{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "75aff475-b6e7-4ad8-a769-5eee2b1630fd",
          "code": "243973-20-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=243973-20-8",
          "code_system": "CAS",
          "references": [
            "10b2618f-9f33-415e-af66-95e97c64454e",
            "414bc9db-788d-4382-8a80-c7fa8033d6ab"
          ]
        },
        {
          "uuid": "99dfdd6f-a7f1-4e1d-ad37-d4f2c0f8d455",
          "code": "147500",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3425",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "10b2618f-9f33-415e-af66-95e97c64454e"
          ]
        },
        {
          "uuid": "5c4a6c77-ab78-4c99-b0df-fbed557891e2",
          "code": "m8834",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8834?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "10b2618f-9f33-415e-af66-95e97c64454e"
          ]
        },
        {
          "uuid": "57e611a3-5c2e-4232-8da2-6a62d877fbd0",
          "code": "210326",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/210326",
          "code_system": "PUBCHEM",
          "references": [
            "10b2618f-9f33-415e-af66-95e97c64454e"
          ]
        },
        {
          "uuid": "34dde0f9-72cc-62e6-4f7b-f0ae8af041d9",
          "code": "7884",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7884",
          "code_system": "HSDB",
          "references": [
            "270c206c-4cad-e0c2-be9e-5b086c1ead8e"
          ]
        },
        {
          "uuid": "f16c5110-dbcd-6fd9-ec6f-700942329793",
          "code": "DTXSID8034823",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8034823",
          "code_system": "EPA CompTox",
          "references": [
            "eb6d2aa6-f182-5a8d-0c99-3d0efa78bea3"
          ]
        },
        {
          "uuid": "07221e55-699c-47a5-9218-004f2f383658",
          "code": "U55GLF9LV9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ac3c86e3-d375-1c0a-de74-64fe5adea6d3",
          "code": "pinoxaden",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pinoxaden.html",
          "code_system": "ALANWOOD",
          "references": [
            "d8d0c8a6-5f12-2ce6-5142-7f30dbee901e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "440420ea-4633-4657-b230-e1664869c27d",
          "name": "8-(2,6-DIETHYL-4-METHYLPHENYL)-1,2,4,5-TETRAHYDRO-7-OXO-7H-PYRAZOLO(1,2-D)(1,4,5)OXADIAZEPIN-9-YL 2,2-DIMETHYLPROPANOATE",
          "stdName": "8-(2,6-DIETHYL-4-METHYLPHENYL)-1,2,4,5-TETRAHYDRO-7-OXO-7H-PYRAZOLO(1,2-D)(1,4,5)OXADIAZEPIN-9-YL 2,2-DIMETHYLPROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae410c1e-4594-4053-97d1-eba31f829184",
            "750a8d0e-391c-4d47-a0f7-33f34f1dbc70"
          ],
          "display_name": false
        },
        {
          "uuid": "b85bc84b-9c54-49c3-9198-5bc350a9ff4d",
          "name": "8-(2,6-DIETHYL-P-TOLYL)-1,2,4,5-TETRAHYDRO-7-OXO-7H-PYRAZOLO(1,2-D)(1,4,5)OXADIAZEPIN-9-YL 2,2-DIMETHYLPROPIONATE",
          "stdName": "8-(2,6-DIETHYL-P-TOLYL)-1,2,4,5-TETRAHYDRO-7-OXO-7H-PYRAZOLO(1,2-D)(1,4,5)OXADIAZEPIN-9-YL 2,2-DIMETHYLPROPIONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d11d09f-ff46-4e36-8cc8-14c5c24258e5",
            "750a8d0e-391c-4d47-a0f7-33f34f1dbc70"
          ],
          "display_name": false
        },
        {
          "uuid": "f4023e61-9f4d-4c64-9b20-070764abdce3",
          "name": "PINOXADEN",
          "stdName": "PINOXADEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be366e1-7007-47ec-bbae-e0c5f8252815",
            "328024b7-dee6-4ca1-8a74-7c1ae2c22ee4",
            "3d7cfb20-fb3b-44f7-b43c-ab638da720ca",
            "504213a6-3a7a-41be-964d-0dcf1578b4c8",
            "3b7b5afd-4982-4213-9ed7-621dde2c2de8",
            "237483bc-e6d6-49f0-aa4d-1d5130a0f465"
          ],
          "display_name": true
        },
        {
          "uuid": "cc0c83d3-09c5-4e95-9e06-22d862788141",
          "name": "PINOXADEN [ISO]",
          "stdName": "PINOXADEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be366e1-7007-47ec-bbae-e0c5f8252815",
            "504213a6-3a7a-41be-964d-0dcf1578b4c8"
          ],
          "display_name": false
        },
        {
          "uuid": "85415fbb-eb2c-40f0-9443-a12be57ab815",
          "name": "PINOXADEN [MI]",
          "stdName": "PINOXADEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be366e1-7007-47ec-bbae-e0c5f8252815",
            "3d7cfb20-fb3b-44f7-b43c-ab638da720ca"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "328024b7-dee6-4ca1-8a74-7c1ae2c22ee4",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "750a8d0e-391c-4d47-a0f7-33f34f1dbc70",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d11d09f-ff46-4e36-8cc8-14c5c24258e5",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae410c1e-4594-4053-97d1-eba31f829184",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d7cfb20-fb3b-44f7-b43c-ab638da720ca",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2be366e1-7007-47ec-bbae-e0c5f8252815",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "504213a6-3a7a-41be-964d-0dcf1578b4c8",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10b2618f-9f33-415e-af66-95e97c64454e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8756f8de-6864-43bc-9bd4-25964e9809f7",
          "citation": "SRS import [U55GLF9LV9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U55GLF9LV9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4922b01-008a-4577-b1d2-22755341f074",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "237483bc-e6d6-49f0-aa4d-1d5130a0f465",
          "citation": "PINOXADEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b7b5afd-4982-4213-9ed7-621dde2c2de8",
