{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6d567123-bf1d-46dc-85dd-66775f1206f1",
          "code": "N0000175536",
          "comments": "Established Pharmacologic Class [EPC]|Diagnostic Dye [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175536",
          "code_system": "NDF-RT",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "e4009203-d463-4af6-9ecc-8e8e924a0474",
          "code": "N0000175533",
          "comments": "Cellular or Molecular Interactions [MoA]|Physiochemical Activity [MoA]|Dyes [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175533",
          "code_system": "NDF-RT",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "cbda4ba0-f92b-4523-ad29-b4eed1321c15",
          "code": "S01JA01",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|DIAGNOSTIC AGENTS|Colouring agents|fluorescein",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01JA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "3810c8e3-d139-40c2-adcb-c0617365a0b5",
          "code": "QS01JA51",
          "comments": "VATC|OPHTHALMOLOGICALS|DIAGNOSTIC AGENTS|Colouring agents|fluorescein, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01JA51&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "e3e0633c-b3ca-4716-834e-59becdf9b661",
          "code": "QS01JA01",
          "comments": "VATC|OPHTHALMOLOGICALS|DIAGNOSTIC AGENTS|Colouring agents|fluorescein",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01JA01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "228b0a0a-729e-4bbc-8f18-914c4bf4f151",
          "code": "2321-07-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2321-07-5",
          "code_system": "CAS",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3",
            "599925c5-40de-49af-935a-5e03b62d2457"
          ]
        },
        {
          "uuid": "aca85831-236a-42ff-9e4c-b7c263a29409",
          "code": "C61766",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61766",
          "code_system": "NCI_THESAURUS",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "0a4f54a3-878a-4eaf-b528-77b78d4a8e78",
          "code": "D019793",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68019793",
          "code_system": "MESH",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "6bfb9cc9-cc10-4d9f-a89d-90786bd3f881",
          "code": "FLUORESCEIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fluorescein",
          "code_system": "WIKIPEDIA",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "97244090-c751-41ee-b055-6dd60462ce98",
          "code": "14.1",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Diagnostic agents|Ophthalmic medicines",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/245/?section=104#type594",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "094afe8b-a12f-4da0-86b6-199efd608e9a",
          "code": "S01JA51",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|DIAGNOSTIC AGENTS|Colouring agents|fluorescein, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01JA51&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "c615daae-f290-4dcb-9cfd-08087c8dff77",
          "code": "219-031-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.302",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "3f802bb5-077d-495a-9266-0cc831f92e3f",
          "code": "25138",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/25138/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "561f6d3d-3248-4526-b90f-adebb310e051",
          "code": "m5462",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5462?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "421dcc13-8a92-4583-bedb-427371306b68",
          "code": "DB00693",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00693",
          "code_system": "DRUG BANK",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "24e9509a-ffdc-46f7-9531-99f626dfb3c8",
          "code": "SUB13902MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "174e4242-8671-46e6-b218-7d75705440d5",
          "code": "CHEMBL177756",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL177756",
          "code_system": "ChEMBL",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "d504a62f-a2c3-4bc6-bf91-e060f0201cbd",
          "code": "16850",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16850",
          "code_system": "PUBCHEM",
          "references": [
            "07e88b83-7524-4c01-bdae-6b0b73089ab3"
          ]
        },
        {
          "uuid": "f34b8d14-5991-f1a6-58cc-a9f5607e0c4a",
          "code": "2128",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2128",
          "code_system": "HSDB",
          "references": [
            "da8c727c-be62-3cdd-f2d6-dc50391a5b3e"
          ]
        },
        {
          "uuid": "4fadc019-244d-3ebe-8cfa-a3e89a930c0d",
          "code": "DTXSID0038887",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0038887",
