{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1fb22fc2-a274-4b2b-ac94-6c05ca33a916",
          "code": "B05XB02",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|BLOOD SUBSTITUTES AND PERFUSION SOLUTIONS|I.V. SOLUTION ADDITIVES|Amino acids|alanyl glutamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B05XB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "49a81639-cf85-424b-bbb4-731307d3b80b",
          "code": "QB05XB02",
          "comments": "VATC|BLOOD SUBSTITUTES AND PERFUSION SOLUTIONS|I.V. SOLUTION ADDITIVES|Amino acids|alanyl glutamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB05XB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "02f0ae49-23ed-48c7-9fdb-3346232a49d8",
          "code": "39537-23-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39537-23-0",
          "code_system": "CAS",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037",
            "35b26515-154b-4900-ba4d-583f201cc49d"
          ]
        },
        {
          "uuid": "dada07af-a862-4cd6-bcad-7041b64e8725",
          "code": "L-ALANYL-L-GLUTAMINE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=6093",
          "code_system": "JECFA EVALUATION",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "af9ed173-7fc1-43bb-8680-78369afd424d",
          "code": "1359422",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1359422/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "768a9ef8-fc0b-4f26-9647-cad2b004664a",
          "code": "C127908",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C127908",
          "code_system": "NCI_THESAURUS",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "f83a6342-a7ac-4c64-bc24-7e14d1bda039",
          "code": "SUB34011",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "3cd00633-af7b-41a7-9f68-7f468a0c2629",
          "code": "CHEMBL3707366",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL3707366",
          "code_system": "ChEMBL",
          "references": [
            "45b179f4-a546-4522-8c19-3721781d8037"
          ]
        },
        {
          "uuid": "5d7f5938-5759-99d9-1734-b03bb6ca001a",
          "code": "DTXSID20192658",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20192658",
          "code_system": "EPA CompTox",
          "references": [
            "43316d33-ef7d-6e7d-c39a-aeba133075a9"
          ]
        },
        {
          "uuid": "99e8881b-6070-0921-577d-2c7e5591cdcc",
          "code": "611617",
          "comments": "ORPHAN DRUG|Designated|Prevention of complications associated with peritoneal dialysis (PD) treatment in end stage renal disease (ESRD)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=611617",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "b3df4fd2-6e40-2895-4a9c-59e932534a2e",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "57a44c15-620b-4746-b9e0-c04efedf8e50",
          "code": "123935",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/123935",
          "code_system": "PUBCHEM",
          "references": [
            "efd5cdb7-e4df-7103-3d5c-f9488c96baaa"
          ]
        },
        {
          "uuid": "eb47e333-0d94-b043-78b2-91273ae7f999",
          "code": "4319",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4319",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "9bf9cd7a-7ff4-68d6-22e9-8f7754d9bd0c",
          "code": "3081 (Number of products:109)",
          "comments": "Dietary Supplement Label Database|chemical|L-Alanyl-Glutamine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3081&item=L-Alanyl-Glutamine",
          "code_system": "DSLD",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "65d21bfd-1281-f9e7-9f85-7928e01f4050",
          "code": "DB11876",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11876",
          "code_system": "DRUG BANK",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "2fe81205-a566-4ea0-8194-f770fee68ff8",
          "code": "U5JDO2770Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0692d488-1733-bd95-3f05-8da6f8103c6e",
          "code": "74387",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74387",
          "code_system": "CHEBI",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "6867db05-83a2-14b3-5ec4-7f7122b57394",
          "code": "73788",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:73788",
          "code_system": "CHEBI",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "6ab34b20-c48b-6132-7aca-e7be78ea602b",
          "code": "Alanyl-glutamine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Alanyl-glutamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "07064176-1676-826c-27b9-984dd9722e4c"
          ]
        },
        {
          "uuid": "b7a264bf-582c-4246-6f84-cb963fca7a0e",
