{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e2b0e1a6-72a8-481e-b9d3-4a23a1748884", "code": "78-12-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=78-12-6", "code_system": "CAS", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd", "9e3f0765-7174-4f74-b274-726ab55eece7" ] }, { "uuid": "9eba0cd7-3ecd-4790-a6b3-31ecc4c2a112", "code": "PETRICHLORAL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Petrichloral", "code_system": "WIKIPEDIA", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "26666687-6ce8-4f54-9d2f-aee47c68bfc6", "code": "517", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=517", "code_system": "INN", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "84596b5f-e68d-41df-bfd0-062230fcd941", "code": "2591", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "a4eb202d-b10d-4691-8fd8-872688f05016", "code": "m869", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m869?q=authorize", "code_system": "MERCK INDEX", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "46ed3d04-be09-408d-90d7-4af460f2bf33", "code": "SUB09739MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "9cd95993-6c94-4aac-aab0-2a954d9ba6ba", "code": "CHEMBL2104857", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104857", "code_system": "ChEMBL", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "bf271194-90cd-4171-a151-631dc14fdcb6", "code": "6519", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6519", "code_system": "PUBCHEM", "references": [ "c48b9ae3-c888-4552-9efe-a7e532078ddd" ] }, { "uuid": "e6869f8b-e5bb-4719-eed7-2e145f5d2f04", "code": "C170313", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C170313", "code_system": "NCI_THESAURUS", "references": [ "22763409-68a2-2f30-7d86-aaa53a5e1565" ] }, { "uuid": "fccc5f3b-f260-4dcc-ba3a-1cde5b4bea72", "code": "U49LID4UYJ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d6ecfeba-e607-1717-4640-1d5e03ba03de", "code": "2086", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2086", "code_system": "DRUG CENTRAL", "references": [ "22763409-68a2-2f30-7d86-aaa53a5e1565" ] }, { "uuid": "ed7b5ddc-8dd3-1d5d-0955-1fb44e796efd", "code": "DTXSID00861633", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00861633", "code_system": "EPA CompTox", "references": [ "22763409-68a2-2f30-7d86-aaa53a5e1565" ] }, { "uuid": "98454121-efb3-ceb5-fde4-2ede7b7084c2", "code": "100000082204", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "1175d028-8a21-b082-4539-d72145f93681" ] } ], "relationships": [ { "uuid": "dbe0c396-cb0d-4f74-bdec-098ec184dc0b", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "a9ece066-c055-427f-822a-df6ceec68ada", "refuuid": "8da5acb4-4a92-45b3-94ab-272fb694e15b", "name": "PETRICHLORAL", "unii": "U49LID4UYJ", "linking_id": "U49LID4UYJ", "ref_pname": "PETRICHLORAL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "5c956f8c-0b25-4ace-94f7-b57f2ff661f3", "name": "PENTAERYTHRITOL CHLORAL", "stdName": "PENTAERYTHRITOL CHLORAL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5418cd9f-0b78-40d8-a5d4-a80eb97da8bc", "7431f521-84b0-4d3e-a38b-2d3e24b104f4", "00f68220-83e0-4f78-ae7a-0ad945ad4615", "5bdd8e65-e184-4d8a-9c8b-e8477daefeeb" ], "display_name": false }, { "uuid": "ae671d02-144d-4e5f-911c-b3fcc8c7bfc4", "name": "PENTAERYTHRITOL CHLORAL [MI]", "stdName": "PENTAERYTHRITOL CHLORAL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7431f521-84b0-4d3e-a38b-2d3e24b104f4", "5bdd8e65-e184-4d8a-9c8b-e8477daefeeb" ], "display_name": false }, { "uuid": "cbf071bb-81fb-4fd2-af24-fd788d6c15a4", "name": "PETRICHLORAL", "stdName": "PETRICHLORAL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "5d6199dc-be00-4de5-a35f-55d92d495ffd", "3def7572-2f53-4e93-9cdb-0a264ccce241", "2458b707-98dc-4f08-bbe9-8829adf26516" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "8fc81ac5-b10c-4f51-b80b-df48c30b8f31", "name_org": "INN" } ] }, { "uuid": "34316087-cde4-422c-b823-b110d635d95a", "name": "petrichloral [INN]", "stdName": "PETRICHLORAL [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5d6199dc-be00-4de5-a35f-55d92d495ffd" ], "display_name": false } ], "references": [ { "uuid": "00f68220-83e0-4f78-ae7a-0ad945ad4615", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5bdd8e65-e184-4d8a-9c8b-e8477daefeeb", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3def7572-2f53-4e93-9cdb-0a264ccce241", "citation": "EMEA 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5d6199dc-be00-4de5-a35f-55d92d495ffd", "citation": "INN Proposed List 6", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7431f521-84b0-4d3e-a38b-2d3e24b104f4", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c48b9ae3-c888-4552-9efe-a7e532078ddd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390965000, "tags": [ "NOMEN" ] }, { "uuid": "d24c3631-41fe-4fdb-abf9-297cc38cbc02", "citation": "SRS import [U49LID4UYJ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U49LID4UYJ", "doc_type": "SRS", "public_domain": true, "document_date": 1493390965000, "tags": [ "NOMEN" ] }, { "uuid": "2458b707-98dc-4f08-bbe9-8829adf26516", "citation": "PETRICHLORAL [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5418cd9f-0b78-40d8-a5d4-a80eb97da8bc", "citation": "PENTAERYTHRITOL CHLORAL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "22763409-68a2-2f30-7d86-aaa53a5e1565", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "9e3f0765-7174-4f74-b274-726ab55eece7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "1175d028-8a21-b082-4539-d72145f93681", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "70c9c58b-495f-451e-aeeb-8fa1d3f46b32", "id": "70c9c58b-495f-451e-aeeb-8fa1d3f46b32", "molfile": "\n Marvin 01132105512D \n\n 33 32 0 0 0 0 999 V2000\n 6.5328 -0.8487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7532 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.2861 -2.1118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2006 -2.