{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7adf8ff8-5a4f-4e0a-b918-c8d248f5611f",
          "code": "QV03AB02",
          "comments": "VATC|ALL OTHER THERAPEUTIC PRODUCTS|ALL OTHER THERAPEUTIC PRODUCTS|Antidotes|nalorphine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QV03AB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "fdc91e6d-f6ba-44e5-9637-009c47590ba2",
          "code": "62-67-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=62-67-9",
          "code_system": "CAS",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658",
            "913dcfbb-664b-42e2-b59c-da65d9302961"
          ]
        },
        {
          "uuid": "2dceb8d5-3e7f-4404-8a2e-e6f4f831523a",
          "code": "D009269",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009269",
          "code_system": "MESH",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "0e7865af-cf9b-4f02-882d-bfe00bc53273",
          "code": "NALORPHINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nalorphine",
          "code_system": "WIKIPEDIA",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "22f9eca3-67b2-4512-9c2b-ffd2be5cb175",
          "code": "V03AB02",
          "comments": "ATC|VARIOUS|ALL OTHER THERAPEUTIC PRODUCTS|ALL OTHER THERAPEUTIC PRODUCTS|Antidotes|nalorphine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=V03AB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "44b2508d-53e1-4737-b786-c6f60de89705",
          "code": "30",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=30",
          "code_system": "INN",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "9fc84d17-b871-4928-b35f-3adae91be46b",
          "code": "200-546-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.497",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "1e97022d-16ca-4b0f-a384-39de6f355144",
          "code": "9400",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Nalorphine",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "5cab47e2-ffae-455b-a161-08dc854c26e4",
          "code": "1629",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=1629",
          "code_system": "IUPHAR",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "938430cc-f3f2-4435-bc6f-9be1af3d6bcb",
          "code": "m7716",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7716?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "ee24d904-4957-4c3e-94ba-cb563fbf10c1",
          "code": "SUB09141MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "ea2004bc-ff21-4578-aa62-4d1e5a987703",
          "code": "CHEMBL415284",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL415284",
          "code_system": "ChEMBL",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "9bcc13a3-0426-49af-8342-9e09a0c9f21d",
          "code": "5284595",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5284595",
          "code_system": "PUBCHEM",
          "references": [
            "03331ebb-fc3e-46e4-95a5-68d7df78f658"
          ]
        },
        {
          "uuid": "b8ddbb6a-3c6f-6f77-0209-5e9067bb22a2",
          "code": "C170198",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C170198",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c5d2964e-499a-2b31-b51a-b74df7a602b0"
          ]
        },
        {
          "uuid": "0e4e8a5d-6b1f-c049-b4b9-3e37a7cb81b1",
          "code": "3278",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3278",
          "code_system": "HSDB",
          "references": [
            "897bb6f7-baf6-2a0e-ae05-e17b75a70f13"
          ]
        },
        {
          "uuid": "052b6a21-a23f-c776-ea1a-6be3b3bef0a8",
          "code": "DTXSID3023348",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023348",
          "code_system": "EPA CompTox",
          "references": [
            "5c4b3eea-e8c8-ba60-6ae3-7ce4834f3b0d"
          ]
        },
        {
          "uuid": "a427239b-54aa-47ec-8b22-8e458fd80cc0",
          "code": "U59WB2WRY2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6a2e011e-89d8-872f-3237-a8b8a7c79d71",
          "code": "DB11490",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11490",
          "code_system": "DRUG BANK",
          "references": [
            "c5d2964e-499a-2b31-b51a-b74df7a602b0"
          ]
        },
        {
          "uuid": "5ee3b8fc-9f50-4ca8-6eea-56b730e2e6e7",
          "code": "1877",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1877",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c5d2964e-499a-2b31-b51a-b74df7a602b0"
          ]
        },
        {
          "uuid": "9a36a2f0-5953-eaa1-4017-0d93c68b6886",
          "code": "100000084442",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "82a1f043-825d-a077-2f31-305e4d6fa593"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "835376b5-db11-4dcc-8436-1d616e747a8e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d206ffff-72e5-4436-977a-08f7861f3d76",
            "refuuid": "a9cf723f-75e3-4bfe-bbb2-4bd6ef6cc8e9",
            "name": "NALORPHINE",
            "unii": "U59WB2WRY2",
            "linking_id": "U59WB2WRY2",
            "ref_pname": "NALORPHINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fad86479-8d78-4140-973c-5dc721b62261",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ef0fbb58-50ad-4cd0-a590-1db09244ba96",
            "refuuid": "a5334eaa-316b-4b1d-93a9-30bb4c24fe7d",
            "name": "NALORPHINE HYDROCHLORIDE",
            "unii": "9FPE56Z2TW",
            "linking_id": "9FPE56Z2TW",
