{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6b7bc987-1e44-4edd-932c-e31b5f087df7",
          "code": "950-35-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=950-35-6",
          "code_system": "CAS",
          "references": [
            "89288729-9933-4605-be33-3e458de8d84c",
            "cb1a5403-facb-4955-881c-6b36e45db27e"
          ]
        },
        {
          "uuid": "e3ca5a42-ff59-4b92-ab27-27435579d272",
          "code": "C008480",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008480",
          "code_system": "MESH",
          "references": [
            "89288729-9933-4605-be33-3e458de8d84c"
          ]
        },
        {
          "uuid": "7fd96e66-c90a-4515-ad3a-45bc6b77d206",
          "code": "53502",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3348",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "89288729-9933-4605-be33-3e458de8d84c"
          ]
        },
        {
          "uuid": "68780fd7-2c54-42f6-a86e-19738a9d4682",
          "code": "1793922",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1793922/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "89288729-9933-4605-be33-3e458de8d84c"
          ]
        },
        {
          "uuid": "c06944fe-03dc-4683-ad02-ca8ac157fea6",
          "code": "13708",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13708",
          "code_system": "PUBCHEM",
          "references": [
            "89288729-9933-4605-be33-3e458de8d84c"
          ]
        },
        {
          "uuid": "8d3a660f-779d-2e0b-c772-97453602b36c",
          "code": "DTXSID5037571",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5037571",
          "code_system": "EPA CompTox",
          "references": [
            "7444a637-7619-bba7-3a0f-2e4df1197030"
          ]
        },
        {
          "uuid": "c17bf71e-ed4f-4365-a53b-d5d4dbab0eb3",
          "code": "UE1A2XL95H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e6a29707-1f18-d0f3-851a-a2c042600181",
          "code": "UE1A2XL95H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=UE1A2XL95H",
          "code_system": "DAILYMED",
          "references": [
            "44c3b288-e4fa-11d5-b9e6-47dd5df5818f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "682eedfe-2aa6-4712-8b7d-1018e6b8e49f",
          "name": "DIMETHYL PARAOXON",
          "stdName": "DIMETHYL PARAOXON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a43fa1-8840-43f5-96f1-12fd35ba45e2",
            "f1bb603b-0187-444b-a28a-c976e16abef8"
          ],
          "display_name": false
        },
        {
          "uuid": "9562b5e5-0ed5-476c-9efe-8aca28759fee",
          "name": "METHYL PARAOXON",
          "stdName": "METHYL PARAOXON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4648178-ae09-44d3-a2b2-e5d8d3564c6f"
          ],
          "display_name": true
        },
        {
          "uuid": "93db2fc0-c77d-46cd-8076-deaddbb59c53",
          "name": "METHYLPARAOXON",
          "stdName": "METHYLPARAOXON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a43fa1-8840-43f5-96f1-12fd35ba45e2",
            "8033a689-d25a-4714-a05c-2a148eec9030"
          ],
          "display_name": false
        },
        {
          "uuid": "8d5de2ad-0a5f-4f9d-bd18-1bd42c144888",
          "name": "PARATHION-METHYL OXYGEN ANALOG",
          "stdName": "PARATHION-METHYL OXYGEN ANALOG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a43fa1-8840-43f5-96f1-12fd35ba45e2",
            "ac14a4b3-cf11-4eec-b265-789f64478b2c"
          ],
          "display_name": false
        },
        {
          "uuid": "79a723d3-0bdb-42e8-9089-4447f509e99a",
          "name": "PHOSPHORIC ACID, DIMETHYL-4-NITROPHENYL ESTER",
          "stdName": "PHOSPHORIC ACID, DIMETHYL-4-NITROPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a43fa1-8840-43f5-96f1-12fd35ba45e2",
            "f1bb603b-0187-444b-a28a-c976e16abef8"
          ],
          "display_name": false
        },
        {
          "uuid": "9bdd08c1-bb3c-41c6-8e29-d51c9493eb70",
          "name": "PHOSPHORIC ACID, DIMETHYL-P-NITROPHENYL ESTER",
          "stdName": "PHOSPHORIC ACID, DIMETHYL-P-NITROPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a43fa1-8840-43f5-96f1-12fd35ba45e2",
            "f1bb603b-0187-444b-a28a-c976e16abef8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f4648178-ae09-44d3-a2b2-e5d8d3564c6f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f1bb603b-0187-444b-a28a-c976e16abef8",
          "citation": "SAX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53a43fa1-8840-43f5-96f1-12fd35ba45e2",
          "citation": "SAX DANGEROUS PROPERTIES",
          "doc_type": "SAX DANGEROUS PROPERTIES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac14a4b3-cf11-4eec-b265-789f64478b2c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8033a689-d25a-4714-a05c-2a148eec9030",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89288729-9933-4605-be33-3e458de8d84c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391775000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc2020f2-6ef1-4b57-a9c4-91ccd3ee4982",
          "citation": "SRS import [UE1A2XL95H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UE1A2XL95H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391775000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d16ae4d-4244-4b6b-8abd-004a56aae3c8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7444a637-7619-bba7-3a0f-2e4df1197030",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=950-35-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb1a5403-facb-4955-881c-6b36e45db27e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "44c3b288-e4fa-11d5-b9e6-47dd5df5818f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "188ffb7e-0d58-4cad-ae71-617e12be7af9",
          "id": "188ffb7e-0d58-4cad-ae71-617e12be7af9",
          "molfile": "\n  Marvin  01132101282D          \n\n 16 16  0  0  0  0            999 V2000\n    4.1219   -0.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0500   -1.6398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3023   -1.9884    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8898   -1.2740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5545   -2.3371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8787   -1.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -2.7637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4095   -2.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8220   -3.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6470   -3.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0595   -2.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6470   -2.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8220   -2.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8846   -2.7637    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.2971   -3.4783    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.2971   -2.0493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  3  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 14  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  CHG  2  14   1  15  -1\nM  END",
          "smiles": "COP(=O)(OC)Oc1ccc(cc1)[N+](=O)[O-]",
          "formula": "C8H10NO6P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "74b54d9d-73b9-4b3f-854c-1437f035cb69"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "247.1422",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "572348dc-f9c3-4415-93a0-209c1cdf9e0b",
      "version": "4",
      "structure": {
        "id": "bd40da20-1622-4e07-abe9-a6273a5eac61",
        "molfile": "\n  Marvin  01132109472D          \n\n 16 16  0  0  0  0            999 V2000\n    3.3023   -1.9884    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -2.7637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4095   -2.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8220   -3.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6470   -3.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0595   -2.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8846   -2.7637    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.2971   -3.4783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2971   -2.0493    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6470   -2.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8220   -2.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0500   -1.6398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1219   -0.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5545   -2.3371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8787   -1.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8898   -1.2740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11 10  2  0  0  0  0\n  3 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  1 16  2  0  0  0  0\nM  CHG  2   7   1   9  -1\nM  END",
        "smiles": "COP(=O)(OC)Oc1ccc(cc1)[N+](=O)[O-]",
        "formula": "C8H10NO6P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "247.1422",
        "optical_activity": "NONE",
        "references": [
          "8d16ae4d-4244-4b6b-8abd-004a56aae3c8",
          "bc2020f2-6ef1-4b57-a9c4-91ccd3ee4982"
        ],
        "stereo_centers": 0
      },
      "unii": "UE1A2XL95H"
    }
  ]
}