b-45da-4a1c-9ee8-4d1bf4b66282",
          "code": "UG6793ON5F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7cbfe933-17dc-549f-a3ba-799d169ca4d8",
          "code": "imazamox",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/imazamox.html",
          "code_system": "ALANWOOD",
          "references": [
            "b8b0a1cf-b399-60d4-e70b-d73ce34b75fd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4e84e808-7f4a-4689-b719-3efb98414c87",
          "amount": {
            "uuid": "1574554b-4207-4c54-bd65-a1a92c5ad23d"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "909c830f-c5aa-4991-9b23-d38613bfc1dc"
          ],
          "related_substance": {
            "uuid": "803ddc60-cc95-424d-b169-a60ab8f3010d",
            "refuuid": "97f284f4-94cc-4321-8e4d-0cd7a3480255",
            "name": "Imazamox-Ammonium",
            "unii": "TUI70EI1Y7",
            "linking_id": "TUI70EI1Y7",
            "ref_pname": "Imazamox-Ammonium",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5965b662-d810-48f7-be12-204b451948d8",
          "amount": {
            "uuid": "bbd0ee6e-a2b7-43a9-b17e-1f66811f12b6"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "8ccdd396-6fc6-4f7f-936c-6f2ccc4c6047"
          ],
          "related_substance": {
            "uuid": "16872c2b-db6b-4bf9-a3c4-4d5af124700f",
            "refuuid": "13394b9e-01f2-4e4a-8e3d-aa83fa854457",
            "name": "Imazamox-Sodium",
            "unii": "U3NM8KFD9Z",
            "linking_id": "U3NM8KFD9Z",
            "ref_pname": "Imazamox-Sodium",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e0caa1e1-48a9-41e8-907a-7ac9a01ada42",
          "name": "(±)-Imazamox",
          "stdName": "(+/-)-IMAZAMOX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d106faf-94ea-4d3d-95e6-0c4b09c6be57"
          ],
          "display_name": false
        },
        {
          "uuid": "5f1c9701-0845-42b7-a6d7-00d279288a59",
          "name": "2-[4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-3-pyridinecarboxylic acid",
          "stdName": "2-(4,5-DIHYDRO-4-METHYL-4-(1-METHYLETHYL)-5-OXO-1H-IMIDAZOL-2-YL)-5-(METHOXYMETHYL)-3-PYRIDINECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02b73f2d-ddc4-4de4-bec6-e6163c89b2f7"
          ],
          "display_name": false
        },
        {
          "uuid": "32a224ab-e16a-40e6-8f91-f5748d04f0e1",
          "name": "2-[4-Isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-5-methoxymethylnicotinic acid",
          "stdName": "2-(4-ISOPROPYL-4-METHYL-5-OXO-2-IMIDAZOLIN-2-YL)-5-METHOXYMETHYLNICOTINIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02b73f2d-ddc4-4de4-bec6-e6163c89b2f7"
          ],
          "display_name": false
        },
        {
          "uuid": "23b12f2e-0f76-414e-aef2-9ff0c0e1128a",
          "name": "3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-",
          "stdName": "3-PYRIDINECARBOXYLIC ACID, 2-(4,5-DIHYDRO-4-METHYL-4-(1-METHYLETHYL)-5-OXO-1H-IMIDAZOL-2-YL)-5-(METHOXYMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "075594cf-3a9c-4ced-bb75-ba8ec2902359"
          ],
          "display_name": false
        },
        {
          "uuid": "6dedfcb7-d6ab-44a4-9a17-9b2b38653889",
          "name": "5-Methoxymethyl-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl) nicotinic acid",
          "stdName": "5-METHOXYMETHYL-2-(4-ISOPROPYL-4-METHYL-5-OXO-2-IMIDAZOLIN-2-YL) NICOTINIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "909c830f-c5aa-4991-9b23-d38613bfc1dc"
          ],
          "display_name": false
        },
        {
          "uuid": "edd91224-54bb-4521-8779-5364d6d23716",
          "name": "AC-299263",
          "stdName": "AC-299263",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0a0a0a4-28d1-457f-aa89-fc61f2528b8c"
          ],
          "display_name": false
        },
        {
          "uuid": "5ae480c2-a69a-441f-9336-857dee7bda59",
          "name": "CL-299263",
          "stdName": "CL-299263",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0a0a0a4-28d1-457f-aa89-fc61f2528b8c"
          ],
          "display_name": false
        },
        {
          "uuid": "1ea44849-b1d6-4905-b174-c6d42134aefc",
          "name": "IMAZAMOX [ISO]",
          "stdName": "IMAZAMOX [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "075594cf-3a9c-4ced-bb75-ba8ec2902359"
          ],
          "display_name": false
        },
        {
          "uuid": "332a3426-083c-4460-be8c-04d3abc593f6",
          "name": "IMAZAMOX [MI]",
          "stdName": "IMAZAMOX [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0a0a0a4-28d1-457f-aa89-fc61f2528b8c"
          ],
          "display_name": false
        },
        {
          "uuid": "e23191e3-32e2-4579-ade4-7a0f0b514a44",
          "name": "Imazamox",
          "stdName": "IMAZAMOX",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "143147d5-db72-4bcb-aefa-241b5b888e89",
            "b0a0a0a4-28d1-457f-aa89-fc61f2528b8c",
            "075594cf-3a9c-4ced-bb75-ba8ec2902359",
            "77f54fa5-3295-45f9-bd98-7b16718085e7"
          ],
          "display_name": true,
          "domains": [
            "Pesticide"
          ],
          "name_orgs": [
            {
              "uuid": "4808c3e0-d355-42f1-96f6-ff4e463fee8d",
              "name_org": "ISO"
            }
          ]
        },
        {
          "uuid": "a40632af-aa02-4fc7-8964-25309991dc6c",
          "name": "PULSAR",
          "stdName": "PULSAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "075594cf-3a9c-4ced-bb75-ba8ec2902359"
          ],
          "display_name": false
        },
        {
          "uuid": "a18b8d53-113d-4e10-9b1f-ce1e57fe0643",
          "name": "RAPTOR",
          "stdName": "RAPTOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0a0a0a4-28d1-457f-aa89-fc61f2528b8c"
          ],
          "display_name": false
        },
        {
          "uuid": "94a7f0ea-dfb8-46c5-83e9-89b9cbda7153",
          "name": "RAPTOR [HSDB]",
          "stdName": "RAPTOR [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "075594cf-3a9c-4ced-bb75-ba8ec2902359"
          ],
          "display_name": false
        },
        {
          "uuid": "3640c2e1-d5a7-4c64-9a24-8b920f1c4784",
          "name": "SWEEPER 70DG",