          "code_system": "EPA CompTox",
          "references": [
            "66029553-1b43-2fb9-2c17-549f93e4bf3d"
          ]
        },
        {
          "uuid": "b192296c-8677-02d1-c5d0-b816671a54a3",
          "code": "Fluorescein",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM537/",
          "code_system": "LACTMED",
          "references": [
            "2a904cec-63e6-17c5-cf96-3b7e446b4bd8"
          ]
        },
        {
          "uuid": "a3039934-f9b2-d18c-cc2a-f8e90bf9b439",
          "code": "C390",
          "comments": "Industrial Aid[C45678]|Reagent[C802]|Imaging Agent[C1966]|Contrast Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C390",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2a904cec-63e6-17c5-cf96-3b7e446b4bd8"
          ]
        },
        {
          "uuid": "22f461bb-35cc-b469-a49c-a58a837cf670",
          "code": "1207",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1207",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2a904cec-63e6-17c5-cf96-3b7e446b4bd8"
          ]
        },
        {
          "uuid": "e96ad272-6d9a-4df9-a05d-166a4e3b10da",
          "code": "TPY09G7XIR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a442e25b-2ee2-f656-67f4-d2dbc84571b8",
          "code": "31624",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31624",
          "code_system": "CHEBI",
          "references": [
            "2a904cec-63e6-17c5-cf96-3b7e446b4bd8"
          ]
        },
        {
          "uuid": "fa1121b2-59cc-6a5e-033e-e3ec264ecef6",
          "code": "1277004",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1277004",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2a904cec-63e6-17c5-cf96-3b7e446b4bd8"
          ]
        },
        {
          "uuid": "e944d7fb-6d48-8a07-e2c6-ef0ddb2e25dd",
          "code": "TPY09G7XIR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=TPY09G7XIR",
          "code_system": "DAILYMED",
          "references": [
            "bbcb231c-d8bd-b31e-a31b-7e6d697e9abc"
          ]
        },
        {
          "uuid": "b8d010fc-1e46-3cb7-f6a9-0beb879266e5",
          "code": "759114",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759114",
          "code_system": "NSC",
          "references": [
            "eebe6131-5cc5-800a-8c32-ada4bc8a9a40"
          ]
        },
        {
          "uuid": "98495d7e-b1f5-a814-7d8d-296284df9add",
          "code": "667256",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=667256",
          "code_system": "NSC",
          "references": [
            "eebe6131-5cc5-800a-8c32-ada4bc8a9a40"
          ]
        },
        {
          "uuid": "61d285a5-6aba-4e40-cd6b-6f7804634a63",
          "code": "100000092805",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "edd91439-57bb-8a0e-614c-395d48ff167a"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "ee271e98-990a-4821-9908-33af42db4840",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2999223-f1c6-4fe2-81f0-57301d37908f",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3af45db5-062e-4ba7-9565-d97d3f01c891",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65088858-2a94-4bcc-9bfe-a147d83a6216",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34d19319-e3b9-49e1-b3e6-f8077dd74b29",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bb07225-06e5-47be-9163-f6db0bf2ef63",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07e88b83-7524-4c01-bdae-6b0b73089ab3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b191df5d-dba8-40ce-ae82-81c88389873d",
          "citation": "SRS import [TPY09G7XIR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TPY09G7XIR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92983ca5-8dc1-4d55-b57b-fbf03b8f549c",
          "citation": "FLUORESCEIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46456d68-4235-448a-a1a9-254c59f3716f",
          "citation": "FLUORESCEIN [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91b745f6-1c54-4c53-849b-f0d81dab7b12",
          "citation": "FLUORESCEIN [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "42d0eae7-2ac0-4408-b6da-95ad68e17d01",
          "citation": "FLUORESCEIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14a9d522-3933-44d3-aff3-d6c397780692",
          "citation": "FLUORESCEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b8b9bf8-beba-4368-8724-36cd1dd6d33e",
          "citation": "YELLOW 7 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "522d1686-1e0d-4c06-8ef6-2a91d1342d69",
          "citation": "FLUORESCEIN [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62d1a7cd-d1e2-43b9-97f9-db0a535e4931",
          "citation": "FLUORESCEIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87684b9f-36d8-4506-8a1c-84857301abfa",
          "citation": "FLUORESCEIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fdc871b8-dc33-463d-a76d-538e60149848",
