{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8f9e35a2-1c80-4b6d-b889-ce8c63a02dc0", "code": "82799-44-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=82799-44-8", "code_system": "CAS", "references": [ "347fbe49-0194-4e47-8899-89521b336ef3", "6da2354b-f4fd-4ab8-bef9-a8a02c1b6eb1" ] }, { "uuid": "7ff24eac-4055-4b4e-9ba2-ada527bdef62", "code": "280-041-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.072.743", "code_system": "ECHA (EC/EINECS)", "references": [ "347fbe49-0194-4e47-8899-89521b336ef3" ] }, { "uuid": "34055e0e-c7bd-471e-89d8-6c404c9d1af7", "code": "122825", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/122825", "code_system": "PUBCHEM", "references": [ "347fbe49-0194-4e47-8899-89521b336ef3" ] }, { "uuid": "864cde7b-f1b1-bdbd-98d4-f9b6728620f8", "code": "DTXSID2072883", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2072883", "code_system": "EPA CompTox", "references": [ "df50feca-1a7a-f644-7dbc-fac517c0c5d4" ] }, { "uuid": "66e48f22-6a0c-4297-866a-52550a992abd", "code": "U5V0PD7FHZ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f4cf0c61-911e-d104-bf83-822998fd8925", "name": "2,4-DIETHYLTHIOXANTHEN-9-ONE", "stdName": "2,4-DIETHYLTHIOXANTHEN-9-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9bede2ce-5d9a-910b-f51d-08142ce9e96f" ], "display_name": false }, { "uuid": "3d7c6ca8-293d-d1b1-17ef-f8fe0adf64d1", "name": "2,4-DIETHYLTHIOXANTHONE", "stdName": "2,4-DIETHYLTHIOXANTHONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9bede2ce-5d9a-910b-f51d-08142ce9e96f" ], "display_name": true }, { "uuid": "be4c7978-052b-4a24-9b56-f966d743fa71", "name": "9H-THIOXANTHEN-9-ONE, 2,4-DIETHYL-", "stdName": "9H-THIOXANTHEN-9-ONE, 2,4-DIETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "41aa5a23-23ad-4f7c-9b9e-0235d5c988c7", "3f757079-b3c1-435c-89aa-a2563b207023" ], "display_name": false }, { "uuid": "a376ec15-2eff-01e8-b15f-7abb877e04f6", "name": "CHEMCURE DETX", "stdName": "CHEMCURE DETX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9bede2ce-5d9a-910b-f51d-08142ce9e96f" ], "display_name": false }, { "uuid": "0d29965e-2246-7b9c-7cdc-a877a3ed3ea5", "name": "DETX", "stdName": "DETX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9bede2ce-5d9a-910b-f51d-08142ce9e96f" ], "display_name": false }, { "uuid": "d86d39dd-7691-4d38-3f39-6384f7275379", "name": "DETX-S", "stdName": "DETX-S", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9bede2ce-5d9a-910b-f51d-08142ce9e96f" ], "display_name": false } ], "references": [ { "uuid": "41aa5a23-23ad-4f7c-9b9e-0235d5c988c7", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3f757079-b3c1-435c-89aa-a2563b207023", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "347fbe49-0194-4e47-8899-89521b336ef3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394037000, "tags": [ "NOMEN" ] }, { "uuid": "df50feca-1a7a-f644-7dbc-fac517c0c5d4", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82799-44-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9bede2ce-5d9a-910b-f51d-08142ce9e96f", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6da2354b-f4fd-4ab8-bef9-a8a02c1b6eb1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9c876ee7-466b-4a00-8589-d4c56b203039", "id": "9c876ee7-466b-4a00-8589-d4c56b203039", "molfile": "\n Marvin 01132108082D \n\n 19 21 0 0 0 0 999 V2000\n -0.4129 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1274 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8418 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8417 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5561 -1.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5560 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8415 -0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2706 -2.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9851 -1.6495 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6996 -2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4140 -1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1285 -2.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.1286 -2.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4142 -3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6997 -2.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9852 -3.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9854 -4.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2707 -2.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5563 -3.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 19 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 5 8 1 0 0 0 0\n 7 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 18 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 16 18 1 0 0 0 0\n 19 18 1 0 0 0 0\nM END", "smiles": "CCc1cc(CC)c2c(c1)c(=O)c3ccccc3s2", "formula": "C17H16OS", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "28d4cec3-bb15-4c37-83e9-dd62f9cb7927" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "268.3751", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "184a2791-754b-4bc1-8145-5f7720d1007d", "version": "5", "structure": { "id": "accdd38c-9fd5-4e45-b786-00cbace85bba", "molfile": "\n Marvin 01132108582D \n\n 19 21 0 0 0 0 999 V2000\n 15.2626 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2627 -3.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5481 -3.4511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -5.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -4.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -3.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9772 -3.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -5.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5478 -5.9261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6915 -3.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6915 -4.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1190 -5.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1192 -3.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9772 -2.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -5.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6918 -2.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4046 -4.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1204 -4.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4047 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 2 1 0 0 0 0\n 8 1 1 0 0 0 0\n 9 4 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 8 2 0 0 0 0\n 12 5 2 0 0 0 0\n 13 6 2 0 0 0 0\n 14 7 1 0 0 0 0\n 15 11 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 12 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 17 2 0 0 0 0\n 7 10 2 0 0 0 0\n 3 6 1 0 0 0 0\n 13 19 1 0 0 0 0\nM END", "smiles": "CCc1cc(CC)c2c(c1)c(=O)c3ccccc3s2", "formula": "C17H16OS", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "268.3751", "optical_activity": "NONE", "references": [ "41aa5a23-23ad-4f7c-9b9e-0235d5c988c7" ], "stereo_centers": 0 }, "unii": "U5V0PD7FHZ" } ] }