{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "442c7007-7e69-448a-9076-44a8256431fa",
          "code": "23696-85-7",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23696-85-7",
          "code_system": "CAS",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f",
            "237c07ed-eadc-4afb-9d70-5274bff3d453"
          ]
        },
        {
          "uuid": "aec5a055-9770-45e9-a037-8e98a6d176a2",
          "code": "C075388",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67075388",
          "code_system": "MESH",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "1d9008da-5545-42d4-b1d8-587bb8ee76d4",
          "code": "DAMASCENONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Damascenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "63787eed-effb-4782-a788-5ec7b73c0b72",
          "code": "23726-93-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23726-93-4",
          "code_system": "CAS",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f",
            "366eb118-1918-4b03-97da-45ffe69d7b5e"
          ]
        },
        {
          "uuid": "cb9c489d-72cc-42e0-96dc-053b3106511b",
          "code": "245-833-2",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.652",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "02c3b032-a303-4997-99a3-6a7a5aeddc2a",
          "code": "m4078",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4078?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "010c6570-4304-4da1-8633-6027ae0b403b",
          "code": "SUB115709",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "8680ea7e-4147-4063-8437-55e296b8bba2",
          "code": "245-844-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.662",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "2bde4e84-0f19-43b2-987a-3f6b8be1ab66",
          "code": "5366074",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5366074",
          "code_system": "PUBCHEM",
          "references": [
            "bb524edc-86fa-421b-8751-25131abbe37f"
          ]
        },
        {
          "uuid": "721d2220-b198-4acf-bba2-c2e1fc76b367",
          "code": "U66V25TBO0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6c32c9fd-7fb1-357e-bce9-3f92047bde23",
          "code": "67251",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:67251",
          "code_system": "CHEBI",
          "references": [
            "d888caf1-c589-429e-0d49-66bec1b97a55"
          ]
        },
        {
          "uuid": "845ee71c-6008-db4f-220a-9517dc058197",
          "code": "100000142136",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3d63c739-0f94-0c75-ec16-7ca46d8db12f"
          ]
        },
        {
          "uuid": "6fd1caf9-2a56-8876-c722-90b09cfe661e",
          "code": "341",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/341/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "48c6599a-b5ee-ca8d-29b8-48f163239f3f"
          ]
        },
        {
          "uuid": "8cc360ed-7b01-508e-8c8d-b1b70d8bfab3",
          "code": "U66V25TBO0",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(U66V25TBO0)",
          "code_system": "DAILYMED",
          "references": [
            "53f00a44-e9b5-1bce-7bbd-17ab957399bc"
          ]
        },
        {
          "uuid": "2460bec5-4810-7914-2f37-2dacdd8e31b0",
          "code": "DTXSID90885242",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90885242",
          "code_system": "EPA CompTox",
          "references": [
            "9e8fc438-3acf-729e-71b1-6c7544d6cc1d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b91b9b5e-2431-4583-85c5-66ed00a17313",
          "name": "(E)-.BETA.-DAMASCENONE",
          "stdName": "(E)-.BETA.-DAMASCENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132ebb51-9216-40c4-9ef5-43f845608dbf"
          ],
          "display_name": false
        },
        {
          "uuid": "000964de-454c-47b9-b525-7caa82bcc54d",
          "name": "(E)-1-(2,6,6-TRIMETHYL-1,3-CYCLOHEXADIEN-1-YL)-2-BUTEN-1-ONE",
          "stdName": "(E)-1-(2,6,6-TRIMETHYL-1,3-CYCLOHEXADIEN-1-YL)-2-BUTEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132ebb51-9216-40c4-9ef5-43f845608dbf"
          ],
          "display_name": false
        },
        {
          "uuid": "5882ec30-2fbc-4917-987c-c776dcb4582f",
          "name": "(E)-1-(2,6,6-TRIMETHYL-1-CYCLOHEXA-1,3-DIENYL)BUT-2-EN-1-ONE",
          "stdName": "(E)-1-(2,6,6-TRIMETHYL-1-CYCLOHEXA-1,3-DIENYL)BUT-2-EN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9580411-a84b-48ed-a555-26ecc75245e7"
