{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6ac37e44-7d25-4fe8-8c5d-d41369e71d10",
          "code": "606-04-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=606-04-2",
          "code_system": "CAS",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8",
            "2b505e23-591b-41e7-a4ab-558c703c2984"
          ]
        },
        {
          "uuid": "1a379d37-c71e-4bfb-af44-8e65fa679c24",
          "code": "C81076",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81076",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "458645bb-dd20-427a-a10b-84b08ab9a31a",
          "code": "C069987",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67069987",
          "code_system": "MESH",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "79b3516f-691a-4997-808f-22cc30476625",
          "code": "734",
          "comments": "LiverTox|Cardiac|Diruetic|Xanthine",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Pamabrom.htm",
          "code_system": "LIVERTOX",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "c8ed0050-8782-4a30-833f-5bc6a4107409",
          "code": "21 CFR 310.201",
          "comments": "PART 310 -- NEW DRUGS|Subpart C--New Drugs Exempted From Prescription-Dispensing Requirements|Sec. 310.201 Exemption for certain drugs limited by new-drug applications to prescription sale.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.201",
          "code_system": "CFR",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "51de4c80-bac4-4483-b2e3-ff58403882ac",
          "code": "54365",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/54365/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "f043a8c9-4da9-48bd-8a75-28328cad0988",
          "code": "m8371",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8371?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "bb8e3f0d-ad22-4b7d-b082-d75071d28306",
          "code": "SUB14745MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "db332ca3-d181-49b6-83e1-4acdd6840f0e",
          "code": "CHEMBL316160",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL316160",
          "code_system": "ChEMBL",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "c5fc8cee-c021-4414-889f-da69e14e1520",
          "code": "210-103-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.186",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "fe4f3d04-f31f-4d19-8cae-3dad7aeac383",
          "code": "11806",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11806",
          "code_system": "PUBCHEM",
          "references": [
            "0d1d2843-b74a-4d1e-9919-32f773271fa8"
          ]
        },
        {
          "uuid": "13687b4d-f4d9-c8ce-66c0-6e4eac79cf65",
          "code": "DTXSID80209397",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80209397",
          "code_system": "EPA CompTox",
          "references": [
            "3c691a07-b09e-4071-1746-b4e90f97c18e"
          ]
        },
        {
          "uuid": "bee20f77-58a1-a9a7-6690-4822dfc3183b",
          "code": "C448",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C448",
          "code_system": "NCI_THESAURUS",
          "references": [
            "04cc631a-94a5-a063-fda8-15fd7469933d"
          ]
        },
        {
          "uuid": "d2496fdd-329e-a827-4b51-b208533d83aa",
          "code": "2047",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2047",
          "code_system": "DRUG CENTRAL",
          "references": [
            "04cc631a-94a5-a063-fda8-15fd7469933d"
          ]
        },
        {
          "uuid": "52100c42-b74d-f88a-5027-2cc841e7b2ef",
          "code": "DBSALT002688",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002688",
          "code_system": "DRUG BANK",
          "references": [
            "04cc631a-94a5-a063-fda8-15fd7469933d"
          ]
        },
        {
          "uuid": "66d85858-f1e4-4bbf-8817-b765d88aa3bd",
          "code": "UA8U0KJM72",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b2a5e663-474c-2edf-9974-a1b6b5b9cb93",
          "code": "Pamabrom",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pamabrom",
          "code_system": "WIKIPEDIA",
          "references": [
            "62b8550f-3d76-2651-5652-c6f5891c7b08"
          ]
        },
        {
          "uuid": "c524a400-2683-7238-0f22-1e082f81d4cd",
          "code": "UA8U0KJM72",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=UA8U0KJM72",
          "code_system": "DAILYMED",
          "references": [
            "2d38661e-a141-9b8a-a267-be64d53f8882"
          ]
        },
        {
          "uuid": "84d37c86-a92f-2c48-7a6e-f2c937f0928f",
          "code": "100000079715",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d9b7d4d5-6295-72cc-1b28-10e78577d093"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f093c200-b5a5-49cf-9622-451332b3bf11",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ccc6bf77-045a-4f26-b741-f407e5ea2a1b",
            "refuuid": "17587650-7791-4c61-956c-b727b2c4e165",
            "name": "BROMOTHEOPHYLLINE",
            "unii": "FZG87K1MQ6",
            "linking_id": "FZG87K1MQ6",
            "ref_pname": "BROMOTHEOPHYLLINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f87c03b9-ec0e-4006-bb00-e4a4e14b66d5",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "91e5a71c-87af-4bad-a132-50dd3c10e701",
            "refuuid": "dc42eeb9-0037-469a-9513-9276756e1560",
            "name": "AMINOMETHYLPROPANOL",
            "unii": "LU49E6626Q",
            "linking_id": "LU49E6626Q",
            "ref_pname": "AMINOMETHYLPROPANOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "770271b4-f7a8-454b-9bd3-384cc8aea882",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "18970ffd-3af6-47ff-8613-af0ae6552df1",
