{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aaf77143-dc9e-4a7d-8560-a9660770d24f",
          "code": "57282-49-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57282-49-2",
          "code_system": "CAS",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4",
            "62258387-de2e-407f-92e1-8532622a672d"
          ]
        },
        {
          "uuid": "9384ebca-ab9c-474e-93ea-8f8f7ce02093",
          "code": "260-664-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.133",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "f0c82fa6-acc9-4a32-988f-c304b471c5fa",
          "code": "C66045",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66045",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "9a810c40-f3e8-42b3-9bc0-1fdbf18c0429",
          "code": "6537",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6537/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "c7e48067-5a53-45e5-9b04-1ccf717d7d78",
          "code": "SUB127496",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "0be46319-1f8e-4f8c-8951-56282cca15b3",
          "code": "SUB127497",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "e7ca605c-1318-4489-8476-71c20d81fae7",
          "code": "SUB21782",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "31bc5db0-bc38-495a-b6ce-f59056a73ce4",
          "code": "CHEMBL2104640",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104640",
          "code_system": "ChEMBL",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "7f1638ee-878b-42d4-8347-7bc6b740664a",
          "code": "104152",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104152",
          "code_system": "PUBCHEM",
          "references": [
            "1784e96e-6390-48d9-9265-d94107f5fdc4"
          ]
        },
        {
          "uuid": "32ae4b34-53bf-a406-9b99-ec5088440667",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "87cc46aa-9871-3f7a-ace6-fa2c9eb391e8"
          ]
        },
        {
          "uuid": "67b4d88a-d3da-c2d3-71aa-121b9f64f7db",
          "code": "DBSALT001763",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001763",
          "code_system": "DRUG BANK",
          "references": [
            "87cc46aa-9871-3f7a-ace6-fa2c9eb391e8"
          ]
        },
        {
          "uuid": "758cb6bf-92f3-48c4-9963-a6bc6d834d94",
          "code": "TTL6G7LIWZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9f85e86b-d7a2-4030-826e-8330aeacd572",
          "code": "4453",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4453",
          "code_system": "DRUG CENTRAL",
          "references": [
            "87cc46aa-9871-3f7a-ace6-fa2c9eb391e8"
          ]
        },
        {
          "uuid": "f18debb2-3161-873d-9f35-6778464b7129",
          "code": "DTXSID80886223",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80886223",
          "code_system": "EPA CompTox",
          "references": [
            "87cc46aa-9871-3f7a-ace6-fa2c9eb391e8"
          ]
        },
        {
          "uuid": "7f8951c9-d746-0a4c-82bd-773179330a1c",
          "code": "1371501",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1371501",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "87cc46aa-9871-3f7a-ace6-fa2c9eb391e8"
          ]
        },
        {
          "uuid": "36f4a206-f5b3-09b9-9db5-2e3a08243186",
          "code": "100000091744",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "669526b2-77a4-08ba-d825-267457eb4911"
          ]
        },
        {
          "uuid": "0211427f-431e-04ad-4933-2648964078a7",
          "code": "TTL6G7LIWZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=TTL6G7LIWZ",
          "code_system": "DAILYMED",
          "references": [
            "340a3e7b-50ac-683a-15a0-67946bbf5822"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "46d5339d-bbfe-4e63-b975-25ce7757008b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f978a063-2c1a-4b0c-be26-82f062744ad8",
            "refuuid": "e86b6ffd-b009-4d29-a2fd-c10b944f4ece",
            "name": "LYSINE",
            "unii": "K3Z4F929H6",
            "linking_id": "K3Z4F929H6",
            "ref_pname": "LYSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "95b6c948-1a22-476f-b972-0638c97dc0a2",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "67164cbf-4bb8-4a67-99ad-1926f890a7d9",
            "refuuid": "e86b6ffd-b009-4d29-a2fd-c10b944f4ece",
            "name": "LYSINE",
            "unii": "K3Z4F929H6",