          "code": "1012517",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1012517",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "4bd5fdf4-2b85-ad69-b330-01137a2c7976"
          ]
        },
        {
          "uuid": "3ca6c40c-df7e-74ca-fd88-dec572f43e57",
          "code": "100000127872",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "82d5f346-d4b5-da1c-46a3-d354d35d07a6"
          ]
        },
        {
          "uuid": "9d493c41-2a06-f65b-6e82-97b2bf49c206",
          "code": "U5JDO2770Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=U5JDO2770Z",
          "code_system": "DAILYMED",
          "references": [
            "266ff015-2ae5-63a8-8f3c-8367861c6baf"
          ]
        },
        {
          "uuid": "35845430-39b2-1439-82ed-c00bab327cc7",
          "code": "2098",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2098/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "e0851e6e-a986-0875-d102-0a3c9a369c3b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "195dce64-86ce-4f9b-a6a6-de2abacd4e3e",
          "amount": {
            "uuid": "be5065d3-595f-4d21-9c9a-ec3251292448"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ea7c8215-b528-4d3f-8bcb-5e469669ef32",
            "refuuid": "a6caf865-2fa3-4270-9ec9-d5147dbc8d0e",
            "name": "ALANYL GLUTAMINE",
            "unii": "U5JDO2770Z",
            "linking_id": "U5JDO2770Z",
            "ref_pname": "ALANYL GLUTAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d82033b6-50d3-473e-845a-430f08eb7b3f",
          "amount": {
            "uuid": "948f186d-77c6-49df-949b-39e9bd1a5973"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "1815a6e1-fa03-4062-8d61-995e229c165e",
            "refuuid": "59fcfbac-b249-4231-a99c-b8391efc5868",
            "name": "ALTERNATIVE DEFINITION for [ALANYL GLUTAMINE]",
            "linking_id": "59fcfbac-b249-4231-a99c-b8391efc5868",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2f81770a-8a61-41fe-a7fa-aff6427d46a5",
          "name": "ALA-GLN",
          "stdName": "ALA-GLN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69357aad-a764-4a24-8aa3-384a5eb97797",
            "73732d8a-9f95-46a0-9bfa-b57d79bbe3de"
          ],
          "display_name": false
        },
        {
          "uuid": "b4ea8e23-6821-437f-a828-cd5bb958d74b",
          "name": "ALANYL GLUTAMINE",
          "stdName": "ALANYL GLUTAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "353e240b-1a95-4827-8c74-e12f28b7ef70",
            "69357aad-a764-4a24-8aa3-384a5eb97797",
            "f38ce554-b09f-479b-b3d0-2079557a8e89",
            "a8e50e62-afb3-486a-8f26-e978441b0eda",
            "0679b1c9-b86d-4040-b517-100f459981f8",
            "8c87e5d2-ae12-4fed-9508-18993539f920"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bdda6c48-bada-4897-b18e-d8f4248994d0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "93b4fefc-1981-4425-82d6-6346aea732b0",
          "name": "ALANYL-GLUTAMINE",
          "stdName": "ALANYL-GLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b1a4a44-a8bd-44f0-8d25-b4436630f6fd"
          ],
          "display_name": false
        },
        {
          "uuid": "09f91e55-488c-0f73-2022-032375ea855d",
          "name": "ALANYL-GLUTAMINE DIPEPTIDE",
          "stdName": "ALANYL-GLUTAMINE DIPEPTIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "121df9a9-5307-7ca9-e038-27a82c389d79"
          ],
          "display_name": false
        },
        {
          "uuid": "27667303-ce10-4681-9ad1-be9acb752721",
          "name": "ALANYLGLUTAMINE",
          "stdName": "ALANYLGLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92bca92d-6565-404a-9eda-15ad75bf8c7a"
          ],
          "display_name": false
        },
        {
          "uuid": "34db1919-b540-cc84-10a4-44dd6f4c60f3",
          "name": "Alanyl glutamine [WHO-DD]",
          "stdName": "ALANYL GLUTAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ce5dc60-140a-82e3-bb82-8ab818b650dc"
          ],
          "display_name": false
        },
        {
          "uuid": "4eecba33-4f25-40fb-8f8c-d988e3883523",
          "name": "DIPEPTAMIN",
          "stdName": "DIPEPTAMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92bca92d-6565-404a-9eda-15ad75bf8c7a"
          ],
          "display_name": false
        },
        {
          "uuid": "d1b0b4d8-1bbd-2090-eba5-47ec2aeb4492",
          "name": "FEMA NO. 4712",
          "stdName": "FEMA NO. 4712",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a531fada-0e61-12d2-8598-1cd54a7c9d4a",
            "efd5cdb7-e4df-7103-3d5c-f9488c96baaa"
          ],
          "display_name": false
        },
        {
          "uuid": "e4d8c740-584f-47bd-9d76-62406227b4f8",
          "name": "GLUTAMAX",
