{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d7a90e29-1429-459e-9a9c-b0081e2cea77", "code": "64194-22-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=64194-22-5", "code_system": "CAS", "references": [ "3993daa7-7fc4-4026-9535-47915a2bf246", "f0e08b0d-094a-4748-9210-5ba2e4ea982a" ] }, { "uuid": "147e2018-da5b-4465-8dd0-0d9569b06155", "code": "264-727-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.058.825", "code_system": "ECHA (EC/EINECS)", "references": [ "3993daa7-7fc4-4026-9535-47915a2bf246" ] }, { "uuid": "5b78d3d6-796c-4360-b097-73c2e5874a55", "code": "6454819", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6454819", "code_system": "PUBCHEM", "references": [ "3993daa7-7fc4-4026-9535-47915a2bf246" ] }, { "uuid": "0a45f93a-90a3-1cfa-626d-2cd96118a4d8", "code": "DTXSID40108418", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40108418", "code_system": "EPA CompTox", "references": [ "48fa7c39-5db0-a510-b7f5-4157080a18f2" ] }, { "uuid": "1ae70271-8587-4a26-be49-c0539f9e0649", "code": "TT6CXS6EZC", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "55339131-0c9f-4ee6-9b74-19f4d318c89c", "name": "2-Propenoic acid, 1,1′-(3-methyl-1,5-pentanediyl) ester", "stdName": "2-PROPENOIC ACID, 1,1'-(3-METHYL-1,5-PENTANEDIYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f0e08b0d-094a-4748-9210-5ba2e4ea982a" ], "display_name": false }, { "uuid": "48a800c8-ba70-4289-939f-5d9762478879", "name": "3-Methyl-1,5-pentanediyl diacrylate", "stdName": "3-METHYL-1,5-PENTANEDIYL DIACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f0e08b0d-094a-4748-9210-5ba2e4ea982a" ], "display_name": true }, { "uuid": "cfbca571-7ce6-4a81-b148-e842a03608e2", "name": "MPD-A", "stdName": "MPD-A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0e08b0d-094a-4748-9210-5ba2e4ea982a" ], "display_name": false } ], "references": [ { "uuid": "272bda1f-9209-4cb3-baea-3294afc01bb2", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3993daa7-7fc4-4026-9535-47915a2bf246", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392161000, "tags": [ "NOMEN" ] }, { "uuid": "48fa7c39-5db0-a510-b7f5-4157080a18f2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64194-22-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f0e08b0d-094a-4748-9210-5ba2e4ea982a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b21656a8-ef88-46bb-95f7-c776bce705fa", "id": "b21656a8-ef88-46bb-95f7-c776bce705fa", "molfile": "\n Marvin 07272320442D \n\n 16 15 0 0 0 0 999 V2000\n 12.0175 -3.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0175 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7320 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4463 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1609 -4.6887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8753 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8753 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5898 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3042 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3030 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5887 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8741 -4.6887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1597 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1597 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4452 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7308 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 10 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 2 0 0 0 0\nM END", "smiles": "C=CC(=O)OCCC(C)CCOC(=O)C=C", "formula": "C12H18O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8a6c4e75-d3e6-420f-a61f-5ef173ab7144" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "226.2694", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "cae21271-9bba-4ec4-9119-98e2845c2d5c", "version": "6", "structure": { "id": "f01b4058-b52c-406d-aea2-6c4cea1c22a3", "molfile": "\n JSDraw207272320442D\n\n 16 15 0 0 0 0 0 V2000\n 22.7240 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7240 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0750 -8.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4258 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7769 -8.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1279 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1279 -6.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4789 -8.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8297 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3730 -8.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0222 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6711 -8.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3201 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3201 -6.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9691 -8.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6183 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 2 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 2 0 0 0 0\nM END", "smiles": "C=CC(=O)OCCC(C)CCOC(=O)C=C", "formula": "C12H18O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "226.2694", "optical_activity": "NONE", "references": [ "272bda1f-9209-4cb3-baea-3294afc01bb2" ], "stereo_centers": 0 }, "unii": "TT6CXS6EZC" } ] }