{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6eb1b19-9941-496f-9fb3-0bf15b756714",
          "code": "56070-16-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56070-16-7",
          "code_system": "CAS",
          "references": [
            "de6a2c9c-7a62-4f21-8ca6-e9674b907fa2",
            "2987a400-094e-4a3b-bf83-6f93362a3128"
          ]
        },
        {
          "uuid": "4fa40509-409e-49da-8726-35dfc218c6d3",
          "code": "340204",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3382",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "de6a2c9c-7a62-4f21-8ca6-e9674b907fa2"
          ]
        },
        {
          "uuid": "2c923dd3-2457-4999-86c7-c248614e9198",
          "code": "41718",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/41718",
          "code_system": "PUBCHEM",
          "references": [
            "de6a2c9c-7a62-4f21-8ca6-e9674b907fa2"
          ]
        },
        {
          "uuid": "49138f0b-5a74-9a32-3008-cdb1c8a9b4d7",
          "code": "DTXSID1042443",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1042443",
          "code_system": "EPA CompTox",
          "references": [
            "bf23f751-4ed0-0662-eeeb-f7e41de9531b"
          ]
        },
        {
          "uuid": "974a0acc-5a8b-4486-9f21-59f64d3ce284",
          "code": "U2V9FRY9P2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9849b2ef-a67b-4b3e-a907-8d4a4ce03a1a",
          "name": "PHOSPHORODITHIOIC ACID, S-(((1,1-DIMETHYETHYL)SULFONYL)METHYL) O,O-DIETHYL ESTER",
          "stdName": "PHOSPHORODITHIOIC ACID, S-(((1,1-DIMETHYETHYL)SULFONYL)METHYL) O,O-DIETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "577732e7-a812-44c4-8a3a-5cddba0bfe00",
            "757f3a9b-b725-44e3-9b93-fb8dca53212a"
          ],
          "display_name": false
        },
        {
          "uuid": "1eefbb08-044b-4de9-9fcf-b5149a5c4555",
          "name": "TERBUFOS SULFONE",
          "stdName": "TERBUFOS SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a08262d-cdf1-4f72-b61e-6e6e3af19f5d"
          ],
          "display_name": true
        },
        {
          "uuid": "9c5eeef5-b2a6-4bb2-bc1e-c9424f48cba7",
          "name": "TERBUFOS SULPHONE",
          "stdName": "TERBUFOS SULPHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a588d565-2277-45fa-9c66-fcfb5d2b7276"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a588d565-2277-45fa-9c66-fcfb5d2b7276",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a08262d-cdf1-4f72-b61e-6e6e3af19f5d",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "577732e7-a812-44c4-8a3a-5cddba0bfe00",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "757f3a9b-b725-44e3-9b93-fb8dca53212a",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de6a2c9c-7a62-4f21-8ca6-e9674b907fa2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "063b0f21-cec9-4f85-b544-6cf1ba9bb7ec",
          "citation": "SRS import [U2V9FRY9P2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U2V9FRY9P2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7752769-7573-4de1-8436-57b8feee2412",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf23f751-4ed0-0662-eeeb-f7e41de9531b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=56070-16-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2987a400-094e-4a3b-bf83-6f93362a3128",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3dd7b19a-b3b2-44f2-afcc-8d39105da5c8",
          "id": "3dd7b19a-b3b2-44f2-afcc-8d39105da5c8",
          "molfile": "\n  Marvin  01132103172D          \n\n 17 16  0  0  0  0            999 V2000\n    8.7541   -5.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9338   -5.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5121   -4.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9196   -3.7488    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6456   -4.1956    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3306   -3.0729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1488   -3.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5794   -3.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2070   -3.3725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4988   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8045   -3.4057    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1992   -2.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3927   -4.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0856   -3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3575   -2.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9723   -1.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1044   -3.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=S)(OCC)SCS(=O)(=O)C(C)(C)C",
          "formula": "C9H21O4PS3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cb85d11e-7495-4857-b38e-33217bd86dc7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "320.433",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b94f4c5d-cedf-48f9-b0f7-0569111852ff",
      "version": "4",
      "structure": {
        "id": "73653ed7-3fa8-4dab-95eb-27d1c4d06c2b",
        "molfile": "\n  Marvin  01132105592D          \n\n 17 16  0  0  0  0            999 V2000\n    7.9196   -3.7488    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2070   -3.3725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4988   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8045   -3.4057    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0856   -3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3575   -2.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9723   -1.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1044   -3.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1992   -2.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3927   -4.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5121   -4.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9338   -5.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7541   -5.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3306   -3.0729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1488   -3.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5794   -3.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6456   -4.1956    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  4 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  1 17  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=S)(OCC)SCS(=O)(=O)C(C)(C)C",
        "formula": "C9H21O4PS3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "320.433",
        "optical_activity": "NONE",
        "references": [
          "f7752769-7573-4de1-8436-57b8feee2412",
          "063b0f21-cec9-4f85-b544-6cf1ba9bb7ec"
        ],
        "stereo_centers": 0
      },
      "unii": "U2V9FRY9P2"
    }
  ]
}