{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fbf2713c-8547-44c7-91f5-edfa2f63468a",
          "code": "N0000175420",
          "comments": "Established Pharmacologic Class [EPC]|Thiazide-like Diuretic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175420",
          "code_system": "NDF-RT",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "3a7d6ec5-6c69-4930-ae1b-8765f5f72b03",
          "code": "C03BA08",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides, plain|metolazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03BA08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "63c26d01-7df1-4430-91f9-4b590bf5c11a",
          "code": "N0000175359",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Diuresis Alteration [PE]|Increased Diuresis [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175359",
          "code_system": "NDF-RT",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "430e672d-a46b-46ca-88be-6ce3bcae3236",
          "code": "QC03BA08",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides, plain|metolazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03BA08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "ee04a028-eeaa-4f09-a8d4-fd52ed3e4ac2",
          "code": "QC03EA12",
          "comments": "VATC|DIURETICS|DIURETICS AND POTASSIUM-SPARING AGENTS IN COMBINATION|Low-ceiling diuretics and potassium-sparing agents|metolazone and potassium-sparing agents",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03EA12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "7e847c1f-da93-4dc7-ba29-cdb659376c45",
          "code": "17560-51-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17560-51-9",
          "code_system": "CAS",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5",
            "655e1b8a-213d-4634-9783-32e3d8ad40e6"
          ]
        },
        {
          "uuid": "84929575-7db3-4723-a5d5-fe9a92cad3ce",
          "code": "C650",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C650",
          "code_system": "NCI_THESAURUS",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "2a0168ad-2c10-4d89-a2a9-0dc34366781d",
          "code": "CHEMBL878",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL878",
          "code_system": "ChEMBL",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "cb7f9d73-2b7a-4b3c-b8c2-81bde74e4a7d",
          "code": "4170",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4170",
          "code_system": "PUBCHEM",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "fe53c556-ebbc-43e1-a652-3ec2838f16f1",
          "code": "D008788",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008788",
          "code_system": "MESH",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "01e60978-97b4-4105-b7bf-eb1f91634480",
          "code": "630",
          "comments": "LiverTox|Cardiac|Diuretic|Thiazide",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/ThiazideDiuretics.htm",
          "code_system": "LIVERTOX",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "212c093a-b7d0-4cb8-8f04-a834dce9d961",
          "code": "METOLAZONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Metolazone",
          "code_system": "WIKIPEDIA",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "6a4bf16d-aab5-4222-b320-0cff9e67222c",
          "code": "C03EA12",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|DIURETICS AND POTASSIUM-SPARING AGENTS IN COMBINATION|Low-ceiling diuretics and potassium-sparing agents|metolazone and potassium-sparing agents",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03EA12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "573b609e-244c-4f33-990b-d0b64a6e6f07",
          "code": "2627",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2627",
          "code_system": "INN",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "712a38d7-e674-4811-ac4a-2b23de646398",
          "code": "241-539-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.748",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "7cc20d71-8b5a-450c-aced-7c07549cffb0",
          "code": "4838",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4838",
          "code_system": "IUPHAR",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "cd72a2cd-6514-4dc0-8ab3-5ab57468ca3e",
