{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3378bf68-642e-400b-bb48-edd6393660fb",
          "code": "R06AX22",
          "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Other antihistamines for systemic use|ebastine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R06AX22&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "784cee9d-01f0-4ba8-9506-b2cd152f88b1",
          "code": "QR06AX22",
          "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Other antihistamines for systemic use|ebastine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AX22&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "565b938a-e542-42a9-ad54-99a058ee1c84",
          "code": "90729-43-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90729-43-4",
          "code_system": "CAS",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792",
            "eaaabb5b-85d6-4314-95a0-b12bc9bd0269"
          ]
        },
        {
          "uuid": "e7b65fff-e1d7-4f1a-a528-7145ac01d5e6",
          "code": "C058249",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67058249",
          "code_system": "MESH",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "c81ac2f6-9625-4ca4-8e4d-f306770577f4",
          "code": "EBASTINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ebastine",
          "code_system": "WIKIPEDIA",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "aea8c3c7-d454-40e9-b6af-d17690e89f04",
          "code": "5633",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5633",
          "code_system": "INN",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "f3b836bc-5603-4fdf-acd8-f585d203ceda",
          "code": "C77437",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77437",
          "code_system": "NCI_THESAURUS",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "9d6a75f2-003f-4fc9-b896-1bcc9db46c51",
          "code": "23796",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/23796/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "4a4e4422-d1ac-4eb8-b325-39b01f8ffebc",
          "code": "m4801",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4801?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "ffc17992-091e-4fc5-85b8-7d5d34463551",
          "code": "SUB06435MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "0f6d1ff1-c3b2-49bc-bb3c-f44f637fc37c",
          "code": "CHEMBL305660",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL305660",
          "code_system": "ChEMBL",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "70a1c4c9-c782-45f8-82fc-15e4b1a2f3f7",
          "code": "3191",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3191",
          "code_system": "PUBCHEM",
          "references": [
            "43751420-a20c-4c8c-8112-84d3ba299792"
          ]
        },
        {
          "uuid": "bfb34cd0-0514-5923-9926-fc37a8750a45",
          "code": "DTXSID6046472",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046472",
          "code_system": "EPA CompTox",
          "references": [
            "29134453-9a2f-7d20-b9c2-169dcb8feedd"
          ]
        },
        {
          "uuid": "98b5ad8f-a940-9748-e8ba-dffcfe1d7068",
          "code": "Ebastine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/ebastine/",
          "code_system": "LACTMED",
          "references": [
            "21612603-9372-1296-f024-d99ba34856fd"
          ]
        },
        {
          "uuid": "d8cb2f2c-65f2-94e6-b18b-9614e8c7698b",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "21612603-9372-1296-f024-d99ba34856fd"
          ]
        },
        {
          "uuid": "ad4f77f1-9599-4e9b-a0de-ca0fe4b06792",
          "code": "TQD7Q784P1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "72a48baf-27df-be1b-71d0-af293b58231d",
          "code": "977",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/977",
          "code_system": "DRUG CENTRAL",
          "references": [
            "21612603-9372-1296-f024-d99ba34856fd"
          ]
        },
        {
          "uuid": "98dd6015-9c9a-567a-ca32-e3f90f0670bd",
          "code": "DB11742",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11742",
          "code_system": "DRUG BANK",
          "references": [
            "21612603-9372-1296-f024-d99ba34856fd"
          ]
        },
        {
          "uuid": "c8ce1852-22f4-a53b-a890-cff8fb6c366a",
          "code": "Y-98",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/Y-98/relevant/1/",
          "code_system": "USAN",
          "references": [
            "f31b5063-f671-b5f4-b4bb-9455a2fbb545"
          ]
        },
        {
          "uuid": "a7caa154-e322-934c-51a1-fa85dfc9d058",
          "code": "100000092562",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f1bab206-fa9a-85cb-9960-8e3f00e08508"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d95fb9d6-81ed-479d-b7ec-86588cce8135",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "416e74f9-3fc7-4f22-8804-6b8f46bb1894",