            "refuuid": "17587650-7791-4c61-956c-b727b2c4e165",
            "name": "BROMOTHEOPHYLLINE",
            "unii": "FZG87K1MQ6",
            "linking_id": "FZG87K1MQ6",
            "ref_pname": "BROMOTHEOPHYLLINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ba844a4-ebc9-41a2-a907-c3f19033abdb",
          "name": "2-AMINO-2-METHYLPROPANOL-1-8-BROMOTHEOPHYLLINATE",
          "stdName": "2-AMINO-2-METHYLPROPANOL-1-8-BROMOTHEOPHYLLINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9a4617-9af5-4d56-ab64-e314f5ce2aac",
            "9916a8b4-a0ac-4b7e-af14-73517fc84772"
          ],
          "display_name": false
        },
        {
          "uuid": "c6b6d656-1db9-4eeb-a632-d93ee135a8f3",
          "name": "8-BROMO-3,7-DIHYDRO-1,3-DIMETHYL-1H-PURINE-2,6-DIONE COMPOUND WITH 2-AMINO-2-METHYL-1-PROPANOL (1:1)",
          "stdName": "8-BROMO-3,7-DIHYDRO-1,3-DIMETHYL-1H-PURINE-2,6-DIONE COMPOUND WITH 2-AMINO-2-METHYL-1-PROPANOL (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0004a17c-7763-4bb2-87c0-127dfb316329"
          ],
          "display_name": false
        },
        {
          "uuid": "c2ad39cb-4db2-407e-ba4e-f546e1ab0a14",
          "name": "8-Bromotheophylline compound with 2-amino-2-methyl-1-propanol (1:1)",
          "stdName": "8-BROMOTHEOPHYLLINE COMPOUND WITH 2-AMINO-2-METHYL-1-PROPANOL (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed497bf7-9e0b-456c-a3e2-2407129f390b"
          ],
          "display_name": false
        },
        {
          "uuid": "ca748348-c791-4221-b6d7-5bec70d4e3e3",
          "name": "PAMABROM",
          "stdName": "PAMABROM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cfce889f-36c7-4c7f-af10-75e52ff571a6",
            "647ef3f8-7172-4ffc-9d55-93fca9da8ee2",
            "763a3725-de67-4aba-8cea-4375c8315e47",
            "0c15af97-128d-4a52-a330-3359ecb98167",
            "93aefd07-0a0d-47fa-b80b-e249af468648",
            "1219ec11-759c-459f-89e5-836cd098cd43",
            "10006cfa-2a25-426e-9122-ecfe5bab26b3",
            "be6aa782-72bf-43b7-9f71-ced6579bd1fc",
            "7151f429-e1ab-4275-85d3-0a866eb6b20f",
            "fea58c71-6641-4c17-b431-1a8d0b4e2e6f",
            "ffbf9258-3efa-436f-8c09-514d9eb2b16a",
            "a65c14e3-ebcd-4559-9319-008f6845da37",
            "969dd3dd-45bc-408a-9510-bc92c5b9c140"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1829772b-da2b-4e56-92b8-bfaab5554fd1",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "fe4e956f-6a37-4b1d-af77-b3e0231a6b84",
          "name": "PAMABROM [MART.]",
          "stdName": "PAMABROM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fea58c71-6641-4c17-b431-1a8d0b4e2e6f"
          ],
          "display_name": false
        },
        {
          "uuid": "aef1e473-fd17-468d-bf80-ff8ab8a6e1e0",
          "name": "PAMABROM [MI]",
          "stdName": "PAMABROM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a65c14e3-ebcd-4559-9319-008f6845da37"
          ],
          "display_name": false
        },
        {
          "uuid": "634d2b4b-cab6-478d-968f-6993c39e06f1",
          "name": "PAMABROM [USAN]",
          "stdName": "PAMABROM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "647ef3f8-7172-4ffc-9d55-93fca9da8ee2"
          ],
          "display_name": false
        },
        {
          "uuid": "bd9b95dc-f0dc-78b9-f636-060fee14c8c2",
          "name": "PAMABROM [USP MONOGRAPH]",
          "stdName": "PAMABROM [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "019f5696-9114-8d09-b892-102b93a56bf0"
          ],
          "display_name": false
        },
        {
          "uuid": "4e437f55-69b1-4512-a529-fe8cae13cc0f",
          "name": "PAMABROM [VANDF]",
          "stdName": "PAMABROM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffbf9258-3efa-436f-8c09-514d9eb2b16a"
          ],
          "display_name": false
        },
        {
          "uuid": "83490317-4de4-8106-0f41-a45a28abe6a5",
          "name": "Pamabrom [WHO-DD]",
          "stdName": "PAMABROM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046765b2-fe9a-0e18-df73-4a9710b31332"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "93aefd07-0a0d-47fa-b80b-e249af468648",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0004a17c-7763-4bb2-87c0-127dfb316329",
          "citation": "usp dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed497bf7-9e0b-456c-a3e2-2407129f390b",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "647ef3f8-7172-4ffc-9d55-93fca9da8ee2",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1219ec11-759c-459f-89e5-836cd098cd43",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fea58c71-6641-4c17-b431-1a8d0b4e2e6f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a65c14e3-ebcd-4559-9319-008f6845da37",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c15af97-128d-4a52-a330-3359ecb98167",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffbf9258-3efa-436f-8c09-514d9eb2b16a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9916a8b4-a0ac-4b7e-af14-73517fc84772",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b9a4617-9af5-4d56-ab64-e314f5ce2aac",
          "citation": "CFR",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d1d2843-b74a-4d1e-9919-32f773271fa8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a6b71bf-1c08-4d2b-ba66-18edf5f7d7f9",
          "citation": "SRS import [UA8U0KJM72]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UA8U0KJM72",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10006cfa-2a25-426e-9122-ecfe5bab26b3",
          "citation": "PAMABROM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7151f429-e1ab-4275-85d3-0a866eb6b20f",
          "citation": "PAMABROM [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "969dd3dd-45bc-408a-9510-bc92c5b9c140",
