{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ab0775f6-46c9-4dec-8cb1-1737f6464b6c",
          "code": "61813-98-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61813-98-7",
          "code_system": "CAS",
          "references": [
            "3f46ccfe-524a-674e-8022-7367e1fc0d14"
          ]
        },
        {
          "uuid": "089beef1-1854-4f67-a9ef-f9207d2ce56e",
          "code": "4645-07-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4645-07-2",
          "code_system": "CAS",
          "references": [
            "3f46ccfe-524a-674e-8022-7367e1fc0d14"
          ]
        },
        {
          "uuid": "18d30ce6-d268-4044-9daf-1b193ed70387",
          "code": "16335-66-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16335-66-3",
          "code_system": "CAS",
          "references": [
            "3f46ccfe-524a-674e-8022-7367e1fc0d14"
          ]
        },
        {
          "uuid": "eccaabb7-1716-47cb-ac99-5c1eb00bd020",
          "code": "1005512-01-5",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1005512-01-5",
          "code_system": "CAS",
          "references": [
            "3f46ccfe-524a-674e-8022-7367e1fc0d14"
          ]
        },
        {
          "uuid": "5744d161-c29e-4eda-b29b-b50c4586a7b8",
          "code": "890719-42-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=890719-42-3",
          "code_system": "CAS",
          "references": [
            "3f46ccfe-524a-674e-8022-7367e1fc0d14"
          ]
        },
        {
          "uuid": "8fe11007-961f-46e4-8e82-3f2ebb559dd3",
          "code": "225-074-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.795",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0b54c325-f2d1-41d7-8eb1-7985e91cf361"
          ]
        },
        {
          "uuid": "cd643c2c-208a-4de3-863b-a554665dac5c",
          "code": "62545",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62545",
          "code_system": "PUBCHEM",
          "references": [
            "0b54c325-f2d1-41d7-8eb1-7985e91cf361"
          ]
        },
        {
          "uuid": "422e4bca-529b-0e1a-46cf-7bf131843567",
          "code": "DTXSID3044677",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3044677",
          "code_system": "EPA CompTox",
          "references": [
            "371d4ac7-1b52-4a95-fec5-12266ca9ceab"
          ]
        },
        {
          "uuid": "3629f634-4b87-4ff8-97f2-117ac4c8ab56",
          "code": "2086291-16-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2086291-16-7",
          "code_system": "CAS",
          "references": [
            "3f46ccfe-524a-674e-8022-7367e1fc0d14"
          ]
        },
        {
          "uuid": "2881a515-d340-41d2-873d-cbf9bbe8ac5c",
          "code": "U4AYW7ZJ90",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "8ff61809-face-4238-80ff-2fa5d77dc18d",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "cdb74ad9-8a18-442d-9a44-46a53f9163f2",
            "refuuid": "c7393b6e-bc05-8661-e0dc-71af3568ddc7",
            "name": "ALTERNATIVE DEFINITION for [SOLVENT YELLOW 72]",
            "linking_id": "c7393b6e-bc05-8661-e0dc-71af3568ddc7",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5caf28f2-9494-441c-a8f7-d935c716774a",
          "name": "2-PYRAZOLIN-5-ONE, 4-((O-METHOXYPHENYL)AZO)-3-METHYL-1-PHENYL-",
          "stdName": "2-PYRAZOLIN-5-ONE, 4-((O-METHOXYPHENYL)AZO)-3-METHYL-1-PHENYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1407ba8-f7d9-4679-92a9-9c14718d040a"
          ],
          "display_name": false
        },
        {
          "uuid": "7528a80e-8170-45b9-a1c7-6a2c14765d4d",
          "name": "3H-PYRAZOL-3-ONE, 2,4-DIHYDRO-4-(2-(2-METHOXYPHENYL)DIAZENYL)-5-METHYL-2-PHENYL-",
          "stdName": "3H-PYRAZOL-3-ONE, 2,4-DIHYDRO-4-(2-(2-METHOXYPHENYL)DIAZENYL)-5-METHYL-2-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1407ba8-f7d9-4679-92a9-9c14718d040a"
          ],
          "display_name": false
        },
        {
          "uuid": "58dbf7f1-8626-4a67-905c-1e4321751a51",
          "name": "4-((O-METHOXYPHENYL)AZO)-3-METHYL-1-PHENYL-2-PYRAZOLIN-5-ONE",
          "stdName": "4-((O-METHOXYPHENYL)AZO)-3-METHYL-1-PHENYL-2-PYRAZOLIN-5-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1704399a-f6b1-42d9-8944-84f7b53bb49c"
          ],
          "display_name": false
        },
        {
          "uuid": "328cae16-c623-47e8-992a-7d3a8005ddad",
          "name": "C.I. 127450",
          "stdName": "C.I. 127450",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1407ba8-f7d9-4679-92a9-9c14718d040a"
          ],
          "display_name": false
        },
        {
          "uuid": "ffa7928c-373d-4008-b3e0-4cbe43dc4ece",
          "name": "C.I. SOLVENT YELLOW 72",
          "stdName": "C.I. SOLVENT YELLOW 72",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1407ba8-f7d9-4679-92a9-9c14718d040a"
          ],
          "display_name": false
        },
        {
          "uuid": "4dc46b19-cd8d-4feb-a430-34ac442bc39b",
          "name": "CI 127450",
          "stdName": "CI 127450",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "861c9567-26f0-4545-a127-bd1622bca546"
          ],
          "display_name": false
        },
        {
          "uuid": "463cf632-8c1d-4620-a526-492e1a2d2a44",
          "name": "SOLVENT YELLOW 72",