          "stdName": "SWEEPER 70DG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d106faf-94ea-4d3d-95e6-0c4b09c6be57"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "11606278-6702-4fa9-8ac7-b472ba79f685",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "075594cf-3a9c-4ced-bb75-ba8ec2902359",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d106faf-94ea-4d3d-95e6-0c4b09c6be57",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0a0a0a4-28d1-457f-aa89-fc61f2528b8c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e207eb3b-2fa0-46bf-8f81-fa4e1f870a74",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392229000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24a93686-428b-4a11-b0bb-70bed7a409e3",
          "citation": "SRS import [UG6793ON5F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UG6793ON5F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392229000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77f54fa5-3295-45f9-bd98-7b16718085e7",
          "citation": "IMAZAMOX [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "143147d5-db72-4bcb-aefa-241b5b888e89",
          "citation": "IMAZAMOX [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1700989-8c3d-ace3-4b27-388908d3af9b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+114311-32-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c97925ae-f159-686c-c21a-3b9c6d19ebe1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=114311-32-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8b0a1cf-b399-60d4-e70b-d73ce34b75fd",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "02b73f2d-ddc4-4de4-bec6-e6163c89b2f7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8ccdd396-6fc6-4f7f-936c-6f2ccc4c6047",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "909c830f-c5aa-4991-9b23-d38613bfc1dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c9b1921e-fff0-4250-a542-5b491efaa369",
          "id": "c9b1921e-fff0-4250-a542-5b491efaa369",
          "molfile": "\n  Marvin  01132110252D          \n\n 22 23  0  0  0  0            999 V2000\n   -3.8138   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0994   -6.7558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3849   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6704   -6.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6704   -7.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9560   -7.9933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2415   -7.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -7.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5592   -8.8137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3662   -8.9853    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.1199   -9.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1113   -9.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3043   -9.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6633  -10.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7787   -8.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5992   -8.1846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2267   -7.6577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2415   -6.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9560   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1875   -6.7558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -5.5183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 19  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 18  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n 17  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  END",
          "smiles": "CC(C)C1(C)C(=O)NC(=N1)c2c(cc(cn2)COC)C(=O)O",
          "formula": "C15H19N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b7a70a05-d7f1-4228-a079-2f91f04cf1b2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "305.3296",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f1042cac-6540-487c-a40d-29e1e7dc6517",
      "version": "11",
      "structure": {
        "id": "33af2812-415d-45c8-8d89-3aa986bd14c6",
        "molfile": "\n  Marvin  01132102462D          \n\n 22 23  0  0  0  0            999 V2000\n   -0.2415   -7.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9560   -7.9933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6704   -7.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6704   -6.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9560   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2415   -6.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7787   -8.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2267   -7.6577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -7.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5592   -8.8137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3662   -8.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1199   -9.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1113   -9.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3043   -9.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6633  -10.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3849   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0994   -6.7558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1875   -6.7558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5992   -8.1846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -5.5183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8138   -6.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 11  7  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11 12  1  0  0  0  0\n  6  1  1  0  0  0  0\n 11 13  1  0  0  0  0\n  7  8  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 15  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  6 16  1  0  0  0  0\n  4 17  1  0  0  0  0\n  4  5  1  0  0  0  0\n 17 18  1  0  0  0  0\n  2  3  1  0  0  0  0\n 16 19  1  0  0  0  0\n  8  9  2  0  0  0  0\n  7 20  2  0  0  0  0\n  9 10  1  0  0  0  0\n 16 21  2  0  0  0  0\n 10 11  1  0  0  0  0\n 18 22  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C1(C)C(=O)N=C(c2c(cc(cn2)COC)C(=O)O)N1",
        "formula": "C15H19N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "305.3296",
        "optical_activity": "( + / - )",
        "references": [
          "24a93686-428b-4a11-b0bb-70bed7a409e3",
          "075594cf-3a9c-4ced-bb75-ba8ec2902359"
        ],
        "stereo_centers": 1
      },
      "unii": "UG6793ON5F"
    }
  ]
}