{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c623c293-38f1-4b07-a2a4-917045bf2443",
          "code": "17540-75-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17540-75-9",
          "code_system": "CAS",
          "references": [
            "7c0c410a-d5c8-4858-8511-17e1d6ec2c8a",
            "48d2c6b3-13f9-4610-bbd3-9058420f61c5"
          ]
        },
        {
          "uuid": "a87cf333-fbe3-411d-a1ef-e96c47a6e287",
          "code": "FCN NO. 80",
          "comments": "FCN|ANTIOXIDANT|PLASTICIZED PVC",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=80",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "7c0c410a-d5c8-4858-8511-17e1d6ec2c8a"
          ]
        },
        {
          "uuid": "f0aa7399-2e91-478f-a533-c2b44ceb6952",
          "code": "21 CFR 175.105",
          "comments": "PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS|Subpart B--Substances for Use Only as Components of Adhesives|Sec. 175.105 Adhesives.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=175.105",
          "code_system": "CFR",
          "references": [
            "7c0c410a-d5c8-4858-8511-17e1d6ec2c8a"
          ]
        },
        {
          "uuid": "e728b1c7-3325-45af-b355-2c57a775d21a",
          "code": "241-533-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.742",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7c0c410a-d5c8-4858-8511-17e1d6ec2c8a"
          ]
        },
        {
          "uuid": "ba56a280-af07-4e7a-a886-1104e44df13c",
          "code": "86583",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86583",
          "code_system": "PUBCHEM",
          "references": [
            "7c0c410a-d5c8-4858-8511-17e1d6ec2c8a"
          ]
        },
        {
          "uuid": "bbd1fad2-01bf-4358-aece-a71ce385387d",
          "code": "DTXSID8029315",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8029315",
          "code_system": "EPA CompTox",
          "references": [
            "ff65eeff-d651-00ea-e406-153d09cc21c6"
          ]
        },
        {
          "uuid": "84d7153b-94a3-47e6-a430-eec687aaf72f",
          "code": "TYL476W27Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8efd7a71-8b00-7b4f-2aeb-65d2a9f5eedb",
          "code": "14460",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=14460",
          "code_system": "NSC",
          "references": [
            "6ecb9f5e-b84b-62e2-918b-410d093ab9f0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f3e0bb69-d8b8-4e1a-b317-88f45601b699",
          "name": "(±)-4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL",
          "stdName": "(+/-)-4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a1f90a-0c63-4a44-b386-07a75b20dea9",
            "14f77112-d500-4a80-92a0-39db21ac4d26"
          ],
          "display_name": false
        },
        {
          "uuid": "63a3928f-674e-42ea-a731-77b21cf88cd3",
          "name": "2,6-BIS(1,1-DIMETHYLETHYL)-4-(1-METHYLPROPYL)PHENOL",
          "stdName": "2,6-BIS(1,1-DIMETHYLETHYL)-4-(1-METHYLPROPYL)PHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6be5f159-6aff-41f8-a712-885e86e72dc4",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": false
        },
        {
          "uuid": "f7b2ef3f-10b1-4658-8698-da6f4e4b4b8a",
          "name": "2,6-DI-TERTIARY-BUTYL-4-SEC-BUTYLPHENOL",
          "stdName": "2,6-DI-TERTIARY-BUTYL-4-SEC-BUTYLPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2775207-523c-4ca2-9c5c-c0e4da52fd82",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": false
        },
        {
          "uuid": "76cf1d7f-8928-47d6-b939-59f17c2aa486",
          "name": "4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL",
          "stdName": "4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc04c4d9-1417-4cba-bedc-97c65acd8532",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": true
        },
        {
          "uuid": "1c6e47ed-a030-4182-929e-aa7cae35171f",
          "name": "ISONOX 132",
          "stdName": "ISONOX 132",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2775207-523c-4ca2-9c5c-c0e4da52fd82",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": false
        },
        {
          "uuid": "38f8e26b-1dd1-4f2c-b39e-9f17d1ca5b8b",
          "name": "ISONOX(R) 132",
          "stdName": "ISONOX(R) 132",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2775207-523c-4ca2-9c5c-c0e4da52fd82",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": false
        },
        {
          "uuid": "1e8d3801-b7c1-4d60-aaac-cfa3360de1fe",
          "name": "NSC-14460",
          "stdName": "NSC-14460",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a1f90a-0c63-4a44-b386-07a75b20dea9",
            "14f77112-d500-4a80-92a0-39db21ac4d26"
          ],
          "display_name": false
        },
        {
          "uuid": "c89986cf-5005-44f0-b567-f75344585078",
          "name": "PHENOL, 2,6-BIS(1,1-DIMETHYLETHYL)-4-(1-METHYLPROPYL)-",
          "stdName": "PHENOL, 2,6-BIS(1,1-DIMETHYLETHYL)-4-(1-METHYLPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc04c4d9-1417-4cba-bedc-97c65acd8532",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": false
        },
        {
          "uuid": "b35212b6-9552-4d9c-8d16-ab1587d2d57c",
          "name": "PHENOL, 4-SEC-BUTYL-2,6-DI-TERT-BUTYL-",
          "stdName": "PHENOL, 4-SEC-BUTYL-2,6-DI-TERT-BUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc04c4d9-1417-4cba-bedc-97c65acd8532",
