{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "16dc5c78-70b9-40a8-9fe5-8b3d11ef625f",
          "code": "134-35-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=134-35-0",
          "code_system": "CAS",
          "references": [
            "6dadca08-e156-4a07-ab34-8d2005df4b96",
            "b450d5e1-8487-4180-8d72-68b8ce38279e"
          ]
        },
        {
          "uuid": "56cbefd5-986c-4da5-ac6f-5a2fa14cc2d1",
          "code": "1313966",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313966/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6dadca08-e156-4a07-ab34-8d2005df4b96"
          ]
        },
        {
          "uuid": "a7f5e0b9-48fa-4d89-b4be-fde1b32c0455",
          "code": "SUB35466",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6dadca08-e156-4a07-ab34-8d2005df4b96"
          ]
        },
        {
          "uuid": "f4b2d808-03cd-b3b0-6295-d8632dac47b4",
          "code": "135415868",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135415868",
          "code_system": "PUBCHEM",
          "references": [
            "e8f92198-37a7-ace1-bc28-f4a144d583ea"
          ]
        },
        {
          "uuid": "200b474a-a0f6-0b66-9754-755c20e61c1b",
          "code": "5-Methyltetrahydrofolate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/5-Methyltetrahydrofolate",
          "code_system": "WIKIPEDIA",
          "references": [
            "936f5e0b-ff2f-c925-c139-516d4000440b"
          ]
        },
        {
          "uuid": "7aa7497c-5eda-e7f9-b35a-3224089f1347",
          "code": "DTXSID4048278",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4048278",
          "code_system": "EPA CompTox",
          "references": [
            "39e652ad-fa36-58e3-ed2f-20bf9793d358"
          ]
        },
        {
          "uuid": "f7dedc4d-aac2-7808-8214-5db5d0ee5e29",
          "code": "33274-2",
          "comments": "LOINC|ACTIVE|CHEM|CSF|5-Methyltetrahydrofolate [Presence] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/33274-2/",
          "code_system": "LOINC",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "d278bb99-5c52-0205-cc9e-dcdfadc11fd5",
          "code": "34637-9",
          "comments": "LOINC|ACTIVE|CHEM|CSF|5-Methyltetrahydrofolate [Mass/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/34637-9/",
          "code_system": "LOINC",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "021d2dab-f39c-6686-5ffe-3516872ae40c",
          "code": "47547-5",
          "comments": "LOINC|ACTIVE|CHEM|CSF|5-Methyltetrahydrofolate [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/47547-5/",
          "code_system": "LOINC",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "9f7444d4-215e-1564-0fca-594183c1dc00",
          "code": "50153-6",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|5-Methyltetrahydrofolate [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/50153-6/",
          "code_system": "LOINC",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "f4d43d3a-d5be-8f13-565f-5da7ba88177b",
          "code": "50039-7",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|5-Methyltetrahydrofolate/Folate in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/50039-7/",
          "code_system": "LOINC",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "467bee9d-4be5-a5bc-142d-7e1794095d42",
          "code": "DB04789",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04789",
          "code_system": "DRUG BANK",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "f44372cf-924b-4d6b-8fd4-7ec6176a60ed",
          "code": "TYK22LML8F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f555d8d6-ee32-c3e9-6ead-be76ea3af787",
          "code": "15641",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15641",
          "code_system": "CHEBI",
          "references": [
            "b2336c38-ceb3-cce2-68ff-68ece1f668dc"
          ]
        },
        {
          "uuid": "9dd49e69-8c78-b52e-95b5-e7dd6bedac46",
          "code": "100000128433",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "502010f6-df88-7385-835f-f2154ef3dc2e"
          ]
        },
        {
          "uuid": "d7590dc4-50da-b421-1d59-b6c4c824246e",
          "code": "TYK22LML8F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=TYK22LML8F",
          "code_system": "DAILYMED",
          "references": [
            "c2f485fa-c7a1-cedd-594d-b8042d8c11d0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f23efa9b-e82e-4261-b0e1-d4b268ec0f2c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6beb1054-4a5a-40cc-8ea2-097d8692ac4a",
            "refuuid": "766575fb-1d4d-4f32-97b8-c204d6225fe0",
            "name": "5-METHYLTETRAHYDROFOLIC ACID",
            "unii": "TYK22LML8F",
            "linking_id": "TYK22LML8F",
            "ref_pname": "5-METHYLTETRAHYDROFOLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "81d77542-184c-4f3d-9a9d-96d855e6d1f6",
          "type": "PARENT->IMPURITY",
          "references": [
            "109a337b-6291-491e-8b2e-6ae95ed03fc4"
          ],
          "related_substance": {
            "uuid": "d100ce0c-14be-4f23-b8ac-3166e0a1f265",
            "refuuid": "761cac42-ddd5-4808-9251-aa10a56cfeb5",
            "name": "LEVOMEFOLATE CALCIUM",
            "unii": "A9R10K3F2F",
            "linking_id": "A9R10K3F2F",
            "ref_pname": "LEVOMEFOLATE CALCIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "64536942-a3cd-4352-874d-e6e09f9fa857",
          "name": "5-METHYLTETRAHYDROFOLATE",
          "stdName": "5-METHYLTETRAHYDROFOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5849f530-34ad-496a-ae7f-6dca6eb1dd95",
            "b13b4b53-a398-477a-810b-7cc7f59ee657",
            "87b44e07-ff52-41a7-b231-dccbd75ef82a",
            "f966f92f-bb78-42f0-ad1f-49317b971e31"
          ],
          "display_name": false
        },
        {
          "uuid": "74cde156-c314-4607-a874-6b34452fc58f",
          "name": "5-METHYLTETRAHYDROFOLIC ACID",
