{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "df58b930-c805-4794-aa1c-560def32097f", "code": "59354-71-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=59354-71-1", "code_system": "CAS", "references": [ "561eb572-64b5-4e69-85a1-3b1fd4f1bbbf", "fb1b7af0-625b-4c91-9958-6a3a25d979e8" ] }, { "uuid": "2bc9182b-3169-4399-b7e2-b0c8b6df07f3", "code": "261-715-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.087", "code_system": "ECHA (EC/EINECS)", "references": [ "561eb572-64b5-4e69-85a1-3b1fd4f1bbbf" ] }, { "uuid": "51758a60-c11c-4f3d-8a40-ce8001bb8c56", "code": "101023", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101023", "code_system": "PUBCHEM", "references": [ "561eb572-64b5-4e69-85a1-3b1fd4f1bbbf" ] }, { "uuid": "540c8209-c770-f9d5-dba6-44cdec69a05e", "code": "DTXSID1069324", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1069324", "code_system": "EPA CompTox", "references": [ "cfb36c8d-162d-a110-f2d9-9b18a4f2e9f1" ] }, { "uuid": "d3bb2644-619d-48f7-a0bb-ad7f2b793473", "code": "U9H3BC99JB", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b57e1074-938b-4027-9852-9be6a674b6c2", "name": "1,1-Dimethyl-2-phenylethyl 2-methylpropanoate", "stdName": "1,1-DIMETHYL-2-PHENYLETHYL 2-METHYLPROPANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fb1b7af0-625b-4c91-9958-6a3a25d979e8" ], "display_name": true }, { "uuid": "bf33ae20-c005-40ca-9f09-011bc1ce8cf2", "name": "Propanoic acid, 2-methyl-, 1,1-dimethyl-2-phenylethyl ester", "stdName": "PROPANOIC ACID, 2-METHYL-, 1,1-DIMETHYL-2-PHENYLETHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bd8c9896-ecac-45a4-ac82-af3c05190e81" ], "display_name": false } ], "references": [ { "uuid": "bd8c9896-ecac-45a4-ac82-af3c05190e81", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "561eb572-64b5-4e69-85a1-3b1fd4f1bbbf", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392530000, "tags": [ "NOMEN" ] }, { "uuid": "cfb36c8d-162d-a110-f2d9-9b18a4f2e9f1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59354-71-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fb1b7af0-625b-4c91-9958-6a3a25d979e8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ae40e4c6-a21c-472e-9dda-85d0131db4e9", "id": "ae40e4c6-a21c-472e-9dda-85d0131db4e9", "molfile": "\n Marvin 07252317352D \n\n 16 16 0 0 0 0 999 V2000\n 13.8036 -5.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0892 -5.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0892 -6.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3748 -5.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6603 -5.9262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3748 -4.6887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6603 -4.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0728 -3.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2478 -4.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9458 -3.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9458 -3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6603 -2.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6603 -1.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9458 -1.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2314 -1.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2314 -2.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 16 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\nM END", "smiles": "CC(C)C(=O)OC(C)(C)Cc1ccccc1", "formula": "C14H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c1941558-114e-41ad-9517-6b4e0039788e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.3079", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5efb2442-57db-4981-9df8-ffa003eb5a2a", "version": "6", "structure": { "id": "4528d7f1-5edd-4080-b217-1065a58b852f", "molfile": "\n JSDraw207252317352D\n\n 16 16 0 0 0 0 0 V2000\n 26.1014 -10.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7504 -11.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7504 -12.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3996 -10.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0486 -11.2059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3996 -8.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0486 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8286 -6.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2686 -9.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6976 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6976 -5.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0486 -4.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0486 -3.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6976 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3466 -3.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3466 -4.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 11 16 1 0 0 0 0\nM END", "smiles": "CC(C)C(=O)OC(C)(C)Cc1ccccc1", "formula": "C14H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.3079", "optical_activity": "NONE", "references": [ "bd8c9896-ecac-45a4-ac82-af3c05190e81" ], "stereo_centers": 0 }, "unii": "U9H3BC99JB" } ] }