{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "44a4a825-dd6c-453e-b968-3d1df4c896ba",
          "code": "A12CB02",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|MINERAL SUPPLEMENTS|OTHER MINERAL SUPPLEMENTS|Zinc|zinc gluconate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A12CB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "57284624-a73a-42d0-8f8c-f5b4a4fd284c",
          "code": "QA12CB02",
          "comments": "VATC|MINERAL SUPPLEMENTS|OTHER MINERAL SUPPLEMENTS|Zinc|zinc gluconate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA12CB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "c7328494-9b5f-433f-8df2-cdaf83a3fab7",
          "code": "4468-02-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4468-02-4",
          "code_system": "CAS",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02",
            "e5d1f3f1-42c4-4ff8-9c8b-db85bca144f7"
          ]
        },
        {
          "uuid": "2eae5f8e-fbdd-4295-944c-25414275b81b",
          "code": "C84248",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84248",
          "code_system": "NCI_THESAURUS",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "03e4b755-3db4-4293-a006-fa46d78bd814",
          "code": "C030691",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67030691",
          "code_system": "MESH",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "c171018d-78bb-4182-81cf-bbee48c9dd5a",
          "code": "ZINC GLUCONATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zinc_gluconate",
          "code_system": "WIKIPEDIA",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "61b62290-e867-4dc5-b15c-bf92ea67720b",
          "code": "21 CFR 522.2690",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.2690 Zinc gluconate.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.2690",
          "code_system": "CFR",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "b393626c-f587-4a1f-a302-7fd064e1a1f7",
          "code": "58300",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/58300/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "f114a80f-36ab-47a8-9ae6-5d410facd305",
          "code": "m5762",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5762?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "61feb28a-5c69-4757-8d40-435e8fa73ba8",
          "code": "SUB15756MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "1ff9251e-aa32-4cc8-a4a7-95ea5494d42f",
          "code": "224-736-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.489",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "302dd9d9-b582-493f-844c-2f770ccdbe02"
          ]
        },
        {
          "uuid": "d5001282-0830-b49d-723d-7488445afb32",
          "code": "1054",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1054",
          "code_system": "HSDB",
          "references": [
            "92a9f532-eae4-d7a8-d9e2-32768a84cb83"
          ]
        },
        {
          "uuid": "303ef0f3-99d1-f3e3-244d-d49e76fe6267",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "2034d43e-b0a6-fce2-b8bc-dec2725f7964",
          "code": "EU/3/16/1793",
          "comments": "EU ORPHAN DRUG|Positive|treatment of facioscapulohumeral muscular dystrophy",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3161793",
          "code_system": "EU-Orphan Drug",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "cc0f2fd4-96a1-7bbe-f107-0d36473cfd08",
          "code": "443445",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/443445",
          "code_system": "PUBCHEM",
          "references": [
            "f575d2bd-6eeb-c309-b75f-cc5ee4ea4270"
          ]
        },
        {
          "uuid": "2d8c3b92-5dec-625a-0f49-6c8586e9abe7",
          "code": "4343",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4343",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "588cb142-bae7-b39f-fb44-07559704ae4e",
          "code": "DB11248",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11248",
          "code_system": "DRUG BANK",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "9301d14b-aaa6-47f5-8f88-47290d3af50a",
          "code": "U6WSN5SQ1Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d0a563f-e9c3-74f2-8558-dd40041985e2",
          "code": "137 (Number of products:9660)",
          "comments": "Dietary Supplement Label Database|Mineral|Zinc",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=137&item=Zinc",
          "code_system": "DSLD",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "5f5abafe-32a8-77d6-6b24-ae0639a9fcb4",
