{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b7a928e9-75ea-40fa-9d7d-d2c71ad01661", "code": "338735-71-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=338735-71-0", "code_system": "CAS", "references": [ "87c22feb-14ba-4738-87ec-836fdad22e43", "fc1e8848-a0e3-4576-9829-150a0b1bc370" ] }, { "uuid": "17ba85cb-b05c-4526-91a1-1af7acb17c8c", "code": "57357974", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57357974", "code_system": "PUBCHEM", "references": [ "87c22feb-14ba-4738-87ec-836fdad22e43" ] }, { "uuid": "e50db308-d5e4-fd2b-c9a7-c133ba8b1e63", "code": "DTXSID9051373", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9051373", "code_system": "EPA CompTox", "references": [ "341680a5-d577-d239-37ff-438e00b5d818" ] }, { "uuid": "cc16e41b-ce9a-4fdf-8c64-fe91aedd2191", "code": "TZ57DU22YD", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d85949f7-0189-44f9-9f38-52bd1ffc6701", "name": "2,6,6,7,8,8-Hexamethyldecahydro-2H-indeno[4,5-b]furan", "stdName": "2,6,6,7,8,8-HEXAMETHYLDECAHYDRO-2H-INDENO(4,5-B)FURAN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d1bd22df-f7cb-46cb-af5e-03d18bfb9f66" ], "display_name": false }, { "uuid": "876ff30c-bc64-4b80-9c70-c0ef13725a8c", "name": "2H-Indeno[4,5-b]furan, decahydro-2,6,6,7,8,8-hexamethyl-", "stdName": "2H-INDENO(4,5-B)FURAN, DECAHYDRO-2,6,6,7,8,8-HEXAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fc1e8848-a0e3-4576-9829-150a0b1bc370" ], "display_name": false }, { "uuid": "cb18bb13-8849-48e6-b891-e88cc6a5a2a4", "name": "Decahydro-2,6,6,7,8,8-hexamethyl-2H-indeno[4,5-b]furan", "stdName": "DECAHYDRO-2,6,6,7,8,8-HEXAMETHYL-2H-INDENO(4,5-B)FURAN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d62c4fcb-0af6-4a18-a2cf-ec3d492e1c27" ], "display_name": true }, { "uuid": "bdd15499-ccd8-4589-899a-44e51b848c64", "name": "TRISAMBER", "stdName": "TRISAMBER", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "d62c4fcb-0af6-4a18-a2cf-ec3d492e1c27" ], "display_name": false } ], "references": [ { "uuid": "d1bd22df-f7cb-46cb-af5e-03d18bfb9f66", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d62c4fcb-0af6-4a18-a2cf-ec3d492e1c27", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "87c22feb-14ba-4738-87ec-836fdad22e43", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391591000, "tags": [ "NOMEN" ] }, { "uuid": "faa7024a-d9c3-48d9-adf2-436265bd2f1d", "citation": "COMMON FRAGRANCE AND FLAVOR MATERIALS: PREPARATION, PROPERTIES AND USES, BY HORST SURBURG, JOHANNES PANTEN;", "url": "http://fragranceingredients.iff.com/ingredients.aspx", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "341680a5-d577-d239-37ff-438e00b5d818", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=338735-71-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fc1e8848-a0e3-4576-9829-150a0b1bc370", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b07a749b-74de-4ab0-bf99-e0583de183dc", "id": "b07a749b-74de-4ab0-bf99-e0583de183dc", "molfile": "\n Marvin 01132109092D \n\n 18 20 0 0 0 0 999 V2000\n 4.9317 -2.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1081 -2.4363 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.6199 -3.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8357 -2.8506 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1157 -3.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4006 -2.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4006 -2.0269 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1157 -1.6077 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.8357 -2.0269 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.6199 -1.7705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9480 -0.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7322 -0.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1244 -0.7151 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.7151 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7841 -1.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1775 -2.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 10 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 9 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 16 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 11 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 11 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\nM END", "smiles": "CC1CC2CCC3C(C2O1)C(C)(C)C(C)C3(C)C", "formula": "C17H30O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2baba616-5793-48db-b160-efc0e646b774" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "250.4201", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "06985ed0-6dff-4f3f-bc35-53d8fab67ad0", "version": "6", "structure": { "id": "df365c81-776c-4f09-a143-9f018203ae55", "molfile": "\n Marvin 01132111342D \n\n 18 20 0 0 0 0 999 V2000\n 3.6199 -1.7705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1081 -2.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8357 -2.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6199 -3.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8357 -2.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1244 -0.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -1.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9480 -0.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4006 -2.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7841 -1.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4006 -2.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -3.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9317 -2.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1775 -2.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7151 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7322 -0.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 13 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 12 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 10 1 0 0 0 0\n 6 16 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 17 1 0 0 0 0\n 8 18 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 15 1 0 0 0 0\n 11 12 1 0 0 0 0\nM END", "smiles": "CC1CC2CCC3C(C2O1)C(C)(C)C(C)C3(C)C", "formula": "C17H30O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "250.4201", "optical_activity": "UNSPECIFIED", "references": [ "d1bd22df-f7cb-46cb-af5e-03d18bfb9f66" ], "stereo_centers": 6 }, "unii": "TZ57DU22YD" } ] }