{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a53e9c1c-5728-4b93-0138-a9a5b7040c9e", "code": "5321003", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5321003", "code_system": "PUBCHEM", "references": [ "f8c5fcee-f64e-afda-fe6e-0b220ae2a01a" ] }, { "uuid": "97c5d5fe-b117-4ca2-a54a-9191e21a8c95", "code": "18374-76-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=18374-76-0", "code_system": "CAS", "references": [ "6d7b25f3-8ccf-4d7f-6149-e5a78bd3f15f" ] }, { "uuid": "a016ba26-1168-43bd-8406-390c21dea843", "code": "U33H52BQ0P", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0cba48ed-6113-4b34-77e7-0df899aae7c6", "code": "Rotundone", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Rotundone", "code_system": "WIKIPEDIA", "references": [ "f2263eb1-006a-3b20-b20e-76d03b9a1fd9" ] }, { "uuid": "bf962ed3-3658-1066-5db4-27197c863ad0", "code": "DTXSID301030485", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301030485", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "03d25707-d342-e423-d437-a6f3464c19b2", "name": "3,8-DIMETHYL-5-PROP-1-EN-2-YL-3,4,5,6,7,8-HEXAHYDRO-2H-AZULEN-1-ONE, (3S,5R,8S)-", "stdName": "3,8-DIMETHYL-5-PROP-1-EN-2-YL-3,4,5,6,7,8-HEXAHYDRO-2H-AZULEN-1-ONE, (3S,5R,8S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6d7b25f3-8ccf-4d7f-6149-e5a78bd3f15f", "476dffb4-1682-34d5-2a83-3f550a980325" ], "display_name": true }, { "uuid": "58192dc5-0ff0-1e1a-0c0f-a8d8ba5529de", "name": "FEMA NO. 4867", "stdName": "FEMA NO. 4867", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "476dffb4-1682-34d5-2a83-3f550a980325", "6d7b25f3-8ccf-4d7f-6149-e5a78bd3f15f" ], "display_name": false }, { "uuid": "447cf4de-b37b-f0c0-42e4-744037e9feec", "name": "GUAIA-1(5),11-DIEN-2-ONE, (-)-", "stdName": "GUAIA-1(5),11-DIEN-2-ONE, (-)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "476dffb4-1682-34d5-2a83-3f550a980325", "6d7b25f3-8ccf-4d7f-6149-e5a78bd3f15f" ], "display_name": false } ], "references": [ { "uuid": "f2263eb1-006a-3b20-b20e-76d03b9a1fd9", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "6d7b25f3-8ccf-4d7f-6149-e5a78bd3f15f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "476dffb4-1682-34d5-2a83-3f550a980325", "citation": "FHFI", "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "68f13f1c-81b3-1d1b-af29-d11687075d92", "citation": "PUBCHEM", "doc_type": "NLM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "f8c5fcee-f64e-afda-fe6e-0b220ae2a01a", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "94bb55ea-7256-2cb5-1add-6bba4f00cee8", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "cf5ad7c8-43c4-176b-687a-ba335c858bfc", "id": "cf5ad7c8-43c4-176b-687a-ba335c858bfc", "molfile": "\n Marvin 01132110432D \n\n 16 17 0 0 1 0 999 V2000\n 16.6010 -3.1493 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 16.6010 -2.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2685 -3.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0135 -4.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4984 -5.0863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1885 -4.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9336 -3.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1612 -3.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4530 -3.7675 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.3422 -4.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9124 -5.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7340 -5.1074 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 16.1571 -5.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7645 -3.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0266 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8138 -2.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 7 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 12 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 1 1 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 1 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\nM END", "smiles": "C=C(C)[C@@H]1CC[C@H](C)C2=C(C1)[C@@H](C)CC2=O", "formula": "C15H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ba60bd77-a743-40b9-9ed8-5593b961fa33" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "218.3351", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "c7f1c441-7944-4399-82b9-9fa444ca20d7", "version": "9", "structure": { "id": "261cfb47-82ac-cdc1-f51b-1b2863cab050", "molfile": "1(2H)-Azulenone, 3,4,5,6,7,8-hexahydro-3,8-dimethyl-5-(1-methylethenyl)-, (3S...\n Marvin 01132102062D \n\n 16 17 0 0 1 0 999 V2000\n 17.4984 -5.0863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0135 -4.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1885 -4.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9336 -3.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6010 -3.1493 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.2685 -3.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6010 -2.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1612 -3.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4530 -3.7675 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.3422 -4.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9124 -5.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7340 -5.1074 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.1571 -5.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7645 -3.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0266 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8138 -2.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 5 7 1 1 0 0 0\n 4 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 3 12 1 0 0 0 0\n 12 13 1 1 0 0 0\n 9 14 1 1 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\nM END", "smiles": "C=C(C)[C@@H]1CC[C@H](C)C2=C(C1)[C@@H](C)CC2=O", "formula": "C15H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "218.3351", "optical_activity": "UNSPECIFIED", "references": [ "6d7b25f3-8ccf-4d7f-6149-e5a78bd3f15f", "476dffb4-1682-34d5-2a83-3f550a980325" ], "stereo_centers": 3 }, "unii": "U33H52BQ0P" } ] }