{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8b251c76-c7b1-40e3-b656-3f2964fed1c8",
          "code": "614-34-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=614-34-6",
          "code_system": "CAS",
          "references": [
            "1f1d452a-a090-4a1e-ba5e-24cfc6907da0",
            "07334774-0b59-4a9f-b0c0-c49b7d77c3e4"
          ]
        },
        {
          "uuid": "aa67e362-e4d0-4301-b845-787baca64334",
          "code": "210-380-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.438",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1f1d452a-a090-4a1e-ba5e-24cfc6907da0"
          ]
        },
        {
          "uuid": "fb326fc0-8ee0-41b8-8bd3-e3072a338da3",
          "code": "11962",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11962",
          "code_system": "PUBCHEM",
          "references": [
            "1f1d452a-a090-4a1e-ba5e-24cfc6907da0"
          ]
        },
        {
          "uuid": "1c37bc2a-d1ff-e4c2-9f10-1828d4898dbf",
          "code": "DTXSID6060632",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6060632",
          "code_system": "EPA CompTox",
          "references": [
            "e77fa044-a407-440e-b61e-0c71837b4c35"
          ]
        },
        {
          "uuid": "6cab0054-ef68-480b-b5f2-00bb8c253a72",
          "code": "TRF6AI5R4X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8d67bbe7-0c61-8992-7896-349f2e8776c9",
          "code": "137593",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=137593",
          "code_system": "NSC",
          "references": [
            "c867ebff-761f-57d9-46a3-2ac5a0142696"
          ]
        },
        {
          "uuid": "20d8e0db-e7ff-a085-a6fc-745061df0053",
          "code": "8788",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8788",
          "code_system": "NSC",
          "references": [
            "c867ebff-761f-57d9-46a3-2ac5a0142696"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4935422c-9070-40cb-9b71-ca4bab0ff381",
          "name": "4-09-00-00306 (BEILSTEIN HANDBOOK REFERENCE)",
          "stdName": "4-09-00-00306 (BEILSTEIN HANDBOOK REFERENCE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b481a3b6-1cd5-400b-8adb-4b6a93dfb9d9"
          ],
          "display_name": false
        },
        {
          "uuid": "7df3a757-dffa-193a-9ccf-c01269ef3d29",
          "name": "4-CRESYL BENZOATE",
          "stdName": "4-CRESYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        },
        {
          "uuid": "0ac67c7c-43e2-1482-f247-f04b97decf08",
          "name": "4-METHYLPHENYL BENZOATE",
          "stdName": "4-METHYLPHENYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        },
        {
          "uuid": "0288044b-a438-b0f0-5795-c2bb3023d1dd",
          "name": "BENZOIC ACID, 4-METHYLPHENYL ESTER",
          "stdName": "BENZOIC ACID, 4-METHYLPHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        },
        {
          "uuid": "15621c6f-6822-6174-3ee8-9ff8558478eb",
          "name": "BENZOIC ACID, P-TOLYL ESTER",
          "stdName": "BENZOIC ACID, P-TOLYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        },
        {
          "uuid": "2e3e5be0-1b1e-42d5-8315-c565849d0530",
          "name": "NSC-137593",
          "stdName": "NSC-137593",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88c5e367-7723-4087-8ddd-95650ba6c4aa"
          ],
          "display_name": false
        },
        {
          "uuid": "6ca66f18-b881-432f-99d4-74c9143a85ea",
          "name": "NSC-8788",
          "stdName": "NSC-8788",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88c5e367-7723-4087-8ddd-95650ba6c4aa"
          ],
          "display_name": false
        },
        {
          "uuid": "2fc27bd0-f73d-d308-6c1b-e944371524b0",
          "name": "P-CRESOL BENZOATE",
          "stdName": "P-CRESOL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": true
        },
        {
          "uuid": "dea80bc5-9740-7250-efe0-048225b0409d",
          "name": "P-CRESYL BENZOATE",
          "stdName": "P-CRESYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        },
        {
          "uuid": "8c8f33af-547b-c97f-f14f-4beb3fac2099",
          "name": "P-METHYLPHENYL BENZOATE",
          "stdName": "P-METHYLPHENYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        },
        {
          "uuid": "e86a5a52-da3f-ac4a-9d13-d4aa0e3002a5",
          "name": "P-TOLYL BENZOATE",
          "stdName": "P-TOLYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e90b7145-c36d-a089-acfc-0e247a95e4e4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b481a3b6-1cd5-400b-8adb-4b6a93dfb9d9",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88c5e367-7723-4087-8ddd-95650ba6c4aa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f1d452a-a090-4a1e-ba5e-24cfc6907da0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392178000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e77fa044-a407-440e-b61e-0c71837b4c35",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=614-34-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e90b7145-c36d-a089-acfc-0e247a95e4e4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "07334774-0b59-4a9f-b0c0-c49b7d77c3e4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c867ebff-761f-57d9-46a3-2ac5a0142696",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "21329dbd-41f0-4739-a1d3-c8457c6633b4",
          "id": "21329dbd-41f0-4739-a1d3-c8457c6633b4",
          "molfile": "\n  Marvin  01132101532D          \n\n 16 17  0  0  0  0            999 V2000\n    5.3475   -3.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7646   -2.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9678   -2.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3849   -2.3956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6042   -1.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0213   -1.0160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2246   -0.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4331    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4278   -0.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7112   -0.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7166   -1.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4331   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3956   -1.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9785   -1.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 16  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 15  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)OC(=O)c2ccccc2",
          "formula": "C14H12O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e98311a5-f3c8-4a19-b5d6-0b7c8f4e1ca2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.2444",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ab7ac1f4-6116-4dd1-a3d0-46f40ef86a65",
      "version": "7",
      "structure": {
        "id": "f779d4d2-092f-4474-8208-80035e45a2ae",
        "molfile": "\n  Marvin  01132112502D          \n\n 16 17  0  0  0  0            999 V2000\n    0.0000   -0.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7166   -1.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4331   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4278   -0.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7112   -0.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2246   -0.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4331    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0213   -1.0160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6042   -1.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3849   -2.3956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9678   -2.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7646   -2.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9785   -1.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3956   -1.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3475   -3.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)OC(=O)c2ccccc2",
        "formula": "C14H12O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "212.2444",
        "optical_activity": "NONE",
        "references": [
          "e90b7145-c36d-a089-acfc-0e247a95e4e4",
          "b481a3b6-1cd5-400b-8adb-4b6a93dfb9d9"
        ],
        "stereo_centers": 0
      },
      "unii": "TRF6AI5R4X"
    }
  ]
}