{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "431898b1-3b12-43a8-bab1-34a3038bd90c",
          "code": "1101132-67-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1101132-67-5",
          "code_system": "CAS",
          "references": [
            "01274529-36f8-4825-9fed-bc9f23e2d80c",
            "ba3e88f1-4325-4efe-8c6c-a3a9abfb0185"
          ]
        },
        {
          "uuid": "85a64181-7b18-4cfc-bdae-30ba2d7d4e20",
          "code": "44473182",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44473182",
          "code_system": "PUBCHEM",
          "references": [
            "01274529-36f8-4825-9fed-bc9f23e2d80c"
          ]
        },
        {
          "uuid": "c396f6e9-5396-4e10-85ab-40d47a548fd2",
          "code": "U30799TIHE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a5b9fd3d-0065-258f-2252-26621a75e2f3",
          "code": "DTXSID10894199",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10894199",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "23ebfecf-51f7-b94a-42cf-4d239903356c",
          "code": "tolpyralate",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tolpyralate.html",
          "code_system": "ALANWOOD",
          "references": [
            "1259f04b-b6dd-a028-3bfc-4cf23f547e40"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2fa4042d-7dab-4c57-aca3-5829b879b1d0",
          "name": "1-((1-ETHYL-4-(3-(2-METHOXYETHOXY)-2-METHYL-4-(METHYLSULFONYL)BENZOYL)-1H-PYRAZOL-5-YL)OXY)ETHYL METHYL ESTER CARBONIC ACID",
          "stdName": "1-((1-ETHYL-4-(3-(2-METHOXYETHOXY)-2-METHYL-4-(METHYLSULFONYL)BENZOYL)-1H-PYRAZOL-5-YL)OXY)ETHYL METHYL ESTER CARBONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba68177c-bc91-4150-8541-2580b0b5794d",
            "646c08de-0a34-408a-939d-6fa7ab2a818b"
          ],
          "display_name": false
        },
        {
          "uuid": "fd53ebe5-895d-4d46-a328-0ee074ef4a6c",
          "name": "TOLPYRALATE",
          "stdName": "TOLPYRALATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "348dc07c-a828-4d47-97b1-95c829907659",
            "ba68177c-bc91-4150-8541-2580b0b5794d",
            "646c08de-0a34-408a-939d-6fa7ab2a818b",
            "3ad69d75-e3e5-403b-a60b-c9d06de01bb0"
          ],
          "display_name": true
        },
        {
          "uuid": "f4280b59-dcbd-47e7-b539-ba9ef1175491",
          "name": "TOLPYRALATE [ISO]",
          "stdName": "TOLPYRALATE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "348dc07c-a828-4d47-97b1-95c829907659",
            "646c08de-0a34-408a-939d-6fa7ab2a818b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "348dc07c-a828-4d47-97b1-95c829907659",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "646c08de-0a34-408a-939d-6fa7ab2a818b",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba68177c-bc91-4150-8541-2580b0b5794d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01274529-36f8-4825-9fed-bc9f23e2d80c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392282000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8bf5e0b-93f1-43b6-b802-011620691449",
          "citation": "SRS import [U30799TIHE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U30799TIHE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392282000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ad69d75-e3e5-403b-a60b-c9d06de01bb0",
          "citation": "TOLPYRALATE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1259f04b-b6dd-a028-3bfc-4cf23f547e40",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ba3e88f1-4325-4efe-8c6c-a3a9abfb0185",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "41b76bfb-b8b6-44e6-a025-08707927155c",
          "id": "41b76bfb-b8b6-44e6-a025-08707927155c",
          "molfile": "\n  Marvin  01132103282D          \n\n 33 34  0  0  0  0            999 V2000\n    4.2748   -1.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7899   -2.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1254   -3.2108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7130   -3.9253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2650   -4.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0187   -4.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7331   -4.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4476   -4.2028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -5.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0187   -5.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0187   -6.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -7.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4476   -6.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -7.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8765   -6.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5910   -7.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3055   -6.6778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0199   -7.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4476   -5.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -5.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -7.9153    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9082   -7.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5582   -7.9153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -8.7403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9324   -3.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5455   -2.8303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3625   -2.9451    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.6715   -3.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8704   -2.2950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6874   -2.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9964   -3.1748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1953   -1.7597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0123   -1.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 25  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 25  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 19  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 21  1  0  0  0  0\n 13 14  1  0  0  0  0\n 19 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 21 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "CCn1c(c(cn1)C(=O)c2ccc(c(c2C)OCCOC)S(=O)(=O)C)OC(C)OC(=O)OC",
          "formula": "C21H28N2O9S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "91bfdd0b-d6b6-4ff5-b868-25ad9ce46178"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "484.5219",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "58a8f022-1571-4444-84e4-ed1193342573",
      "version": "5",
      "structure": {
        "id": "232990dd-bca6-4667-a629-9b52213ab4c4",
        "molfile": "\n  Marvin  01132101582D          \n\n 33 34  0  0  0  0            999 V2000\n    5.5455   -2.8303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9324   -3.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1254   -3.2108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7899   -2.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2748   -1.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7130   -3.9253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2650   -4.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0187   -4.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7331   -4.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -5.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0187   -5.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0187   -6.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -7.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -7.9153    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5582   -7.9153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -8.7403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9082   -7.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4476   -6.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -7.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8765   -6.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5910   -7.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3055   -6.6778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0199   -7.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4476   -5.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -5.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4476   -4.2028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3625   -2.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6715   -3.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8704   -2.2950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6874   -2.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9964   -3.1748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1953   -1.7597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0123   -1.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 18 13  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 18  1  0  0  0  0\n 24 25  1  0  0  0  0\n 10 24  2  0  0  0  0\n  9 26  2  0  0  0  0\n  2  8  2  0  0  0  0\n  1 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
        "smiles": "CCn1c(c(cn1)C(=O)c2ccc(c(c2C)OCCOC)S(=O)(=O)C)OC(C)OC(=O)OC",
        "formula": "C21H28N2O9S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "484.5219",
        "optical_activity": "( + / - )",
        "references": [
          "a8bf5e0b-93f1-43b6-b802-011620691449",
          "ba68177c-bc91-4150-8541-2580b0b5794d"
        ],
        "stereo_centers": 1
      },
      "unii": "U30799TIHE"
    }
  ]
}