          "citation": "FLUORESCEIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f82bf91b-4f61-4e77-a2db-dae0bc7296d8",
          "citation": "FLUORESCEIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62c253b0-da54-4365-a7f1-6fc499e2b56c",
          "citation": "ACID YELLOW 73 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7be512ea-f494-459d-a03c-fc1e9a26fac9",
          "citation": "KI201 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3778b1b3-081a-49a2-a483-4b752df85ec0",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5646a5b3-2fd6-4bca-bf04-c757e83e3409",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92103013-8d56-4c4b-89bc-6aaf9c9d792e",
          "citation": "21CFR  74.1707",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf47dcd9-f662-48e5-b86d-73ab223c5f7a",
          "citation": "ACD8.0( 21CFR 74.17)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35c391ba-593a-4b70-b49e-0842c70372fa",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a3a1160-97ed-4dd8-8777-b20ea38c97f5",
          "citation": "CTFA 2004",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f089050d-f54e-46d9-97e6-6fe5fe26b3be",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11d3093c-a318-4bf1-9404-65b7a291615c",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f26e008-6d1f-4afe-943a-3cf6561658c3",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cb26ecd-d81a-4409-8417-1918443e452c",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c7bd37d-0ee6-463e-9a96-a04fb87022cc",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3766f462-01b1-48a4-9fee-0b02e547a352",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da8c727c-be62-3cdd-f2d6-dc50391a5b3e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2321-07-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66029553-1b43-2fb9-2c17-549f93e4bf3d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2321-07-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e88bb948-b05e-6fca-92b5-404b50bf8ab3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+2321-07-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a904cec-63e6-17c5-cf96-3b7e446b4bd8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "599925c5-40de-49af-935a-5e03b62d2457",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dd11c5ef-e5a9-e034-23d6-a2bf51b9958f",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "eebe6131-5cc5-800a-8c32-ada4bc8a9a40",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9d4e6c39-ce91-4511-9510-b9c915b5f29a",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "06578ec1-0e51-4424-b2e7-09c0a481f705",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4290e7fa-b77f-29a5-22ee-8d6ff2aaf4f3",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "6503bf8e-8180-4c11-be83-3f0df32f2b61",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6c99f01-c70f-3a81-950f-958197334bd6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bbcb231c-d8bd-b31e-a31b-7e6d697e9abc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "edd91439-57bb-8a0e-614c-395d48ff167a",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "29157004-766a-4fee-8725-8d37e127d89a",
          "id": "29157004-766a-4fee-8725-8d37e127d89a",
          "molfile": "\n  Marvin  01132102152D          \n\n 25 29  0  0  0  0            999 V2000\n    0.0000   -3.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7192   -3.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7192   -2.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -1.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1499   -2.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1499   -3.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8563   -3.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -3.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -3.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9882   -3.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7177   -3.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9882   -2.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -1.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -2.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8486   -1.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5137   -1.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2662   -0.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7302    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4619   -0.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9128   -0.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0853   -0.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8275   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4179   -1.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2118   -1.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4565   -3.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 25  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 15  1  0  0  0  0\n  7  6  1  0  0  0  0\n 25  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 14  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 24 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)OC23c4ccc(cc4Oc5cc(ccc53)O)O",