          "stdName": "5-METHYLTETRAHYDROFOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e0d4f02-fdf1-4da0-8c49-b15a47e9f8b8",
            "f2455812-67f3-4041-9803-829c623c020d",
            "b13b4b53-a398-477a-810b-7cc7f59ee657",
            "fc68111e-8e66-456f-abff-69b610492f8c"
          ],
          "display_name": true
        },
        {
          "uuid": "78333edc-6d81-45cf-b742-1ec164cb7723",
          "name": "5-METHYLTETRAHYDROFOLIC ACID [DSC]",
          "stdName": "5-METHYLTETRAHYDROFOLIC ACID [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2455812-67f3-4041-9803-829c623c020d",
            "b13b4b53-a398-477a-810b-7cc7f59ee657"
          ],
          "display_name": false
        },
        {
          "uuid": "ddcfbf8a-49a2-41cc-29a4-9c7c246c2a2f",
          "name": "5-Methyltetrahydrofolate [WHO-DD]",
          "stdName": "5-METHYLTETRAHYDROFOLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "124b556d-35b9-5dbe-d6eb-4db6502bb223"
          ],
          "display_name": false
        },
        {
          "uuid": "a41af02f-e244-45be-a71a-e6eaad1772cb",
          "name": "L-GLUTAMIC ACID, N-(4-(((2-AMINO-1,4,5,6,7,8-HEXAHYDRO-5-METHYL-4-OXO-6-PTERIDINYL)METHYL)AMINO)BENZOYL)-",
          "stdName": "L-GLUTAMIC ACID, N-(4-(((2-AMINO-1,4,5,6,7,8-HEXAHYDRO-5-METHYL-4-OXO-6-PTERIDINYL)METHYL)AMINO)BENZOYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b13b4b53-a398-477a-810b-7cc7f59ee657",
            "fc68111e-8e66-456f-abff-69b610492f8c"
          ],
          "display_name": false
        },
        {
          "uuid": "3dd4c027-654a-42ab-be41-16420b82af0c",
          "name": "MEFOLIC ACID",
          "stdName": "MEFOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb6a782b-7371-4637-8ab7-665488f400f4",
            "b13b4b53-a398-477a-810b-7cc7f59ee657"
          ],
          "display_name": false
        },
        {
          "uuid": "90c435ec-4681-4ac0-9012-360586e39249",
          "name": "METHYL FOLATE",
          "stdName": "METHYL FOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e303178-7014-4b09-a5e2-28fcf607f58c",
            "b13b4b53-a398-477a-810b-7cc7f59ee657"
          ],
          "display_name": false
        },
        {
          "uuid": "e3a6b2c3-9795-4eb0-abc4-3cb262ec6fb1",
          "name": "N5-METHYLTETRAHYDROFOLATE",
          "stdName": "N5-METHYLTETRAHYDROFOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b13b4b53-a398-477a-810b-7cc7f59ee657",
            "fc68111e-8e66-456f-abff-69b610492f8c"
          ],
          "display_name": false
        },
        {
          "uuid": "9284d79d-e8ad-4e1a-abdb-980179c63f23",
          "name": "N5-METHYLTETRAHYDROFOLIC ACID",
          "stdName": "N5-METHYLTETRAHYDROFOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2133b4fd-c815-453e-be95-9cdabe1d4872",
            "b13b4b53-a398-477a-810b-7cc7f59ee657"
          ],
          "display_name": false
        },
        {
          "uuid": "f6cc7660-ed0c-4d48-a85e-8aa78a258c87",
          "name": "N5-METHYLTETRAHYDROPTEROYLGLUTAMATE",
          "stdName": "N5-METHYLTETRAHYDROPTEROYLGLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b13b4b53-a398-477a-810b-7cc7f59ee657",
            "fc68111e-8e66-456f-abff-69b610492f8c"
          ],
          "display_name": false
        },
        {
          "uuid": "f8065750-b6e4-4f1b-a673-c72a5893b9c4",
          "name": "PREFOLIC A",
          "stdName": "PREFOLIC A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b13b4b53-a398-477a-810b-7cc7f59ee657",
            "fc68111e-8e66-456f-abff-69b610492f8c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fc68111e-8e66-456f-abff-69b610492f8c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b13b4b53-a398-477a-810b-7cc7f59ee657",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87b44e07-ff52-41a7-b231-dccbd75ef82a",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2133b4fd-c815-453e-be95-9cdabe1d4872",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb6a782b-7371-4637-8ab7-665488f400f4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e303178-7014-4b09-a5e2-28fcf607f58c",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2455812-67f3-4041-9803-829c623c020d",
          "citation": "USP-DSC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5849f530-34ad-496a-ae7f-6dca6eb1dd95",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dadca08-e156-4a07-ab34-8d2005df4b96",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "109a337b-6291-491e-8b2e-6ae95ed03fc4",
          "citation": "USP DIETARY SUPPLEMENTS COMPENDIUM",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fb7d29c-24c5-4c95-b494-49094862894e",
          "citation": "SRS import [TYK22LML8F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TYK22LML8F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f966f92f-bb78-42f0-ad1f-49317b971e31",
          "citation": "5-METHYLTETRAHYDROFOLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0e0d4f02-fdf1-4da0-8c49-b15a47e9f8b8",
          "citation": "5-METHYLTETRAHYDROFOLIC ACID [DSC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "936f5e0b-ff2f-c925-c139-516d4000440b",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/5-Methyltetrahydrofolate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "39e652ad-fa36-58e3-ed2f-20bf9793d358",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=134-35-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b450d5e1-8487-4180-8d72-68b8ce38279e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b2336c38-ceb3-cce2-68ff-68ece1f668dc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e8f92198-37a7-ace1-bc28-f4a144d583ea",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "c2f485fa-c7a1-cedd-594d-b8042d8c11d0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "124b556d-35b9-5dbe-d6eb-4db6502bb223",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "502010f6-df88-7385-835f-f2154ef3dc2e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fc494b4c-8f9d-4c8e-8ed7-8236af590cd7",
