{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1f7de79d-4d50-4895-b3c6-4763af1c4e3f", "code": "465-21-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=465-21-4", "code_system": "CAS", "references": [ "844230c4-f1ae-4d8f-bfed-a30ae0093446", "9ded255f-81bc-465b-8f77-9cca321fe5ad" ] }, { "uuid": "e6fd231b-6b5d-46e7-9072-128f5d3e7c37", "code": "m2748", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m2748?q=authorize", "code_system": "MERCK INDEX", "references": [ "844230c4-f1ae-4d8f-bfed-a30ae0093446" ] }, { "uuid": "16d54b37-d115-4aa1-b4a0-a893b07678f4", "code": "9547215", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9547215", "code_system": "PUBCHEM", "references": [ "844230c4-f1ae-4d8f-bfed-a30ae0093446" ] }, { "uuid": "44457c4d-8726-a800-6060-b6c186b88b08", "code": "Bufalin", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Bufalin", "code_system": "WIKIPEDIA", "references": [ "2d9b151e-ce83-fc1b-3594-38a59d4c0135" ] }, { "uuid": "555eb552-f749-6718-a2b6-c254eae73e99", "code": "C471", "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C471", "code_system": "NCI_THESAURUS", "references": [ "786fa808-4b77-e5da-79ec-3719e44559b0" ] }, { "uuid": "a9efb829-80f6-df54-f4e7-c4c7f71ae081", "code": "C107555", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C107555", "code_system": "NCI_THESAURUS", "references": [ "81d576b5-a91b-9e90-e98d-043a961ea36f" ] }, { "uuid": "7c4ad69d-b2be-4546-a7f8-949807347eac", "code": "U549S98QLW", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3f0a0efe-c329-088c-7fad-bb3785c49831", "code": "89595", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=89595", "code_system": "NSC", "references": [ "e4ed6f0f-e468-3503-9eab-3bd8ede4595d" ] }, { "uuid": "b5a8932d-eb23-7922-2b7a-b358aa045d9f", "code": "DTXSID90873563", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90873563", "code_system": "EPA CompTox", "references": [ "786fa808-4b77-e5da-79ec-3719e44559b0" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ace86278-2851-4f89-9622-00cbe714aaf7", "name": "BUFA-20,22-DIENOLIDE, 3,14-DIHYDROXY-, (3.BETA.,5.BETA.)-", "stdName": "BUFA-20,22-DIENOLIDE, 3,14-DIHYDROXY-, (3.BETA.,5.BETA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "35418810-cf78-4f35-bfc0-000ccd756504", "50c656dd-2cda-404a-bb36-da9ad2829175" ], "display_name": false }, { "uuid": "0ab97a68-4ff6-40b8-9c91-594cb963cef1", "name": "BUFALIN", "stdName": "BUFALIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab10f58c-85f5-40d9-a766-67e1486c3eec", "d340d3e5-7dcf-49cd-aa7e-b9a6fc5961f5", "35418810-cf78-4f35-bfc0-000ccd756504", "bbb2dd0a-72e5-4929-9d99-9f63ddd42213" ], "display_name": true }, { "uuid": "9fc3aca6-586f-4a64-94a9-d68774f86d2f", "name": "BUFALIN [MI]", "stdName": "BUFALIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d340d3e5-7dcf-49cd-aa7e-b9a6fc5961f5", "35418810-cf78-4f35-bfc0-000ccd756504" ], "display_name": false }, { "uuid": "a6ffde12-727d-0955-fe08-c7918e2ba583", "name": "Bufalin [WHO-DD]", "stdName": "BUFALIN [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "40007141-3cf5-0aa8-93b1-695a0dd046be" ], "display_name": false }, { "uuid": "df70ccef-7f54-4e62-a2f8-5e408a2f5c62", "name": "NSC-89595", "stdName": "NSC-89595", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "35418810-cf78-4f35-bfc0-000ccd756504", "50c656dd-2cda-404a-bb36-da9ad2829175" ], "display_name": false } ], "references": [ { "uuid": "ab10f58c-85f5-40d9-a766-67e1486c3eec", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "35418810-cf78-4f35-bfc0-000ccd756504", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "50c656dd-2cda-404a-bb36-da9ad2829175", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d340d3e5-7dcf-49cd-aa7e-b9a6fc5961f5", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "844230c4-f1ae-4d8f-bfed-a30ae0093446", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391962000, "tags": [ "NOMEN" ] }, { "uuid": "c2403232-ccfe-4544-9728-84df5b9429d0", "citation": "SRS import [U549S98QLW]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U549S98QLW", "doc_type": "SRS", "public_domain": true, "document_date": 1493391962000, "tags": [ "NOMEN" ] }, { "uuid": "bbb2dd0a-72e5-4929-9d99-9f63ddd42213", "citation": "BUFALIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2d9b151e-ce83-fc1b-3594-38a59d4c0135", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Bufalin", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "786fa808-4b77-e5da-79ec-3719e44559b0", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "81d576b5-a91b-9e90-e98d-043a961ea36f", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "9ded255f-81bc-465b-8f77-9cca321fe5ad", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "40007141-3cf5-0aa8-93b1-695a0dd046be", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e4ed6f0f-e468-3503-9eab-3bd8ede4595d", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d8961e28-ce46-48c8-9a1c-911aa249bdb1", "id": "d8961e28-ce46-48c8-9a1c-911aa249bdb1", "molfile": "\n Marvin 01132111142D \n\n 28 32 0 0 1 0 999 V2000\n 10.7851 -4.8873 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 11.4526 -5.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1976 -6.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3726 -6.1569 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.7082 -6.9106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8206 -6.7700 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.0755 -7.