          "formula": "C20H12O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8c974c92-de41-4a50-a8e2-e56322d09801"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "332.307",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8a15ed58-2bf4-4a90-9331-5a97c74b70f5",
      "version": "42",
      "structure": {
        "id": "6dfbfa92-f582-447e-a784-7d6caa03bdf8",
        "molfile": "\n  Marvin  01132105432D          \n\n 25 29  0  0  0  0            999 V2000\n    2.8486   -1.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5137   -1.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1499   -2.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -2.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2118   -1.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2662   -0.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1499   -3.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5678   -3.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8563   -3.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4619   -0.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -3.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4565   -3.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4256   -1.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2793   -1.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7302    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9882   -3.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7192   -3.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7192   -2.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9882   -2.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4179   -1.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7177   -3.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9128   -0.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8275   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0853   -0.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  2  0  0  0  0\n  8  4  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15  6  2  0  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 14  2  0  0  0  0\n 20  5  1  0  0  0  0\n 21 17  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 10  1  0  0  0  0\n 24 20  2  0  0  0  0\n 25 24  1  0  0  0  0\n 10  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n 25 23  2  0  0  0  0\n 16 11  2  0  0  0  0\n 17 12  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)OC23c4ccc(cc4Oc5cc(ccc53)O)O",
        "formula": "C20H12O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "332.307",
        "optical_activity": "NONE",
        "references": [
          "b191df5d-dba8-40ce-ae82-81c88389873d",
          "3778b1b3-081a-49a2-a483-4b752df85ec0"
        ],
        "stereo_centers": 0
      },
      "unii": "TPY09G7XIR",
      "relationships": [
        {
          "uuid": "9251aa6a-fd1c-497d-b151-95dc43391e6d",
          "amount": {
            "uuid": "caea6030-8f55-4882-ac48-4460e2caf978"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "803053c4-d02f-4134-b3d0-e0dbce7c8fbf",
            "refuuid": "8a15ed58-2bf4-4a90-9331-5a97c74b70f5",
            "name": "Fluorescein",
            "unii": "TPY09G7XIR",
            "linking_id": "TPY09G7XIR",
            "ref_pname": "Fluorescein",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "87559116-ec22-43a3-8d4a-54d6b77f7509",
          "amount": {
            "uuid": "1470b568-95ec-4dc7-9d48-1381ea700c78"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0f858188-bbfc-43be-99d5-56f3fc1ecd0e",
            "refuuid": "1f398212-db9b-40fe-bb2d-bc99e6fa2a38",
            "name": "FLUORESCEIN DIPOTASSIUM",
            "unii": "Z6551U35SA",
            "linking_id": "Z6551U35SA",
            "ref_pname": "FLUORESCEIN DIPOTASSIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3ba692ea-5ce4-49e3-b13f-73de209c92f8",
          "amount": {
            "uuid": "2265517d-a29f-44fb-9ddd-cbc368f5627c",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "6503bf8e-8180-4c11-be83-3f0df32f2b61"
          ],
          "related_substance": {
            "uuid": "4c134b05-0360-4e6f-a9b2-30f083469a5a",
            "refuuid": "3ded9d27-53dd-4ad7-8687-32354f7876b3",
            "name": "Phthalic acid",
            "unii": "6O7F7IX66E",
            "linking_id": "6O7F7IX66E",
            "ref_pname": "Phthalic acid"
          }
        },
        {
          "uuid": "c9abe60c-18a0-4ece-b3e0-482618d6e1da",
          "amount": {
            "uuid": "33b9de0a-4456-4582-b21f-421989cd5d14"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "599925c5-40de-49af-935a-5e03b62d2457"
