{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "becce1b1-662e-4ae4-a15f-81c9d726cb2b", "code": "L01XX07", "comments": "ATC|ANTINEOPLASTIC AND IMMUNOMODULATING AGENTS|ANTINEOPLASTIC AGENTS|OTHER ANTINEOPLASTIC AGENTS|Other antineoplastic agents|lonidamine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=L01XX07&showdescription=yes", "code_system": "WHO-ATC", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "767fc8d6-9f47-4e57-89af-6e5fc7541c1c", "code": "QL01XX07", "comments": "VATC|ANTINEOPLASTIC AGENTS|OTHER ANTINEOPLASTIC AGENTS|Other antineoplastic agents|lonidamine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QL01XX07&showdescription=yes", "code_system": "WHO-VATC", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "4b699ca2-062a-43dc-b3f8-0e2252d4ebbb", "code": "50264-69-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=50264-69-2", "code_system": "CAS", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829", "de65677d-aa5a-4a1e-bda0-4ec51d9e60a1" ] }, { "uuid": "fef6e943-4bae-49ef-865b-24083cfa6ddd", "code": "C1146", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1146", "code_system": "NCI_THESAURUS", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "796c9046-3fed-4777-9d72-6333b1da0118", "code": "C016371", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67016371", "code_system": "MESH", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "5d31800c-2cea-48fa-8550-68f057dc093e", "code": "LONIDAMINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Lonidamine", "code_system": "WIKIPEDIA", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "9cf817ef-668b-4e85-a6bc-0bdc1930c41d", "code": "4324", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4324", "code_system": "INN", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "9707483f-51a7-422e-b279-93cff80af291", "code": "m6895", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m6895?q=authorize", "code_system": "MERCK INDEX", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "c3e08fdb-2814-48d4-813d-1c4a86d6d282", "code": "SUB08571MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "39686209-f98d-4c16-845b-d83eaeec0a54", "code": "CHEMBL1257030", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1257030", "code_system": "ChEMBL", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "7872bb9c-d4dd-498f-a0b8-cd6de880299f", "code": "256-510-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.356", "code_system": "ECHA (EC/EINECS)", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "457d2df2-90b8-4b90-927a-1c21565b4e6b", "code": "39562", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/39562", "code_system": "PUBCHEM", "references": [ "dcf1afd3-c480-475d-807d-e419ead63829" ] }, { "uuid": "5cbcef42-3fd2-9aa6-805c-36adc56357e9", "code": "DTXSID5020782", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5020782", "code_system": "EPA CompTox", "references": [ "c13ec93d-e242-65c9-cb08-a53e06198f42" ] }, { "uuid": "33b45deb-cf85-b1a3-ee81-7a2909fa7147", "code": "C1744", "comments": "Pharmacologic Substance[C1909]|Multidrug Resistance Modulator", "codeText": "Pharmacologic Substance[C1909]|Multidrug Resistance Modulator", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1744", "code_system": "NCI_THESAURUS", "references": [ "1862516f-b8ba-045d-ff5b-bf2511a7776f" ] }, { "uuid": "04a1871b-e18a-8105-4262-e482c77f6a28", "code": "C798", "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Radiosensitizing Agent", "codeText": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Radiosensitizing Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C798", "code_system": "NCI_THESAURUS", "references": [ "1862516f-b8ba-045d-ff5b-bf2511a7776f" ] }, { "uuid": "1badae3d-d8a3-487a-bea6-6e5c5091af96", "code": "U78804BIDR", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "458d1dfd-2f3c-5f09-8d47-37a4160fd4ef", "code": "1598", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1598", "code_system": "DRUG CENTRAL", "references": [ "1862516f-b8ba-045d-ff5b-bf2511a7776f" ] }, { "uuid": "9b59d713-78c5-7c9f-c807-26fa765df6af", "code": "DB06266", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB06266", "code_system": "DRUG BANK", "references": [ "1862516f-b8ba-045d-ff5b-bf2511a7776f" ] }, { "uuid": "f7782924-435c-be54-d4f2-1ca9bb9c6879", "code": "50138", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50138", "code_system": "CHEBI", "references": [ "1862516f-b8ba-045d-ff5b-bf2511a7776f" ] }, { "uuid": "552a70a4-b939-7387-918c-4a2bde664eaa", "code": "100000082026", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "d1a50d84-0ecc-5d2b-16d0-48bf7d9c27d8" ] }, { "uuid": "642f2ffb-7068-46f3-c4ac-db99488205c5", "code": "758419", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758419", "code_system": "NSC", "references": [ "f3ea3917-5407-ff36-3e0c-1569a3af61df" ] }, { "uuid": "4767bc7e-e3e1-c55b-3f9d-65a1d4c4277e", "code": "741419", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=741419", "code_system": "NSC", "references": [ "f3ea3917-5407-ff36-3e0c-1569a3af61df" ] } ], "substance_class": "chemical", "references": [ { "uuid": "937398c3-c612-4e01-8e5c-8817365da685", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7639bbd9-a45b-4670-83e2-92fe4e1ca39b", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "38e697d2-f0fc-4757-8dcc-78b1c93dad52", "citation": "INN Proposed List 38", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL38.