{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d0a87af4-5960-4a1a-b8cb-d6564439b2e5", "code": "4196-86-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4196-86-5", "code_system": "CAS", "references": [ "c6a72a8b-83a9-4eb3-a6f4-4087e117346b", "56264225-da63-42ee-9114-3a33f9d36940" ] }, { "uuid": "b4c2b167-cbf6-4112-9590-1abd575ea255", "code": "224-079-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.891", "code_system": "ECHA (EC/EINECS)", "references": [ "c6a72a8b-83a9-4eb3-a6f4-4087e117346b" ] }, { "uuid": "48583da9-6fab-40b0-863b-a6e069e867c4", "code": "20167", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20167", "code_system": "PUBCHEM", "references": [ "c6a72a8b-83a9-4eb3-a6f4-4087e117346b" ] }, { "uuid": "ef5abf3c-ad73-2e6d-a760-c0e7560c0068", "code": "DTXSID8024608", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024608", "code_system": "EPA CompTox", "references": [ "1be0da1f-5e63-967c-d9e2-5694d527b1d8" ] }, { "uuid": "4e0c65ba-333c-49a5-b57f-c815618a26a1", "code": "U7L44GIS4O", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9b8913af-a38b-962b-599e-c984f31f2480", "code": "166502", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=166502", "code_system": "NSC", "references": [ "ec6eaacf-8b72-3f79-9f55-546ba9b61643" ] }, { "uuid": "14932a34-3db6-4c69-a26e-a0cdde20ca5f", "code": "39449-02-0", "type": "GENERIC (FAMILY)", "url": "https://commonchemistry.cas.org/detail?cas_rn=39449-02-0", "code_system": "CAS", "references": [ "56264225-da63-42ee-9114-3a33f9d36940" ] }, { "uuid": "9d1ef7c0-f95d-4006-b48a-c3adcd34033e", "code": "1579279-32-5", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=1579279-32-5", "code_system": "CAS", "references": [ "56264225-da63-42ee-9114-3a33f9d36940" ] } ], "substance_class": "chemical", "names": [ { "uuid": "4d9814e8-056f-4849-9964-a23360162eac", "name": "2,2-bis[(Benzoyloxy)methyl]-1,3-propanediol dibenzoate", "stdName": "2,2-BIS((BENZOYLOXY)METHYL)-1,3-PROPANEDIOL DIBENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e4e84833-68fb-4a7d-bab9-a019472244ae", "376e82ed-3410-4508-b510-6a758e7bd681" ], "display_name": false }, { "uuid": "b247d166-b606-4ed5-8ea9-9ae346c16373", "name": "BIS((BENZOYLOXY)METHYL)-1,3-PROPANEDIOL DIBENZOATE, 2,2-", "stdName": "BIS((BENZOYLOXY)METHYL)-1,3-PROPANEDIOL DIBENZOATE, 2,2-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b1376971-d2c8-4b48-9417-5ad766521ee7" ], "display_name": false }, { "uuid": "1076335c-095f-4607-af89-700f49d75f37", "name": "NSC-166502", "stdName": "NSC-166502", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2cbf116f-2c0b-4ed8-b3c5-cfe5edefac43", "e4e84833-68fb-4a7d-bab9-a019472244ae" ], "display_name": false }, { "uuid": "14f72d4f-054a-4973-b496-7bc9d6411027", "name": "Pentaerythritol Tetrabenzoate", "stdName": "PENTAERYTHRITOL TETRABENZOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e4e84833-68fb-4a7d-bab9-a019472244ae", "2f7056e6-046b-489e-96db-9695cb4aa13a", "595fd30b-f09d-4da5-bb45-93513f00f193", "cb4cc06c-f0c3-4565-a3ff-6880c70ca94c" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4cd269a1-41b5-4530-90eb-7117ffaefd2f", "name_org": "INCI" } ] }, { "uuid": "a29089be-9aa0-496b-a35e-8004d94fd167", "name": "UNIPLEX 552", "stdName": "UNIPLEX 552", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e4e84833-68fb-4a7d-bab9-a019472244ae", "2f7056e6-046b-489e-96db-9695cb4aa13a" ], "display_name": false } ], "references": [ { "uuid": "b1376971-d2c8-4b48-9417-5ad766521ee7", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "595fd30b-f09d-4da5-bb45-93513f00f193", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e4e84833-68fb-4a7d-bab9-a019472244ae", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2f7056e6-046b-489e-96db-9695cb4aa13a", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "376e82ed-3410-4508-b510-6a758e7bd681", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a7558743-f31d-49f1-8a79-ec09cd32b613", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2cbf116f-2c0b-4ed8-b3c5-cfe5edefac43", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c6a72a8b-83a9-4eb3-a6f4-4087e117346b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390938000, "tags": [ "NOMEN" ] }, { "uuid": "f458f1ef-bf87-4be8-bbcd-4953465a0e2b", "citation": "SRS import [U7L44GIS4O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U7L44GIS4O", "doc_type": "SRS", "public_domain": true, "document_date": 1493390938000, "tags": [ "NOMEN" ] }, { "uuid": "8c93aaa2-8b28-42b3-bbc6-08d81b713a27", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cb4cc06c-f0c3-4565-a3ff-6880c70ca94c", "citation": "PENTAERYTHRITYL TETRABENZOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1be0da1f-5e63-967c-d9e2-5694d527b1d8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4196-86-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ec6eaacf-8b72-3f79-9f55-546ba9b61643", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "56264225-da63-42ee-9114-3a33f9d36940", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fbf195cd-456c-45e9-aa01-0eecd45a1a3d", "id": "fbf195cd-456c-45e9-aa01-0eecd45a1a3d", "molfile": "\n Marvin 01132113032D \n\n 41 44 0 0 0 0 999 V2000\n 4.6611 -5.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0541 -6.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8870 -6.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2845 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9157 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3281 -4.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1649 -4.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5502 -5.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5502 -4.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3752 -4.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7726 -3.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3752 -2.