            "refuuid": "de77180c-56e4-4956-a69e-fbe0a6b44656",
            "name": "EBASTINE",
            "unii": "TQD7Q784P1",
            "linking_id": "TQD7Q784P1",
            "ref_pname": "EBASTINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5a07a29b-92a4-4090-a09c-c85b0d88f165",
          "type": "IMPURITY->PARENT",
          "references": [
            "aed35c56-1d4e-4702-bf77-d1542b36c5b9"
          ],
          "related_substance": {
            "uuid": "f8bff433-7635-4dd7-bc0f-978f662e537e",
            "refuuid": "905699ef-b588-486b-993e-232ea4d23524",
            "name": "P-TERT-BUTYLACETOPHENONE",
            "unii": "JAH8J5D78Y",
            "linking_id": "JAH8J5D78Y",
            "ref_pname": "P-TERT-BUTYLACETOPHENONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b6376b19-04c0-4820-a689-6f86a43c5a71",
          "type": "IMPURITY->PARENT",
          "references": [
            "aed35c56-1d4e-4702-bf77-d1542b36c5b9"
          ],
          "related_substance": {
            "uuid": "7eb38b10-109f-4ca0-9ebd-e6d72fad0da9",
            "refuuid": "7d99bb4e-4796-4df4-a303-c737a7681156",
            "name": "4-BENZHYDRYLOXYPIPERIDINE",
            "unii": "Z2QV6QD5VV",
            "linking_id": "Z2QV6QD5VV",
            "ref_pname": "4-BENZHYDRYLOXYPIPERIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "26124d3a-968a-4e85-bab4-a91a5d8ce678",
          "type": "IMPURITY->PARENT",
          "references": [
            "aed35c56-1d4e-4702-bf77-d1542b36c5b9"
          ],
          "related_substance": {
            "uuid": "f5298599-073c-4af6-aa61-7f4860c1eaf1",
            "refuuid": "7d99bb4e-4796-4df4-a303-c737a7681156",
            "name": "4-BENZHYDRYLOXYPIPERIDINE",
            "unii": "Z2QV6QD5VV",
            "linking_id": "Z2QV6QD5VV",
            "ref_pname": "4-BENZHYDRYLOXYPIPERIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "aa79f2fc-6778-4067-aa79-48e6043946c8",
          "type": "IMPURITY->PARENT",
          "references": [
            "aed35c56-1d4e-4702-bf77-d1542b36c5b9"
          ],
          "related_substance": {
            "uuid": "594bd950-00ee-4578-8256-d0a28134edd4",
            "refuuid": "a4711314-066a-41f6-b163-6ed2331d4797",
            "name": "TERT-AMYL EBASTINE",
            "unii": "355R44ZCF2",
            "linking_id": "355R44ZCF2",
            "ref_pname": "TERT-AMYL EBASTINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "26ca30ff-89a7-4c72-b035-fe9a28ceb844",
          "type": "IMPURITY->PARENT",
          "references": [
            "aed35c56-1d4e-4702-bf77-d1542b36c5b9"
          ],
          "related_substance": {
            "uuid": "4be61bea-8051-4dfc-8017-c8708d997f95",
            "refuuid": "4a4a0faa-d19a-409c-a83a-ec86dfa5ce7e",
            "name": "1-(4-(1,1-DIMETHYLETHYL)PHENYL)-4-(CIS-4-(DIPHENYLMETHOXY)-1-OXIDOPIPERIDIN-1-YL)-BUTAN-1-ONE",
            "unii": "D6B5LI0E0G",
            "linking_id": "D6B5LI0E0G",
            "ref_pname": "1-(4-(1,1-DIMETHYLETHYL)PHENYL)-4-(CIS-4-(DIPHENYLMETHOXY)-1-OXIDOPIPERIDIN-1-YL)-BUTAN-1-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ea607083-13a0-4cc3-af24-d9078d63b775",
          "type": "IMPURITY->PARENT",
          "references": [
            "aed35c56-1d4e-4702-bf77-d1542b36c5b9"
          ],
          "related_substance": {
            "uuid": "83bda58e-2342-4a4f-958f-0a3f90cfd549",
            "refuuid": "145a3269-4c0c-4e3a-8ea9-e2dcaa08f481",
            "name": "1-[4-(1,1-Dimethylethyl)phenyl]-4-[trans-4-(diphenylmethoxy)-1-oxido-1-piperidinyl]-1-butanone",
            "unii": "ASF3YCT962",
            "linking_id": "ASF3YCT962",
            "ref_pname": "1-[4-(1,1-Dimethylethyl)phenyl]-4-[trans-4-(diphenylmethoxy)-1-oxido-1-piperidinyl]-1-butanone",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "88fb7c2e-42ab-4ad6-8c6a-da7da8f3af93",
          "type": "TARGET->INHIBITOR",
          "references": [
            "872232e0-5805-48b8-99bd-a674eb86c0e9"
          ],
          "related_substance": {
            "uuid": "e0f8ee3e-d776-4b75-a619-ff153a7348ef",
            "refuuid": "23559f52-21c8-4b43-92f1-981b36cdfe1d",
            "name": "HISTAMINE H1 RECEPTOR",
            "unii": "28XBT591QG",
            "linking_id": "28XBT591QG",
            "ref_pname": "HISTAMINE H1 RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "88bd8fc9-2e39-46fe-b46f-d1fb355e9f8f",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "8d9fdc5b-4e65-48e7-84ef-f7f26172938c",
            "refuuid": "c22e9f0d-d141-4986-a994-a2a3bac7334f",
            "name": "CAREBASTINE",
            "unii": "75DLN707DO",
            "linking_id": "75DLN707DO",
            "ref_pname": "CAREBASTINE"
          }
        },
        {
          "uuid": "cbd7df1a-fcf2-4295-a7d9-261d7cb9a0a8",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "mediator_substance": {
            "uuid": "94ab526e-6055-428d-a433-932d14a5b62c",
            "refuuid": "cad84a8c-0142-44e6-8b6a-90a75ddf5a53",
            "name": "CYTOCHROME P450 2J2",