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4966 -2.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1085 -3.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0361 -3.4868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5032 -4.1315 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.2828 -4.7532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2894 -4.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9045 -4.7236 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7072 -3.5888 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3222 -4.1282 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8782 -3.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9506 -3.4769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4835 -4.1183 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.7039 -4.7400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6974 -4.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2796 -3.5789 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6644 -4.1183 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0822 -4.7104 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7927 -2.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8782 -2.0953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4144 -1.4539 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.6348 -0.8289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6250 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0098 -0.8585 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2072 -1.9934 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5921 -1.4539 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5426 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1578 -0.8783 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9604 -2.0131 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5756 -1.4704 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 30 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 14 1 0 0 0 0\n 22 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 1 0 0 0 0\n 21 18 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 24 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 26 1 0 0 0 0\n 29 26 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 30 1 0 0 0 0\n 33 30 1 0 0 0 0\nM END", "smiles": "C(C(COC(C(Cl)(Cl)Cl)O)(COC(C(Cl)(Cl)Cl)O)COC(C(Cl)(Cl)Cl)O)OC(C(Cl)(Cl)Cl)O", "formula": "C13H16Cl12O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2e6da6ef-48af-4905-836e-559e9188767c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "725.6971", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "8da5acb4-4a92-45b3-94ab-272fb694e15b", "version": "7", "structure": { "id": "7788b62d-f93d-473e-b042-ee28f6844eb3", "molfile": "\n Marvin 01132106122D \n\n 33 32 0 0 0 0 999 V2000\n 1.6974 -4.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6250 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2894 -4.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5426 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4966 -2.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4144 -1.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4835 -4.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7532 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5032 -4.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0361 -3.4868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2861 -2.1118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9506 -3.4769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8782 -2.0953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2796 -3.5789 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6644 -4.1183 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9045 -4.7236 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7072 -3.5888 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3222 -4.1282 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0098 -0.8585 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2072 -1.9934 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5921 -1.4539 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0822 -4.7104 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1578 -0.8783 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9604 -2.0131 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5756 -1.4704 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1085 -3.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7927 -2.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8782 -3.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2006 -2.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5328 -0.8487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2828 -4.7532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7039 -4.7400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6348 -0.8289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 6 1 0 0 0 0\n 3 9 1 0 0 0 0\n 4 8 1 0 0 0 0\n 5 28 1 0 0 0 0\n 6 13 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 11 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 26 1 0 0 0 0\n 11 29 1 0 0 0 0\n 12 7 1 0 0 0 0\n 13 27 1 0 0 0 0\n 14 1 1 0 0 0 0\n 15 1 1 0 0 0 0\n 16 3 1 0 0 0 0\n 17 3 1 0 0 0 0\n 18 3 1 0 0 0 0\n 19 2 1 0 0 0 0\n 20 2 1 0 0 0 0\n 21 2 1 0 0 0 0\n 22 1 1 0 0 0 0\n 23 4 1 0 0 0 0\n 24 4 1 0 0 0 0\n 25 4 1 0 0 0 0\n 26 5 1 0 0 0 0\n 27 5 1 0 0 0 0\n 28 12 1 0 0 0 0\n 29 5 1 0 0 0 0\n 8 30 1 0 0 0 0\n 9 31 1 0 0 0 0\n 7 32 1 0 0 0 0\n 6 33 1 0 0 0 0\nM END", "smiles": "C(C(COC(C(Cl)(Cl)Cl)O)(COC(C(Cl)(Cl)Cl)O)COC(C(Cl)(Cl)Cl)O)OC(C(Cl)(Cl)Cl)O", "formula": "C13H16Cl12O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "725.6971", "optical_activity": "UNSPECIFIED", "references": [ "5d6199dc-be00-4de5-a35f-55d92d495ffd", "d24c3631-41fe-4fdb-abf9-297cc38cbc02" ], "stereo_centers": 4 }, "unii": "U49LID4UYJ" } ] }