{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c11e57f7-cf32-407b-89c8-b8406ddab701", "code": "362467-67-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=362467-67-2", "code_system": "CAS", "references": [ "4782e971-b6fc-41de-b4d2-601059936d02", "ded4a684-c9a9-4faf-8653-de8cbdce0c36" ] }, { "uuid": "5dd0e067-4b6f-4f96-9113-0ec97ae5c932", "code": "11064349", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11064349", "code_system": "PUBCHEM", "references": [ "4782e971-b6fc-41de-b4d2-601059936d02" ] }, { "uuid": "fc48916d-7280-4be9-c714-1d1b7388e1a3", "code": "DTXSID60889171", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60889171", "code_system": "EPA CompTox" }, { "uuid": "d14826b7-8800-4ec6-8be8-602ce0f53e11", "code": "U65Z9ULK5H", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "44597173-a57a-4bb1-b3f6-28c2f0279fda", "name": "2H-1,5-Benzodioxepin-3(4H)-one, 7-(3-methylbutyl)-", "stdName": "2H-1,5-BENZODIOXEPIN-3(4H)-ONE, 7-(3-METHYLBUTYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "37082e11-d466-43a4-ba51-b0136261e056", "97e3abe3-8904-4fad-8afb-6654f69cfd31" ], "display_name": false }, { "uuid": "572c0836-3469-40e3-a1ca-69b77f0d3c59", "name": "7-(3-Methylbutyl)-2H-1,5-benzodioxepin-3(4H)-one", "stdName": "7-(3-METHYLBUTYL)-2H-1,5-BENZODIOXEPIN-3(4H)-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ded4a684-c9a9-4faf-8653-de8cbdce0c36" ], "display_name": true } ], "references": [ { "uuid": "37082e11-d466-43a4-ba51-b0136261e056", "citation": "NCI DRUG DICTIONARY", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "97e3abe3-8904-4fad-8afb-6654f69cfd31", "citation": "NCI DRUG DICTIONARY", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4782e971-b6fc-41de-b4d2-601059936d02", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393242000, "tags": [ "NOMEN" ] }, { "uuid": "61ceb0b6-d351-4fdb-a0ed-2c2fdc2d0b3b", "citation": "NCI RECORD 362467-67-2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ded4a684-c9a9-4faf-8653-de8cbdce0c36", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "057b2369-01d7-4875-abfb-583e575e7c78", "id": "057b2369-01d7-4875-abfb-583e575e7c78", "molfile": "\n Marvin 01132100352D \n\n 17 18 0 0 0 0 999 V2000\n 8.6251 0.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9091 0.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9059 1.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1962 0.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4801 0.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7673 0.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7673 -0.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0198 -1.2278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2822 -0.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6373 -1.3012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8330 -1.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4750 -0.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6500 -0.3743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8330 0.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6373 0.5526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2822 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0198 0.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 17 6 2 0 0 0 0\n 8 7 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 16 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "CC(C)CCc1ccc2c(c1)OCC(=O)CO2", "formula": "C14H18O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3d71e847-256c-46ba-9117-29501790da10" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "234.2915", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6e92adc1-8f0e-4aac-941d-6ca8458341a6", "version": "5", "structure": { "id": "1df1f959-e8da-45ca-a086-d7d13c9c8d7c", "molfile": "\n Marvin 01132101432D \n\n 17 18 0 0 0 0 999 V2000\n 5.0198 0.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0198 -1.2278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7673 -0.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4801 0.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1962 0.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6251 0.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9059 1.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7673 0.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6500 -0.3743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8330 0.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8330 -1.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4750 -0.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2822 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2822 -0.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9091 0.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6373 0.5526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6373 -1.3012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13 16 1 0 0 0 0\n 10 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 11 17 1 0 0 0 0\n 9 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 1 13 2 0 0 0 0\n 2 14 2 0 0 0 0\n 1 8 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 8 1 0 0 0 0\n 2 3 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 12 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 15 1 0 0 0 0\n 6 15 1 0 0 0 0\n 7 15 1 0 0 0 0\nM END", "smiles": "CC(C)CCc1ccc2c(c1)OCC(=O)CO2", "formula": "C14H18O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "234.2915", "optical_activity": "NONE", "references": [ "61ceb0b6-d351-4fdb-a0ed-2c2fdc2d0b3b" ], "stereo_centers": 0 }, "unii": "U65Z9ULK5H" } ] }