{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6bbde9fe-1081-4ee3-af19-0997b17e66cc", "code": "110300-76-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=110300-76-0", "code_system": "CAS", "references": [ "437019e2-04b6-4dda-a6a0-9593a576cbd6", "d0febb04-2fa2-445b-abd6-8c76a3f27c1c" ] }, { "uuid": "9cd32179-f080-4d79-9bdd-77460ee0d6f8", "code": "130631", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/130631", "code_system": "PUBCHEM", "references": [ "45a79aa6-0cd7-4f7b-9dea-ca3ef903455b" ] }, { "uuid": "2f7e2ade-a2fa-f6fc-70e2-1fead12e3e0f", "code": "DTXSID40149205", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40149205", "code_system": "EPA CompTox" }, { "uuid": "a6d3d885-d624-e819-cd08-30db40330b0c", "code": "Taxamairin A", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Taxamairin_A", "code_system": "WIKIPEDIA", "references": [ "437019e2-04b6-4dda-a6a0-9593a576cbd6" ] }, { "uuid": "08bd6098-4ac5-4b1c-b946-1303643f4b1f", "code": "UD9474U6RM", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "5926f33b-64a0-4386-8b9a-faadd482aff1", "name": "1H-DIBENZO(A,D)CYCLOHEPTENE-2,10-DIONE, 6-HYDROXY-7-METHOXY-1,1-DIMETHYL-8-(1-METHYLETHYL)-", "stdName": "1H-DIBENZO(A,D)CYCLOHEPTENE-2,10-DIONE, 6-HYDROXY-7-METHOXY-1,1-DIMETHYL-8-(1-METHYLETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d0febb04-2fa2-445b-abd6-8c76a3f27c1c" ], "display_name": false }, { "uuid": "d2e84ad1-de80-428c-8444-df887a4aa6c0", "name": "6-HYDROXY-7-METHOXY-1,1-DIMETHYL-8-(1-METHYLETHYL)-1H-DIBENZO(A,D)CYCLOHEPTENE-2,10-DIONE", "stdName": "6-HYDROXY-7-METHOXY-1,1-DIMETHYL-8-(1-METHYLETHYL)-1H-DIBENZO(A,D)CYCLOHEPTENE-2,10-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d0febb04-2fa2-445b-abd6-8c76a3f27c1c" ], "display_name": false }, { "uuid": "75b53229-62bc-4318-8704-28f1c6e26503", "name": "TAXAMAIRIN A", "stdName": "TAXAMAIRIN A", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "437019e2-04b6-4dda-a6a0-9593a576cbd6", "d371a8a2-1aaa-4e48-9e95-bb5d0213e409" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "60ce789e-9ac4-45c2-aa66-aeb5425c6081", "name_org": "INCI" } ] } ], "references": [ { "uuid": "d371a8a2-1aaa-4e48-9e95-bb5d0213e409", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "437019e2-04b6-4dda-a6a0-9593a576cbd6", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "45a79aa6-0cd7-4f7b-9dea-ca3ef903455b", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d0febb04-2fa2-445b-abd6-8c76a3f27c1c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c815fa08-fdfd-4374-8bbb-8c139d4e590f", "id": "c815fa08-fdfd-4374-8bbb-8c139d4e590f", "molfile": "\n Marvin 04032210452D \n\n 25 27 0 0 0 0 999 V2000\n 15.6533 -5.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6533 -4.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3676 -4.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9387 -4.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9387 -3.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2243 -3.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5099 -3.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8648 -3.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0604 -3.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5957 -2.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7731 -2.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4150 -3.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5924 -3.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8798 -4.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7026 -4.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0604 -4.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8648 -4.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0483 -5.7606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5099 -4.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2243 -4.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0325 -4.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3183 -4.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2243 -2.3794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6533 -3.2044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6533 -2.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 20 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 24 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 23 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 19 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 15 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 21 1 0 0 0 0\n 14 22 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CC(C)c1cc2c(cc3C=CC(=O)C(C)(C)c3cc2=O)c(c1OC)O", "formula": "C21H22O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "232cb9ad-3df3-46d1-9fc5-a9f23f451008" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "338.3978", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "fdb0bf4b-d92f-4766-a693-f379f7947656", "version": "12", "structure": { "id": "57cb6c2c-b14f-406e-a40d-85fe590829da", "molfile": "\n JSDraw204032210452D\n\n 25 27 0 0 0 0 0 V2000\n 29.5990 -10.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5990 -9.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9496 -8.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2477 -8.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2477 -6.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8969 -6.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.5460 -6.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3262 -5.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8051 -6.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9264 -4.9249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3710 -5.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6938 -6.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1384 -6.5635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5727 -7.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1286 -7.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8051 -9.0247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3262 -9.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6731 -10.8928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.5460 -8.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8969 -9.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8615 -9.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2510 -8.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8969 -4.4992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5990 -6.0592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5990 -4.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 9 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 7 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 4 20 1 0 0 0 0\n 14 21 1 0 0 0 0\n 14 22 1 0 0 0 0\n 6 23 1 0 0 0 0\n 5 24 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CC(C)c1cc2c(cc3C=CC(=O)C(C)(C)c3cc2=O)c(c1OC)O", "formula": "C21H22O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "338.3978", "optical_activity": "NONE", "references": [ "437019e2-04b6-4dda-a6a0-9593a576cbd6", "d371a8a2-1aaa-4e48-9e95-bb5d0213e409" ], "stereo_centers": 0 }, "unii": "UD9474U6RM" } ] }