{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9304f554-4390-48ed-953e-11d5f8c23e77",
          "code": "30007-47-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=30007-47-7",
          "code_system": "CAS",
          "references": [
            "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0",
            "a01a4d0a-9b22-4818-9848-31c5b92211a7"
          ]
        },
        {
          "uuid": "c9f69b33-6b9a-4410-8962-6ba560a6379b",
          "code": "BRONIDOX",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bronidox",
          "code_system": "WIKIPEDIA",
          "references": [
            "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0"
          ]
        },
        {
          "uuid": "c148dcbe-887e-4b10-85c8-8564679b1ff0",
          "code": "250-001-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.441",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0"
          ]
        },
        {
          "uuid": "cfa5f171-0cb1-4c88-9c8a-7cca33b2a8a0",
          "code": "1364947",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1364947/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0"
          ]
        },
        {
          "uuid": "44b1905e-5de9-4e98-af63-994d5828afe1",
          "code": "SUB75544",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0"
          ]
        },
        {
          "uuid": "f0f2be80-20fa-412d-90e0-691a1838a75d",
          "code": "1807",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1807",
          "code_system": "PUBCHEM",
          "references": [
            "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0"
          ]
        },
        {
          "uuid": "bd58175d-434a-838e-e6d5-f418514d957b",
          "code": "DTXSID1044560",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1044560",
          "code_system": "EPA CompTox",
          "references": [
            "55bcc18b-dc62-222a-eb87-f9016e4c3999"
          ]
        },
        {
          "uuid": "a313f3ae-f0d4-4b65-bbaa-9f105062f67b",
          "code": "U184I9QBNM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fa22a84e-5f70-4867-95cd-3c4039d69b5b",
          "code": "100000137419",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e63ab1ee-bfad-89a5-3956-5316267e8e6c"
          ]
        },
        {
          "uuid": "76e6c1a4-accf-7eef-6e7f-0a5e876eccc7",
          "code": "U184I9QBNM",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=U184I9QBNM",
          "code_system": "DAILYMED",
          "references": [
            "7445754e-6fa5-c6ef-6ce6-7cdef9b8e55a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "63b62a57-5985-49f6-bd38-f1c819b4c2f3",
          "name": "1,3-DIOXANE, 5-BROMO-5-NITRO-",
          "stdName": "1,3-DIOXANE, 5-BROMO-5-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53b2b64f-17e1-4fb3-aa4a-5f944fc739f3",
            "b592bfef-f244-4ca5-a348-a6d617a6996f"
          ],
          "display_name": false
        },
        {
          "uuid": "e7c9fa7a-cd37-42d8-a561-ff94db8bb977",
          "name": "5-BROMO-5-NITRO-1,3-DIOXANE",
          "stdName": "5-BROMO-5-NITRO-1,3-DIOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53b2b64f-17e1-4fb3-aa4a-5f944fc739f3",
            "7fc0c919-18e4-435b-9aa5-abc21e8ad750",
            "25144db3-3039-443f-80ef-343614ee3c09",
            "b592bfef-f244-4ca5-a348-a6d617a6996f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ff12ff53-d3ec-4135-931b-7acfc3ce6c12",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1a1e44ac-9062-4305-82c4-84a50735ac01",
          "name": "BRONIDOX",
          "stdName": "BRONIDOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07417d83-ba60-49c5-9318-7132ba8c1e19",
            "53b2b64f-17e1-4fb3-aa4a-5f944fc739f3"
          ],
          "display_name": false
        },
        {
          "uuid": "533ac5f6-f1e7-467a-b13d-63b381d3443f",
          "name": "M-DIOXANE, 5-BROMO-5-NITRO-",
          "stdName": "M-DIOXANE, 5-BROMO-5-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07417d83-ba60-49c5-9318-7132ba8c1e19",
            "53b2b64f-17e1-4fb3-aa4a-5f944fc739f3"
          ],
          "display_name": false
        },
        {
          "uuid": "1bace66b-9b53-4e8e-bbb1-0615dcf3493c",
          "name": "MICROCIDE I",
          "stdName": "MICROCIDE I",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07417d83-ba60-49c5-9318-7132ba8c1e19",
            "53b2b64f-17e1-4fb3-aa4a-5f944fc739f3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b592bfef-f244-4ca5-a348-a6d617a6996f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "53b2b64f-17e1-4fb3-aa4a-5f944fc739f3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07417d83-ba60-49c5-9318-7132ba8c1e19",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25144db3-3039-443f-80ef-343614ee3c09",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdc73fa1-b1c1-40e8-9fdc-879ee4d59bb0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390967000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "384b4451-25ba-4603-97ef-b5da26693fd4",
          "citation": "SRS import [U184I9QBNM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=U184I9QBNM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390967000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fc0c919-18e4-435b-9aa5-abc21e8ad750",
          "citation": "5-BROMO-5-NITRO-1,3-DIOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55bcc18b-dc62-222a-eb87-f9016e4c3999",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=30007-47-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a01a4d0a-9b22-4818-9848-31c5b92211a7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7445754e-6fa5-c6ef-6ce6-7cdef9b8e55a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e63ab1ee-bfad-89a5-3956-5316267e8e6c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "28905371-bb59-4b93-aed7-58dc74ee3507",
          "id": "28905371-bb59-4b93-aed7-58dc74ee3507",
          "molfile": "\n  Marvin  01132102132D          \n\n 10 10  0  0  0  0            999 V2000\n   -0.5373   -1.1420    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.2749   -0.9973    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.8063   -1.6283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5556   -0.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2570   -0.0790    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2712   -0.6321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9868   -0.2216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9868    0.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2712    1.0263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5556    0.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n 10  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "C1C(COCO1)(Br)[N+](=O)[O-]",
          "formula": "C4H6BrNO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "081182db-47a1-44e3-9c53-8efd05ccb9e1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "211.9984",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ba4e603a-8616-427d-b69a-cddc492f2a6a",
      "version": "6",
      "structure": {
        "id": "6b3af071-c067-4f66-bfd0-67fea6c62e67",
        "molfile": "\n  Marvin  01132105342D          \n\n 10 10  0  0  0  0            999 V2000\n    1.2712   -0.6321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9868   -0.2216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9868    0.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2712    1.0263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5556    0.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5556   -0.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2570   -0.0790    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.2749   -0.9973    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -0.5373   -1.1420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8063   -1.6283    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  6  1  1  0  0  0  0\nM  CHG  2   8   1  10  -1\nM  END",
        "smiles": "C1C(COCO1)(Br)[N+](=O)[O-]",
        "formula": "C4H6BrNO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "211.9984",
        "optical_activity": "NONE",
        "references": [
          "384b4451-25ba-4603-97ef-b5da26693fd4",
          "b592bfef-f244-4ca5-a348-a6d617a6996f"
        ],
        "stereo_centers": 0
      },
      "unii": "U184I9QBNM"
    }
  ]
}