          "code": "DTXSID20894125",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20894125",
          "code_system": "EPA CompTox",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "087d2b0e-4579-80e7-310e-b41a6f44ca51",
          "code": "805420",
          "comments": "ORPHAN DRUG|Designated|Treatment of Microvillus Inclusion Disease.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=805420",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "a34ea004-b31d-643b-7d4d-b78e5b167ad4"
          ]
        },
        {
          "uuid": "27a57124-3d30-47ed-ebbb-7052fede79ea",
          "code": "U6WSN5SQ1Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=U6WSN5SQ1Z",
          "code_system": "DAILYMED",
          "references": [
            "aac1f113-b2bf-f4cd-1150-e8d27fa3cbc8"
          ]
        },
        {
          "uuid": "cdc1cb62-fc84-12f6-e010-95ef065ca025",
          "code": "300000052200",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b1f74734-bf01-1828-2280-5252406faf64"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ac3c4cb7-cab3-41bc-9296-582db85952a9",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f08cbb02-1b4b-4392-9421-1cca0bd77ae4",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a20ff89f-3d00-4d86-9eff-4ee0b1e062c8",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "c2d327f4-d2fc-4a43-8722-ca4d86c247f4",
            "refuuid": "20ccd816-7e70-49cc-835e-aa74b6a05e8c",
            "name": "Gluconic Acid",
            "unii": "R4R8J0Q44B",
            "linking_id": "R4R8J0Q44B",
            "ref_pname": "Gluconic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e6b26bd4-e1b3-4f40-b47d-40898e4736cd",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a1cf68ff-5f93-49fc-922a-869f75fb83f1",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8c44c91d-9882-4e40-a78f-3f1136d78a0f",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "4a95dd7f-44ae-4659-8026-a9da0b14d416"
          ],
          "related_substance": {
            "uuid": "bd5603a5-d7e7-464a-8065-27fdad2f91ad",
            "refuuid": "ffde2906-0d34-48d7-a4b5-8df494e52bc9",
            "name": "ZINC GLUCONATE TRIHYDRATE",
            "unii": "F2F0XU34WQ",
            "linking_id": "F2F0XU34WQ",
            "ref_pname": "ZINC GLUCONATE TRIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "28d4223d-259b-4f60-88c6-8efd5a54f704",
          "amount": {
            "uuid": "ceb96fd8-0ace-40aa-b0aa-a1dfa6e29d74"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "129d3fc3-af2b-430d-88ad-30993857d18e",
            "refuuid": "20ccd816-7e70-49cc-835e-aa74b6a05e8c",
            "name": "Gluconic Acid",
            "unii": "R4R8J0Q44B",
            "linking_id": "R4R8J0Q44B",
            "ref_pname": "Gluconic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5ba02f10-82d6-4743-b465-bd6dcdd8c9d5",
          "name": "BIS(D-GLUCONATO-O1,O2) ZINC",
          "stdName": "BIS(D-GLUCONATO-O1,O2) ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3436eadc-d023-4a83-a52d-3fc9f8dfead3"
          ],
          "display_name": false
        },
        {
          "uuid": "b5d8116c-c7df-4ed1-8b4e-3798dc30aa03",
          "name": "GLUCONIC ACID ZINC COMPLEX",
          "stdName": "GLUCONIC ACID ZINC COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2154e3ff-6d23-4c0b-9331-7f3f0e784369",
            "d1b21b3c-2a1f-446c-b141-ec93e997ade2"
          ],
          "display_name": false
        },
        {
          "uuid": "8b773504-9fae-4047-971d-c0fd98ea082f",
          "name": "GLUCONIC ACID ZINC COMPLEX [MI]",
          "stdName": "GLUCONIC ACID ZINC COMPLEX [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2154e3ff-6d23-4c0b-9331-7f3f0e784369"
          ],
          "display_name": false
        },
        {
          "uuid": "0744410b-b538-4f31-bc34-90cd03305665",
          "name": "ZINC D-GLUCONATE (1:2)",
          "stdName": "ZINC D-GLUCONATE (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3436eadc-d023-4a83-a52d-3fc9f8dfead3"
          ],
          "display_name": false
        },
        {
          "uuid": "811de857-7a69-46c3-a2ec-0aef17dabe31",
          "name": "ZINC GLUCONATE",
          "stdName": "ZINC GLUCONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9c51d5f-7a8f-4b4c-8f94-2b64b89399df",
            "766a95f8-61a1-4061-93b2-1d3dfa883c8d",
            "acc02071-2b47-4702-94e7-7d06bdda217e",
            "8f3391eb-fa23-44c1-9ed5-a71bfd745330",