          "code": "6916",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6916/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "8a5001c4-12ca-4d93-8ce0-a78d3c33bda6",
          "code": "m7494",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7494?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "ef56baed-9d55-4f6e-af34-7962cb8c7162",
          "code": "DB00524",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00524",
          "code_system": "DRUG BANK",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "28cfe489-37b0-4eef-bc85-ac2427608ac3",
          "code": "SUB08906MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "18668b4b-3ac9-47cf-bf42-c42f311edeb5"
          ]
        },
        {
          "uuid": "42d96ec5-ba6a-0055-76db-5a5784adbef6",
          "code": "3367",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3367",
          "code_system": "HSDB",
          "references": [
            "b6f5e372-8a44-c8ea-bad4-73d2ec419e7c"
          ]
        },
        {
          "uuid": "30aafe7f-1c67-f605-42ba-85d652bbd1fd",
          "code": "DTXSID6045167",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6045167",
          "code_system": "EPA CompTox",
          "references": [
            "a9b30f37-435b-ebdf-fd55-91b31657336b"
          ]
        },
        {
          "uuid": "52545c40-9adc-e481-f38a-c8c3d15e7d3a",
          "code": "Metolazone",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM181/",
          "code_system": "LACTMED",
          "references": [
            "d3132a4e-19e3-78b5-d76f-4e9c3cafd1a9"
          ]
        },
        {
          "uuid": "e4579822-b825-83ec-74d2-b063db426214",
          "code": "C49185",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Thiazide Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49185",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d3132a4e-19e3-78b5-d76f-4e9c3cafd1a9"
          ]
        },
        {
          "uuid": "32e4e4b9-8019-4e44-8d51-609220b2a9f4",
          "code": "TZ7V40X7VX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4819a70d-ab97-f294-c4ff-f9c420e7c8dd",
          "code": "1783",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1783",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d3132a4e-19e3-78b5-d76f-4e9c3cafd1a9"
          ]
        },
        {
          "uuid": "9f98840d-eb6b-6dd5-1e42-742b5c20501a",
          "code": "1441200",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1441200",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "d3132a4e-19e3-78b5-d76f-4e9c3cafd1a9"
          ]
        },
        {
          "uuid": "66f8f79d-7a00-32f4-df5f-ba769686858e",
          "code": "64354",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64354",
          "code_system": "CHEBI",
          "references": [
            "d3132a4e-19e3-78b5-d76f-4e9c3cafd1a9"
          ]
        },
        {
          "uuid": "73054bc7-6a29-9413-0eed-0c2117e52793",
          "code": "TZ7V40X7VX",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=TZ7V40X7VX",
          "code_system": "DAILYMED",
          "references": [
            "ce953cc5-d850-cfab-e240-2bc252551b4f"
          ]
        },
        {
          "uuid": "0c18a67e-5a8d-5acf-11be-d90d46b7220b",
          "code": "100000080921",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "65174c13-c803-c239-2232-c48eef55d51f"
          ]
        },
        {
          "uuid": "82ccfec6-d5fc-4bb5-1b9c-4a3e31f663a1",
          "code": "759581",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759581",
          "code_system": "NSC",
          "references": [
            "6a8a5004-7165-9abb-35e3-bf8bea474f9f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cf1a2f76-0f4c-4c73-83a0-4c7cc1deaac0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ba101628-5cf8-47b0-a3f7-588c99512fdf",
            "refuuid": "5b1741bf-115f-4bd0-8138-fa87a902f81a",
            "name": "METOLAZONE",
            "unii": "TZ7V40X7VX",
            "linking_id": "TZ7V40X7VX",
            "ref_pname": "METOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c673ea9e-9df6-4843-9c8c-fefedd4ac4b7",
          "amount": {
            "uuid": "76ebd1b9-2f91-415f-998b-9aaa7d59c186",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e7c5caca-995d-4ab5-9ce6-a62266ccc570"