          "id": "fc494b4c-8f9d-4c8e-8ed7-8236af590cd7",
          "molfile": "\n  Marvin  01132113042D          \n\n 33 35  0  0  1  0            999 V2000\n    9.1008   -2.9176    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.8069   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8069   -4.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5316   -4.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5316   -5.3913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2423   -4.1498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3809   -3.3283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3809   -4.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1008   -4.5607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6609   -4.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6609   -5.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9640   -5.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2486   -5.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5379   -5.7929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5379   -6.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8180   -7.0529    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.0980   -6.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3964   -7.0529    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3964   -7.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6672   -8.2897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6672   -9.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9566   -9.5266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3964   -9.5266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0980   -9.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8180   -9.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0980   -8.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8180   -7.8697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5379   -8.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2486   -4.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9640   -4.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1008   -2.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8069   -1.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3809   -1.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  6  0  0  0\n  1 31  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 30  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 29 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 27  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 26  2  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 24 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 30 29  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 31  2  0  0  0  0\nM  END",
          "smiles": "CN1C(CNc2ccc(cc2)C(=O)N[C@@H](CCC(=O)O)C(=O)O)CNc3c1c(=O)[nH]c(N)n3",
          "formula": "C20H25N7O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c448690d-913f-40c2-b213-829bb5ea332a"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "459.4566",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "766575fb-1d4d-4f32-97b8-c204d6225fe0",
      "version": "22",
      "structure": {
        "id": "a946331e-d7bf-491b-93e5-4d80ebfb79e4",
        "molfile": "L-Glutamic acid, N-[4-[[(2-amino-3,4,5,6,7,8-hexahydro-5-methyl-4-oxo-6-pteri...\n  Marvin  01132108472D          \n\n 33 35  0  0  1  0            999 V2000\n   12.0474   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -4.4825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3329   -4.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3329   -5.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -6.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -5.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -4.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4763   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -4.8949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -3.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -4.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -3.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -3.6575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4776   -3.2449    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   19.1921   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9065   -3.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6210   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3355   -3.2449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6210   -4.4825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4776   -2.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1921   -2.0075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -2.0075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0487   -2.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6185   -6.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9040   -5.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9040   -4.8949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6185   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6185   -3.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1895   -6.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 10 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 18 24  1  6  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 16 27  2  0  0  0  0\n  4 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n  3 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 29 33  1  0  0  0  0\nM  END",
        "smiles": "CN1C(CNc2ccc(cc2)C(=O)N[C@@H](CCC(=O)O)C(=O)O)CNc3c1c(=O)[nH]c(N)n3",
        "formula": "C20H25N7O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "459.4566",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4fb7d29c-24c5-4c95-b494-49094862894e",
          "fc68111e-8e66-456f-abff-69b610492f8c"
        ],
        "stereo_centers": 2
      },
      "unii": "TYK22LML8F"
    }
  ]
}