{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "85effa49-78f4-468f-bfa9-cab563865e5f",
          "code": "520-34-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=520-34-3",
          "code_system": "CAS",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506",
            "e88f932c-1cac-4975-aa4f-5c1bbf406069"
          ]
        },
        {
          "uuid": "f47d3632-5d04-414f-b445-ff22b6756d78",
          "code": "C039602",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67039602",
          "code_system": "MESH",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "2e1bb40a-5d3f-4686-83fe-a9fce5b83467",
          "code": "DIOSMETIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diosmetin",
          "code_system": "WIKIPEDIA",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "b79a7aff-f0d9-4444-944f-765f82fa9032",
          "code": "208-291-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.539",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "7ef909b3-7cc5-4ab7-84af-fe951823f69b",
          "code": "1314347",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314347/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "d3808a8d-bba7-4bc2-b7db-932697bb8ac5",
          "code": "m4594",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4594?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "191b255c-99c8-4c52-b2ef-439b26b863be",
          "code": "SUB35834",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "58e303e6-ea55-4ca5-b130-1dcfcaa86ca8",
          "code": "5281612",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281612",
          "code_system": "PUBCHEM",
          "references": [
            "d809db8d-3169-459d-80d9-56aebccfa506"
          ]
        },
        {
          "uuid": "240014d6-c0eb-079f-bd59-6e0c5cdf1bdf",
          "code": "8101",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8101",
          "code_system": "HSDB",
          "references": [
            "d6bddd67-c15a-0060-14e0-3f8c4db2b2ea"
          ]
        },
        {
          "uuid": "47caa5c9-98d3-ff20-8abc-c7939d2b1cc9",
          "code": "DTXSID80199966",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80199966",
          "code_system": "EPA CompTox",
          "references": [
            "2d8420ce-ab44-098b-2c13-7d2da4abf67e"
          ]
        },
        {
          "uuid": "949e5bc9-75a9-e48b-17e5-7504ddfeae26",
          "code": "4601",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4601",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c7d14fc9-056c-f9be-ed24-85a2732b7f81"
          ]
        },
        {
          "uuid": "bb55146c-862d-2af1-cb25-4fcc1dbbd95c",
          "code": "4156 (Number of products:7)",
          "comments": "Dietary Supplement Label Database|chemical|Diosmetin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4156&item=Diosmetin",
          "code_system": "DSLD",
          "references": [
            "c7d14fc9-056c-f9be-ed24-85a2732b7f81"
          ]
        },
        {
          "uuid": "fa8adacd-a5a3-24aa-c3a7-5c9e3ec36902",
          "code": "DB11259",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11259",
          "code_system": "DRUG BANK",
          "references": [
            "c7d14fc9-056c-f9be-ed24-85a2732b7f81"
          ]
        },
        {
          "uuid": "8f6721a1-fa1b-4544-941b-0fa2ee77f94b",
          "code": "TWZ37241OT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5f3f77e4-822a-214a-b515-3d3ba0d67c8d",
          "code": "4630",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4630",
          "code_system": "CHEBI",
          "references": [
            "c7d14fc9-056c-f9be-ed24-85a2732b7f81"
          ]
        },
        {
          "uuid": "58788c7c-f006-b19f-aabe-29ffd3ab65de",
          "code": "100000128590",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a9598612-b300-976d-8293-b0d654b13bc9"
          ]
        },
        {
          "uuid": "485c5996-4ddc-3ccb-809d-d0f775a900b0",
          "code": "TWZ37241OT",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=TWZ37241OT",
          "code_system": "DAILYMED",
          "references": [
            "d28560de-d52f-285c-c279-2f62292fb79d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "09c36f98-2f8a-43b0-b8b3-0477cf3aae53",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9517725f-4776-44ea-96a2-e75f124ad522",
            "refuuid": "c7499481-4d9e-4587-a3b1-a93bfd5de6fc",
            "name": "DIOSMETIN",
            "unii": "TWZ37241OT",
            "linking_id": "TWZ37241OT",
            "ref_pname": "DIOSMETIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "79026fa5-20b1-4392-90b7-1d88ab73082d",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "ecc4c250-c8f7-4dd6-90b2-b14e06fb758a"
          ],
          "related_substance": {
            "uuid": "ce87819b-bda4-446f-bfc1-2ff2828d4079",
            "refuuid": "c1f4d2fb-83bd-4a8f-be47-30fdebaba6a8",
            "name": "AGATHOSMA BETULINA LEAF",
            "unii": "369DDH39Z0",
            "linking_id": "369DDH39Z0",