            "unii": "848C605P1X",
            "linking_id": "848C605P1X",
            "ref_pname": "CYTOCHROME P450 2J2",
            "substance_class": "reference"
          },
          "references": [
            "71abf55e-5676-4b0c-8d23-2206763ec6e2"
          ],
          "related_substance": {
            "uuid": "54119375-d6da-4c68-90df-e5d6a8f6ba6c",
            "refuuid": "4bb53507-ffea-4452-9855-64f6ab58cc31",
            "name": "HYDROXYEBASTINE",
            "unii": "U07WX9MN7J",
            "linking_id": "U07WX9MN7J",
            "ref_pname": "HYDROXYEBASTINE"
          }
        },
        {
          "uuid": "e27b0272-08ec-4654-bbbe-307f6173b2d3",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MAJOR",
          "references": [
            "2d6c115b-2f2a-8112-5c12-1280be9cc3b8"
          ],
          "related_substance": {
            "uuid": "67ef3e2d-f11f-46c4-b46a-e042ea950dbc",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "40d59a01-cab2-49f5-8bf6-083110359884",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "2d6c115b-2f2a-8112-5c12-1280be9cc3b8"
          ],
          "related_substance": {
            "uuid": "698d89b8-60bd-45bd-b81a-2ab34b372e20",
            "refuuid": "067f0cda-3bfe-4af9-ba1e-dcd127c8a228",
            "name": "CYTOCHROME P450 3A5",
            "unii": "805SU96HKF",
            "linking_id": "805SU96HKF",
            "ref_pname": "CYTOCHROME P450 3A5",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fbb0ebd2-d6c0-47b7-b37d-0fd0fb2e5c2b",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "ACTIVATOR",
          "references": [
            "2d6c115b-2f2a-8112-5c12-1280be9cc3b8"
          ],
          "related_substance": {
            "uuid": "18305140-051a-4d25-b0f6-cd7ab6ba19ec",
            "refuuid": "cad84a8c-0142-44e6-8b6a-90a75ddf5a53",
            "name": "CYTOCHROME P450 2J2",
            "unii": "848C605P1X",
            "linking_id": "848C605P1X",
            "ref_pname": "CYTOCHROME P450 2J2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cd225f07-3c17-441f-b94c-4d2dc7e6e118",
          "type": "METABOLITE->PARENT",
          "mediator_substance": {
            "uuid": "380a1e34-f760-4b2a-9a56-72cc017a46ac",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          },
          "references": [
            "9487b56f-627b-4b07-8042-e00019a78774"
          ],
          "related_substance": {
            "uuid": "86483ebd-cd19-49e4-97f4-0692804a3fb2",
            "refuuid": "7d99bb4e-4796-4df4-a303-c737a7681156",
            "name": "4-BENZHYDRYLOXYPIPERIDINE",
            "unii": "Z2QV6QD5VV",
            "linking_id": "Z2QV6QD5VV",
            "ref_pname": "4-BENZHYDRYLOXYPIPERIDINE"
          }
        },
        {
          "uuid": "7912bb40-1009-419f-bf12-6a06513a6923",
          "amount": {
            "uuid": "c2cde18e-c5b9-43da-8eb3-502072b262f6"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "1c19a3a7-11f5-40c0-bcf1-779246cf65d4"
          ],
          "related_substance": {
            "uuid": "71141334-0353-4993-898b-cd4c3655da11",
            "refuuid": "145a3269-4c0c-4e3a-8ea9-e2dcaa08f481",
            "name": "1-[4-(1,1-Dimethylethyl)phenyl]-4-[trans-4-(diphenylmethoxy)-1-oxido-1-piperidinyl]-1-butanone",
            "unii": "ASF3YCT962",
            "linking_id": "ASF3YCT962",
            "ref_pname": "1-[4-(1,1-Dimethylethyl)phenyl]-4-[trans-4-(diphenylmethoxy)-1-oxido-1-piperidinyl]-1-butanone",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "94323d17-df9c-4b01-8c07-4143c3bf25eb",
          "name": "EBASTINE",
          "stdName": "EBASTINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "119ed460-13a4-49ac-942f-7dc044be2f6f",
            "442d26a5-1e58-4bb5-b968-69ac9bec6605",
            "09192350-8da7-4912-acd9-a137131b06c4",
            "f5ec7918-fc8e-4378-adf8-7a66773cd2ed",
            "892dada7-867f-47ff-9e7a-b6bce30caae5",
            "82b7e257-df69-4d9c-be61-7366b885e1ca",
            "6bc8ddf2-4fce-42c5-ad3b-77bc3905e6f0",
            "8ea1ef57-8bb2-4b6f-b032-e814a1a0c258",
            "cd16d78e-54de-4844-83c4-c5043f91a54b",
            "5d35a2ee-5248-4997-872c-206a5652afce",
            "8f8a9ead-cfc5-4251-a720-25411539829c",
            "3d1fb011-698f-436a-89f8-2f037d0af17d",
            "5d373e75-bfe0-4b37-a4a2-4f50a7639dba",
            "0435ad00-242c-40bc-855a-458c96331622",
            "f57b6bb1-3e33-4ead-a155-99d6dda2e82a",
            "2d5ef2c8-7308-4e31-999b-77a6bba311d3",
            "ae7a0ae2-2a45-4dec-b965-82af7cc17ce8",
            "593468a0-98e6-4f7b-8884-5d95a460677e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a3963c1a-c3ee-494d-9507-0d3b1457a7de",
              "name_org": "USAN"
            },
            {
              "uuid": "39e3d6dd-4311-4588-bc4b-a143217bc81f",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3e44cea7-1ade-6244-001c-392dead98b0d",
          "name": "EBASTINE [EP IMPURITY]",