            "15c70db6-24bf-49ab-b153-f42e70f1359c",
            "0c6d2ff6-7098-436e-882f-168c37e22d88",
            "f10201a8-2592-49f8-9145-af007b449750",
            "ab524bdd-3f41-4203-935c-c86d11bb1399",
            "5f78c364-ceee-4083-90c6-57576ce0807b",
            "87c4b5a1-211c-491b-94a3-006d788482bf",
            "d0dc7419-41bf-4eae-a3b3-3462944e3fae",
            "8817181e-e681-488c-bee0-50de079b962f",
            "3e6a95c0-7a3b-4930-af49-2a220b0325cf",
            "be2ef328-0ff8-4198-b84e-208ab454fafd",
            "8048ef8c-b3d8-44cf-82c7-8e7ef9c5dd94",
            "e22789fe-e63c-45a7-8591-da781b6434f0",
            "312e0cf2-03ce-4200-b526-28d9c8260cc1",
            "88b2f7e9-82ca-4c37-8b47-ea03f3d3d734",
            "a6fc648c-1ca3-4594-9030-916335096765"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5c109bff-bd36-4f8d-9bd7-ccdd2ae73385",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e4812891-b2d6-97e6-3425-f4504a138f56",
          "name": "ZINC GLUCONATE [EP IMPURITY]",
          "stdName": "ZINC GLUCONATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c6d2ff6-7098-436e-882f-168c37e22d88"
          ],
          "display_name": false
        },
        {
          "uuid": "c6dc5442-0e2a-71d7-7343-ff32315dfa91",
          "name": "ZINC GLUCONATE [EP MONOGRAPH]",
          "stdName": "ZINC GLUCONATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0427448e-ee59-b99a-c0c7-6012d3622e2c"
          ],
          "display_name": false
        },
        {
          "uuid": "0b305c47-67d1-4317-98fd-e6de198167d1",
          "name": "ZINC GLUCONATE [FCC]",
          "stdName": "ZINC GLUCONATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e6a95c0-7a3b-4930-af49-2a220b0325cf"
          ],
          "display_name": false
        },
        {
          "uuid": "88e824b1-eab8-4613-993e-753172636497",
          "name": "ZINC GLUCONATE [GREEN BOOK]",
          "stdName": "ZINC GLUCONATE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f78c364-ceee-4083-90c6-57576ce0807b"
          ],
          "display_name": false
        },
        {
          "uuid": "a4605cb3-817f-4b83-954f-321fd43f6bd3",
          "name": "ZINC GLUCONATE [HSDB]",
          "stdName": "ZINC GLUCONATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10201a8-2592-49f8-9145-af007b449750"
          ],
          "display_name": false
        },
        {
          "uuid": "995d89bb-25a4-465e-9a3b-b6148d82b0f1",
          "name": "ZINC GLUCONATE [MART.]",
          "stdName": "ZINC GLUCONATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87c4b5a1-211c-491b-94a3-006d788482bf"
          ],
          "display_name": false
        },
        {
          "uuid": "9bcb2e8d-5214-8e2a-7cca-e660f98da390",
          "name": "ZINC GLUCONATE [USP MONOGRAPH]",
          "stdName": "ZINC GLUCONATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f98072b-2946-cdfb-ddc9-6bbedb3c401a"
          ],
          "display_name": false
        },
        {
          "uuid": "ecdac351-e1fe-4eb3-81d3-a7f491466647",
          "name": "ZINC GLUCONATE [VANDF]",
          "stdName": "ZINC GLUCONATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e22789fe-e63c-45a7-8591-da781b6434f0"
          ],
          "display_name": false
        },
        {
          "uuid": "2c880552-133a-49b9-a3c4-019dd4cbece9",
          "name": "ZINCUM GLUCONICUM",
          "stdName": "ZINCUM GLUCONICUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7c01e42-10c5-4b36-8e75-c2c07acb33cf",
            "00b9947f-096c-4f7d-a6a3-907cc5703f0f",
            "1e9a46fe-cacc-4389-bfaa-dcc0248a583b"
          ],
          "display_name": false
        },
        {
          "uuid": "48018c0c-10a4-4405-8048-8aebbd4d8602",
          "name": "ZINCUM GLUCONICUM [HPUS]",
          "stdName": "ZINCUM GLUCONICUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7c01e42-10c5-4b36-8e75-c2c07acb33cf",
            "00b9947f-096c-4f7d-a6a3-907cc5703f0f"
          ],
          "display_name": false
        },
        {
          "uuid": "a4449e48-13af-e8d4-12ea-47801ea09dde",
          "name": "Zinc gluconate [WHO-DD]",
          "stdName": "ZINC GLUCONATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86eabe22-0de2-edbe-ad9b-11b5e6f4add6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3436eadc-d023-4a83-a52d-3fc9f8dfead3",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "00b9947f-096c-4f7d-a6a3-907cc5703f0f",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f3391eb-fa23-44c1-9ed5-a71bfd745330",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acc02071-2b47-4702-94e7-7d06bdda217e",