            "ref_pname": "AGATHOSMA BETULINA LEAF",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27807474-ddf3-4852-9e0c-c230d8e4b413",
          "name": "3',5,7-TRIHYDROXY-4'-METHOXYFLAVONE",
          "stdName": "3',5,7-TRIHYDROXY-4'-METHOXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "25f4786c-9019-4e88-99f9-06b42891ab6b"
          ],
          "display_name": false
        },
        {
          "uuid": "03b2b122-5ffa-469f-b285-8c335e6e813f",
          "name": "4'-METHYLLUTEOLIN",
          "stdName": "4'-METHYLLUTEOLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "1932e252-9b9e-4e6c-bc1a-5899a00eac3d"
          ],
          "display_name": false
        },
        {
          "uuid": "26db2c95-1120-42ae-ad84-d27531a9f083",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "1932e252-9b9e-4e6c-bc1a-5899a00eac3d"
          ],
          "display_name": false
        },
        {
          "uuid": "c2d1cc5b-94a3-4bce-a9b0-701244e947ee",
          "name": "5,7-DIHYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "5,7-DIHYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "25f4786c-9019-4e88-99f9-06b42891ab6b"
          ],
          "display_name": false
        },
        {
          "uuid": "65fc33ae-1cdc-4cc6-a9ba-6eab88064f40",
          "name": "5,7-DIHYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)CHROMEN-4-ONE",
          "stdName": "5,7-DIHYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)CHROMEN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d2e79b7-901e-4484-913f-9fa29770d779",
            "185b0378-0d9a-4791-8231-05886417d165"
          ],
          "display_name": false
        },
        {
          "uuid": "978b78fb-42de-47a8-8180-03be0e1ded4b",
          "name": "CYANIDENON-4'-METHYL ETHER 1479",
          "stdName": "CYANIDENON-4'-METHYL ETHER 1479",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "25f4786c-9019-4e88-99f9-06b42891ab6b"
          ],
          "display_name": false
        },
        {
          "uuid": "7e19c7f1-e874-4e34-939f-dad8c713ca64",
          "name": "DIOSMETIN",
          "stdName": "DIOSMETIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3372157-370e-4260-bf05-058566f4b388",
            "185b0378-0d9a-4791-8231-05886417d165",
            "dc43db39-991b-4b9f-9126-1e0c59f87e30",
            "f4f35182-357c-431b-8de4-9331a38a749b",
            "cae0c31c-0ee6-49d7-885e-adc4cb80684b",
            "25f4786c-9019-4e88-99f9-06b42891ab6b",
            "39131478-eb21-44e8-80e8-c8ef568fd684",
            "81448838-7975-4375-bcfd-2bec00b69689"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "feddaf1c-03ca-40fe-b560-c20e620a1fc6",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "42ce25fb-bba2-43d3-b1bb-77bf05b322f0",
          "name": "DIOSMETIN [MI]",
          "stdName": "DIOSMETIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc43db39-991b-4b9f-9126-1e0c59f87e30",
            "185b0378-0d9a-4791-8231-05886417d165"
          ],
          "display_name": false
        },
        {
          "uuid": "6d8dd00f-2841-4a22-b918-69537ba2a04c",
          "name": "DIOSMETINE",
          "stdName": "DIOSMETINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "1932e252-9b9e-4e6c-bc1a-5899a00eac3d"
          ],
          "display_name": false
        },
        {
          "uuid": "af7644c5-2204-4229-9f16-a3b83b23e597",
          "name": "DIOSMETOL",
          "stdName": "DIOSMETOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "1932e252-9b9e-4e6c-bc1a-5899a00eac3d"
          ],
          "display_name": false
        },
        {
          "uuid": "bd56b544-7e49-87b4-9134-a77423dae9a0",
          "name": "Diosmetin [WHO-DD]",
          "stdName": "DIOSMETIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb8c3548-9704-bad2-bfb0-ae9fe3f29172"
          ],
          "display_name": false
        },
        {
          "uuid": "deb0d5e5-7274-460b-ae6c-174a86225577",
          "name": "FLAVONE, 3',5,7-TRIHYDROXY-4'-METHOXY-",
          "stdName": "FLAVONE, 3',5,7-TRIHYDROXY-4'-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "1932e252-9b9e-4e6c-bc1a-5899a00eac3d"
          ],
          "display_name": false
        },
        {
          "uuid": "8f71076d-8899-4c23-bbce-662118c4c595",
          "name": "LUTEOLIN-4'-METHYL ETHER",
          "stdName": "LUTEOLIN-4'-METHYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "185b0378-0d9a-4791-8231-05886417d165",
            "25f4786c-9019-4e88-99f9-06b42891ab6b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "25f4786c-9019-4e88-99f9-06b42891ab6b",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "185b0378-0d9a-4791-8231-05886417d165",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d2e79b7-901e-4484-913f-9fa29770d779",
          "citation": "Wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1932e252-9b9e-4e6c-bc1a-5899a00eac3d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc43db39-991b-4b9f-9126-1e0c59f87e30",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4f35182-357c-431b-8de4-9331a38a749b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3372157-370e-4260-bf05-058566f4b388",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d809db8d-3169-459d-80d9-56aebccfa506",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390863000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecc4c250-c8f7-4dd6-90b2-b14e06fb758a",