          ],
          "related_substance": {
            "uuid": "9ced8dbc-48f4-46a7-94d7-1aa0be060c3c",
            "refuuid": "0fb231cd-5de3-4213-a1f8-f300c8f93921",
            "name": "M-METOLAZONE",
            "unii": "Q1M5J89G86",
            "linking_id": "Q1M5J89G86",
            "ref_pname": "M-METOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8f603ce4-33a6-4b07-a549-99160f363954",
          "amount": {
            "uuid": "b6244f1c-456a-4ea4-a31b-d42e15c756ef",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e7c5caca-995d-4ab5-9ce6-a62266ccc570"
          ],
          "related_substance": {
            "uuid": "7c5ac4ce-a86b-4ba2-9003-a273f5c4bf97",
            "refuuid": "5c35dabe-50ac-4f53-bc9e-9cb9930afc67",
            "name": "DESMETHYL METOLAZONE",
            "unii": "HC03B6WQA9",
            "linking_id": "HC03B6WQA9",
            "ref_pname": "DESMETHYL METOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ad1fd667-81fc-4e8f-80a6-fa402bced8e7",
          "amount": {
            "uuid": "f07bf022-e072-4366-8c15-be50adc9673a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e7c5caca-995d-4ab5-9ce6-a62266ccc570"
          ],
          "related_substance": {
            "uuid": "7cb5584a-6a94-4068-b0c4-25028f8c52d5",
            "refuuid": "51f1b52d-da80-4d52-9952-80b2e882a6aa",
            "name": "DIDEHYDROMETOLAZONE",
            "unii": "74G6NBS2I7",
            "linking_id": "74G6NBS2I7",
            "ref_pname": "DIDEHYDROMETOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dea786a5-9070-413f-9b3b-d64bf245290c",
          "amount": {
            "uuid": "e1aa716d-8a41-4188-97fd-d4fee6383989",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e7c5caca-995d-4ab5-9ce6-a62266ccc570"
          ],
          "related_substance": {
            "uuid": "f3038249-5929-457c-93b7-b8c953f66547",
            "refuuid": "3b3d9764-3783-4e5a-9bb7-9c4881c5fc2e",
            "name": "2-Amino-4-chloro-5-sulfamoyl-N-(o-tolyl)benzamide",
            "unii": "U9363D8R2T",
            "linking_id": "U9363D8R2T",
            "ref_pname": "2-Amino-4-chloro-5-sulfamoyl-N-(o-tolyl)benzamide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ab210c12-c83b-44e7-a8e9-9f8786c15dc2",
          "amount": {
            "uuid": "0ba94c6b-2862-4c78-8d7a-e16b671e8ef1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 97
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "e7c5caca-995d-4ab5-9ce6-a62266ccc570"
          ],
          "related_substance": {
            "uuid": "a0b92bc0-ff10-4376-821c-5e3310d3c18f",
            "refuuid": "5b1741bf-115f-4bd0-8138-fa87a902f81a",
            "name": "METOLAZONE",
            "unii": "TZ7V40X7VX",
            "linking_id": "TZ7V40X7VX",
            "ref_pname": "METOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a6eba6af-35cc-4a1b-bcc9-98c0d9d06e11",
          "amount": {
            "uuid": "f683f8bc-ada7-45ca-a3dd-d64d16c07d26",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 97
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (UV)",
          "references": [
            "785cc8a1-d2e9-41df-bfc2-9582559ff436"
          ],
          "related_substance": {
            "uuid": "0635a1c4-e036-4aab-97a9-1ca548ba13c8",
            "refuuid": "5b1741bf-115f-4bd0-8138-fa87a902f81a",
            "name": "METOLAZONE",
            "unii": "TZ7V40X7VX",
            "linking_id": "TZ7V40X7VX",
            "ref_pname": "METOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "22725509-97e8-4899-a9ac-979d592e8ebc",
          "amount": {
            "uuid": "b2210caf-f6be-4b30-9cb4-13a5acbcde18",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e7c5caca-995d-4ab5-9ce6-a62266ccc570"
          ],
          "related_substance": {
            "uuid": "b6b0913b-3b8f-4dd6-868a-5df43a2bad3b",
            "refuuid": "5e46b412-7dc6-40ef-a6cf-e3d06a038844",
            "name": "P-METOLAZONE",
            "unii": "883J1AF03V",
            "linking_id": "883J1AF03V",
            "ref_pname": "P-METOLAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cf480215-a83b-4c84-9dcb-64237b7f5b4f",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "60622fb2-9337-4af0-9b51-7dcb99dbcd4e",
            "refuuid": "ad52678d-952e-4cad-863b-37ca882d8bfb",