          "stdName": "EBASTINE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09192350-8da7-4912-acd9-a137131b06c4"
          ],
          "display_name": false
        },
        {
          "uuid": "2cfb5e14-244c-f7b4-7318-68275e4736ed",
          "name": "EBASTINE [EP MONOGRAPH]",
          "stdName": "EBASTINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21f060ec-ccc2-5ba5-bd7e-69c35df74e25"
          ],
          "display_name": false
        },
        {
          "uuid": "9be68922-88c9-4753-bb5a-0538654bcbdb",
          "name": "EBASTINE [JAN]",
          "stdName": "EBASTINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f8a9ead-cfc5-4251-a720-25411539829c",
            "2d5ef2c8-7308-4e31-999b-77a6bba311d3"
          ],
          "display_name": false
        },
        {
          "uuid": "8bc1ee37-c45c-4e68-84d2-a99827080175",
          "name": "EBASTINE [MART.]",
          "stdName": "EBASTINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "119ed460-13a4-49ac-942f-7dc044be2f6f"
          ],
          "display_name": false
        },
        {
          "uuid": "bf8f5081-50cb-485c-98c7-d957811a4bed",
          "name": "EBASTINE [MI]",
          "stdName": "EBASTINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f8a9ead-cfc5-4251-a720-25411539829c",
            "0435ad00-242c-40bc-855a-458c96331622"
          ],
          "display_name": false
        },
        {
          "uuid": "99d574ca-882e-48d9-86e7-b71394f4f5bd",
          "name": "EBASTINE [USAN]",
          "stdName": "EBASTINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d373e75-bfe0-4b37-a4a2-4f50a7639dba"
          ],
          "display_name": false
        },
        {
          "uuid": "5084c43c-30dc-d632-f1ae-9d54e9d6fafb",
          "name": "Ebastine [WHO-DD]",
          "stdName": "EBASTINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7ee103d-64d0-3664-2720-d47cb31847db"
          ],
          "display_name": false
        },
        {
          "uuid": "3cd2287b-709a-4cb5-b160-7a02fbba3c8f",
          "name": "LAS-W-090",
          "stdName": "LAS-W-090",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f8a9ead-cfc5-4251-a720-25411539829c",
            "b493630b-c2a1-4ec0-9cdd-1b16a6076463"
          ],
          "display_name": false
        },
        {
          "uuid": "3471fa6a-388b-4941-872b-9e3129a95159",
          "name": "RP 64305",
          "stdName": "RP 64305",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f8a9ead-cfc5-4251-a720-25411539829c",
            "b493630b-c2a1-4ec0-9cdd-1b16a6076463"
          ],
          "display_name": false
        },
        {
          "uuid": "16616d5f-5b25-4d37-aae7-acb0d3f2e72f",
          "name": "RP-64305",
          "stdName": "RP-64305",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f8a9ead-cfc5-4251-a720-25411539829c",
            "b493630b-c2a1-4ec0-9cdd-1b16a6076463"
          ],
          "display_name": false
        },
        {
          "uuid": "bc5f0eb6-df73-4273-9f6e-560030d59b4b",
          "name": "ebastine [INN]",
          "stdName": "EBASTINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b7e257-df69-4d9c-be61-7366b885e1ca"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "892dada7-867f-47ff-9e7a-b6bce30caae5",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5d373e75-bfe0-4b37-a4a2-4f50a7639dba",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82b7e257-df69-4d9c-be61-7366b885e1ca",
          "citation": "INN Proposed List 52",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL52.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "09192350-8da7-4912-acd9-a137131b06c4",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d5ef2c8-7308-4e31-999b-77a6bba311d3",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f8a9ead-cfc5-4251-a720-25411539829c",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "119ed460-13a4-49ac-942f-7dc044be2f6f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0435ad00-242c-40bc-855a-458c96331622",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bc8ddf2-4fce-42c5-ad3b-77bc3905e6f0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "442d26a5-1e58-4bb5-b968-69ac9bec6605",
          "citation": "http://store.usp.org/OA_HTML/ibeCCtpItmDspRte.jsp?item=149143&section=10552&beginIndex=0&sitex=10020",
          "url": "http://store.usp.org/OA_HTML/ibeCCtpItmDspRte.jsp?item=149143&section=10552&beginIndex=0&sitex=10020",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b493630b-c2a1-4ec0-9cdd-1b16a6076463",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43751420-a20c-4c8c-8112-84d3ba299792",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390521000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aed35c56-1d4e-4702-bf77-d1542b36c5b9",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/ebastine-2-0",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "872232e0-5805-48b8-99bd-a674eb86c0e9",
          "citation": "https://en.wikipedia.org/wiki/Ebastine",
