{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "05452440-5181-4b28-9b76-b1967b4f69b0", "code": "6505-28-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6505-28-8", "code_system": "CAS", "references": [ "e08b7ed9-f081-4562-9a30-3ec5f6b74156", "5ac5f60e-ccad-46e1-9c9e-6f2706e3c3f7" ] }, { "uuid": "e8d05848-b2a5-413c-9aa5-5fcfecc1ade6", "code": "229-388-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.717", "code_system": "ECHA (EC/EINECS)", "references": [ "e08b7ed9-f081-4562-9a30-3ec5f6b74156" ] }, { "uuid": "66958d5a-cf99-4fd6-9e8b-7c10b3015194", "code": "110869", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/110869", "code_system": "PUBCHEM", "references": [ "e08b7ed9-f081-4562-9a30-3ec5f6b74156" ] }, { "uuid": "377731ec-13a9-4bc1-8cfc-dc38af21eb92", "code": "TVN9QAX6UH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "068034cd-314b-7f26-0693-a2e13a71936c", "code": "DTXSID60863890", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60863890", "code_system": "EPA CompTox" }, { "uuid": "a2f745a2-90e4-d6ee-240c-aed0538e80da", "code": "300000053558", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "df812e8a-9268-1f73-5a72-08be77756ba2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "db02a3f5-68e3-4c75-933e-84fade8d08f9", "name": "2,2'-((3,3'-DIMETHOXY(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(3-OXO-N-PHENYLBUTANAMIDE)", "stdName": "2,2'-((3,3'-DIMETHOXY(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(3-OXO-N-PHENYLBUTANAMIDE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fb1bf8f2-1934-4187-9bb7-c9dd2371e366" ], "display_name": false }, { "uuid": "a4d1359c-8ff7-4896-bafd-8be63054ec0f", "name": "BUTANAMIDE, 2,2'-((3,3'-DIMETHOXY(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(3-OXO-N-PHENYL-", "stdName": "BUTANAMIDE, 2,2'-((3,3'-DIMETHOXY(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(3-OXO-N-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fb1bf8f2-1934-4187-9bb7-c9dd2371e366" ], "display_name": false }, { "uuid": "19dbe329-9f4b-40bf-b0b1-56af12a6c9a5", "name": "C.I. 21160", "stdName": "C.I. 21160", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "fb1bf8f2-1934-4187-9bb7-c9dd2371e366" ], "display_name": false }, { "uuid": "5222801a-1a6a-49e6-8ef6-b775aedfc9d3", "name": "C.I. PIGMENT ORANGE 16", "stdName": "C.I. PIGMENT ORANGE 16", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "08447414-6ef3-47d8-a10b-06e5451653c2" ], "display_name": false }, { "uuid": "69784267-9c14-4a5e-880f-9a50de10d459", "name": "CI 21160", "stdName": "CI 21160", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "fb1bf8f2-1934-4187-9bb7-c9dd2371e366" ], "display_name": false }, { "uuid": "5a03db3a-67e1-4159-9072-7bb06034b97d", "name": "CI PIGMENT ORANGE 16", "stdName": "CI PIGMENT ORANGE 16", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fb1bf8f2-1934-4187-9bb7-c9dd2371e366" ], "display_name": false }, { "uuid": "b5abcc6d-fa71-42cd-8a29-926e62d3c1aa", "name": "PIGMENT ORANGE 16", "stdName": "PIGMENT ORANGE 16", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fb1bf8f2-1934-4187-9bb7-c9dd2371e366" ], "display_name": true } ], "references": [ { "uuid": "08447414-6ef3-47d8-a10b-06e5451653c2", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "fb1bf8f2-1934-4187-9bb7-c9dd2371e366", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e08b7ed9-f081-4562-9a30-3ec5f6b74156", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392180000, "tags": [ "NOMEN" ] }, { "uuid": "0104a477-bda9-4651-8e7f-c1e7c2932442", "citation": "SRS import [TVN9QAX6UH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TVN9QAX6UH", "doc_type": "SRS", "public_domain": true, "document_date": 1493392180000, "tags": [ "NOMEN" ] }, { "uuid": "5ac5f60e-ccad-46e1-9c9e-6f2706e3c3f7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "df812e8a-9268-1f73-5a72-08be77756ba2", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "cac9aec0-67c5-4878-b175-ed5d83f1e3a4", "id": "cac9aec0-67c5-4878-b175-ed5d83f1e3a4", "molfile": "\n Marvin 01132110282D \n\n 46 49 0 0 0 0 999 V2000\n 10.8423 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -4.1324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4127 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6979 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9830 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9830 -5.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6979 -5.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4127 -5.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -5.7801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -6.6040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8423 -7.0159 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.8302 -7.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5450 -8.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -8.2517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5450 -6.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2599 -7.0159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5450 -5.7801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2599 -5.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2599 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9747 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6895 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6895 -5.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9747 -5.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2803 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2803 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5655 -2.8965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8507 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -2.8965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -2.0727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4210 -1.6608 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.4331 -0.