            "linking_id": "K3Z4F929H6",
            "ref_pname": "LYSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "06b4579d-d280-481e-95bb-8de0296577bf",
          "amount": {
            "uuid": "e792fcb3-03d5-44a8-90cb-d8413c24ede6",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "c4720fb8-7cbd-4e1b-9dfa-606c3d35c5b4"
          ],
          "related_substance": {
            "uuid": "7c39142e-ad24-42df-80a7-efe768671375",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE"
          }
        },
        {
          "uuid": "93fb746c-7e48-4cef-bc89-b1130d7e90b5",
          "amount": {
            "uuid": "aa0b2fc9-9451-4f85-9779-14c71848aea1",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "1e262c3a-d625-4894-b152-36579820acd1"
          ],
          "related_substance": {
            "uuid": "39c0fc73-b320-4bbb-9474-d43bb0669f29",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid"
          }
        },
        {
          "uuid": "31846ebc-be9b-443b-87c4-9e3a8a67affd",
          "amount": {
            "uuid": "ba389fb3-5f34-43ff-9e61-141d4df8a7ae",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "5c99114a-6eed-4301-95dd-76fd21c6301c"
          ],
          "related_substance": {
            "uuid": "66630863-7367-4a39-8bfc-db551aa72829",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID"
          }
        },
        {
          "uuid": "964301d2-c48b-4671-9234-b0d0741499e3",
          "amount": {
            "uuid": "745b8d5d-c802-4c98-b43a-0aa7dc70b63e",
            "units": "PPM",
            "high_limit": 200
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "313ea2f1-3fd6-a4fb-7fbf-f82de5c013ab"
          ],
          "related_substance": {
            "uuid": "dde005a6-dee5-4ccf-ba86-5eb8d70e16a1",
            "refuuid": "5c20d1c4-85df-46d8-8bf2-63f8eb5fa403",
            "name": "Chloride ion",
            "unii": "Q32ZN48698",
            "linking_id": "Q32ZN48698",
            "ref_pname": "Chloride ion",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7a43c87a-10a5-4bce-a665-1d94e67e45c3",
          "amount": {
            "uuid": "261d0a34-c78b-4b02-a0b6-c234549b4696",
            "units": "PPM",
            "high_limit": 300
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "313ea2f1-3fd6-a4fb-7fbf-f82de5c013ab"
          ],
          "related_substance": {
            "uuid": "94694258-cb0d-4a66-becc-28d7e9547cf7",
            "refuuid": "a84b1250-6d81-438d-a24f-19398a8490e5",
            "name": "SULFATE ION",
            "unii": "7IS9N8KPMG",
            "linking_id": "7IS9N8KPMG",
            "ref_pname": "SULFATE ION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d83a556e-bb70-48ba-91d8-aad68eb43194",
          "amount": {
            "uuid": "fce5731c-7bda-4d43-846e-153952063807",
            "units": "PPM",
            "high_limit": 200
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "313ea2f1-3fd6-a4fb-7fbf-f82de5c013ab"
          ],
          "related_substance": {
            "uuid": "1957d4a4-f09f-41e6-9db6-6832f78958eb",
            "refuuid": "8e8ae9f3-1601-4114-9461-a004668b64f1",
            "name": "AMMONIUM CATION",
            "unii": "54S68520I4",
            "linking_id": "54S68520I4",
            "ref_pname": "AMMONIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7501554d-2d25-43fd-81f7-48ee9570b34e",
          "amount": {
            "uuid": "e4a12a75-af5e-43ac-8abb-c80e707b4b03",
            "units": "PPM",
            "high_limit": 30
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "313ea2f1-3fd6-a4fb-7fbf-f82de5c013ab"
          ],
          "related_substance": {
            "uuid": "4e3df704-5545-4d56-8f63-7a4842601e0c",
            "refuuid": "61a8926e-5f01-4a54-aac9-10b35ba293d3",
            "name": "Iron",
            "unii": "E1UOL152H7",
            "linking_id": "E1UOL152H7",
            "ref_pname": "Iron",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3c5c947c-eb91-4ae5-9c9d-6871a7d6389b",
          "amount": {
            "uuid": "2939972d-6691-492a-9cca-19b234943bc8",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "958d5f24-6f9d-4244-bdf2-0ff5ab78ac78"
          ],
          "related_substance": {
            "uuid": "d889f392-1302-4f6a-b3df-395a1cade6c7",
            "refuuid": "56b08ff4-39da-4e90-83fb-9977f6f02e5e",
            "name": "VALINE",
            "unii": "HG18B9YRS7",
            "linking_id": "HG18B9YRS7",
            "ref_pname": "VALINE"
