{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "774e00cc-1dbc-4206-b488-72978327fc26",
          "code": "58543-17-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58543-17-2",
          "code_system": "CAS",
          "references": [
            "13f5506f-914c-4813-9c35-6d0e4ccf956a",
            "c2559af9-68ac-49cd-8ca1-639f9eed5ef2"
          ]
        },
        {
          "uuid": "3690ed4f-2b39-4eef-b17c-583acc636855",
          "code": "m9513",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9513?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "13f5506f-914c-4813-9c35-6d0e4ccf956a"
          ]
        },
        {
          "uuid": "0b6d055e-9b60-4571-bbf3-c04eb6ac1c4c",
          "code": "21593623",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21593623",
          "code_system": "PUBCHEM",
          "references": [
            "13f5506f-914c-4813-9c35-6d0e4ccf956a"
          ]
        },
        {
          "uuid": "e4a8dd4a-5d4d-4fa6-a530-32108750652b",
          "code": "U2N4XKX7HP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7b344800-7701-e5b0-aece-a14ff4498dd2",
          "code": "968",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=968",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "84e22ea0-6000-d225-e0f7-c2505eeb15df"
          ]
        },
        {
          "uuid": "e9160ae6-9e0a-8813-0d06-d3bdcc6c22f4",
          "code": "DTXSID70974103",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70974103",
          "code_system": "EPA CompTox",
          "references": [
            "ccc2c17b-5dca-0e9b-3ecf-b59294d6c69a"
          ]
        },
        {
          "uuid": "ade1df50-e4fb-2d9d-ad9c-df6cc37f7772",
          "code": "100000182009",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fda2a5cf-b8e1-51b6-09d6-96291dab450f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c1a176a6-8821-4c00-bcda-bd15fe3000ce",
          "comments": "Isolated stevia sweetener, produced by the extraction of STEVIA REBAUDIANA leaves by hot water and powdering.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "4ec6bb09-07f5-4956-8558-ffbb3a13899d"
          ],
          "related_substance": {
            "uuid": "734f9f99-d943-4fba-9b2f-f2012799d246",
            "refuuid": "9de3c1b3-dd78-4d38-9230-990ef6702535",
            "name": "STEVIA REBAUDIANA LEAF",
            "unii": "6TC6NN0876",
            "linking_id": "6TC6NN0876",
            "ref_pname": "STEVIA REBAUDIANA LEAF",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6192e278-fd6a-42c3-9c34-d929aaeea73a",
          "name": "KAUR-16-EN-18-OIC ACID, 13-((O-.BETA.-D-GLUCOPYRANOSYL-(1->2)-O-(.BETA.-D-GLUCOPYRANOSYL-(1->3))-.BETA.-D-GLUCOPYRANOSYL)OXY)-, (4.ALPHA.)-",
          "stdName": "KAUR-16-EN-18-OIC ACID, 13-((O-.BETA.-D-GLUCOPYRANOSYL-(1->2)-O-(.BETA.-D-GLUCOPYRANOSYL-(1->3))-.BETA.-D-GLUCOPYRANOSYL)OXY)-, (4.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f06a5e2-6c07-4d3d-b26c-8088d51a80ef"
          ],
          "display_name": false
        },
        {
          "uuid": "f3a47a1e-fda1-4533-b649-adbe60629a4c",
          "name": "REBAUDIOSIDE B",
          "stdName": "REBAUDIOSIDE B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "011b4306-9e25-451b-8b9a-acb7511a6a72",
            "935e283f-be02-4656-b35b-cb5347d19519",
            "3cbabf1b-0d8f-4e94-a461-9f724132b379",
            "6f06a5e2-6c07-4d3d-b26c-8088d51a80ef",
            "0e896e7d-9927-4902-acb3-2da8555b3e5a"
          ],
          "display_name": true
        },
        {
          "uuid": "0cfffc96-4bb5-4ae1-a445-09a60f2c372d",
          "name": "REBAUDIOSIDE B [MI]",
          "stdName": "REBAUDIOSIDE B [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cbabf1b-0d8f-4e94-a461-9f724132b379"
          ],
          "display_name": false
        },
        {
          "uuid": "528fcdb6-1202-4fa9-86e3-76db6dae0144",
          "name": "REBB",
          "stdName": "REBB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25f15d50-7003-4f7d-81c1-15e528d0ebc6"
          ],
          "display_name": false
        },
        {
          "uuid": "4c73709c-978c-448c-8657-e280234531af",
          "name": "STEVIOSIDE A4",
          "stdName": "STEVIOSIDE A4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f06a5e2-6c07-4d3d-b26c-8088d51a80ef"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "935e283f-be02-4656-b35b-cb5347d19519",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6f06a5e2-6c07-4d3d-b26c-8088d51a80ef",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cbabf1b-0d8f-4e94-a461-9f724132b379",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25f15d50-7003-4f7d-81c1-15e528d0ebc6",
          "citation": "http://www.tandfonline.com/doi/pdf/10.1080/19440049.2013.843101",
          "url": "http://www.tandfonline.com/doi/pdf/10.1080/19440049.2013.843101",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13f5506f-914c-4813-9c35-6d0e4ccf956a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392049000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ec6bb09-07f5-4956-8558-ffbb3a13899d",
          "citation": "KAKIGI, Y ET AL, CLASSIFICATION OF STEVIA SWEETENERS IN SOFT DRINKS USING LIQUID CHROMATOGRAPHY AND TIME-OF-FLIGHT MASS SPECTROMETRY, FOOD ADDITIVES & CONTAMINANTS. PART A., 30(12)2043-2049, 2013",
          "url": "http://www.tandfonline.com/doi/pdf/10.1080/19440049.2013.843101",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9316bdf4-ca7a-4e1b-95e3-1a859e1d788a",
          "citation": "SRS import [U2N4XKX7HP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U2N4XKX7HP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392049000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "011b4306-9e25-451b-8b9a-acb7511a6a72",
          "citation": "REBAUDIOSIDE B [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0e896e7d-9927-4902-acb3-2da8555b3e5a",