          "citation": "PAMABROM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "763a3725-de67-4aba-8cea-4375c8315e47",
          "citation": "PAMABROM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfce889f-36c7-4c7f-af10-75e52ff571a6",
          "citation": "PAMABROM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be6aa782-72bf-43b7-9f71-ced6579bd1fc",
          "citation": "PAMABROM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c691a07-b09e-4071-1746-b4e90f97c18e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=606-04-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04cc631a-94a5-a063-fda8-15fd7469933d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "62b8550f-3d76-2651-5652-c6f5891c7b08",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "019f5696-9114-8d09-b892-102b93a56bf0",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "2b505e23-591b-41e7-a4ab-558c703c2984",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "046765b2-fe9a-0e18-df73-4a9710b31332",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2d38661e-a141-9b8a-a267-be64d53f8882",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d9b7d4d5-6295-72cc-1b28-10e78577d093",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "93aec9c2-cf6b-4be8-be07-fce7439d916a",
          "id": "93aec9c2-cf6b-4be8-be07-fce7439d916a",
          "molfile": "\n  Marvin  01132107392D          \n\n  6  5  0  0  0  0            999 V2000\n    3.2206   -2.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6967   -2.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2509   -2.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3601   -1.5843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0567   -1.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2919   -1.9199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(CO)N",
          "formula": "C4H11NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eb6fa76d-0870-43f4-9f81-8f2e8641e7a2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "89.1364",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "269bdb40-abba-4c6c-8123-98a4f650ca4a",
          "id": "269bdb40-abba-4c6c-8123-98a4f650ca4a",
          "molfile": "\n  Marvin  01132102082D          \n\n 14 15  0  0  0  0            999 V2000\n   -1.8987   -3.6898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8987   -2.8636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1826   -2.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4040   -2.7429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0787   -2.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9019   -2.0823    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3961   -1.4133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1800   -1.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8987   -1.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8987   -0.4249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5986   -1.6599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2911   -1.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5986   -2.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3120   -2.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  2  0  0  0  0\nM  END",
          "smiles": "Cn1c2c(c(=O)n(C)c1=O)[nH]c(Br)n2",
          "formula": "C7H7BrN4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e954ff71-34a9-4c80-adfc-2f7a3c7cd318"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "259.0599",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b882ec9c-a7eb-40da-b7ca-4cb3dcca9da5",
      "version": "13",
      "structure": {
        "id": "6d0a4501-f440-41b7-acc9-f85487e2263f",
        "molfile": "\n  Marvin  01132105402D          \n\n 20 20  0  0  0  0            999 V2000\n   -1.1812   -2.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1786   -1.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8962   -2.8600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5955   -1.6578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5955   -2.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8962   -1.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4034   -2.7395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3955   -1.4116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0786   -2.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3078   -2.8914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8962   -0.4243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8962   -3.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9009   -2.0795    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2869   -1.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7216   -2.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3895   -1.5950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3073   -1.9328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0773   -1.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2423   -2.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2795   -2.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 11  6  2  0  0  0  0\n 12  3  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  4  1  0  0  0  0\n  9  8  2  0  0  0  0\n  6  4  1  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  5  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 15  1  0  0  0  0\nM  END",
        "smiles": "Cn1c2c(c(=O)n(C)c1=O)nc(Br)[nH]2.CC(C)(CO)N",
        "formula": "C7H7BrN4O2.C4H11NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "348.1963",
        "optical_activity": "NONE",
        "references": [
          "93aefd07-0a0d-47fa-b80b-e249af468648",
          "5a6b71bf-1c08-4d2b-ba66-18edf5f7d7f9"
        ],
        "stereo_centers": 0
      },
      "unii": "UA8U0KJM72"
    }
  ]
}