          ],
          "related_substance": {
            "uuid": "006a7d8c-017d-4b04-9274-0ea2a20d00ed",
            "refuuid": "382d9848-382a-40b1-a692-394cb20c393e",
            "name": "FLUORESCEIN SODIUM",
            "unii": "93X55PE38X",
            "linking_id": "93X55PE38X",
            "ref_pname": "FLUORESCEIN SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f18f8ea8-6223-40bc-819e-5554aa9b8efa",
          "amount": {
            "uuid": "e54550e7-894c-4312-a34b-5cb57412e6b1"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "1d5468e0-571d-41a8-933b-90ff84091f7d",
            "refuuid": "25e40416-9076-ef7d-428e-296c2a83b837",
            "name": "ALTERNATIVE DEFINITION for [Fluorescein]",
            "linking_id": "25e40416-9076-ef7d-428e-296c2a83b837",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "3ad25c05-5177-47be-a934-bac8753d237b",
          "amount": {
            "uuid": "33fd4ac1-409d-4743-af0b-8dad5b96a676",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "9d4e6c39-ce91-4511-9510-b9c915b5f29a"
          ],
          "related_substance": {
            "uuid": "1a59766a-7b2c-4495-a86b-bbee029ec193",
            "refuuid": "f917d420-86a3-437d-9462-de489864610d",
            "name": "Resorcinol",
            "unii": "YUL4LO94HK",
            "linking_id": "YUL4LO94HK",
            "ref_pname": "Resorcinol"
          }
        },
        {
          "uuid": "d259b7ed-56ee-4454-ae62-c805e79e9f94",
          "amount": {
            "uuid": "f3361d0b-cce5-448c-a82e-96445d1fc0a8",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.6
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "06578ec1-0e51-4424-b2e7-09c0a481f705"
          ],
          "related_substance": {
            "uuid": "d0a3e984-e3ca-44d3-bee7-e8aabd35d3af",
            "refuuid": "7bfb3c96-9bdf-4607-9ed2-0984ee227e11",
            "name": "2-(2',4'-DIHYDROXYBENZOYL)BENZOIC ACID",
            "unii": "63XZ9244E2",
            "linking_id": "63XZ9244E2",
            "ref_pname": "2-(2',4'-DIHYDROXYBENZOYL)BENZOIC ACID"
          }
        }
      ],
      "names": [
        {
          "uuid": "bb053f6b-d21d-490a-844d-e2281086fa2d",
          "name": "ACID YELLOW 73",
          "stdName": "ACID YELLOW 73",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "62c253b0-da54-4365-a7f1-6fc499e2b56c",
            "35c391ba-593a-4b70-b49e-0842c70372fa",
            "34d19319-e3b9-49e1-b3e6-f8077dd74b29"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a21f2ac1-f61d-46ab-9875-034b41f2d529",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6d0b1c84-65be-4d02-b4d7-1f98c83aa874",
          "name": "CI 45350:1",
          "stdName": "CI 45350:1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c391ba-593a-4b70-b49e-0842c70372fa",
            "4a3a1160-97ed-4dd8-8777-b20ea38c97f5"
          ],
          "display_name": false
        },
        {
          "uuid": "00f587e3-9b7d-4299-8921-bb2e0fa14170",
          "name": "D & C YELLOW NO. 7 K7133",
          "stdName": "D & C YELLOW NO. 7 K7133",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "35c391ba-593a-4b70-b49e-0842c70372fa"
          ],
          "display_name": false
        },
        {
          "uuid": "a7c61722-8903-4b7c-8415-be544a76beb1",
          "name": "D&C YELLOW NO. 7",
          "stdName": "D&C YELLOW NO. 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92103013-8d56-4c4b-89bc-6aaf9c9d792e"
          ],
          "display_name": false
        },
        {
          "uuid": "575f68be-fe08-7e55-7c13-bd362f540250",
          "name": "FLUORESCEIN [EP MONOGRAPH]",
          "stdName": "FLUORESCEIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4290e7fa-b77f-29a5-22ee-8d6ff2aaf4f3"
          ],
          "display_name": false
        },
        {
          "uuid": "0cf93681-7bcf-4f34-aed0-a6ba7b21736e",
          "name": "FLUORESCEIN [HSDB]",
          "stdName": "FLUORESCEIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "ee271e98-990a-4821-9908-33af42db4840"
          ],
          "display_name": false
        },
        {
          "uuid": "dc095bdc-5bd7-433c-b034-f4b0b0020a2a",
          "name": "FLUORESCEIN [II]",
          "stdName": "FLUORESCEIN [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3778b1b3-081a-49a2-a483-4b752df85ec0"
          ],
          "display_name": false
        },
        {
          "uuid": "c43f2774-9cd1-446b-b660-0f696de9474e",
          "name": "FLUORESCEIN [JAN]",
          "stdName": "FLUORESCEIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "4f26e008-6d1f-4afe-943a-3cf6561658c3"
          ],
          "display_name": false
        },
        {
          "uuid": "68b1b725-4c50-4a94-840b-7a67461ec414",
          "name": "FLUORESCEIN [MART.]",
          "stdName": "FLUORESCEIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c7bd37d-0ee6-463e-9a96-a04fb87022cc"