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5234 -8.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7165 -7.9962 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.1644 -8.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3575 -8.4378 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.8054 -9.0509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1026 -7.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6546 -7.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4616 -7.2116 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.2066 -6.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0136 -6.5985 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.7586 -5.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3107 -5.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1177 -5.3723 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 9.9461 -4.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7851 -4.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0706 -3.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0706 -2.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7851 -2.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7851 -1.5873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4996 -2.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4996 -3.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 20 1 1 0 0 0 0\n 1 22 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 6 4 1 0 0 0 0\n 4 20 1 0 0 0 0\n 6 7 1 6 0 0 0\n 6 17 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 6 0 0 0\n 15 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 1 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 1 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 1 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\n 22 23 1 0 0 0 0\n 22 28 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 27 25 1 0 0 0 0\n 28 27 1 0 0 0 0\nM END", "smiles": "C[C@@]12CC[C@@H](C[C@H]2CC[C@@H]3[C@@H]1CC[C@]4(C)[C@H](CC[C@]34O)c5ccc(=O)oc5)O", "formula": "C24H34O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fc578ba0-f0b1-43d0-98ae-b724ace8307c" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "386.5253", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "COMPLETE", "uuid": "b5dbcbdc-a361-4289-a595-0fa7381ab59f", "version": "12", "structure": { "id": "7116e7d8-5aa8-4f8c-8629-938ea6c72eea", "molfile": "\n Marvin 01132105522D \n\n 31 35 0 0 1 0 999 V2000\n 10.7082 -6.9106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3726 -6.1569 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.8206 -6.7700 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.5656 -5.9854 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0755 -7.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5234 -8.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7165 -7.9962 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.9714 -8.7809 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1644 -8.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3575 -8.4378 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.8054 -9.0509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1026 -7.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6546 -7.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4616 -7.2116 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.2066 -6.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0136 -6.5985 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.2685 -7.3831 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7586 -5.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3107 -5.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1177 -5.3723 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.7851 -4.8873 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.7851 -4.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4996 -3.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4996 -2.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7851 -2.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7851 -1.5873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0706 -2.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0706 -3.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4526 -5.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1976 -6.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9461 -4.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 1 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 7 1 0 0 0 0\n 14 15 1 1 0 0 0\n 16 14 1 0 0 0 0\n 3 16 1 0 0 0 0\n 16 17 1 6 0 0 0\n 16 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 2 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 1 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 27 25 1 0 0 0 0\n 28 27 2 0 0 0 0\n 22 28 1 0 0 0 0\n 21 29 1 0 0 0 0\n 2 30 1 0 0 0 0\n 30 29 1 0 0 0 0\n 20 31 1 1 0 0 0\nM END", "smiles": "C[C@@]12CC[C@@H](C[C@@]2([H])CC[C@]3([H])[C@]1([H])CC[C@]4(C)[C@H](CC[C@]34O)c5ccc(=O)oc5)O", "formula": "C24H34O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "386.5253", "optical_activity": "UNSPECIFIED", "references": [ "ab10f58c-85f5-40d9-a766-67e1486c3eec", "c2403232-ccfe-4544-9728-84df5b9429d0" ], "stereo_centers": 8 }, "unii": "U549S98QLW" } ] }