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "517fc57f-2f62-4606-bb9c-4ac43c0b5c27", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f4a810fb-c076-4012-a844-15689b2a4787", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2bab303d-d631-445d-95b6-8e28387b0139", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b7e91260-5837-4e52-a975-68add92c0bd2", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b4a963dd-089b-43df-ba1d-b7d733dabe41", "citation": "D07257", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "63104b2e-98df-475f-ba66-80c9e107bc74", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dcf1afd3-c480-475d-807d-e419ead63829", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389681000, "tags": [ "NOMEN" ] }, { "uuid": "61cb13da-c786-48ef-9600-13cf6aa77d3f", "citation": "SRS import [U78804BIDR]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U78804BIDR", "doc_type": "SRS", "public_domain": true, "document_date": 1493389681000, "tags": [ "NOMEN" ] }, { "uuid": "956e55ae-8833-4cf5-8017-cb058ab3e097", "citation": "LONIDAMINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5192bcf1-cfff-4c86-993d-9efb8d7a789d", "citation": "LONIDAMINE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c3879f9d-9cdb-4a24-b105-389980a73164", "citation": "LONIDAMINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f2b18145-3e6d-4850-8598-58c1e79c4d9d", "citation": "LONIDAMINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c13ec93d-e242-65c9-cb08-a53e06198f42", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50264-69-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1862516f-b8ba-045d-ff5b-bf2511a7776f", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "de65677d-aa5a-4a1e-bda0-4ec51d9e60a1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2e4185d0-f433-46eb-9402-8cbd535cdd13", "citation": "WIK", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2f891c26-b6ab-4610-bad2-11b5a0cee8fd", "citation": "WIK", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f3ea3917-5407-ff36-3e0c-1569a3af61df", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "9183cd30-ca8a-437a-8a72-948469fad26e", "citation": "Mayola, Eleonore, Joel Chopineau, and Catherine Brenner. \"The adenine nucleotide translocase 2, a mitochondrial target for anticancer biotherapy.\" Current drug targets 12.6 (2011): 894-901.", "url": "https://www.ingentaconnect.com/content/ben/cdt/2011/00000012/00000006/art00012?crawler=true", "doc_type": "JA", "public_domain": true }, { "uuid": "5bf71ac8-91de-1876-3c8c-5553fd4ce5af", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "d1a50d84-0ecc-5d2b-16d0-48bf7d9c27d8", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a50eda11-ff46-4324-9e4f-96b4332473b7", "id": "a50eda11-ff46-4324-9e4f-96b4332473b7", "molfile": "\n Marvin 01132108342D \n\n 21 23 0 0 0 0 999 V2000\n 1.9661 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4795 -0.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2803 -0.4492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2125 -1.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6900 -2.0791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2100 -2.7259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5745 -3.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3804 -3.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7834 -2.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6432 -2.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0667 -3.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8778 -3.4266 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6227 -4.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7834 -4.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3830 -4.8383 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4194 -2.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6853 -2.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7110 -1.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4194 -1.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 21 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 16 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 14 8 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 2 0 0 0 0\n 18 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c(C(=O)O)nn2Cc3ccc(cc3Cl)Cl", "formula": "C15H10Cl2N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8066c465-644e-4824-a64d-bf1c39c36a54" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "321.1585", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "381e6a00-5677-4c81-9fbb-3e04479522e8", "version": "21", "structure": { "id": "d5d33520-09ce-4301-afb4-7621e071fe83", "molfile": "\n Marvin 01132111052D \n\n 21 23 0 0 0 0 999 V2000\n 2.2125 -1.