{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2cca2620-b3e5-42a7-84e5-68baaa65d774",
          "code": "170637-72-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=170637-72-6",
          "code_system": "CAS",
          "references": [
            "8c78bf80-93b7-4606-a6c0-435d4ffc9e4e",
            "31ea59d0-741c-4695-91f7-e0a40ec7bf35"
          ]
        },
        {
          "uuid": "c094b9ed-c8ad-51c2-9c84-97ba6a96130d",
          "code": "22239276",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22239276",
          "code_system": "PUBCHEM",
          "references": [
            "199bd717-96c5-db1f-e49e-8fc524ec89e4"
          ]
        },
        {
          "uuid": "ea96c03d-4c18-42d8-b1e1-39ff28393df1",
          "code": "U4087152TE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9629208a-a0ed-423d-ac08-f4b68a02b27b",
          "name": "2-PROPENOIC ACID, 3-(3,4,5-TRIMETHOXYPHENYL)-, 3-METHYL-4-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)-1-DISILOXANYL)BUTYL ESTER",
          "stdName": "2-PROPENOIC ACID, 3-(3,4,5-TRIMETHOXYPHENYL)-, 3-METHYL-4-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)-1-DISILOXANYL)BUTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "946504ae-0e37-487c-805b-5844126f69f7",
            "1eb6adb0-4f94-44bb-9044-0a9aa24b5285"
          ],
          "display_name": false
        },
        {
          "uuid": "264fdde8-e073-4dac-9a7e-0099b056664d",
          "name": "ISOPENTYL TRIMETHOXYCINNAMATE TRISILOXANE",
          "stdName": "ISOPENTYL TRIMETHOXYCINNAMATE TRISILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "051f301d-14f6-46dc-839b-370b26abf432",
            "5cd5982d-e7b1-43f0-81ed-cace9677a2c4",
            "1eb6adb0-4f94-44bb-9044-0a9aa24b5285"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1ce7c0ff-6892-4b9f-a1ca-0ca1e42a5220",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8418f9cb-43cc-42c7-8c8f-795d7ef2631d",
          "name": "SUNSHELTER SP",
          "stdName": "SUNSHELTER SP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "946504ae-0e37-487c-805b-5844126f69f7",
            "1eb6adb0-4f94-44bb-9044-0a9aa24b5285"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "051f301d-14f6-46dc-839b-370b26abf432",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1eb6adb0-4f94-44bb-9044-0a9aa24b5285",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "946504ae-0e37-487c-805b-5844126f69f7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c78bf80-93b7-4606-a6c0-435d4ffc9e4e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392846000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e03cb9d2-9aa7-424a-8c76-e3e106793282",
          "citation": "SRS import [U4087152TE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U4087152TE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392846000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cd5982d-e7b1-43f0-81ed-cace9677a2c4",
          "citation": "ISOPENTYL TRIMETHOXYCINNAMATE TRISILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "199bd717-96c5-db1f-e49e-8fc524ec89e4",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "31ea59d0-741c-4695-91f7-e0a40ec7bf35",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ce92b3b0-d4ce-44af-88e1-deb39e5b32b9",
          "id": "ce92b3b0-d4ce-44af-88e1-deb39e5b32b9",
          "molfile": "\n  Marvin  01132110402D          \n\n 34 34  0  0  0  0            999 V2000\n    9.3485   -9.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -8.9513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7774   -7.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7774   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6340   -6.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9195   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -7.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6340   -8.1262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9195   -7.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4919   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2064   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9210   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9210   -5.6512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6355   -6.8888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3500   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0645   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7790   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   15.7790   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4935   -6.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -6.4762    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -7.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -6.8887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -7.7138    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   17.9225   -8.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6369   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -5.6512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -5.2387    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   18.6369   -4.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -4.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6369   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 13  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 30  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 26 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 31 34  1  0  0  0  0\nM  END",
          "smiles": "CC(CCOC(=O)/C=C/c1cc(c(c(c1)OC)OC)OC)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
          "formula": "C24H44O7Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fdae848b-dce6-4e1b-bed9-aa73fafffb47"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "528.859",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b2fd9a92-d8ad-46e5-b363-efd965f3e95b",
      "version": "5",
      "structure": {
        "id": "e3586690-c7ca-4eac-9c42-6405853cfd23",
        "molfile": "\n  Marvin  01132111462D          \n\n 34 34  0  0  0  0            999 V2000\n    8.6340   -8.1262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -7.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -8.9513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -9.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7774   -7.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7774   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4919   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2064   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9210   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9210   -5.6512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6355   -6.8888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3500   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0645   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7790   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7790   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4935   -6.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -6.4762    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -7.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -6.8887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -7.7138    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   17.9225   -8.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6369   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2080   -5.6512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -5.2387    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   18.6369   -4.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9224   -4.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6369   -5.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -6.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6340   -6.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9195   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9195   -7.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 18 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 26 29  1  0  0  0  0\n 30  7  2  0  0  0  0\n 31 30  1  0  0  0  0\n  2 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n  1 34  1  0  0  0  0\nM  END",
        "smiles": "CC(CCOC(=O)/C=C/c1cc(c(c(c1)OC)OC)OC)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C",
        "formula": "C24H44O7Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "528.859",
        "optical_activity": "( + / - )",
        "references": [
          "e03cb9d2-9aa7-424a-8c76-e3e106793282",
          "946504ae-0e37-487c-805b-5844126f69f7"
        ],
        "stereo_centers": 1
      },
      "unii": "U4087152TE"
    }
  ]
}