            "name": "METOLAZONE SODIUM",
            "unii": "Q3AVC19UXB",
            "linking_id": "Q3AVC19UXB",
            "ref_pname": "METOLAZONE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c1191dbf-2589-4534-855a-b0287cde59fd",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "c226dec5-254e-4129-bd20-4e36a030c68d",
            "refuuid": "30161d51-91aa-4b2f-8886-a6af154e683b",
            "name": "METOLAZONE, (+)-",
            "unii": "NM7V2Y3G0U",
            "linking_id": "NM7V2Y3G0U",
            "ref_pname": "METOLAZONE, (+)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d015b022-cd8a-4541-aa2d-046e12e1572c",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "94fd95d4-9e61-4687-a18a-8dffe3a67447",
            "refuuid": "2b0c18ff-4ab5-4f59-ae29-2391d304fee5",
            "name": "METOLAZONE, (-)-",
            "unii": "NN9U607695",
            "linking_id": "NN9U607695",
            "ref_pname": "METOLAZONE, (-)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "96c6864f-03eb-4467-961b-4bfbb91476ed",
          "amount": {
            "uuid": "c15a8739-155b-4c02-951e-d0cc8e3c0302"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "e2f02d27-624c-46de-994e-8af76b43a641"
          ],
          "related_substance": {
            "uuid": "cc0c1928-44a1-4c40-8465-eaca8a5133d0",
            "refuuid": "a97027e4-e28e-4096-9648-aa4b1dff90a2",
            "name": "7-Chloro-6-sulfamoylisatoic anhydride",
            "unii": "ET594CS2LG",
            "linking_id": "ET594CS2LG",
            "ref_pname": "7-Chloro-6-sulfamoylisatoic anhydride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c53913b9-0a33-4bd4-8975-efb2d80495b1",
          "amount": {
            "uuid": "60cb242f-851d-44fe-ba20-b81320aef49e"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "a2c1df5b-d328-4203-b9ae-9ad629c330e2"
          ],
          "related_substance": {
            "uuid": "fb0e6787-4186-4afa-b7e7-6810e97945bf",
            "refuuid": "7d501625-30c8-475c-a273-61e596a72db7",
            "name": "N-nitroso-metolazone",
            "unii": "546MM27N7Q",
            "linking_id": "546MM27N7Q",
            "ref_pname": "N-nitroso-metolazone",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c696ee7e-3f35-436c-aa04-329b4549daa7",
          "name": "6-QUINAZOLINESULFONAMIDE, 7-CHLORO-1,2,3,4-TETRAHYDRO-2-METHYL-3-(2-METHYLPHENYL)-4-OXO-",
          "stdName": "6-QUINAZOLINESULFONAMIDE, 7-CHLORO-1,2,3,4-TETRAHYDRO-2-METHYL-3-(2-METHYLPHENYL)-4-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f03b0e84-7f73-4bbb-b993-52c097bfdd68"
          ],
          "display_name": false
        },
        {
          "uuid": "2d76f0de-2003-47bc-9647-0f05381e2b9c",
          "name": "7-CHLORO-1,2,3,4-TETRAHYDRO-2-METHYL-4-OXO-3-O-TOLYL-6-QUINAZOLINESULFONAMIDE",
          "stdName": "7-CHLORO-1,2,3,4-TETRAHYDRO-2-METHYL-4-OXO-3-O-TOLYL-6-QUINAZOLINESULFONAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f03b0e84-7f73-4bbb-b993-52c097bfdd68"
          ],
          "display_name": false
        },
        {
          "uuid": "fe85cc4b-088f-4227-890f-bcd3fe9eb572",
          "name": "DIULO",
          "stdName": "DIULO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f03b0e84-7f73-4bbb-b993-52c097bfdd68"
          ],
          "display_name": false
        },
        {
          "uuid": "fdeee137-0a19-4f34-bde8-c8702d54513a",
          "name": "METAZOLINE",
          "stdName": "METAZOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e068896d-d0d9-49f5-9095-b5511d6d47de"
          ],
          "display_name": false
        },
        {
          "uuid": "9ab6e03a-e6f1-42ff-8425-6e8b0f420409",
          "name": "METENIX",
          "stdName": "METENIX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e068896d-d0d9-49f5-9095-b5511d6d47de"
          ],
          "display_name": false
        },
        {
          "uuid": "0897537e-f9a9-4653-a2eb-08f8031b22a3",
          "name": "METOLAZONE",
          "stdName": "METOLAZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f042b7-9199-46ff-9830-db2807d62e71",
            "2e5199b4-6853-4770-bc99-b3aa3347df1a",
            "c242531b-fbe5-4fd9-b203-2390ef679b20",
            "d0ba0e44-e606-40be-b565-9a5ec731f47f",
            "217b0201-408f-4380-977f-676386833605",