          "url": "https://en.wikipedia.org/wiki/Ebastine",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0d69655-ca96-437f-8a58-9775d064ecd2",
          "citation": "SRS import [TQD7Q784P1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TQD7Q784P1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390521000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d1fb011-698f-436a-89f8-2f037d0af17d",
          "citation": "EBASTINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f5ec7918-fc8e-4378-adf8-7a66773cd2ed",
          "citation": "EBASTINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f57b6bb1-3e33-4ead-a155-99d6dda2e82a",
          "citation": "EBASTINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d35a2ee-5248-4997-872c-206a5652afce",
          "citation": "EBASTINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ea1ef57-8bb2-4b6f-b032-e814a1a0c258",
          "citation": "EBASTINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae7a0ae2-2a45-4dec-b965-82af7cc17ce8",
          "citation": "EBASTINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd16d78e-54de-4844-83c4-c5043f91a54b",
          "citation": "EBASTINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "593468a0-98e6-4f7b-8884-5d95a460677e",
          "citation": "EBASTINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29134453-9a2f-7d20-b9c2-169dcb8feedd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90729-43-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "21612603-9372-1296-f024-d99ba34856fd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f31b5063-f671-b5f4-b4bb-9455a2fbb545",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "eaaabb5b-85d6-4314-95a0-b12bc9bd0269",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "71abf55e-5676-4b0c-8d23-2206763ec6e2",
          "citation": "Liu, Kwang-Hyeon, et al. \"Characterization of ebastine, hydroxyebastine, and carebastine metabolism by human liver microsomes and expressed cytochrome P450 enzymes: major roles for CYP2J2 and CYP3A.\" Drug metabolism and disposition 34.11 (2006): 1793-1797.",
          "url": "https://dmd.aspetjournals.org/content/dmd/34/11/1793.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d6c115b-2f2a-8112-5c12-1280be9cc3b8",
          "citation": "Liu, Kwang-Hyeon, et al. \"Characterization of ebastine, hydroxyebastine, and carebastine metabolism by human liver microsomes and expressed cytochrome P450 enzymes: major roles for CYP2J2 and CYP3A.\" Drug metabolism and disposition 34.11 (2006): 1793-1797.",
          "url": "https://dmd.aspetjournals.org/content/dmd/34/11/1793.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9487b56f-627b-4b07-8042-e00019a78774",
          "citation": "Liu, Kwang-Hyeon, et al. \"Characterization of ebastine, hydroxyebastine, and carebastine metabolism by human liver microsomes and expressed cytochrome P450 enzymes: major roles for CYP2J2 and CYP3A.\" Drug metabolism and disposition 34.11 (2006): 1793-1797.",
          "url": "https://dmd.aspetjournals.org/content/dmd/34/11/1793.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "21f060ec-ccc2-5ba5-bd7e-69c35df74e25",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "e7ee103d-64d0-3664-2720-d47cb31847db",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f1bab206-fa9a-85cb-9960-8e3f00e08508",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1c19a3a7-11f5-40c0-bcf1-779246cf65d4",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/ebastine-2-0",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c13368c0-26dd-4794-94d4-831d7cd9469c",
          "id": "c13368c0-26dd-4794-94d4-831d7cd9469c",
          "molfile": "\n  Marvin  01132109592D          \n\n 35 38  0  0  0  0            999 V2000\n    7.5612   -3.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5612   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3965   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5612   -5.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7389   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3315   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4963   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0941   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5195   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3315   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2820   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8644   -5.0452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8644   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0291   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6244   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7891   -2.9106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3818   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5594   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1521   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5594   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3818   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6832   -2.9106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0879   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6600   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1521   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5594   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1521   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6600   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0622   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9129   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3151   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1271   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5318   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1271   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3151   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 22  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 30 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 29 24  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 35 30  2  0  0  0  0\n 32 31  2  0  0  0  0\n 33 32  1  0  0  0  0\n 33 34  2  0  0  0  0\n 34 35  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4",
          "formula": "C32H39NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "220e8992-e0be-4d49-ab9c-556b4b3c5b05"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "469.6588",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "de77180c-56e4-4956-a69e-fbe0a6b44656",
      "version": "29",
      "structure": {
        "id": "5b4c4a79-15aa-4a38-8fc8-8260562341b4",
        "molfile": "\n  Marvin  01132104442D          \n\n 35 38  0  0  0  0            999 V2000\n   -1.0879   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7891   -2.9106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6832   -2.9106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5612   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7389   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2820   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0941   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9129   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6600   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8644   -5.0452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3315   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3315   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4963   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5195   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1521   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5594   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5594   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3818   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3818   -2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6244   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0291   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8644   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5612   -3.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3965   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5612   -5.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0622   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3151   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1521   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3151   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5594   -5.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6600   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1271   -4.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1271   -2.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1521   -5.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5318   -3.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 18  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 22  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11 14  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  7  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15  3  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20  2  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23  4  1  0  0  0  0\n 24  4  1  0  0  0  0\n 25  4  1  0  0  0  0\n 26  9  2  0  0  0  0\n 27  8  1  0  0  0  0\n 28  9  1  0  0  0  0\n 29  8  2  0  0  0  0\n 30 28  2  0  0  0  0\n 31 26  1  0  0  0  0\n 32 27  2  0  0  0  0\n 33 29  1  0  0  0  0\n 34 30  1  0  0  0  0\n 35 33  2  0  0  0  0\n 34 31  2  0  0  0  0\n 35 32  1  0  0  0  0\n 19  2  1  0  0  0  0\n  5 12  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4",
        "formula": "C32H39NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "469.6588",
        "optical_activity": "NONE",
        "references": [
          "892dada7-867f-47ff-9e7a-b6bce30caae5",
          "b0d69655-ca96-437f-8a58-9775d064ecd2",
          "82b7e257-df69-4d9c-be61-7366b885e1ca"
        ],
        "stereo_centers": 0
      },
      "unii": "TQD7Q784P1"
    }
  ]
}