          "stdName": "SOLVENT YELLOW 72",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "861c9567-26f0-4545-a127-bd1622bca546"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "3f46ccfe-524a-674e-8022-7367e1fc0d14",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1704399a-f6b1-42d9-8944-84f7b53bb49c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "861c9567-26f0-4545-a127-bd1622bca546",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1407ba8-f7d9-4679-92a9-9c14718d040a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b54c325-f2d1-41d7-8eb1-7985e91cf361",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392056000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "492edf42-05ef-40f6-b873-0d48072ca6c6",
          "citation": "SRS import [U4AYW7ZJ90]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U4AYW7ZJ90",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392056000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "371d4ac7-1b52-4a95-fec5-12266ca9ceab",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4645-07-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dbcd22ef-76d9-4898-8c25-2720a97bbf2b",
          "id": "dbcd22ef-76d9-4898-8c25-2720a97bbf2b",
          "molfile": "\n  Marvin  01132111242D          \n\n 23 25  0  0  0  0            999 V2000\n    3.3257   -4.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0402   -4.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0402   -5.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3257   -5.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3257   -6.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0402   -7.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7547   -6.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7547   -5.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4691   -5.5227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4691   -4.6977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1836   -4.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2698   -3.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6567   -2.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0768   -3.2933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4893   -4.0078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3097   -4.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7946   -3.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6152   -3.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9507   -4.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4658   -4.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6453   -4.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9373   -4.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1087   -5.4278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 22 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(=O)n(-c2ccccc2)[nH]1)/N=N/c3ccccc3OC",
          "formula": "C17H16N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "20865150-d577-4ac2-bc42-1a7089193fce"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "308.3352",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e7713d57-df30-4e3a-9fa5-71f16bee452f",
      "version": "9",
      "structure": {
        "id": "a59460be-89db-4b22-be10-d8e3ec574b8c",
        "molfile": "\n  Marvin  01132108362D          \n\n 23 25  0  0  0  0            999 V2000\n    7.0768   -3.2933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4893   -4.0078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9373   -4.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1836   -4.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2698   -3.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6567   -2.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4691   -4.6977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4691   -5.5227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7547   -5.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7547   -6.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0402   -7.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3257   -6.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3257   -5.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0402   -5.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0402   -4.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3257   -4.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1087   -5.4278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3097   -4.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7946   -3.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6152   -3.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9507   -4.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4658   -4.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6453   -4.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  1  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  9 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  3 17  1  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 18 23  2  0  0  0  0\nM  END",
        "smiles": "Cc1c(c(n(-c2ccccc2)n1)O)/N=N/c3ccccc3OC",
        "formula": "C17H16N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "308.3352",
        "optical_activity": "NONE",
        "references": [
          "a1407ba8-f7d9-4679-92a9-9c14718d040a",
          "492edf42-05ef-40f6-b873-0d48072ca6c6"
        ],
        "stereo_centers": 0
      },
      "unii": "U4AYW7ZJ90"
    }
  ]
}