            "817a2da6-c322-4ded-9492-0780f9a331fc",
            "459361ad-f410-4f44-b5f6-a8c475946637",
            "776fbf07-d791-47b6-8e97-92017d367efc",
            "09756ef1-4c72-4412-9735-159b137d7c5e",
            "3868f8af-2ceb-410c-89f8-55cb77a76407",
            "e3d8294b-8fd6-41bf-94d6-7e780eaafc2e",
            "39e1c7ae-e448-44a1-a39c-c5689bf2721b",
            "c98f1806-3a61-4bfd-b9a3-cd0d53f7627e",
            "a9b7fc2a-7b72-4bb9-8f5c-288b3eabb9d7",
            "e7c57af3-2bd2-4cbf-bc8e-e802c9e99e7a",
            "91c042cd-6f8f-4c66-adef-4b354084c8f9",
            "b49fb655-a1b0-4e85-bfe8-cee44d784771",
            "dc9fc303-57e9-42f4-90bf-b7a8553e4f73",
            "450a5fb5-b2fc-4cc5-9341-30f5a40d369c",
            "5c9b5014-a31b-4a7c-852b-d20fd61093de",
            "aa7238bb-c5b3-4d82-a6ad-15a1789435c2",
            "668a9f8d-9605-4afd-89de-c5a4c2a3ece9",
            "95c4ace7-41c0-432d-829f-28949e0f8d71",
            "bc7b91e6-77a6-4727-b2dd-e1f802725dd3",
            "01bcdf76-59f4-43dc-abb9-0b2218d4eeed"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "62144743-cfb4-4df2-a2a8-a49e99d6f00e",
              "name_org": "INN"
            },
            {
              "uuid": "012addd5-a6cd-4893-b7cf-3f4feb40e0fe",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "7e1dcee0-5474-244a-5fab-4e6bcef4266a",
          "name": "METOLAZONE [EP IMPURITY]",
          "stdName": "METOLAZONE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "776fbf07-d791-47b6-8e97-92017d367efc"
          ],
          "display_name": false
        },
        {
          "uuid": "4e14a933-f4d0-0947-d81c-addd387e23a5",
          "name": "METOLAZONE [EP MONOGRAPH]",
          "stdName": "METOLAZONE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "040c64ad-1f93-7d92-3705-4e0d6d8fa833"
          ],
          "display_name": false
        },
        {
          "uuid": "ee2d9bf4-b0fa-4adb-9b2f-bd64dd0b88e6",
          "name": "METOLAZONE [HSDB]",
          "stdName": "METOLAZONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "459361ad-f410-4f44-b5f6-a8c475946637"
          ],
          "display_name": false
        },
        {
          "uuid": "870f2a88-ab0d-4a2d-b2c9-dc94825aaf26",
          "name": "METOLAZONE [JAN]",
          "stdName": "METOLAZONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91c042cd-6f8f-4c66-adef-4b354084c8f9"
          ],
          "display_name": false
        },
        {
          "uuid": "937a2ade-edbd-4bde-bb76-2c42b85a50d9",
          "name": "METOLAZONE [MART.]",
          "stdName": "METOLAZONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3d8294b-8fd6-41bf-94d6-7e780eaafc2e"
          ],
          "display_name": false
        },
        {
          "uuid": "f10e4f84-219e-41a6-9f87-1e38a64f4262",
          "name": "METOLAZONE [MI]",
          "stdName": "METOLAZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "668a9f8d-9605-4afd-89de-c5a4c2a3ece9"
          ],
          "display_name": false
        },
        {
          "uuid": "799db96f-cc16-47b8-ad97-405476a79b03",
          "name": "METOLAZONE [ORANGE BOOK]",
          "stdName": "METOLAZONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e5199b4-6853-4770-bc99-b3aa3347df1a"
          ],
          "display_name": false
        },
        {
          "uuid": "67b5ed4e-2fc1-4eb3-8f31-fbc4b29210d5",
          "name": "METOLAZONE [USAN]",
          "stdName": "METOLAZONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95c4ace7-41c0-432d-829f-28949e0f8d71"
          ],
          "display_name": false
        },
        {
          "uuid": "871d37ac-db74-af5a-80ea-1d4d3aca9e45",
          "name": "METOLAZONE [USP MONOGRAPH]",
          "stdName": "METOLAZONE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4cbc429-6909-fcf5-8775-e9e50888174c"
          ],
          "display_name": false
        },
        {
          "uuid": "4d0c8882-7ccc-4770-8be0-9bc57d259211",
          "name": "METOLAZONE [USP-RS]",
          "stdName": "METOLAZONE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c98f1806-3a61-4bfd-b9a3-cd0d53f7627e"
          ],
          "display_name": false
        },
        {
          "uuid": "26050620-982f-4bc0-9538-5ec0ef5214c4",
          "name": "METOLAZONE [VANDF]",