          "citation": "REBAUDIOSIDE B [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84e22ea0-6000-d225-e0f7-c2505eeb15df",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c2559af9-68ac-49cd-8ca1-639f9eed5ef2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ccc2c17b-5dca-0e9b-3ecf-b59294d6c69a",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "fda2a5cf-b8e1-51b6-09d6-96291dab450f",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4851f481-4ab2-4ac2-8888-ab4397120d06",
          "id": "4851f481-4ab2-4ac2-8888-ab4397120d06",
          "molfile": "\n  Marvin  01132103472D          \n\n 56 62  0  0  1  0            999 V2000\n   12.0743   -3.7646    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.8989   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6621   -4.4791    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.0743   -5.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8989   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8375   -4.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4252   -3.7646    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.6007   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1884   -4.4791    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.6007   -5.1938    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.4252   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1884   -5.9084    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.6007   -6.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4252   -6.6230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3638   -5.9084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -5.1938    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1270   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7147   -5.9084    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.9176   -6.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -7.6675    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.9346   -7.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1820   -6.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9790   -6.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -8.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4504   -8.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358   -8.4921    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.0212   -8.9043    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.3066   -9.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3066   -8.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3066   -7.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0212   -7.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358   -7.6675    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.7358   -6.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4504   -7.2552    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.3129   -6.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8901   -5.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0212   -9.7289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358  -10.1412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3066  -10.1412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3638   -4.4791    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9515   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1270   -3.7646    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.7147   -4.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8901   -4.4791    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.4779   -5.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6533   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4779   -3.7646    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.6533   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8901   -3.0500    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4779   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7147   -3.0500    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1270   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8375   -3.0500    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.4252   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6621   -3.0500    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.0743   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 55  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  6  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 53  7  1  0  0  0  0\n  9  8  1  1  0  0  0\n 10  9  1  0  0  0  0\n  9 40  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 40 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 22 18  1  0  0  0  0\n 18 36  1  0  0  0  0\n 20 19  1  6  0  0  0\n 20 21  1  0  0  0  0\n 20 24  1  0  0  0  0\n 34 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  6  0  0  0\n 26 27  1  0  0  0  0\n 26 32  1  0  0  0  0\n 27 28  1  1  0  0  0\n 27 29  1  0  0  0  0\n 27 37  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  6  0  0  0\n 32 34  1  0  0  0  0\n 34 35  1  6  0  0  0\n 36 35  1  0  0  0  0\n 37 38  1  0  0  0  0\n 37 39  2  0  0  0  0\n 40 41  1  6  0  0  0\n 42 41  1  6  0  0  0\n 42 43  1  0  0  0  0\n 51 42  1  0  0  0  0\n 44 43  1  0  0  0  0\n 44 45  1  6  0  0  0\n 44 47  1  0  0  0  0\n 45 46  1  0  0  0  0\n 47 48  1  1  0  0  0\n 47 49  1  0  0  0  0\n 49 50  1  6  0  0  0\n 49 51  1  0  0  0  0\n 51 52  1  1  0  0  0\n 53 54  1  6  0  0  0\n 55 53  1  0  0  0  0\n 55 56  1  1  0  0  0\nM  END",
          "smiles": "C=C1C[C@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)O)[C@@H]3CC[C@@]1(C2)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O",
          "formula": "C38H60O18",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b9e29f5e-745f-4b97-8aa2-4ff7d8430e92"
          },
          "defined_stereo": 21,
          "ez_centers": 0,
