{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bfa77df9-170b-46b6-aa90-d8012eed93c9",
          "code": "155-84-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=155-84-0",
          "code_system": "CAS",
          "references": [
            "40607550-be03-467e-8b4b-b08f436f9260",
            "05961790-8d02-48dc-a3c7-6a216ecfcbe9"
          ]
        },
        {
          "uuid": "cc1cceda-8794-4314-b6e9-6e5edfdf9da1",
          "code": "205-846-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.316",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "40607550-be03-467e-8b4b-b08f436f9260"
          ]
        },
        {
          "uuid": "ccdfc205-50ba-48d1-bce8-ea34f147d550",
          "code": "67427",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67427",
          "code_system": "PUBCHEM",
          "references": [
            "40607550-be03-467e-8b4b-b08f436f9260"
          ]
        },
        {
          "uuid": "5a36a562-be52-4ea0-2e0d-f3a5ffd3be43",
          "code": "DB01985",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01985",
          "code_system": "DRUG BANK",
          "references": [
            "6ad965ec-780f-4809-684b-6ecd6a834dbf"
          ]
        },
        {
          "uuid": "acabb6d5-097e-42e0-a9e1-4a80def0a759",
          "code": "TQ7DL04CAE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "05b14ad0-dafd-77b7-b4ec-171ed8ee77ee",
          "code": "40521",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:40521",
          "code_system": "CHEBI",
          "references": [
            "6ad965ec-780f-4809-684b-6ecd6a834dbf"
          ]
        },
        {
          "uuid": "7e47373d-4aaa-8bfd-7dc2-75006a22b3d7",
          "code": "2469242",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2469242/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9889c1a8-1e42-612a-6a2f-53f066216007"
          ]
        },
        {
          "uuid": "7ab04039-0bdc-1022-d393-6eb488f6c55a",
          "code": "DTXSID80883338",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80883338",
          "code_system": "EPA CompTox",
          "references": [
            "6ad965ec-780f-4809-684b-6ecd6a834dbf"
          ]
        },
        {
          "uuid": "130786ed-0305-e196-97f8-05441dd70248",
          "code": "TQ7DL04CAE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=TQ7DL04CAE",
          "code_system": "DAILYMED",
          "references": [
            "9ac08385-2e8a-f74b-c867-483d7129dba8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2d5f1e1d-34fd-4329-a213-90823c733e32",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "698ab841-789d-4027-b795-d2882362ac13",
            "refuuid": "1daacb3b-6cd2-9f48-1c23-b0338ceda033",
            "name": "ACETYL-DL-ARGININE",
            "unii": "V43Y2NZH05",
            "linking_id": "V43Y2NZH05",
            "ref_pname": "ACETYL-DL-ARGININE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ec2a9a75-0a8d-4d5a-a38b-d5c005df5365",
          "name": ".ALPHA.-N-ACETYL-L-ARGININE",
          "stdName": ".ALPHA.-N-ACETYL-L-ARGININE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "6f666053-83d7-4516-8048-3f35308e30dc",
          "name": "ACETYL ARGININE",
          "stdName": "ACETYL ARGININE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7999acc-190c-4690-b83d-ebc4469a4bc6",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0",
            "0575a971-57df-47b3-98f6-d7edb15f2424"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b996bf80-449e-42bd-96ac-28fc8ee4823e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fc1d2f49-65e2-4485-bae0-99f0255afa9f",
          "name": "ARGININE, N2-ACETYL-, L-",
          "stdName": "ARGININE, N2-ACETYL-, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "00bc25c5-ed4a-474e-b0d9-6fa6b844df10",
          "name": "L-ARGININE, N2-ACETYL-, DIHYDRATE",
          "stdName": "L-ARGININE, N2-ACETYL-, DIHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "26199a8a-d968-43ae-9686-315a14dc5750",
          "name": "N-ACETYL-L-ARGININE",
          "stdName": "N-ACETYL-L-ARGININE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "a4f5d660-9ca3-4e1f-828e-c75f204982a1",
          "name": "N-ACETYLARGININE",
          "stdName": "N-ACETYLARGININE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8899a97b-74e3-46d1-8fa1-15429b8cc8ac",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "d5175594-59ab-4b11-a625-82296991daed",
          "name": "N.ALPHA.-ACETYL-L-ARGININE",
          "stdName": "N.ALPHA.-ACETYL-L-ARGININE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "1ced57be-586e-478d-8fcc-31d2ed868963",
          "name": "N.ALPHA.-ACETYLARGININE",
          "stdName": "N.ALPHA.-ACETYLARGININE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e",
            "ff8dad9e-f73b-4a6e-8c86-846472f28db0"
          ],
          "display_name": false
        },
        {
          "uuid": "52ed8511-fca6-4de7-af85-3c8a33392cd8",
          "name": "N2-ACETYL-L-ARGININE",
          "stdName": "N2-ACETYL-L-ARGININE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e14039ac-6c08-4116-86d2-637a9077c32e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e14039ac-6c08-4116-86d2-637a9077c32e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c7999acc-190c-4690-b83d-ebc4469a4bc6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff8dad9e-f73b-4a6e-8c86-846472f28db0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8899a97b-74e3-46d1-8fa1-15429b8cc8ac",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40607550-be03-467e-8b4b-b08f436f9260",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51b9f83c-f6dc-447e-a0d2-6fae6b232963",
          "citation": "SRS import [TQ7DL04CAE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TQ7DL04CAE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d924a99-204d-4b67-81fc-ac28edea691a",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0575a971-57df-47b3-98f6-d7edb15f2424",
          "citation": "ACETYL ARGININE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ad965ec-780f-4809-684b-6ecd6a834dbf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "05961790-8d02-48dc-a3c7-6a216ecfcbe9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9889c1a8-1e42-612a-6a2f-53f066216007",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "9ac08385-2e8a-f74b-c867-483d7129dba8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7421aca7-2f3d-48c9-9786-ffa308668fa9",
          "id": "7421aca7-2f3d-48c9-9786-ffa308668fa9",
          "molfile": "\n  Marvin  01132106012D          \n\n 15 14  0  0  1  0            999 V2000\n    5.3980   -4.9017    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1104   -5.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8247   -4.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5435   -5.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2560   -4.9017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9702   -5.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6827   -4.9017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9702   -6.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6827   -5.3144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6827   -6.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3964   -6.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9639   -6.5464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3980   -4.0765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1196   -3.6639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6929   -3.6639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  9  1  6  0  0  0\n  1 13  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](CCCNC(=N)N)C(=O)O",
          "formula": "C8H16N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1d5e38d1-3cbc-4b4c-b351-6808ce2b1ece"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "216.238",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d86c7e47-f75f-4fec-a04b-056445c54494",
      "version": "10",
      "structure": {
        "id": "639d031e-0c6d-4faa-86b3-d28325115aef",
        "molfile": "\n  Marvin  01132105102D          \n\n 15 14  0  0  1  0            999 V2000\n    3.9639   -6.5464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6827   -6.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6827   -5.3144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3980   -4.9017    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3980   -4.0765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1196   -3.6639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6929   -3.6639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1104   -5.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8247   -4.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5435   -5.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2560   -4.9017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9702   -5.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6827   -4.9017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9702   -6.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3964   -6.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n  2 15  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](CCCNC(=N)N)C(=O)O",
        "formula": "C8H16N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "216.238",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8d924a99-204d-4b67-81fc-ac28edea691a",
          "51b9f83c-f6dc-447e-a0d2-6fae6b232963"
        ],
        "stereo_centers": 1
      },
      "unii": "TQ7DL04CAE"
    }
  ]
}