          "stdName": "METOLAZONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3868f8af-2ceb-410c-89f8-55cb77a76407"
          ],
          "display_name": false
        },
        {
          "uuid": "37bb1ad5-c715-4b1c-9d68-3b0ba4ad12ec",
          "name": "METOZALONE",
          "stdName": "METOZALONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e068896d-d0d9-49f5-9095-b5511d6d47de"
          ],
          "display_name": false
        },
        {
          "uuid": "7d345ca6-49a6-4f32-8c61-060470582101",
          "name": "MYKROX",
          "stdName": "MYKROX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f03b0e84-7f73-4bbb-b993-52c097bfdd68"
          ],
          "display_name": false
        },
        {
          "uuid": "86bbc613-e0b2-fddb-1093-c5c964117033",
          "name": "Metolazone [WHO-DD]",
          "stdName": "METOLAZONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35131c7b-cb9f-fb6c-3b1c-291f06c9cfd4"
          ],
          "display_name": false
        },
        {
          "uuid": "9c66f75b-01c0-4140-929d-ce1573ccd4a2",
          "name": "NORMELAN",
          "stdName": "NORMELAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e068896d-d0d9-49f5-9095-b5511d6d47de"
          ],
          "display_name": false
        },
        {
          "uuid": "a5e043e3-ba46-0e2a-d25e-d997efd263b0",
          "name": "NSC-759581",
          "stdName": "NSC-759581",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a8a5004-7165-9abb-35e3-bf8bea474f9f"
          ],
          "display_name": false
        },
        {
          "uuid": "2cd74235-b3e3-4c49-bb0e-9ded25001faf",
          "name": "OLDREN",
          "stdName": "OLDREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e068896d-d0d9-49f5-9095-b5511d6d47de"
          ],
          "display_name": false
        },
        {
          "uuid": "e8dde756-81c9-460f-88c6-13e3b54790af",
          "name": "SR 720-22",
          "stdName": "SR 720-22",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f03b0e84-7f73-4bbb-b993-52c097bfdd68"
          ],
          "display_name": false
        },
        {
          "uuid": "176ee801-c932-4487-8949-974ff71c486d",
          "name": "SR-720-22",
          "stdName": "SR-720-22",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e068896d-d0d9-49f5-9095-b5511d6d47de"
          ],
          "display_name": false
        },
        {
          "uuid": "8b6b663e-c139-4e1b-964a-01dfd101ec94",
          "name": "ZAROXOLYN",
          "stdName": "ZAROXOLYN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f03b0e84-7f73-4bbb-b993-52c097bfdd68"
          ],
          "display_name": false
        },
        {
          "uuid": "bfe04b70-1d7f-4805-a13c-00345f8ecf0d",
          "name": "metolazone [INN]",
          "stdName": "METOLAZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc9fc303-57e9-42f4-90bf-b7a8553e4f73"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5c9b5014-a31b-4a7c-852b-d20fd61093de",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f03b0e84-7f73-4bbb-b993-52c097bfdd68",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc9fc303-57e9-42f4-90bf-b7a8553e4f73",
          "citation": "INN Proposed List 21",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL21.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "95c4ace7-41c0-432d-829f-28949e0f8d71",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "776fbf07-d791-47b6-8e97-92017d367efc",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc7b91e6-77a6-4727-b2dd-e1f802725dd3",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91c042cd-6f8f-4c66-adef-4b354084c8f9",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e5199b4-6853-4770-bc99-b3aa3347df1a",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3d8294b-8fd6-41bf-94d6-7e780eaafc2e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "668a9f8d-9605-4afd-89de-c5a4c2a3ece9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "459361ad-f410-4f44-b5f6-a8c475946637",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c98f1806-3a61-4bfd-b9a3-cd0d53f7627e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7c57af3-2bd2-4cbf-bc8e-e802c9e99e7a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3868f8af-2ceb-410c-89f8-55cb77a76407",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e068896d-d0d9-49f5-9095-b5511d6d47de",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18668b4b-3ac9-47cf-bf42-c42f311edeb5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7c5caca-995d-4ab5-9ce6-a62266ccc570",