            "ref_pname": "NALORPHINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "af9374db-8b08-48b4-804d-e89ee01baaef",
          "name": "MORPHINAN-3,6-DIOL, 7,8-DIDEHYDRO-4,5-EPOXY-17-(2-PROPENYL)-(5.ALPHA.,6.ALPHA.)-",
          "stdName": "MORPHINAN-3,6-DIOL, 7,8-DIDEHYDRO-4,5-EPOXY-17-(2-PROPENYL)-(5.ALPHA.,6.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "962eb2c6-5359-4129-bf54-3f06f04e10b9",
            "9164f72e-b5a9-448a-a91c-a4b56620a340"
          ],
          "display_name": false
        },
        {
          "uuid": "b792a062-3f5c-49ce-9a58-5c8e800e2f20",
          "name": "NALORPHINE",
          "stdName": "NALORPHINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "381d60fa-8c01-4599-a14f-1bd0c56e5ecd",
            "37673cc1-1288-4c50-bc3e-2a6774d7a908",
            "438d7248-c9af-4167-8298-6abb1f0dbef0",
            "68be8ea7-d794-41de-95f7-1b502cb1a597",
            "77ae2cc6-eb4a-47a7-82ed-4c96183ba1a9",
            "a236796d-bc2d-4157-b611-af67cea74534",
            "9164f72e-b5a9-448a-a91c-a4b56620a340",
            "e02214fd-aa5d-40c0-ab73-511c1311e099",
            "636b4070-c5ab-49a9-8d93-e0df2588bba7",
            "1517aa46-697e-4327-8db6-6d6f235b59ce",
            "7e30d981-3716-4c09-9530-fc0cbc6a5aa1",
            "78d69256-22cb-46a1-8d4d-18e8e7df669d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "145b90bc-c686-4cee-bcfb-68346dcde0ae",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "abc45e4d-b08d-4919-bfc7-2f643e08dea5",
          "name": "NALORPHINE SERB",
          "stdName": "NALORPHINE SERB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b7d3464-f8d4-4f02-ad12-751de543a7f6",
            "1df88a35-df6e-4eff-8377-04b629aef542"
          ],
          "display_name": false
        },
        {
          "uuid": "c23743a6-2c39-4f46-b3ea-6f6d3dac0c01",
          "name": "NALORPHINE [HSDB]",
          "stdName": "NALORPHINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1517aa46-697e-4327-8db6-6d6f235b59ce",
            "9164f72e-b5a9-448a-a91c-a4b56620a340"
          ],
          "display_name": false
        },
        {
          "uuid": "990e0485-e35e-4084-b7e3-4b451874bdae",
          "name": "NALORPHINE [MART.]",
          "stdName": "NALORPHINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae2cc6-eb4a-47a7-82ed-4c96183ba1a9"
          ],
          "display_name": false
        },
        {
          "uuid": "c1053277-88f9-4fd6-8df5-63b889076bb1",
          "name": "NALORPHINE [MI]",
          "stdName": "NALORPHINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "636b4070-c5ab-49a9-8d93-e0df2588bba7",
            "9164f72e-b5a9-448a-a91c-a4b56620a340"
          ],
          "display_name": false
        },
        {
          "uuid": "a46d9337-8b26-0082-fef2-9f05f6d3f307",
          "name": "Nalorphine [WHO-DD]",
          "stdName": "NALORPHINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "405d4335-6f39-b307-01ce-5df5a8fef6e8"
          ],
          "display_name": false
        },
        {
          "uuid": "1cff155a-a81b-41d7-9ff5-83f2994784a6",
          "name": "nalorphine [INN]",
          "stdName": "NALORPHINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e02214fd-aa5d-40c0-ab73-511c1311e099",
            "7d520a44-cd94-40fc-b51d-bc78442433cd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a236796d-bc2d-4157-b611-af67cea74534",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9164f72e-b5a9-448a-a91c-a4b56620a340",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "962eb2c6-5359-4129-bf54-3f06f04e10b9",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e02214fd-aa5d-40c0-ab73-511c1311e099",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77ae2cc6-eb4a-47a7-82ed-4c96183ba1a9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "636b4070-c5ab-49a9-8d93-e0df2588bba7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b7d3464-f8d4-4f02-ad12-751de543a7f6",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1df88a35-df6e-4eff-8377-04b629aef542",
          "citation": "D08247",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1517aa46-697e-4327-8db6-6d6f235b59ce",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e30d981-3716-4c09-9530-fc0cbc6a5aa1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03331ebb-fc3e-46e4-95a5-68d7df78f658",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f248541-d368-4325-bac7-8630ec8e7c5d",
          "citation": "SRS import [U59WB2WRY2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U59WB2WRY2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "438d7248-c9af-4167-8298-6abb1f0dbef0",
          "citation": "NALORPHINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78d69256-22cb-46a1-8d4d-18e8e7df669d",
          "citation": "NALORPHINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "381d60fa-8c01-4599-a14f-1bd0c56e5ecd",
          "citation": "NALORPHINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37673cc1-1288-4c50-bc3e-2a6774d7a908",
          "citation": "NALORPHINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68be8ea7-d794-41de-95f7-1b502cb1a597",