          "stdName": "GLUTAMAX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92bca92d-6565-404a-9eda-15ad75bf8c7a"
          ],
          "display_name": false
        },
        {
          "uuid": "cced56bb-03b5-cd2d-a524-d58297c2c4e2",
          "name": "GLUTAMINE, N2-L-ALANYL-",
          "stdName": "GLUTAMINE, N2-L-ALANYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efd5cdb7-e4df-7103-3d5c-f9488c96baaa",
            "a531fada-0e61-12d2-8598-1cd54a7c9d4a"
          ],
          "display_name": false
        },
        {
          "uuid": "732bb7cc-bd52-496a-b0e8-9dd858994c74",
          "name": "L-ALANYL-L-GLUTAMINE",
          "stdName": "L-ALANYL-L-GLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69357aad-a764-4a24-8aa3-384a5eb97797",
            "47676da1-1dfb-4bcb-8821-330f86e53a0e",
            "f83f69a0-24a3-437b-9591-53f9f4c61241",
            "73732d8a-9f95-46a0-9bfa-b57d79bbe3de"
          ],
          "display_name": false
        },
        {
          "uuid": "f80fcbe1-5429-4ffa-9975-198c3a760ebe",
          "name": "L-ALANYL-L-GLUTAMINE AMINO ACID",
          "stdName": "L-ALANYL-L-GLUTAMINE AMINO ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69357aad-a764-4a24-8aa3-384a5eb97797",
            "73732d8a-9f95-46a0-9bfa-b57d79bbe3de"
          ],
          "display_name": false
        },
        {
          "uuid": "0ca27d38-4e31-4ea6-962e-09cf692c0245",
          "name": "L-ALANYL-L-GLUTAMINE [USP-RS]",
          "stdName": "L-ALANYL-L-GLUTAMINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69357aad-a764-4a24-8aa3-384a5eb97797",
            "47676da1-1dfb-4bcb-8821-330f86e53a0e"
          ],
          "display_name": false
        },
        {
          "uuid": "5c588656-d33a-4609-befc-3afcf0afa4a1",
          "name": "L-GLUTAMINE, N2-L-ALANYL-",
          "stdName": "L-GLUTAMINE, N2-L-ALANYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92bca92d-6565-404a-9eda-15ad75bf8c7a"
          ],
          "display_name": false
        },
        {
          "uuid": "4e2de740-e9b3-4ba9-b3ff-f154d6a8a68c",
          "name": "N(2)-L-ALANYL-L-GLUTAMINE",
          "stdName": "N(2)-L-ALANYL-L-GLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92bca92d-6565-404a-9eda-15ad75bf8c7a"
          ],
          "display_name": false
        },
        {
          "uuid": "5aa211ac-5a80-42fb-9864-26ad0c161649",
          "name": "N(2)-L-ALANYL-LEVOGLUTAMIDE",
          "stdName": "N(2)-L-ALANYL-LEVOGLUTAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b87ae214-c26d-4ea6-be94-ceb62beba5f8"
          ],
          "display_name": false
        },
        {
          "uuid": "ee64adda-1f8a-4fd4-90f0-2068a73a3827",
          "name": "SUSTAMINE",
          "stdName": "SUSTAMINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8504e9d-d262-4d46-a72e-38a133a6775a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9b1a4a44-a8bd-44f0-8d25-b4436630f6fd",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "73732d8a-9f95-46a0-9bfa-b57d79bbe3de",
          "citation": "http://www.bioresearchonline.com/product.mvc/L-Alanyl-L-Glutamine-Amino-Acid-Ala-Gln-0001?VNETCOOKIE",
          "url": "http://www.bioresearchonline.com/product.mvc/L-Alanyl-L-Glutamine-Amino-Acid-Ala-Gln-0001?VNETCOOKIE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69357aad-a764-4a24-8aa3-384a5eb97797",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0679b1c9-b86d-4040-b517-100f459981f8",
          "citation": "WHO-LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "353e240b-1a95-4827-8c74-e12f28b7ef70",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47676da1-1dfb-4bcb-8821-330f86e53a0e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92bca92d-6565-404a-9eda-15ad75bf8c7a",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c87e5d2-ae12-4fed-9508-18993539f920",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45b179f4-a546-4522-8c19-3721781d8037",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f0f6c94-eaf3-45b2-80ad-7eab26ad1bf6",
          "citation": "SRS import [U5JDO2770Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U5JDO2770Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8e50e62-afb3-486a-8f26-e978441b0eda",
          "citation": "ALANYL GLUTAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f83f69a0-24a3-437b-9591-53f9f4c61241",
          "citation": "L-ALANYL-L-GLUTAMINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f38ce554-b09f-479b-b3d0-2079557a8e89",
          "citation": "ALANYL GLUTAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "121df9a9-5307-7ca9-e038-27a82c389d79",
          "citation": "ORPHAN DRUG",
          "doc_type": "ORPHAN DRUG",
          "public_domain": true
        },