          "citation": "EP 7.8 METOLAZONE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "785cc8a1-d2e9-41df-bfc2-9582559ff436",
          "citation": "USP 36 METOLAZONE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "addc9cd9-d516-40a0-ad27-998526363352",
          "citation": "SRS import [TZ7V40X7VX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TZ7V40X7VX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95f042b7-9199-46ff-9830-db2807d62e71",
          "citation": "METOLAZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01bcdf76-59f4-43dc-abb9-0b2218d4eeed",
          "citation": "METOLAZONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39e1c7ae-e448-44a1-a39c-c5689bf2721b",
          "citation": "METOLAZONE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0ba0e44-e606-40be-b565-9a5ec731f47f",
          "citation": "METOLAZONE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9b7fc2a-7b72-4bb9-8f5c-288b3eabb9d7",
          "citation": "METOLAZONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "217b0201-408f-4380-977f-676386833605",
          "citation": "METOLAZONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09756ef1-4c72-4412-9735-159b137d7c5e",
          "citation": "METOLAZONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b49fb655-a1b0-4e85-bfe8-cee44d784771",
          "citation": "METOLAZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "817a2da6-c322-4ded-9492-0780f9a331fc",
          "citation": "METOLAZONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa7238bb-c5b3-4d82-a6ad-15a1789435c2",
          "citation": "METOLAZONE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c242531b-fbe5-4fd9-b203-2390ef679b20",
          "citation": "METOLAZONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "450a5fb5-b2fc-4cc5-9341-30f5a40d369c",
          "citation": "METOLAZONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6f5e372-8a44-c8ea-bad4-73d2ec419e7c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+17560-51-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9b30f37-435b-ebdf-fd55-91b31657336b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17560-51-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bb5140ae-0a75-bf0a-e19a-01906864cdbb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+17560-51-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e2f02d27-624c-46de-994e-8af76b43a641",
          "citation": "https://en.wikipedia.org/wiki/Metolazone",
          "url": "https://en.wikipedia.org/wiki/Metolazone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d3132a4e-19e3-78b5-d76f-4e9c3cafd1a9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "655e1b8a-213d-4634-9783-32e3d8ad40e6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f4cbc429-6909-fcf5-8775-e9e50888174c",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "6a8a5004-7165-9abb-35e3-bf8bea474f9f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "040c64ad-1f93-7d92-3705-4e0d6d8fa833",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "ce953cc5-d850-cfab-e240-2bc252551b4f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "35131c7b-cb9f-fb6c-3b1c-291f06c9cfd4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "65174c13-c803-c239-2232-c48eef55d51f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a2c1df5b-d328-4203-b9ae-9ad629c330e2",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0ef873c6-ca04-4185-a4da-19cd464cca3c",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8441fe5d-c323-4ea8-b33b-14cc2791715f",
          "id": "8441fe5d-c323-4ea8-b33b-14cc2791715f",
