{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "90cd77cb-6c66-4fb4-9600-35d3d2f61f6e",
          "code": "119026173",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119026173",
          "code_system": "PUBCHEM",
          "references": [
            "a967dc5b-147b-4678-8465-7cd5044dd9b8"
          ]
        },
        {
          "uuid": "635f1455-416f-46a5-ad68-d5d5d47d6498",
          "code": "1971007-92-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1971007-92-7",
          "code_system": "CAS",
          "references": [
            "799b884e-39b9-30c1-8a07-3afc1c9a62cb"
          ]
        },
        {
          "uuid": "862e771d-0d12-4f16-baf9-94f36c91f28e",
          "code": "TY9AKI870R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c2b915fc-3f0b-51b6-6d44-63c451f5125d",
          "code": "Designer-drugs-AMB-FUBINACA",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indazole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "b557a676-6a43-8f90-dbcd-6f5843016f8d"
          ]
        },
        {
          "uuid": "96fecd32-3f8f-4801-af43-4feb19eab461",
          "code": "AMB-FUBINACA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/AMB-FUBINACA",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "6eda0a59-79cb-500a-ce79-31cbb263b802",
          "code": "DTXSID501009973",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501009973",
          "code_system": "EPA CompTox",
          "references": [
            "b557a676-6a43-8f90-dbcd-6f5843016f8d"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "ce6067e0-3ddd-4dc0-b9f4-a3cf3af0d073",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ab4a8976-f8ae-4307-b865-1ecebf813528",
          "citation": "https://www.caymanchem.com/product/9001960",
          "url": "https://www.caymanchem.com/product/9001960",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a967dc5b-147b-4678-8465-7cd5044dd9b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391534000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91dc38ab-5b81-443c-8855-358e6024737b",
          "citation": "SRS import [TY9AKI870R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TY9AKI870R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391534000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ba9fae0-5187-45ac-8329-a222f8e23711",
          "citation": "cayman",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13aea5dc-1045-b85b-f208-938ea2c63e6f",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "799b884e-39b9-30c1-8a07-3afc1c9a62cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13928591-60bf-47e5-988b-003baeab00c0",
          "citation": "Synthetic-cannabinoids-in-Europe-EMCDDA-technical-report.pdf 103 / 126 100%",
          "url": "https://www.emcdda.europa.eu/system/files/publications/14035/Synthetic-cannabinoids-in-Europe-EMCDDA-technical-report.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "65c465d9-dbe9-454b-9449-4c86b0607053",
          "citation": "Synthetic-cannabinoids-in-Europe-EMCDDA-technical-report.pdf 103 / 126 100%",
          "url": "https://www.emcdda.europa.eu/system/files/publications/14035/Synthetic-cannabinoids-in-Europe-EMCDDA-technical-report.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b557a676-6a43-8f90-dbcd-6f5843016f8d",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f71d8da4-e199-4177-a690-f5ab560dd559",
          "id": "f71d8da4-e199-4177-a690-f5ab560dd559",
          "molfile": "\n  Marvin  01132112492D          \n\n 28 30  0  0  1  0            999 V2000\n    6.0659   -3.5804    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.0659   -4.4053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -4.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4941   -4.4053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -5.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4470   -6.1286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1901   -6.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6783   -7.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4960   -7.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8302   -6.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6525   -6.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1407   -7.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9584   -7.2351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8019   -8.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9796   -8.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3652   -6.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8120   -7.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0065   -7.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7494   -6.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3028   -5.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1083   -6.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3473   -3.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6331   -3.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3473   -2.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -3.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -2.3408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4941   -3.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2082   -3.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 22  1  0  0  0  0\n  1 25  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n 21  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 15  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C(=O)OC)NC(=O)c1c2ccccc2n(Cc3ccc(cc3)F)n1",
          "formula": "C21H22FN3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d5252f3e-4c67-4efe-9c4e-000b1eacf111"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "383.4169",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c0a5783-e757-404f-9692-59fe12cb9931",
      "version": "11",
      "structure": {
        "id": "4d0104c4-576e-47a0-af56-1010dbac3ae0",