          "citation": "HERBAL MEDICINES 4TH ED 2013",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36c92eb7-cc19-42c8-9bdf-b1c7b93e6648",
          "citation": "SRS import [TWZ37241OT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TWZ37241OT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390863000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81448838-7975-4375-bcfd-2bec00b69689",
          "citation": "DIOSMETIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cae0c31c-0ee6-49d7-885e-adc4cb80684b",
          "citation": "DIOSMETIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39131478-eb21-44e8-80e8-c8ef568fd684",
          "citation": "DIOSMETIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6bddd67-c15a-0060-14e0-3f8c4db2b2ea",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+520-34-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d8420ce-ab44-098b-2c13-7d2da4abf67e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=520-34-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c7d14fc9-056c-f9be-ed24-85a2732b7f81",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e88f932c-1cac-4975-aa4f-5c1bbf406069",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bb8c3548-9704-bad2-bfb0-ae9fe3f29172",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d28560de-d52f-285c-c279-2f62292fb79d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a9598612-b300-976d-8293-b0d654b13bc9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e1ed3fb2-627c-4f54-a9b3-5e9c596d4975",
          "id": "e1ed3fb2-627c-4f54-a9b3-5e9c596d4975",
          "molfile": "\n  Marvin  01132111422D          \n\n 22 24  0  0  0  0            999 V2000\n    0.7228   -3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -2.8871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -1.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1490   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4338   -0.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7184   -0.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7221   -1.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0089   -2.0654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    0.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    2.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7167    3.2978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    3.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    2.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5731    3.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    0.8239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n 10  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 22  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 21 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(cc1O)-c2cc(=O)c3c(cc(cc3o2)O)O",
          "formula": "C16H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d8e16cd9-927f-4fe7-b810-aed995b1a7c7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "300.2635",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c7499481-4d9e-4587-a3b1-a93bfd5de6fc",
      "version": "15",
      "structure": {
        "id": "d412089b-e5c9-46ee-a6cf-a98a07d1d539",
        "molfile": "\n  Marvin  01132110592D          \n\n 22 24  0  0  0  0            999 V2000\n    3.5731    3.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    2.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    3.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    2.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7167    3.2978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    0.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4338   -0.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7184   -0.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7221   -1.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0089   -2.0654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -2.8871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7228   -3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -1.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1490   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    0.8239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 11  2  0  0  0  0\n 10 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21  6  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22  2  2  0  0  0  0\nM  END",
        "smiles": "COc1ccc(cc1O)-c2cc(=O)c3c(cc(cc3o2)O)O",
        "formula": "C16H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "300.2635",
        "optical_activity": "NONE",
        "references": [
          "36c92eb7-cc19-42c8-9bdf-b1c7b93e6648",
          "25f4786c-9019-4e88-99f9-06b42891ab6b"
        ],
        "stereo_centers": 0
      },
      "unii": "TWZ37241OT"
    }
  ]
}