          }
        },
        {
          "uuid": "fa288688-8b34-4b0c-a81d-2ef8a02fd4c2",
          "amount": {
            "uuid": "f54b391c-df9c-4675-b4b3-bd7e2f0b45f3",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "9c9ff0f3-960f-4dc7-9123-adf059fb421e"
          ],
          "related_substance": {
            "uuid": "38724cd1-55c8-4dff-8cda-f74ecf4a6c9f",
            "refuuid": "1265b094-a6e8-4d2b-837f-e8d754c9c44b",
            "name": "ORNITHINE",
            "unii": "E524N2IXA3",
            "linking_id": "E524N2IXA3",
            "ref_pname": "ORNITHINE"
          }
        },
        {
          "uuid": "f639d078-1270-43b4-bb8c-e3194d039980",
          "amount": {
            "uuid": "3e9881a6-6828-4ef4-a623-16c713c710f5",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "3db1374b-375b-4fcd-96fe-95fb46579b96"
          ],
          "related_substance": {
            "uuid": "92740e5e-adc6-4314-848f-18915ead2d18",
            "refuuid": "39501106-1e90-43aa-841b-12331ae28812",
            "name": "ALANINE",
            "unii": "OF5P57N2ZX",
            "linking_id": "OF5P57N2ZX",
            "ref_pname": "ALANINE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "26fb951a-4b39-4522-a194-3a69ed2a7c42",
          "name": "L-LYSINE ACETATE",
          "stdName": "L-LYSINE ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77bb617e-d56d-4342-99bb-cc0791480a2c",
            "d1cb6ebd-72aa-4abf-88b7-282c04492a2c",
            "d6e1e33c-318c-4034-bc88-75505ea440c0",
            "4a8d55a2-93b9-4cab-8f5e-92bfa2a2c2f3",
            "45b59dd8-9539-46c8-bf37-c65bdcbd7f73"
          ],
          "display_name": false
        },
        {
          "uuid": "8ea529bc-1af5-4939-9553-3f353638754e",
          "name": "L-LYSINE ACETATE [JAN]",
          "stdName": "L-LYSINE ACETATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77bb617e-d56d-4342-99bb-cc0791480a2c"
          ],
          "display_name": false
        },
        {
          "uuid": "277a65fe-574a-440f-96fa-99550355ad67",
          "name": "L-LYSINE ACETATE [USP-RS]",
          "stdName": "L-LYSINE ACETATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45b59dd8-9539-46c8-bf37-c65bdcbd7f73"
          ],
          "display_name": false
        },
        {
          "uuid": "a5905d8a-b5b6-45fc-a89b-080a37b6f841",
          "name": "L-LYSINE MONOACETATE",
          "stdName": "L-LYSINE MONOACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f865d9f-1a3a-4449-a43f-dc58613e9d8d"
          ],
          "display_name": false
        },
        {
          "uuid": "ed3e959a-964f-42f9-9fee-62734b239cb8",
          "name": "LYSINE (AS ACETATE)",
          "stdName": "LYSINE (AS ACETATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c4b2a9d-58d1-4bc9-b5ea-439949370ffe"
          ],
          "display_name": false
        },
        {
          "uuid": "29d0d032-ad41-4500-950e-47e02cefcea6",
          "name": "LYSINE ACETATE",
          "stdName": "LYSINE ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f865d9f-1a3a-4449-a43f-dc58613e9d8d",
            "5bbdfc22-c4c3-41d9-877b-d632305c1249",
            "e76daf7c-129d-4f32-8c38-9987d4123511",
            "685b58c5-2007-4e94-bdb2-a34fb3743632",
            "21309ede-2b1f-4568-8a67-570d8f08c460",
            "1eeadbf0-2e84-4d8c-b71d-df45da6df19b",
            "b610c448-8739-4dfd-ae07-efd91c8ca592",
            "7a107a2c-dfe4-4197-ae27-8f6c9c9f619e",
            "d16fa2b8-72c8-470a-83d3-b28a85b13d6c",
            "a35cc3fd-d518-4496-a870-fdf1eec2006c",
            "e6294bb1-78c7-4aa0-bc73-49d572f3d420",
            "f1329301-58b8-4c2c-b918-8ade1299a45a"
          ],
          "display_name": true
        },
        {
          "uuid": "85971889-ced0-922d-3b24-f980e607a621",
          "name": "LYSINE ACETATE [EP IMPURITY]",
          "stdName": "LYSINE ACETATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a35cc3fd-d518-4496-a870-fdf1eec2006c"
          ],
          "display_name": false
        },
        {
          "uuid": "d6af89f5-88e3-8cee-8117-4541d8f8f9a3",
          "name": "LYSINE ACETATE [EP MONOGRAPH]",
          "stdName": "LYSINE ACETATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "449e6247-8c62-ad9a-64f9-08301107bd77"
          ],
          "display_name": false
        },
        {
          "uuid": "cf42a8cc-a170-4718-9650-9010b0589479",
          "name": "LYSINE ACETATE [II]",