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6900 -2.0791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2100 -2.7259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4194 -1.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4194 -2.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4795 -0.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5745 -3.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3804 -3.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7834 -4.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6227 -4.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9661 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7834 -2.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0667 -3.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3830 -4.8383 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2803 -0.4492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7110 -1.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6432 -2.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8778 -3.4266 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6853 -2.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 1 1 0 0 0 0\n 7 3 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 6 2 0 0 0 0\n 12 8 1 0 0 0 0\n 13 17 1 0 0 0 0\n 14 9 1 0 0 0 0\n 15 6 1 0 0 0 0\n 16 4 1 0 0 0 0\n 17 12 2 0 0 0 0\n 18 13 1 0 0 0 0\n 19 5 1 0 0 0 0\n 20 16 2 0 0 0 0\n 21 20 1 0 0 0 0\n 5 3 1 0 0 0 0\n 21 19 2 0 0 0 0\n 13 10 2 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c(C(=O)O)nn2Cc3ccc(cc3Cl)Cl", "formula": "C15H10Cl2N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "321.1585", "optical_activity": "NONE", "references": [ "61cb13da-c786-48ef-9600-13cf6aa77d3f", "937398c3-c612-4e01-8e5c-8817365da685", "38e697d2-f0fc-4757-8dcc-78b1c93dad52" ], "stereo_centers": 0 }, "unii": "U78804BIDR", "relationships": [ { "uuid": "ee82b76a-ad97-48c2-bfec-6311c890cf8d", "amount": { "uuid": "a75f9c46-7fcd-4058-9b11-0ae6cd4bb141" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "786b5083-24e1-40ce-b3af-6b83c56c2cb0", "refuuid": "381e6a00-5677-4c81-9fbb-3e04479522e8", "name": "LONIDAMINE", "unii": "U78804BIDR", "linking_id": "U78804BIDR", "ref_pname": "LONIDAMINE", "substance_class": "reference" } } ], "names": [ { "uuid": "a5e0e45c-6eee-4fdd-bada-5d416665fe92", "name": "1-(2,4-DICHLOROBENZYL)-1H-INDAZOLE-3-CARBOXYLIC ACID", "stdName": "1-(2,4-DICHLOROBENZYL)-1H-INDAZOLE-3-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7639bbd9-a45b-4670-83e2-92fe4e1ca39b" ], "display_name": false }, { "uuid": "ed918e3d-29cf-40b7-9076-497620ada0ba", "name": "1-(2,4-DICHLOROPHENYL)-1H-INDAZOL-3-CARBOXYLIC ACID", "stdName": "1-(2,4-DICHLOROPHENYL)-1H-INDAZOL-3-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "937398c3-c612-4e01-8e5c-8817365da685" ], "display_name": false }, { "uuid": "764c843e-d136-406e-a9d9-e4fc9c930fa0", "name": "DORIDAMINA", "stdName": "DORIDAMINA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "b7e91260-5837-4e52-a975-68add92c0bd2", "b4a963dd-089b-43df-ba1d-b7d733dabe41" ], "display_name": false }, { "uuid": "df8d010f-1c91-4faa-a2ca-300897968d31", "name": "LONIDAMINE", "stdName": "LONIDAMINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "f4a810fb-c076-4012-a844-15689b2a4787", "f2b18145-3e6d-4850-8598-58c1e79c4d9d", "937398c3-c612-4e01-8e5c-8817365da685", "956e55ae-8833-4cf5-8017-cb058ab3e097", "63104b2e-98df-475f-ba66-80c9e107bc74", "5192bcf1-cfff-4c86-993d-9efb8d7a789d", "38e697d2-f0fc-4757-8dcc-78b1c93dad52", "517fc57f-2f62-4606-bb9c-4ac43c0b5c27", "2bab303d-d631-445d-95b6-8e28387b0139", "c3879f9d-9cdb-4a24-b105-389980a73164" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "27864c96-07c3-457a-9a38-74d3dec1c8de", "name_org": "INN" } ] }, { "uuid": "07ce94ba-a87f-4822-9dec-e55beefb7e56", "name": "LONIDAMINE [MART.]", "stdName": "LONIDAMINE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "517fc57f-2f62-4606-bb9c-4ac43c0b5c27" ], "display_name": false }, { "uuid": "0a9d11bf-c376-4902-a74d-952f578f6e61", "name": "LONIDAMINE [MI]", "stdName": "LONIDAMINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f4a810fb-c076-4012-a844-15689b2a4787", "2bab303d-d631-445d-95b6-8e28387b0139" ], "display_name": false }, { "uuid": "75e7c861-b3ff-9017-dd7c-4574ff4f6300", "name": "Lonidamine [WHO-DD]", "stdName": "LONIDAMINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5bf71ac8-91de-1876-3c8c-5553fd4ce5af" ], "display_name": false }, { "uuid": "95b934d8-2005-c682-9725-04458c6e17d0", "name": "NSC-741419", "stdName": "NSC-741419", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f3ea3917-5407-ff36-3e0c-1569a3af61df" ], "display_name": false }, { "uuid": "4467ca5a-98e4-5483-d37f-31a0ffa76a34", "name": "NSC-758419", "stdName": "NSC-758419", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f3ea3917-5407-ff36-3e0c-1569a3af61df" ], "display_name": false }, { "uuid": "4b3800ca-23d5-462d-a21e-928c19f1d9b1", "name": "lonidamine [INN]", "stdName": "LONIDAMINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "38e697d2-f0fc-4757-8dcc-78b1c93dad52" ], "display_name": false } ], "modifications": { "uuid": "c5ef869b-c3ee-4b9d-87c0-fe3b2ae01361" } } ] }