{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "77ee3fdd-89df-4499-881d-84af449ce050",
          "code": "53824-77-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53824-77-4",
          "code_system": "CAS",
          "references": [
            "474d87c0-ff38-4d60-ad5c-d213c0eb3209",
            "e06b714f-95f6-4074-836b-89c667553dd8"
          ]
        },
        {
          "uuid": "572563f7-399d-45c7-92f1-e9c8c5c040a7",
          "code": "1427009",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427009/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "474d87c0-ff38-4d60-ad5c-d213c0eb3209"
          ]
        },
        {
          "uuid": "75dc0b0f-e771-4a80-abad-0edb3bba9972",
          "code": "258-814-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.053.450",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "474d87c0-ff38-4d60-ad5c-d213c0eb3209"
          ]
        },
        {
          "uuid": "6710b08b-3a27-4b4f-a7f1-fc0cc46d3371",
          "code": "103849",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/103849",
          "code_system": "PUBCHEM",
          "references": [
            "474d87c0-ff38-4d60-ad5c-d213c0eb3209"
          ]
        },
        {
          "uuid": "a02f1f2d-fe23-4f46-8775-926696a7a8d5",
          "code": "U783H9JHWY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5faca27c-5fbc-be58-71e6-6b6ca8407354",
          "code": "U783H9JHWY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=U783H9JHWY",
          "code_system": "DAILYMED",
          "references": [
            "72b87960-f936-26df-13ea-0438110aa3d4"
          ]
        },
        {
          "uuid": "070be87e-7eef-be46-168a-cf387be95fb9",
          "code": "DTXSID40866364",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40866364",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2a137092-c874-455b-96cf-1a4303e99acd",
          "name": "1,2-PROPANEDIOL DICAPRATE",
          "stdName": "1,2-PROPANEDIOL DICAPRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ac015b-a8c8-443f-be23-528ef38b2e59",
            "f9148b01-d87b-44f1-853d-a969a0e75fe9"
          ],
          "display_name": false
        },
        {
          "uuid": "85b283b8-dea1-46f0-87ba-c815306e9fe0",
          "name": "1,2-PROPANEDIOL DIDECANOATE",
          "stdName": "1,2-PROPANEDIOL DIDECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ac015b-a8c8-443f-be23-528ef38b2e59",
            "f9148b01-d87b-44f1-853d-a969a0e75fe9"
          ],
          "display_name": false
        },
        {
          "uuid": "7d47d085-8f46-4b8b-9d3e-214f2ecaab7b",
          "name": "CAPTEX 100",
          "stdName": "CAPTEX 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ac015b-a8c8-443f-be23-528ef38b2e59",
            "f9148b01-d87b-44f1-853d-a969a0e75fe9"
          ],
          "display_name": false
        },
        {
          "uuid": "83b48ece-5f4c-4b4e-9ffc-d597aa8542b7",
          "name": "DECANOIC ACID, 1-METHYL-1,2-ETHANEDIYL ESTER",
          "stdName": "DECANOIC ACID, 1-METHYL-1,2-ETHANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ac015b-a8c8-443f-be23-528ef38b2e59",
            "f9148b01-d87b-44f1-853d-a969a0e75fe9"
          ],
          "display_name": false
        },
        {
          "uuid": "40f56736-39c5-4d9c-a57d-ea530620db5d",
          "name": "N-DECANOIC ACID, 1,2-PROPANEDIYL ESTER",
          "stdName": "N-DECANOIC ACID, 1,2-PROPANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ac015b-a8c8-443f-be23-528ef38b2e59",
            "f9148b01-d87b-44f1-853d-a969a0e75fe9"
          ],
          "display_name": false
        },
        {
          "uuid": "6285f680-e20f-4b41-9b75-1bb6ca272ffe",
          "name": "PROPYLENE GLYCOL DICAPRATE",
          "stdName": "PROPYLENE GLYCOL DICAPRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ac015b-a8c8-443f-be23-528ef38b2e59",
            "4a814f1a-8ec0-4952-bdc8-7bc6a7256f7b",
            "fb970aa2-e4b1-416d-92c8-e2bef3467f0b",
            "f9148b01-d87b-44f1-853d-a969a0e75fe9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ab9088e7-7811-46b3-9442-e74987aaf2b0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e16287c2-91ec-45c3-bc67-0c58c280cf7d",
          "name": "PROPYLENE GLYCOL DIDECANOATE",
          "stdName": "PROPYLENE GLYCOL DIDECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9148b01-d87b-44f1-853d-a969a0e75fe9",
            "9f4fbc6f-7cd0-4c4a-b195-859e5b8508e9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "08ac015b-a8c8-443f-be23-528ef38b2e59",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f9148b01-d87b-44f1-853d-a969a0e75fe9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a814f1a-8ec0-4952-bdc8-7bc6a7256f7b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f4fbc6f-7cd0-4c4a-b195-859e5b8508e9",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "474d87c0-ff38-4d60-ad5c-d213c0eb3209",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "255e19c3-0968-4a17-803e-f7bafdb9519f",
          "citation": "SRS import [U783H9JHWY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U783H9JHWY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb970aa2-e4b1-416d-92c8-e2bef3467f0b",
          "citation": "PROPYLENE GLYCOL DICAPRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e06b714f-95f6-4074-836b-89c667553dd8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "72b87960-f936-26df-13ea-0438110aa3d4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c0c571bb-a038-4454-9390-56435e1d4f7c",
          "id": "c0c571bb-a038-4454-9390-56435e1d4f7c",
          "molfile": "\n  Marvin  01132109582D          \n\n 27 26  0  0  0  0            999 V2000\n   -0.7708   -5.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0784   -4.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6555   -5.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3479   -4.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0634   -5.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7743   -4.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4897   -5.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2007   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9161   -5.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6317   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6317   -3.9156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3425   -5.1528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0580   -4.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7688   -5.1342    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7688   -5.9513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4844   -4.7235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1952   -5.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1952   -5.9513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8876   -4.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6216   -5.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3140   -4.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0479   -5.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7634   -4.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4743   -5.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1667   -4.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8961   -5.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5931   -4.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCCC",
          "formula": "C23H44O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c14f8e6e-a24e-4406-b78a-1af94fed54da"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "384.5939",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf34a813-4032-48e5-95f5-6665e057e43d",
      "version": "5",
      "structure": {
        "id": "087c1847-b10c-4dc7-8c9c-f4c307592ef6",
        "molfile": "\n  Marvin  01132100432D          \n\n 27 26  0  0  0  0            999 V2000\n    9.1952   -5.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1952   -5.9513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4844   -4.7235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7688   -5.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0580   -4.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3425   -5.1528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6317   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6317   -3.9156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9161   -5.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2007   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4897   -5.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7743   -4.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0634   -5.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3479   -4.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6555   -5.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0784   -4.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7708   -5.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7688   -5.9513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8876   -4.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6216   -5.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3140   -4.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0479   -5.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7634   -4.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4743   -5.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1667   -4.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8961   -5.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5931   -4.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18  4  1  0  0  0  0\n 19  1  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCCC",
        "formula": "C23H44O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "384.5939",
        "optical_activity": "( + / - )",
        "references": [
          "08ac015b-a8c8-443f-be23-528ef38b2e59",
          "255e19c3-0968-4a17-803e-f7bafdb9519f"
        ],
        "stereo_centers": 1
      },
      "unii": "U783H9JHWY"
    }
  ]
}