          "stdName": "LYSINE ACETATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f865d9f-1a3a-4449-a43f-dc58613e9d8d"
          ],
          "display_name": false
        },
        {
          "uuid": "bec37ad2-7f50-4bae-a584-881135eee957",
          "name": "LYSINE ACETATE [MART.]",
          "stdName": "LYSINE ACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bbdfc22-c4c3-41d9-877b-d632305c1249"
          ],
          "display_name": false
        },
        {
          "uuid": "6079c20f-30f0-8fc4-85da-9750b9783cd1",
          "name": "LYSINE ACETATE [USP MONOGRAPH]",
          "stdName": "LYSINE ACETATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d54c0c2f-8846-ce5d-8e0e-268ef89cc2e0"
          ],
          "display_name": false
        },
        {
          "uuid": "09a4ac23-4121-41bb-8642-9060aee0c26c",
          "name": "LYSINE, L-, MONOACETATE",
          "stdName": "LYSINE, L-, MONOACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b72572c2-3a62-4f8f-82ca-d719785c7ea4"
          ],
          "display_name": false
        },
        {
          "uuid": "e0e3b28f-64c7-2ab0-4202-ea2b7ad33bdd",
          "name": "Lysine acetate [WHO-DD]",
          "stdName": "LYSINE ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ddd9e6e-4988-874c-481b-4ebc81ff35a5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3db1374b-375b-4fcd-96fe-95fb46579b96",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5c99114a-6eed-4301-95dd-76fd21c6301c",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c4720fb8-7cbd-4e1b-9dfa-606c3d35c5b4",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "313ea2f1-3fd6-a4fb-7fbf-f82de5c013ab",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10a3b3f6-e11c-d98e-adeb-85669191bd7b",
          "citation": "USP42-NF37 - 2650, Lysine Acetate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62258387-de2e-407f-92e1-8532622a672d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "958d5f24-6f9d-4244-bdf2-0ff5ab78ac78",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c9ff0f3-960f-4dc7-9123-adf059fb421e",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dbfd2738-943f-4eb1-96ef-efb770ef117e",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6f865d9f-1a3a-4449-a43f-dc58613e9d8d",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a35cc3fd-d518-4496-a870-fdf1eec2006c",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b610c448-8739-4dfd-ae07-efd91c8ca592",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bbdfc22-c4c3-41d9-877b-d632305c1249",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45b59dd8-9539-46c8-bf37-c65bdcbd7f73",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b72572c2-3a62-4f8f-82ca-d719785c7ea4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1eeadbf0-2e84-4d8c-b71d-df45da6df19b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a8d55a2-93b9-4cab-8f5e-92bfa2a2c2f3",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77bb617e-d56d-4342-99bb-cc0791480a2c",
          "citation": "FEB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21309ede-2b1f-4568-8a67-570d8f08c460",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c4b2a9d-58d1-4bc9-b5ea-439949370ffe",
          "citation": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=118694",
          "url": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=118694",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1784e96e-6390-48d9-9265-d94107f5fdc4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c265f44f-30c7-4f47-b8b1-ab780e91be66",
          "citation": "SRS import [TTL6G7LIWZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TTL6G7LIWZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e76daf7c-129d-4f32-8c38-9987d4123511",
          "citation": "LYSINE ACETATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "685b58c5-2007-4e94-bdb2-a34fb3743632",
          "citation": "LYSINE ACETATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d16fa2b8-72c8-470a-83d3-b28a85b13d6c",
          "citation": "LYSINE ACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e6294bb1-78c7-4aa0-bc73-49d572f3d420",
          "citation": "LYSINE ACETATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6e1e33c-318c-4034-bc88-75505ea440c0",
          "citation": "L-LYSINE ACETATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7a107a2c-dfe4-4197-ae27-8f6c9c9f619e",
          "citation": "LYSINE ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1cb6ebd-72aa-4abf-88b7-282c04492a2c",