          "citation": "NALORPHINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "897bb6f7-baf6-2a0e-ae05-e17b75a70f13",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+62-67-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5c4b3eea-e8c8-ba60-6ae3-7ce4834f3b0d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=62-67-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c5d2964e-499a-2b31-b51a-b74df7a602b0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "913dcfbb-664b-42e2-b59c-da65d9302961",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7d520a44-cd94-40fc-b51d-bc78442433cd",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "405d4335-6f39-b307-01ce-5df5a8fef6e8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "82a1f043-825d-a077-2f31-305e4d6fa593",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5a72c5e0-ebef-44af-9f28-5f45b553caf6",
          "id": "5a72c5e0-ebef-44af-9f28-5f45b553caf6",
          "molfile": "\n  Marvin  01132104412D          \n\n 23 27  0  0  1  0            999 V2000\n    6.1870   -4.9614    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.3569   -5.4214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5418   -4.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9568   -4.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5418   -3.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9519   -2.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -2.8262    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1671   -2.1860    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1671   -1.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9422   -0.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9422    0.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3221   -2.1860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3571   -4.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -4.2363    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.1971   -3.5212    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.0221   -3.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4322   -4.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0172   -4.9614    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.4222   -5.6766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7317   -3.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3216   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7267   -4.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3116   -5.6365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 14  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 22  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n 14  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n 20  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 15  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 12  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "C=CCN1CC[C@@]23[C@H]4C=C[C@@H]([C@@H]2Oc5c(ccc(C[C@H]41)c53)O)O",
          "formula": "C19H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f2cc85ec-2c58-446a-9cef-2bc4b1fdd5e5"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "311.3757",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9cf723f-75e3-4bfe-bbb2-4bd6ef6cc8e9",
      "version": "13",
      "structure": {
        "id": "2c677593-7e84-46fe-95a8-165ce1486b8a",
        "molfile": "\n  Marvin  01132102242D          \n\n 25 29  0  0  1  0            999 V2000\n    5.7769   -4.2363    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9568   -4.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5418   -4.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7267   -4.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3116   -5.6365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3216   -4.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7317   -3.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5418   -3.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9519   -2.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -2.8262    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1971   -3.5212    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0221   -3.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4322   -4.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0172   -4.9614    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1870   -4.9614    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3569   -5.4214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5245   -6.2977    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4222   -5.6766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3869   -3.5212    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1671   -2.1860    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1671   -1.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9422   -0.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9422    0.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3221   -2.1860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3571   -4.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15  1  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  3  1  0  0  0  0\n 15 17  1  1  0  0  0\n 14 18  1  6  0  0  0\n 11 19  1  1  0  0  0\n 10 20  1  1  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 20  1  0  0  0  0\n 24 25  1  0  0  0  0\n  1 25  1  1  0  0  0\nM  END",
        "smiles": "C=CCN1CC[C@@]23[C@@]4([H])C=C[C@@H]([C@]2([H])Oc5c(ccc(C[C@H]41)c53)O)O",
        "formula": "C19H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "311.3757",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a236796d-bc2d-4157-b611-af67cea74534",
          "4f248541-d368-4325-bac7-8630ec8e7c5d",
          "7d520a44-cd94-40fc-b51d-bc78442433cd"
        ],
        "stereo_centers": 5
      },
      "unii": "U59WB2WRY2"
    }
  ]
}