{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9824a932-bf95-4742-a32b-e445b1571dda",
          "code": "51200-86-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51200-86-3",
          "code_system": "CAS",
          "references": [
            "d7fba164-9f9b-448c-8790-bfc6e4f97410",
            "15b9c8c2-3d5a-4729-ac1d-e56423a54969"
          ]
        },
        {
          "uuid": "048c4b55-6230-4fac-9cfc-c9bdb7830a2b",
          "code": "380816",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/380816",
          "code_system": "PUBCHEM",
          "references": [
            "d7fba164-9f9b-448c-8790-bfc6e4f97410"
          ]
        },
        {
          "uuid": "a0db2af9-31af-4986-52d9-4e4be88a3166",
          "code": "DTXSID30965471",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30965471",
          "code_system": "EPA CompTox",
          "references": [
            "409c5bce-6ff5-e33e-569a-4e5e164a7081"
          ]
        },
        {
          "uuid": "906648ff-d4ea-4053-a8da-6e35294a0e80",
          "code": "TOI7X658VH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "838c10f8-feb1-465e-b122-11268397bde2",
          "name": "2-CYCLOHEXEN-1-ONE, 3-HYDROXY-2-METHYL-5-(1-METHYLETHENYL)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 3-HYDROXY-2-METHYL-5-(1-METHYLETHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a77ce9ed-5390-46f9-bc8a-befe7dddebdf",
            "1981a13c-2c5e-4ec0-bfee-fd9c4f87acf4"
          ],
          "display_name": false
        },
        {
          "uuid": "d35496b0-61c5-4231-bf5b-7963ee69c8ee",
          "name": "6-HYDROXYCARVONE",
          "stdName": "6-HYDROXYCARVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a77ce9ed-5390-46f9-bc8a-befe7dddebdf",
            "1981a13c-2c5e-4ec0-bfee-fd9c4f87acf4"
          ],
          "display_name": true
        },
        {
          "uuid": "02128b66-c515-4ec3-b452-5b770378a83d",
          "name": "FEMA NO. 4523",
          "stdName": "FEMA NO. 4523",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1981a13c-2c5e-4ec0-bfee-fd9c4f87acf4",
            "5d895fe5-71cb-4dee-bb72-8b61a19c8fbc"
          ],
          "display_name": false
        },
        {
          "uuid": "d8cd9bc1-86a1-4048-b630-79c0efb37ce9",
          "name": "P-MENTHA-1,8-DIEN-2-OL-6-ONE",
          "stdName": "P-MENTHA-1,8-DIEN-2-OL-6-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a77ce9ed-5390-46f9-bc8a-befe7dddebdf",
            "1981a13c-2c5e-4ec0-bfee-fd9c4f87acf4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a77ce9ed-5390-46f9-bc8a-befe7dddebdf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1981a13c-2c5e-4ec0-bfee-fd9c4f87acf4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d895fe5-71cb-4dee-bb72-8b61a19c8fbc",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7fba164-9f9b-448c-8790-bfc6e4f97410",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbf2fe6c-9d77-4591-bb67-7f47ac22467f",
          "citation": "SRS import [TOI7X658VH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TOI7X658VH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15b9c8c2-3d5a-4729-ac1d-e56423a54969",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "409c5bce-6ff5-e33e-569a-4e5e164a7081",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58d6047b-7b6e-46d7-8920-3c83e4572ea6",
          "id": "58d6047b-7b6e-46d7-8920-3c83e4572ea6",
          "molfile": "\n  Marvin  01132104372D          \n\n 12 12  0  0  0  0            999 V2000\n   12.1334   -4.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4201   -4.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4201   -3.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7049   -4.9615    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.7049   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9892   -6.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9892   -7.0251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2741   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5602   -6.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2741   -4.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5584   -4.5511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9892   -4.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
          "smiles": "C=C(C)C1CC(=C(C)C(=O)C1)O",
          "formula": "C10H14O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f26625d4-3f1b-486b-9b99-8813958a15f0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "166.2173",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "068e64c7-028f-40f4-95cb-5f0eda3e8b81",
      "version": "5",
      "structure": {
        "id": "ef6afd05-d44e-470f-8207-8bb0802318c1",
        "molfile": "\n  Marvin  01132112252D          \n\n 12 12  0  0  0  0            999 V2000\n    8.5590   -4.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9899   -4.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7056   -4.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7056   -5.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9899   -6.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2747   -5.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2747   -4.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1342   -4.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4209   -4.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4209   -3.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5608   -6.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9899   -7.0256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 11  6  1  0  0  0  0\n  3  9  1  0  0  0  0\n  7  1  2  0  0  0  0\n  7  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  5 12  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)C1CC(=C(C)C(=O)C1)O",
        "formula": "C10H14O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "166.2173",
        "optical_activity": "( + / - )",
        "references": [
          "cbf2fe6c-9d77-4591-bb67-7f47ac22467f",
          "a77ce9ed-5390-46f9-bc8a-befe7dddebdf"
        ],
        "stereo_centers": 1
      },
      "unii": "TOI7X658VH"
    }
  ]
}