            "50a1f90a-0c63-4a44-b386-07a75b20dea9"
          ],
          "display_name": false
        },
        {
          "uuid": "ed47976a-62b2-48e4-8646-73c3fa64a31d",
          "name": "VANOX 1320",
          "stdName": "VANOX 1320",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a1f90a-0c63-4a44-b386-07a75b20dea9",
            "14f77112-d500-4a80-92a0-39db21ac4d26"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "14f77112-d500-4a80-92a0-39db21ac4d26",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "50a1f90a-0c63-4a44-b386-07a75b20dea9",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc04c4d9-1417-4cba-bedc-97c65acd8532",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2775207-523c-4ca2-9c5c-c0e4da52fd82",
          "citation": "CHEMICAL BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6be5f159-6aff-41f8-a712-885e86e72dc4",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c0c410a-d5c8-4858-8511-17e1d6ec2c8a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390825000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de9dba3c-a6bf-41d1-826d-79bceab90506",
          "citation": "CFSAN FAP 3B3734",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbbb2a93-1661-4d3c-8657-7d8a0582c21f",
          "citation": "SRS import [TYL476W27Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TYL476W27Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390825000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff65eeff-d651-00ea-e406-153d09cc21c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17540-75-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48d2c6b3-13f9-4610-bbd3-9058420f61c5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6ecb9f5e-b84b-62e2-918b-410d093ab9f0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "41a95d01-a02c-452b-982d-662d4e06ab4e",
          "id": "41a95d01-a02c-452b-982d-662d4e06ab4e",
          "molfile": "\n  Marvin  01132103282D          \n\n 19 19  0  0  0  0            999 V2000\n    4.1988   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0238   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4363   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.0238   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2613   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6738   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4987   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9112   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7362   -4.2392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4987   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6738   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9112   -5.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3279   -6.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4416   -6.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5871   -5.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9112   -2.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3279   -2.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5871   -3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4416   -2.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
          "smiles": "CCC(C)c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C",
          "formula": "C18H30O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f58acfeb-8afe-402c-a668-9c7c480302ba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "262.4309",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3fba8cff-b64c-4d49-abcb-9a7cdf88a6ee",
      "version": "4",
      "structure": {
        "id": "a99879da-7cd7-48fd-ae92-c5008cd8197b",
        "molfile": "\n  Marvin  01132108482D          \n\n 19 19  0  0  0  0            999 V2000\n    5.0238   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1988   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4363   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2613   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6738   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4987   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9112   -2.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3279   -2.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5871   -3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4416   -2.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9112   -4.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7362   -4.2392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4987   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6738   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9112   -5.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3279   -6.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4416   -6.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5871   -5.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0238   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  4  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n  3 19  1  0  0  0  0\nM  END",
        "smiles": "CCC(C)c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C",
        "formula": "C18H30O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "262.4309",
        "optical_activity": "( + / - )",
        "references": [
          "bc04c4d9-1417-4cba-bedc-97c65acd8532",
          "cbbb2a93-1661-4d3c-8657-7d8a0582c21f"
        ],
        "stereo_centers": 1
      },
      "unii": "TYL476W27Y"
    }
  ]
}