        {
          "uuid": "43316d33-ef7d-6e7d-c39a-aeba133075a9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=39537-23-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4bd5fdf4-2b85-ad69-b330-01137a2c7976",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "efd5cdb7-e4df-7103-3d5c-f9488c96baaa",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a531fada-0e61-12d2-8598-1cd54a7c9d4a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "35b26515-154b-4900-ba4d-583f201cc49d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "07064176-1676-826c-27b9-984dd9722e4c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c8504e9d-d262-4d46-a72e-38a133a6775a",
          "citation": "https://kyowa-usa.com/news/2015/study-shows-taking-sustamine-l-alanyl-l-glutamine-during-exercise-may-ward-off-exhaustion",
          "url": "https://kyowa-usa.com/news/2015/study-shows-taking-sustamine-l-alanyl-l-glutamine-during-exercise-may-ward-off-exhaustion",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "1ce5dc60-140a-82e3-bb82-8ab818b650dc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "266ff015-2ae5-63a8-8f3c-8367861c6baf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "82d5f346-d4b5-da1c-46a3-d354d35d07a6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b87ae214-c26d-4ea6-be94-ceb62beba5f8",
          "citation": "mhra",
          "doc_type": "MHRSA",
          "public_domain": true
        },
        {
          "uuid": "e0851e6e-a986-0875-d102-0a3c9a369c3b",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c37a4a0a-fa76-43f1-8d3f-70ac1bddabd1",
          "id": "c37a4a0a-fa76-43f1-8d3f-70ac1bddabd1",
          "molfile": "\n  Marvin  01132110062D          \n\n 15 14  0  0  1  0            999 V2000\n    5.5144   -4.1354    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4795   -3.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8124   -4.5762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2421   -4.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2769   -5.3368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9488   -4.0747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6765   -4.4550    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.3786   -4.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1108   -4.3944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7992   -3.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7666   -3.1838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6115   -4.2616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7112   -5.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4439   -5.6701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0240   -5.7441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
          "smiles": "C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N",
          "formula": "C8H15N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "06bcea2e-9f4f-4645-b3f2-c91465906394"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "217.2227",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a6caf865-2fa3-4270-9ec9-d5147dbc8d0e",
      "version": "31",
      "structure": {
        "id": "fbb23d73-af75-497a-b18f-970fc6b41210",
        "molfile": "\n  Marvin  01132113022D          \n\n 15 14  0  0  1  0            999 V2000\n    6.2421   -4.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9488   -4.0747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6765   -4.4550    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7112   -5.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4439   -5.6701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0240   -5.7441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3786   -4.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1108   -4.3944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7992   -3.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6115   -4.2616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7666   -3.1838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2769   -5.3368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5144   -4.1354    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8124   -4.5762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4795   -3.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  3  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12  1  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N",
        "formula": "C8H15N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "217.2227",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2f0f6c94-eaf3-45b2-80ad-7eab26ad1bf6",
          "9b1a4a44-a8bd-44f0-8d25-b4436630f6fd"
        ],
        "stereo_centers": 2
      },
      "unii": "U5JDO2770Z"
    }
  ]
}