          ],
          "display_name": false
        },
        {
          "uuid": "b2fdfc0a-c960-4c09-bdea-42c752d8ca7b",
          "name": ".BETA.-DAMASCENON, TRANS-",
          "stdName": ".BETA.-DAMASCENON, TRANS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9580411-a84b-48ed-a555-26ecc75245e7"
          ],
          "display_name": false
        },
        {
          "uuid": "b97be4f9-19f1-499c-9626-0d8a032b3e62",
          "name": ".BETA.-DAMASCENONE",
          "stdName": ".BETA.-DAMASCENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c989ce4-43e7-43eb-90e0-cd8110a3ed65",
            "1c9d997f-c4d6-4075-98af-8a1fa3429655",
            "fe13d8e5-9d7f-41d3-9d7f-3a0ac68af763"
          ],
          "display_name": true
        },
        {
          "uuid": "b2217da3-0f71-46f3-8a87-ecb5e368f293",
          "name": ".BETA.-DAMASCENONE [MI]",
          "stdName": ".BETA.-DAMASCENONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c9d997f-c4d6-4075-98af-8a1fa3429655"
          ],
          "display_name": false
        },
        {
          "uuid": "12900523-782e-4fa0-90b4-23febc63e77b",
          "name": "4-(2,6,6-TRIMETHYL CYCLOHEXA-1,3-DIENYL) BUT-2-EN-4-ONE [FHFI]",
          "stdName": "4-(2,6,6-TRIMETHYL CYCLOHEXA-1,3-DIENYL) BUT-2-EN-4-ONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7afb1b40-c213-4ebe-bb87-28de8b9ff7fc"
          ],
          "display_name": false
        },
        {
          "uuid": "bd4203f0-67f2-438f-a995-536a46ce0575",
          "name": "4-(2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENYL)BUT-2-EN-4-ONE",
          "stdName": "4-(2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENYL)BUT-2-EN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93d9ddeb-a7c8-457a-a1af-1519aaab0cc2"
          ],
          "display_name": false
        },
        {
          "uuid": "bfceb8d5-6305-443d-ac99-0e445a477f85",
          "name": "BETA-DAMASCENONE",
          "stdName": "BETA-DAMASCENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe13d8e5-9d7f-41d3-9d7f-3a0ac68af763"
          ],
          "display_name": false
        },
        {
          "uuid": "c203b59c-e76d-4a42-8be3-8451cd4cdfaf",
          "name": "DAMASCENONE",
          "stdName": "DAMASCENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132ebb51-9216-40c4-9ef5-43f845608dbf"
          ],
          "display_name": false
        },
        {
          "uuid": "99005e85-7389-4597-b39b-8ad6567242fa",
          "name": "DAMASCENONE,.BETA.-",
          "stdName": "DAMASCENONE,.BETA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9de09028-4999-4a25-ad41-103366a6aa6d"
          ],
          "display_name": false
        },
        {
          "uuid": "17057286-1237-4535-a3b9-f1059385904a",
          "name": "FEMA NO. 3420",
          "stdName": "FEMA NO. 3420",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0eae72d5-6feb-4521-b19d-0dbacf667eb1",
            "5a742510-3819-4e38-a4c2-ee2f7d852cbc"
          ],
          "display_name": false
        },
        {
          "uuid": "88c26988-bef0-4bc9-b609-99de06ec0d3b",
          "name": "TRANS-.BETA.-DAMASCENON",
          "stdName": "TRANS-.BETA.-DAMASCENON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132ebb51-9216-40c4-9ef5-43f845608dbf"
          ],
          "display_name": false
        },
        {
          "uuid": "e7518022-ad44-4f79-9198-a725710d0762",
          "name": "TRANS-DAMASCENONE",
          "stdName": "TRANS-DAMASCENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132ebb51-9216-40c4-9ef5-43f845608dbf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0eae72d5-6feb-4521-b19d-0dbacf667eb1",
          "citation": "CHEMID FEMA BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5a742510-3819-4e38-a4c2-ee2f7d852cbc",
          "citation": "CHEMID BATCH 2010",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9de09028-4999-4a25-ad41-103366a6aa6d",
          "citation": "GRAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe13d8e5-9d7f-41d3-9d7f-3a0ac68af763",
