{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "501b96a7-b9a7-44af-9012-0c4883cce819", "code": "343346-17-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=343346-17-8", "code_system": "CAS", "references": [ "74299941-ba6d-4468-98d5-72d99d8bbe08", "dd5a0d3e-b7f5-41f4-970e-112af1ccae50" ] }, { "uuid": "571d4193-b16b-41f2-9ec0-21f1fb82f9b7", "code": "23798827", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23798827", "code_system": "PUBCHEM", "references": [ "74299941-ba6d-4468-98d5-72d99d8bbe08" ] }, { "uuid": "4535bc85-01c5-42fc-92af-a5efc982de1e", "code": "TZH7RZE6PF", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "65a23889-3fdc-4800-af7c-ec97c7af3ac0", "name": "ADAMANTANYL TRIHYDROXYBENZAMIDE", "stdName": "ADAMANTANYL TRIHYDROXYBENZAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a8b47043-d9b7-4afa-a986-9bb7940ef158", "97159009-98f8-43e2-821e-f3279b30269a", "ba69929e-317f-4089-bbd3-a1784c7ded81" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "6fb10cee-5ec1-4d37-b7a9-0579cc4fcffa", "name_org": "INCI" } ] }, { "uuid": "7f57f192-9641-48f2-b85f-cb33260a21ed", "name": "BENZAMIDE, 3,4,5-TRIHYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-", "stdName": "BENZAMIDE, 3,4,5-TRIHYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a8b47043-d9b7-4afa-a986-9bb7940ef158", "9c945f91-9366-4a7b-945c-3ab630206abc" ], "display_name": false }, { "uuid": "e334c324-e81e-436d-850e-45a3db4e9f9f", "name": "SNOWIN AP-1", "stdName": "SNOWIN AP-1", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a8b47043-d9b7-4afa-a986-9bb7940ef158", "ba69929e-317f-4089-bbd3-a1784c7ded81" ], "display_name": false } ], "references": [ { "uuid": "ba69929e-317f-4089-bbd3-a1784c7ded81", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a8b47043-d9b7-4afa-a986-9bb7940ef158", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9c945f91-9366-4a7b-945c-3ab630206abc", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "74299941-ba6d-4468-98d5-72d99d8bbe08", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391419000, "tags": [ "NOMEN" ] }, { "uuid": "39f49c73-acf3-4853-8ab8-239ffd083f9e", "citation": "SRS import [TZH7RZE6PF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TZH7RZE6PF", "doc_type": "SRS", "public_domain": true, "document_date": 1493391419000, "tags": [ "NOMEN" ] }, { "uuid": "97159009-98f8-43e2-821e-f3279b30269a", "citation": "ADAMANTANYL TRIHYDROXYBENZAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dd5a0d3e-b7f5-41f4-970e-112af1ccae50", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c985b1a4-a512-48a1-b9c6-0019d6929425", "id": "c985b1a4-a512-48a1-b9c6-0019d6929425", "molfile": "\n Marvin 01132110242D \n\n 22 25 0 0 0 0 999 V2000\n 7.6743 -5.4670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0314 -5.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6257 -6.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8007 -6.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3815 -5.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7872 -4.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5143 -4.2661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6121 -4.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9317 -4.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3949 -6.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8142 -7.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5700 -6.8936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1643 -7.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6959 -8.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1822 -9.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1822 -8.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6493 -8.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1295 -8.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6027 -8.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1356 -9.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1188 -7.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6493 -7.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 8 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 10 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 21 1 0 0 0 0\n 22 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 22 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 1 0 0 0 0\nM END", "smiles": "C1C2CC3CC1CC(C2)(C3)NC(=O)c4cc(c(c(c4)O)O)O", "formula": "C17H21NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "31621000-c0f9-4c26-9b86-e071e96c890c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "303.3536", "optical_activity": "NONE", "stereo_centers": 4 } ], "definition_level": "INCOMPLETE", "uuid": "cea256fa-372d-48f9-9afa-b8d5116224a9", "version": "3", "structure": { "id": "b69658e8-0a23-46de-9d3a-9a75b930f302", "molfile": "\n Marvin 01132109272D \n\n 22 25 0 0 0 0 999 V2000\n 7.0314 -5.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6121 -4.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7872 -4.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3815 -5.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8007 -6.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6257 -6.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3949 -6.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5700 -6.8936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8142 -7.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1643 -7.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6493 -7.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6493 -8.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1822 -8.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1822 -9.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6959 -8.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1188 -7.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6027 -8.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1356 -9.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1295 -8.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6743 -5.4670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9317 -4.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5143 -4.2661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 15 1 0 0 0 0\n 10 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 14 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 12 19 1 0 0 0 0\n 1 20 1 0 0 0 0\n 2 21 1 0 0 0 0\n 3 22 1 0 0 0 0\nM END", "smiles": "C1C2CC3CC1CC(C2)(C3)NC(=O)c4cc(c(c(c4)O)O)O", "formula": "C17H21NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "303.3536", "optical_activity": "NONE", "references": [ "39f49c73-acf3-4853-8ab8-239ffd083f9e", "ba69929e-317f-4089-bbd3-a1784c7ded81" ], "stereo_centers": 0 }, "unii": "TZH7RZE6PF" } ] }