          "citation": "ZINC GLUCONATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1b21b3c-2a1f-446c-b141-ec93e997ade2",
          "citation": "GLUCONIC ACID ZINC COMPLEX [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7c01e42-10c5-4b36-8e75-c2c07acb33cf",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c6d2ff6-7098-436e-882f-168c37e22d88",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15c70db6-24bf-49ab-b153-f42e70f1359c",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87c4b5a1-211c-491b-94a3-006d788482bf",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f78c364-ceee-4083-90c6-57576ce0807b",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88b2f7e9-82ca-4c37-8b47-ea03f3d3d734",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e6a95c0-7a3b-4930-af49-2a220b0325cf",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f10201a8-2592-49f8-9145-af007b449750",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8817181e-e681-488c-bee0-50de079b962f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e22789fe-e63c-45a7-8591-da781b6434f0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2154e3ff-6d23-4c0b-9331-7f3f0e784369",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "302dd9d9-b582-493f-844c-2f770ccdbe02",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389644000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f715d62-12d8-40fe-a065-aac46613a38d",
          "citation": "SRS import [U6WSN5SQ1Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U6WSN5SQ1Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389644000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e9a46fe-cacc-4389-bfaa-dcc0248a583b",
          "citation": "ZINCUM GLUCONICUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6fc648c-1ca3-4594-9030-916335096765",
          "citation": "ZINC GLUCONATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "766a95f8-61a1-4061-93b2-1d3dfa883c8d",
          "citation": "ZINC GLUCONATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9c51d5f-7a8f-4b4c-8f94-2b64b89399df",
          "citation": "ZINC GLUCONATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0dc7419-41bf-4eae-a3b3-3462944e3fae",
          "citation": "ZINC GLUCONATE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be2ef328-0ff8-4198-b84e-208ab454fafd",
          "citation": "ZINC GLUCONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8048ef8c-b3d8-44cf-82c7-8e7ef9c5dd94",
          "citation": "ZINC GLUCONATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "312e0cf2-03ce-4200-b526-28d9c8260cc1",
          "citation": "ZINC GLUCONATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab524bdd-3f41-4203-935c-c86d11bb1399",
          "citation": "ZINC GLUCONATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9955062e-46cb-45e1-8f12-42e072d9e0cb",
          "citation": "ZINC (AS GLUCONATE) [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "92a9f532-eae4-d7a8-d9e2-32768a84cb83",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+4468-02-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4a95dd7f-44ae-4659-8026-a9da0b14d416",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a34ea004-b31d-643b-7d4d-b78e5b167ad4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e5d1f3f1-42c4-4ff8-9c8b-db85bca144f7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f575d2bd-6eeb-c309-b75f-cc5ee4ea4270",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "0427448e-ee59-b99a-c0c7-6012d3622e2c",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "3f98072b-2946-cdfb-ddc9-6bbedb3c401a",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "aac1f113-b2bf-f4cd-1150-e8d27fa3cbc8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "86eabe22-0de2-edbe-ad9b-11b5e6f4add6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b113b08c-9e79-52f7-971c-3905a69edc9c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b1f74734-bf01-1828-2280-5252406faf64",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a8107efa-ee7b-4c30-aae1-785763487fb3",
          "id": "a8107efa-ee7b-4c30-aae1-785763487fb3",
          "molfile": "\n  Marvin  01132108442D          \n\n  1  0  0  0  1  0            999 V2000\n    9.6074   -3.0730    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5ca75b6d-a4c8-4427-8239-1eb6cfc2c291"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "eb977c9a-161f-4d8e-bae0-50ad1c90b1d2",