        "molfile": "\n  Marvin  01132104012D          \n\n 28 30  0  0  1  0            999 V2000\n    7.6783   -7.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1901   -6.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3652   -6.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1083   -6.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -5.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4470   -6.1286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -4.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0659   -4.4053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0659   -3.5804    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7753   -3.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4941   -3.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2082   -3.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7753   -2.3408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3473   -3.1657    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6331   -3.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3473   -2.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4941   -4.4053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3028   -5.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7494   -6.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0065   -7.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8120   -7.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4960   -7.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8302   -6.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6525   -6.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1407   -7.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8019   -8.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9796   -8.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9584   -7.2351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10 13  2  0  0  0  0\n  9 14  1  1  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n  7 17  2  0  0  0  0\n  4 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n  3 21  2  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 22 27  1  0  0  0  0\n 25 28  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H](C(=O)OC)NC(=O)c1c2ccccc2n(Cc3ccc(cc3)F)n1",
        "formula": "C21H22FN3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "383.4169",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "91dc38ab-5b81-443c-8855-358e6024737b",
          "8ba9fae0-5187-45ac-8329-a222f8e23711"
        ],
        "stereo_centers": 1
      },
      "unii": "TY9AKI870R",
      "relationships": [
        {
          "uuid": "25f674f8-0711-4458-9b50-dcfb2a52ade9",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "574d0bbe-154e-44d6-be3c-1c03938f4b38",
            "refuuid": "602d135b-d29a-4de0-9f53-e8a13557a408",
            "name": "AMB-FUBINACA, (±)-",
            "unii": "2N1280157D",
            "linking_id": "2N1280157D",
            "ref_pname": "AMB-FUBINACA, (±)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "30cf5232-4a4b-40b3-8f5c-724337f73fe3",
          "amount": {
            "uuid": "101fdc9e-6229-4fb5-bea7-b7c44fcedce1",
            "average": 0.536,
            "high": 0.651,
            "low": 0.421,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "b1873072-450d-433a-996e-370d3357358c",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "64f9d788-b90b-4ea0-b40d-172c22f9e4c6",
          "amount": {
            "uuid": "9f3da185-c4c8-4df2-9974-d3af7501caf0",
            "average": 18,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "34669972-d3a4-440e-9588-119164a00362",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9907867c-eab6-41f8-927b-6c6c4d7a259d",
          "amount": {
            "uuid": "c59df91c-7157-4efd-b4ff-2073b3d7da87",
            "average": 0.387,
            "high": 0.522,
            "low": 0.252,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "69bf03ba-3c33-4b38-b083-68610be67c16",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a315cc2a-2fd8-47b1-a2a7-ed7228d6b7ee",
          "amount": {
            "uuid": "a7ef944a-98de-43aa-88c7-7b59d04a1c61",
            "average": 2,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "13928591-60bf-47e5-988b-003baeab00c0"
          ],
          "related_substance": {
            "uuid": "dc5f50e2-79cb-474e-9654-7e71562db60b",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c63a5d0-f44c-4d0c-867b-1813171c3995",
          "amount": {
            "uuid": "8b94349f-84b8-4ed4-80d1-29d400429b3e"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "65c465d9-dbe9-454b-9449-4c86b0607053"
          ],
          "related_substance": {
            "uuid": "2a6e9626-9b5c-4eaf-a481-bda7e3a1d000",
            "refuuid": "c987fa5c-a03e-40d7-bd80-b8ea8ae4b7d4",
            "name": "N-((1-((4-FLUOROPHENYL)METHYL)-1H-INDAZOL-3-YL)CARBONYL)-L-VALINE",
            "unii": "CGP65B4RYW",
            "linking_id": "CGP65B4RYW",
            "ref_pname": "N-((1-((4-FLUOROPHENYL)METHYL)-1H-INDAZOL-3-YL)CARBONYL)-L-VALINE"
          }
        }
      ],
      "names": [
        {
          "uuid": "c3125b70-d11a-d8e9-2941-955f1f5279d6",
          "name": "AMB-FUBINACA",
          "stdName": "AMB-FUBINACA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13aea5dc-1045-b85b-f208-938ea2c63e6f"
          ],
          "display_name": true
        },
        {
          "uuid": "415aa0b4-69c6-4aa4-88f2-ce475c1443cb",
          "name": "AMB-FUBINACA, (S)-",
          "stdName": "AMB-FUBINACA, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab4a8976-f8ae-4307-b865-1ecebf813528"
          ],
          "display_name": false
        },
        {
          "uuid": "e82cd92e-138f-423d-8157-1590bef1f32c",
          "name": "FUB-AMB, (S)-",
          "stdName": "FUB-AMB, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce6067e0-3ddd-4dc0-b9f4-a3cf3af0d073"
          ],
          "display_name": false
        },
        {
          "uuid": "1811f130-e9b4-4f2e-bd9d-a5b1855bd871",
          "name": "METHYL (1-(4-FLUOROBENZYL)-1H-INDAZOLE-3-CARBONYL)-L-VALINATE",
          "stdName": "METHYL (1-(4-FLUOROBENZYL)-1H-INDAZOLE-3-CARBONYL)-L-VALINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab4a8976-f8ae-4307-b865-1ecebf813528"
          ],
          "display_name": false
        },
        {
          "uuid": "1041d1c2-d165-45b7-9544-ee8d9cf80f33",
          "name": "MMB-FUBINACA, (S)-",
          "stdName": "MMB-FUBINACA, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab4a8976-f8ae-4307-b865-1ecebf813528"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "3f0de69f-3bfe-4309-8a90-26e76c8dd50e"
      }
    }
  ]
}