          "citation": "PINOXADEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "270c206c-4cad-e0c2-be9e-5b086c1ead8e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+243973-20-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb6d2aa6-f182-5a8d-0c99-3d0efa78bea3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=243973-20-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d8d0c8a6-5f12-2ce6-5142-7f30dbee901e",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "414bc9db-788d-4382-8a80-c7fa8033d6ab",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "73e05d63-e14e-4a53-8e96-c492edf2b2e3",
          "id": "73e05d63-e14e-4a53-8e96-c492edf2b2e3",
          "molfile": "\n  Marvin  01132106002D          \n\n 29 31  0  0  0  0            999 V2000\n    8.0531   -3.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4713   -4.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8886   -4.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7159   -4.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1384   -5.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9633   -5.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7252   -6.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9011   -6.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4912   -7.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0715   -7.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4893   -5.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6645   -5.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1759   -5.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -4.2382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -3.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0391   -3.8637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0473   -2.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8457   -2.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4633   -2.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2593   -2.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3883   -5.2858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7187   -4.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9025   -5.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5942   -5.7626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9602   -6.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7287   -6.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3883   -6.1107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1805   -6.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4417   -7.1488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 11  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 28 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 27  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\nM  END",
          "smiles": "CCc1cc(C)cc(CC)c1-c2c(=O)n3CCOCCn3c2OC(=O)C(C)(C)C",
          "formula": "C23H32N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a9d3718b-c31c-4c5a-adf9-1d970b7f9545"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "400.5121",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d30cbfb-cbe3-4a0d-959d-1c4d64f2813a",
      "version": "5",
      "structure": {
        "id": "3c436d29-6e93-4110-abbe-44a8b78ad208",
        "molfile": "\n  Marvin  01132103122D          \n\n 29 31  0  0  0  0            999 V2000\n    4.7187   -4.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9025   -5.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5942   -5.7626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9602   -6.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7287   -6.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3883   -6.1107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1805   -6.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6645   -5.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1759   -5.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3883   -5.2858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -4.2382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -3.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0473   -2.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8457   -2.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4633   -2.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2593   -2.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0391   -3.8637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4893   -5.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9011   -6.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7252   -6.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1384   -5.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7159   -4.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8886   -4.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4713   -4.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0531   -3.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9633   -5.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4912   -7.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0715   -7.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4417   -7.1488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10  6  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 12 17  2  0  0  0  0\n  8 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 18  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 21 26  1  0  0  0  0\n 19 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n  7 29  2  0  0  0  0\nM  END",
        "smiles": "CCc1cc(C)cc(CC)c1-c2c(=O)n3CCOCCn3c2OC(=O)C(C)(C)C",
        "formula": "C23H32N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "400.5121",
        "optical_activity": "NONE",
        "references": [
          "a4922b01-008a-4577-b1d2-22755341f074",
          "8756f8de-6864-43bc-9bd4-25964e9809f7"
        ],
        "stereo_centers": 0
      },
      "unii": "U55GLF9LV9"
    }
  ]
}