          "molecular_weight": "804.8737",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 21
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ca8f0d8a-b76d-4d4c-9983-4806294a7222",
      "version": "10",
      "structure": {
        "id": "0262fc97-3608-4dd5-88a2-c79625e13792",
        "molfile": "\n  Marvin  01132100262D          \n\n 58 64  0  0  1  0            999 V2000\n    7.9790   -6.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1820   -6.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9346   -7.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -7.6675    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1650   -8.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4504   -8.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358   -8.4921    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0212   -8.9043    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3066   -8.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3066   -7.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0212   -7.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358   -7.6675    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4504   -7.2552    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4504   -8.0798    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3129   -6.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8901   -5.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7147   -5.9084    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9176   -6.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1270   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9515   -5.1938    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3638   -4.4791    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9515   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1270   -3.7646    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7147   -3.0500    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1270   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8901   -3.0500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4779   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4779   -3.7646    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6533   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8901   -4.4791    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7147   -4.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4779   -5.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6533   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1884   -4.4791    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.6007   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4252   -3.7646    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8375   -3.0500    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.4252   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6621   -3.0500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.0743   -2.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0743   -3.7646    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.8989   -3.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6621   -4.4791    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.8375   -4.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0743   -5.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8989   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6007   -5.1938    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.4252   -5.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1884   -5.9084    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3638   -5.9084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6007   -6.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4252   -6.6230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358   -6.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0212   -9.7289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358  -10.1412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3066  -10.1412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3066   -9.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7358   -9.3166    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  7 12  1  0  0  0  0\n  4 13  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n  2 17  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n  4 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 20 19  1  1  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  6  0  0  0\n 23 22  1  6  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  1  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  1  0  0  0\n 28 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 23 31  1  0  0  0  0\n 30 32  1  6  0  0  0\n 32 33  1  0  0  0  0\n 21 34  1  0  0  0  0\n 34 35  1  1  0  0  0\n 36 35  1  1  0  0  0\n 36 37  1  0  0  0  0\n 37 38  1  6  0  0  0\n 37 39  1  0  0  0  0\n 39 40  1  1  0  0  0\n 39 41  1  0  0  0  0\n 41 42  1  6  0  0  0\n 41 43  1  0  0  0  0\n 43 44  1  0  0  0  0\n 36 44  1  0  0  0  0\n 43 45  1  1  0  0  0\n 45 46  1  0  0  0  0\n 34 47  1  0  0  0  0\n 47 48  1  6  0  0  0\n 47 49  1  0  0  0  0\n 49 50  1  0  0  0  0\n 20 50  1  0  0  0  0\n 49 51  1  1  0  0  0\n 51 52  1  0  0  0  0\n 12 53  1  6  0  0  0\n  8 54  1  0  0  0  0\n 54 55  2  0  0  0  0\n 54 56  1  0  0  0  0\n  8 57  1  1  0  0  0\n  7 58  1  1  0  0  0\nM  END",
        "smiles": "C=C1C[C@]23CC[C@@]4([H])[C@@](C)(CCC[C@@]4(C)C(=O)O)[C@]3([H])CC[C@@]1(C2)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O",
        "formula": "C38H60O18",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 21,
        "ez_centers": 0,
        "molecular_weight": "804.8737",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9316bdf4-ca7a-4e1b-95e3-1a859e1d788a",
          "6f06a5e2-6c07-4d3d-b26c-8088d51a80ef"
        ],
        "stereo_centers": 21
      },
      "unii": "U2N4XKX7HP"
    }
  ]
}