{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "59384133-b114-4336-8185-bc6cb1277890",
          "code": "76738-75-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76738-75-5",
          "code_system": "CAS",
          "references": [
            "6125c640-242f-4611-a085-15e76883fd7f",
            "252de35c-4b14-465f-81e3-24e0eb191f87"
          ]
        },
        {
          "uuid": "d536c830-ddc4-423c-ad60-a8865bcfd682",
          "code": "m2515",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2515?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6125c640-242f-4611-a085-15e76883fd7f"
          ]
        },
        {
          "uuid": "be424cb8-5fd1-444e-820b-9071a2eac23b",
          "code": "1201551",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1201551",
          "code_system": "PUBCHEM",
          "references": [
            "6125c640-242f-4611-a085-15e76883fd7f"
          ]
        },
        {
          "uuid": "4495dba5-5707-4666-ad70-2154dd0f43d1",
          "code": "U799YDE8BR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d1afa2a6-7de0-4372-94dd-5ff1405bd90d",
          "name": "(+)-ANYMOL",
          "stdName": "(+)-ANYMOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41828aab-1427-40ae-af06-8d37b7f97e69",
            "258b5b75-820a-40db-8fd9-2711bbb25abf"
          ],
          "display_name": false
        },
        {
          "uuid": "94065808-6c7a-4660-b487-7141626c9af1",
          "name": "(+)-EPI-.ALPHA.-BISABOLOL",
          "stdName": "(+)-EPI-.ALPHA.-BISABOLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41828aab-1427-40ae-af06-8d37b7f97e69",
            "99a22aa8-6350-4a73-a432-114f502c9965",
            "258b5b75-820a-40db-8fd9-2711bbb25abf",
            "6cb93445-c43a-4e75-b647-ea6d02281bd4"
          ],
          "display_name": false
        },
        {
          "uuid": "07a599f6-c5a5-4730-a443-048fd5045da0",
          "name": "(+)-EPI-.ALPHA.-BISABOLOL [MI]",
          "stdName": "(+)-EPI-.ALPHA.-BISABOLOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41828aab-1427-40ae-af06-8d37b7f97e69",
            "6cb93445-c43a-4e75-b647-ea6d02281bd4"
          ],
          "display_name": false
        },
        {
          "uuid": "6b3a5a60-e8d8-4eca-9aa7-885252e0da9b",
          "name": ".ALPHA.-BISABOLOL, (+)-EPI-",
          "stdName": ".ALPHA.-BISABOLOL, (+)-EPI-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41828aab-1427-40ae-af06-8d37b7f97e69",
            "31aaf1ad-373b-4916-90a4-64ec55d93577"
          ],
          "display_name": true
        },
        {
          "uuid": "6e3c4599-7cc3-4993-a63d-a2851bc40fb2",
          "name": "3-CYCLOHEXENE-1-METHANOL, .ALPHA.,4-DIMETHYL-.ALPHA.-(4-METHYL-3-PENTEN-1-YL)-, (.ALPHA.S,1R)-",
          "stdName": "3-CYCLOHEXENE-1-METHANOL, .ALPHA.,4-DIMETHYL-.ALPHA.-(4-METHYL-3-PENTEN-1-YL)-, (.ALPHA.S,1R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41828aab-1427-40ae-af06-8d37b7f97e69",
            "258b5b75-820a-40db-8fd9-2711bbb25abf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "31aaf1ad-373b-4916-90a4-64ec55d93577",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "41828aab-1427-40ae-af06-8d37b7f97e69",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cb93445-c43a-4e75-b647-ea6d02281bd4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "258b5b75-820a-40db-8fd9-2711bbb25abf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6125c640-242f-4611-a085-15e76883fd7f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53b4d5c8-b768-4c40-b36c-b605c1651e15",
          "citation": "SRS import [U799YDE8BR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U799YDE8BR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99a22aa8-6350-4a73-a432-114f502c9965",
          "citation": "(+)-EPI-.ALPHA.-BISABOLOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "252de35c-4b14-465f-81e3-24e0eb191f87",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "18f9b46e-ff02-419d-ac1c-9c79f2df9025",
          "id": "18f9b46e-ff02-419d-ac1c-9c79f2df9025",
          "molfile": "\n  Marvin  01132101292D          \n\n 16 16  0  0  1  0            999 V2000\n    7.2442   -4.6507    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.5316   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8114   -4.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8114   -3.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0950   -3.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5240   -3.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2442   -3.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5299   -5.4246    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.7560   -5.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3904   -6.2377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3431   -5.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6288   -6.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4419   -6.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7277   -7.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2003   -7.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5408   -7.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  6  0  0  0\n  1  8  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  6  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC[C@@](C)([C@H]1CC=C(C)CC1)O)C",
          "formula": "C15H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "be83ac07-89e6-4b60-88a1-504393f789f5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "222.3669",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "851a4869-98ff-46c7-be34-42de0398133e",
      "version": "2",
      "structure": {
        "id": "e18a9f6c-3b7c-4355-8c6f-2cee11462433",
        "molfile": "\n  Marvin  01132111412D          \n\n 17 17  0  0  1  0            999 V2000\n    7.2442   -4.6507    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5299   -5.4246    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.0560   -4.5036    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5316   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8114   -4.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8114   -3.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0950   -3.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5240   -3.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2442   -3.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7560   -5.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3904   -6.2377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3431   -5.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6288   -6.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4419   -6.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7277   -7.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2003   -7.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5408   -7.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n  2 11  1  6  0  0  0\n 12  2  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC[C@@](C)([C@@]1([H])CC=C(C)CC1)O)C",
        "formula": "C15H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "222.3669",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "53b4d5c8-b768-4c40-b36c-b605c1651e15",
          "258b5b75-820a-40db-8fd9-2711bbb25abf"
        ],
        "stereo_centers": 2
      },
      "unii": "U799YDE8BR"
    }
  ]
}