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7183 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -0.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7183 -2.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0035 -1.6608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7183 -2.8965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0035 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0035 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2887 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5738 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5738 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2887 -2.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8507 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -4.5443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4210 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5655 -4.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 8 2 0 0 0 0\n 5 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 24 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 46 2 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 43 27 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 34 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 34 35 2 0 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 42 2 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 41 40 2 0 0 0 0\n 42 41 1 0 0 0 0\n 44 43 1 0 0 0 0\n 46 43 1 0 0 0 0\n 44 45 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccccc1)/N=N/c2ccc(cc2OC)-c3ccc(c(c3)OC)/N=N/C(C(=O)C)C(=O)Nc4ccccc4", "formula": "C34H32N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bb41e714-2743-4224-933a-5f73e832c67f" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "620.6558", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "dd9fdd20-8ddb-4d59-8936-b5f104a8a935", "version": "5", "structure": { "id": "0e0cbd34-0f4c-4abe-8169-d08f51547b44", "molfile": "\n Marvin 01132100582D \n\n 46 49 0 0 0 0 999 V2000\n 10.1275 -4.1324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8423 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4127 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6979 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9830 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9830 -5.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6979 -5.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4127 -5.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -5.7801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -6.6040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8423 -7.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5450 -6.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5450 -5.7801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2599 -5.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2599 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9747 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6895 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6895 -5.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9747 -5.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2599 -7.0159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8302 -7.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5450 -8.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1275 -8.2517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2803 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5655 -4.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8507 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -4.5443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4210 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8507 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -2.8965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -2.0727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4210 -1.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7183 -2.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7183 -2.8965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0035 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0035 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2887 -4.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5738 -4.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5738 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2887 -2.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0035 -1.6608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4331 -0.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7183 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1358 -0.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5655 -2.8965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2803 -3.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 3 8 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 14 19 1 0 0 0 0\n 19 18 2 0 0 0 0\n 12 20 2 0 0 0 0\n 11 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 5 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 26 29 2 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 39 38 1 0 0 0 0\n 35 40 1 0 0 0 0\n 40 39 2 0 0 0 0\n 33 41 2 0 0 0 0\n 32 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 42 44 2 0 0 0 0\n 45 29 1 0 0 0 0\n 24 46 1 0 0 0 0\n 46 45 2 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccccc1)/N=N/c2ccc(cc2OC)-c3ccc(c(c3)OC)/N=N/C(C(=O)C)C(=O)Nc4ccccc4", "formula": "C34H32N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "620.6558", "optical_activity": "UNSPECIFIED", "references": [ "0104a477-bda9-4651-8e7f-c1e7c2932442", "08447414-6ef3-47d8-a10b-06e5451653c2" ], "stereo_centers": 2 }, "unii": "TVN9QAX6UH" } ] }