          "citation": "http://www.thegoodscentscompany.com/data/rw1021911.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1021911.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9580411-a84b-48ed-a555-26ecc75245e7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c9d997f-c4d6-4075-98af-8a1fa3429655",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7afb1b40-c213-4ebe-bb87-28de8b9ff7fc",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93d9ddeb-a7c8-457a-a1af-1519aaab0cc2",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "132ebb51-9216-40c4-9ef5-43f845608dbf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb524edc-86fa-421b-8751-25131abbe37f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d75315a4-4f8a-4051-b48a-adca1c2dbb62",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "742ea8ac-f11e-49f9-aa60-d717a2b6d337",
          "citation": "SRS import [U66V25TBO0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U66V25TBO0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92ea1fb0-23ee-49e8-af9b-82311e3ceee1",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c989ce4-43e7-43eb-90e0-cd8110a3ed65",
          "citation": ".BETA.-DAMASCENONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "491570a9-1c37-1403-7610-7973f2a9887f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23696-85-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d888caf1-c589-429e-0d49-66bec1b97a55",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "237c07ed-eadc-4afb-9d70-5274bff3d453",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "366eb118-1918-4b03-97da-45ffe69d7b5e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3d63c739-0f94-0c75-ec16-7ca46d8db12f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "48c6599a-b5ee-ca8d-29b8-48f163239f3f",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "53f00a44-e9b5-1bce-7bbd-17ab957399bc",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9e8fc438-3acf-729e-71b1-6c7544d6cc1d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f253c80a-96b3-4d6e-8a58-6fb65830bd95",
          "id": "f253c80a-96b3-4d6e-8a58-6fb65830bd95",
          "molfile": "\n  Marvin  01132112342D          \n\n 14 14  0  0  0  0            999 V2000\n    9.1004   -4.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3831   -4.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6742   -4.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9568   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9568   -3.5526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2434   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2434   -5.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9605   -6.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5344   -6.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8170   -5.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8170   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5344   -4.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2395   -3.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8094   -3.9557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "C/C=C/C(=O)C1=C(C)C=CCC1(C)C",
          "formula": "C13H18O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4bbb49cf-2d82-424a-9554-63c64e8a8a5c"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "190.2819",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "952e1a1f-1dee-4c91-9f50-f3245cb75b87",
      "version": "12",
      "structure": {
        "id": "5b0e1e84-30ab-4f99-a895-4a71ae99f1b9",
        "molfile": "\n  Marvin  01132104432D          \n\n 14 14  0  0  0  0            999 V2000\n    6.2434   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5344   -4.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8170   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8170   -5.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5344   -6.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2434   -5.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9605   -6.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2395   -3.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8094   -3.9557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9568   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6742   -4.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3831   -4.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1004   -4.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9568   -3.5526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 10 14  2  0  0  0  0\nM  END",
        "smiles": "C/C=C/C(=O)C1=C(C)C=CCC1(C)C",
        "formula": "C13H18O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "190.2819",
        "optical_activity": "NONE",
        "references": [
          "92ea1fb0-23ee-49e8-af9b-82311e3ceee1",
          "742ea8ac-f11e-49f9-aa60-d717a2b6d337"
        ],
        "stereo_centers": 0
      },
      "unii": "U66V25TBO0"
    }
  ]
}