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5502 -2.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1649 -3.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -4.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -4.2617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -3.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5674 -3.0241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -3.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3959 -3.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6830 -3.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6830 -2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3959 -1.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -6.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -6.6827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -7.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0860 -7.9359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5172 -7.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5172 -8.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2222 -9.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9476 -8.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9476 -7.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2222 -7.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6611 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0541 -7.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6611 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8361 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4425 -7.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8361 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 2 36 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 16 1 0 0 0 0\n 5 26 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 25 2 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 35 2 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 41 2 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 40 39 2 0 0 0 0\n 41 40 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C(=O)OCC(COC(=O)c2ccccc2)(COC(=O)c3ccccc3)COC(=O)c4ccccc4", "formula": "C33H28O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5874eaf0-5ced-4eeb-8f9f-365752ce0bd6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "552.5719", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "87a45081-8280-45b1-8266-5382860c2ee7", "version": "8", "structure": { "id": "7931521c-c298-4e6b-b7e6-3a81896e2b8a", "molfile": "\n Marvin 01132106182D \n\n 41 44 0 0 0 0 999 V2000\n 7.1095 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2845 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8870 -6.1705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0541 -6.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6611 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0541 -7.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6611 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8361 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4425 -7.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8361 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6611 -5.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9157 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3281 -4.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1649 -4.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5502 -4.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3752 -4.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7726 -3.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3752 -2.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5502 -2.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1649 -3.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5502 -5.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -4.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -4.2617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -3.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -3.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3959 -3.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6830 -3.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6830 -2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3959 -1.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -2.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5674 -3.0241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1095 -6.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -6.6827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7957 -7.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5172 -7.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5172 -8.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2222 -9.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9476 -8.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9476 -7.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2222 -7.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0860 -7.9359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 4 11 2 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 15 20 2 0 0 0 0\n 14 21 2 0 0 0 0\n 1 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 2 0 0 0 0\n 25 30 1 0 0 0 0\n 24 31 2 0 0 0 0\n 1 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 2 0 0 0 0\n 37 38 1 0 0 0 0\n 39 38 2 0 0 0 0\n 40 39 1 0 0 0 0\n 35 40 2 0 0 0 0\n 34 41 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C(=O)OCC(COC(=O)c2ccccc2)(COC(=O)c3ccccc3)COC(=O)c4ccccc4", "formula": "C33H28O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "552.5719", "optical_activity": "NONE", "references": [ "8c93aaa2-8b28-42b3-bbc6-08d81b713a27", "f458f1ef-bf87-4be8-bbcd-4953465a0e2b" ], "stereo_centers": 0 }, "modifications": { "uuid": "71ba02e1-2a6e-458b-901e-2bc19c410e1c" }, "unii": "U7L44GIS4O" } ] }