          "molfile": "\n  Marvin  01132106522D          \n\n 24 26  0  0  0  0            999 V2000\n    1.8312   -0.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1110   -1.3638    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.3780   -0.9450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2758   -1.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0088   -0.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7367   -1.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4723   -0.8812    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7367   -2.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0344   -2.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2911   -2.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3294   -2.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3141   -3.2895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1110   -2.1556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7929   -2.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5361   -2.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2410   -2.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2410   -3.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5208   -3.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7929   -3.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1519   -3.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3573   -2.4927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2078   -2.8528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8835   -1.8465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2731   -3.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 10  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 21  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 24 21  2  0  0  0  0\nM  END",
          "smiles": "Cc1ccccc1N2C(C)Nc3cc(c(cc3C2=O)S(=O)(=O)N)Cl",
          "formula": "C16H16ClN3O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d5acf782-c4d5-40e7-9bc5-fac0d2a98a2c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "365.8362",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b1741bf-115f-4bd0-8138-fa87a902f81a",
      "version": "58",
      "structure": {
        "id": "03d7f1f0-0806-4036-ad2d-98ad8a01f352",
        "molfile": "\n  Marvin  01132100302D          \n\n 24 26  0  0  0  0            999 V2000\n    1.1110   -2.1556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3294   -2.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2911   -2.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3573   -2.4927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7367   -2.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1110   -1.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2758   -1.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3780   -0.9450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0344   -2.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7929   -2.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7367   -1.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0088   -0.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3141   -3.2895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8835   -1.8465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2731   -3.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2078   -2.8528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7929   -3.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4723   -0.8812    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.8312   -0.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5361   -2.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1519   -3.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5208   -3.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2410   -2.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2410   -3.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  2  2  0  0  0  0\n 14  4  2  0  0  0  0\n 15  4  2  0  0  0  0\n 16  4  1  0  0  0  0\n 17 10  2  0  0  0  0\n 18 11  1  0  0  0  0\n  6 19  1  0  0  0  0\n 20 10  1  0  0  0  0\n 21 17  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 20  2  0  0  0  0\n 24 23  1  0  0  0  0\n  7  3  1  0  0  0  0\n 24 22  2  0  0  0  0\n 11  5  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccccc1N2C(C)Nc3cc(c(cc3C2=O)S(=O)(=O)N)Cl",
        "formula": "C16H16ClN3O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "365.8362",
        "optical_activity": "( + / - )",
        "references": [
          "5c9b5014-a31b-4a7c-852b-d20fd61093de",
          "addc9cd9-d516-40a0-ad27-998526363352",
          "dc9fc303-57e9-42f4-90bf-b7a8553e4f73"
        ],
        "stereo_centers": 1
      },
      "unii": "TZ7V40X7VX"
    }
  ]
}