          ],
          "display_name": false
        },
        {
          "uuid": "3167ce94-d7dd-42c4-8fae-7d3510b0e90d",
          "name": "FLUORESCEIN [MI]",
          "stdName": "FLUORESCEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3766f462-01b1-48a4-9fee-0b02e547a352",
            "1cb26ecd-d81a-4409-8417-1918443e452c"
          ],
          "display_name": false
        },
        {
          "uuid": "52b9c851-6be4-e7cf-4433-9194aa2f9713",
          "name": "FLUORESCEIN [USP MONOGRAPH]",
          "stdName": "FLUORESCEIN [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd11c5ef-e5a9-e034-23d6-a2bf51b9958f"
          ],
          "display_name": false
        },
        {
          "uuid": "d742c247-298e-49b5-864c-aeb6b24b2cd1",
          "name": "FLUORESCEIN [USP-RS]",
          "stdName": "FLUORESCEIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "f2999223-f1c6-4fe2-81f0-57301d37908f"
          ],
          "display_name": false
        },
        {
          "uuid": "34f0564a-08f5-455c-8ded-bfca99e2a11a",
          "name": "FLUORESCEIN [VANDF]",
          "stdName": "FLUORESCEIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65088858-2a94-4bcc-9bfe-a147d83a6216",
            "1cb26ecd-d81a-4409-8417-1918443e452c"
          ],
          "display_name": false
        },
        {
          "uuid": "e3f3019f-2462-4493-ab7c-81ecf13a0ee0",
          "name": "Fluorescein",
          "stdName": "FLUORESCEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdc871b8-dc33-463d-a76d-538e60149848",
            "3778b1b3-081a-49a2-a483-4b752df85ec0",
            "522d1686-1e0d-4c06-8ef6-2a91d1342d69",
            "f2999223-f1c6-4fe2-81f0-57301d37908f",
            "14a9d522-3933-44d3-aff3-d6c397780692",
            "3af45db5-062e-4ba7-9565-d97d3f01c891",
            "3766f462-01b1-48a4-9fee-0b02e547a352",
            "65088858-2a94-4bcc-9bfe-a147d83a6216",
            "ee271e98-990a-4821-9908-33af42db4840",
            "92983ca5-8dc1-4d55-b57b-fbf03b8f549c",
            "46456d68-4235-448a-a1a9-254c59f3716f",
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "62d1a7cd-d1e2-43b9-97f9-db0a535e4931",
            "87684b9f-36d8-4506-8a1c-84857301abfa",
            "42d0eae7-2ac0-4408-b6da-95ad68e17d01",
            "91b745f6-1c54-4c53-849b-f0d81dab7b12",
            "f82bf91b-4f61-4e77-a2db-dae0bc7296d8",
            "f089050d-f54e-46d9-97e6-6fe5fe26b3be",
            "5c7bd37d-0ee6-463e-9a96-a04fb87022cc",
            "11d3093c-a318-4bf1-9404-65b7a291615c",
            "4f26e008-6d1f-4afe-943a-3cf6561658c3"
          ],
          "display_name": true
        },
        {
          "uuid": "c072e7dc-d7a3-9680-ebbe-13955be4108a",
          "name": "Fluorescein [WHO-DD]",
          "stdName": "FLUORESCEIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6c99f01-c70f-3a81-950f-958197334bd6"
          ],
          "display_name": false
        },
        {
          "uuid": "e8f3541e-51a1-41d3-8266-cabe4ad20121",
          "name": "KI201",
          "stdName": "KI201",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "7be512ea-f494-459d-a03c-fc1e9a26fac9",
            "34d19319-e3b9-49e1-b3e6-f8077dd74b29"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "387b4e1d-e5b7-4d05-894a-26a76e524b07",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "147f9ae8-d6bf-4a3a-b0d1-a921afb8bc60",
          "name": "NSC-667256",
          "stdName": "NSC-667256",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bb07225-06e5-47be-9163-f6db0bf2ef63",
            "1cb26ecd-d81a-4409-8417-1918443e452c"
          ],
          "display_name": false
        },
        {
          "uuid": "2314e963-950d-d9f4-9b29-ce4e74ea142b",
          "name": "NSC-759114",
          "stdName": "NSC-759114",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eebe6131-5cc5-800a-8c32-ada4bc8a9a40"
          ],
          "display_name": false
        },
        {
          "uuid": "b46ac100-166c-4c3c-84ec-c74d9c075115",
          "name": "SPIRO(ISOBENZOFURAN-1(3H),9'-(9H)XANTHEN)-3-ONE, 3',6'-DIHYDROXY-",
          "stdName": "SPIRO(ISOBENZOFURAN-1(3H),9'-(9H)XANTHEN)-3-ONE, 3',6'-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5646a5b3-2fd6-4bca-bf04-c757e83e3409"
          ],
          "display_name": false
        },
        {
          "uuid": "41c93de1-20ee-4c03-8b14-50112c8600a2",
          "name": "YELLOW 7",
          "stdName": "YELLOW 7",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1cb26ecd-d81a-4409-8417-1918443e452c",
            "35c391ba-593a-4b70-b49e-0842c70372fa",
            "0b8b9bf8-beba-4368-8724-36cd1dd6d33e"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7c250b03-1e56-47ac-976c-359487fed084",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "modifications": {
        "uuid": "50093f2f-e0b5-49fb-b3e2-14e7d0fedd6f"
      }
    }
  ]
}