          "citation": "L-LYSINE ACETATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1329301-58b8-4c2c-b918-8ade1299a45a",
          "citation": "LYSINE ACETATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87cc46aa-9871-3f7a-ace6-fa2c9eb391e8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "449e6247-8c62-ad9a-64f9-08301107bd77",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "1e262c3a-d625-4894-b152-36579820acd1",
          "citation": "European Pharmacopoeia Online 9.8, Lysine Acetate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d54c0c2f-8846-ce5d-8e0e-268ef89cc2e0",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "340a3e7b-50ac-683a-15a0-67946bbf5822",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9ddd9e6e-4988-874c-481b-4ebc81ff35a5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "669526b2-77a4-08ba-d825-267457eb4911",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "93240c0a-5876-4bd2-ae51-54f84ab4192b",
          "id": "93240c0a-5876-4bd2-ae51-54f84ab4192b",
          "molfile": "\n  Marvin  01132107382D          \n\n  4  3  0  0  1  0            999 V2000\n    8.1046   -1.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8206   -1.3452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8124   -0.5256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5284   -1.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)O",
          "formula": "C2H4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e6d4b2a4-49ab-4d96-ae30-1c059a97aa1c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "60.052",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "87a05875-81c8-49b6-9ffb-9f935f1d0862",
          "id": "87a05875-81c8-49b6-9ffb-9f935f1d0862",
          "molfile": "\n  Marvin  01132107022D          \n\n 10  9  0  0  1  0            999 V2000\n    3.9944   -1.5208    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.9944   -2.3334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2681   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5670   -1.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8659   -1.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1433   -1.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4243   -1.0822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7063   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7063   -0.3164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4074   -1.5208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)O)N",
          "formula": "C6H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3baa7faa-a50e-4ad4-8fc9-0cef8a17a52b"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "146.1878",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5ddf378f-1dc4-4da0-90c8-0e14393a0bfb",
      "version": "27",
      "structure": {
        "id": "b747c325-4f35-4e96-80d9-4a402b7fe76f",
        "molfile": "\n  Marvin  01132109292D          \n\n 14 12  0  0  1  0            999 V2000\n    4.7581   -1.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7581   -0.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0386   -1.5377    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4668   -1.5377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0386   -2.3591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4291   -1.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1559   -1.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3040   -1.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8863   -1.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5954   -1.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7462   -1.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -0.4617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3676   -1.5413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1172   -1.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9 10  1  0  0  0  0\n 10  8  1  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  3  5  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  3  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)O)N.CC(=O)O",
        "formula": "C6H14N2O2.C2H4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "206.2398",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6f865d9f-1a3a-4449-a43f-dc58613e9d8d",
          "c265f44f-30c7-4f47-b8b1-ab780e91be66"
        ],
        "stereo_centers": 1
      },
      "unii": "TTL6G7LIWZ"
    }
  ]
}