          "id": "eb977c9a-161f-4d8e-bae0-50ad1c90b1d2",
          "molfile": "\n  Marvin  01132112112D          \n\n 13 12  0  0  1  0            999 V2000\n    4.5385   -2.6721    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.5344   -1.8454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8245   -3.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1105   -2.6763    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2525   -3.0814    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.2484   -3.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9664   -2.6680    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.9623   -1.8413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6804   -3.0772    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.6763   -3.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3944   -2.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1084   -3.0730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3903   -1.8371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)[O-]",
          "formula": "C6H11O7",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "782c328b-bdbb-44e3-befc-0dece27ca80b"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "195.1476",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "48b0a536-d743-4a38-b86b-54c3de7a6895",
      "version": "26",
      "structure": {
        "id": "1419cbbc-23f6-4761-83af-d06e9921c5ea",
        "molfile": "\n  Marvin  01132101152D          \n\n 27 24  0  0  1  0            999 V2000\n    9.6074   -3.0730    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    3.1105   -2.6763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8245   -3.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5385   -2.6721    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2525   -3.0814    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9664   -2.6680    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6804   -3.0772    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3944   -2.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1084   -3.0730    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3903   -1.8371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6763   -3.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9623   -1.8413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2484   -3.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5344   -1.8454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1105   -2.6763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8245   -3.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5385   -2.6721    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2525   -3.0814    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9664   -2.6680    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6804   -3.0772    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3944   -2.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1084   -3.0730    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3903   -1.8371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6763   -3.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9623   -1.8413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2484   -3.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5344   -1.8454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  7 11  1  6  0  0  0\n  6 12  1  6  0  0  0\n  5  6  1  0  0  0  0\n  5 13  1  6  0  0  0\n  2  3  1  0  0  0  0\n  4 14  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  4  5  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 27  1  1  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 26  1  6  0  0  0\n 19 25  1  6  0  0  0\n 19 20  1  0  0  0  0\n 20 24  1  6  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  CHG  3   1   2   9  -1  22  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1 11  17  18  19  20  21  22  23  24  25  26  27\nM  SPA   1 13   2   3   4   5   6   7   8   9  10  11  12  13  14\nM  SDI   1  4    2.6905   -4.3281    2.6905   -1.4171\nM  SDI   1  4    8.5284   -1.4171    8.5284   -4.3281\nM  SMT   1 2\nM  END",
        "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Zn+2]",
        "formula": "2C6H11O7.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "455.6908",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3436eadc-d023-4a83-a52d-3fc9f8dfead3",
          "1f715d62-12d8-40fe-a065-aac46613a38d"
        ],
        "stereo_centers": 8
      },
      "unii": "U6WSN5SQ1Z"
    }
  ]
}